{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d2206854-b164-4e96-a59e-1fa0335a9ae0",
          "code": "17928-28-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17928-28-8",
          "code_system": "CAS",
          "references": [
            "09b7293e-0bc9-4cde-8fd8-625f0150e81d",
            "85f6fbe6-e908-458f-858a-ad085f9190d5"
          ]
        },
        {
          "uuid": "a032113d-b0f4-447e-a773-16d7c0a04ed3",
          "code": "241-867-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.046",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "09b7293e-0bc9-4cde-8fd8-625f0150e81d"
          ]
        },
        {
          "uuid": "0154e5c0-7981-4237-ab2b-9fb5c3be0015",
          "code": "1311614",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311614/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "09b7293e-0bc9-4cde-8fd8-625f0150e81d"
          ]
        },
        {
          "uuid": "0fe2a3e9-de79-4bdf-86f0-fc01cf54db2d",
          "code": "28838",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28838",
          "code_system": "PUBCHEM",
          "references": [
            "09b7293e-0bc9-4cde-8fd8-625f0150e81d"
          ]
        },
        {
          "uuid": "0a8d96ef-195b-0210-6694-60dad43138d2",
          "code": "DTXSID9025669",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9025669",
          "code_system": "EPA CompTox",
          "references": [
            "7baf569a-5324-3294-092d-371fe7b6d57a"
          ]
        },
        {
          "uuid": "247e91fe-e827-4a0a-9b0e-53150431c0bb",
          "code": "S73ZQI0GXM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6a466009-c1d6-708f-5a9a-1f4d271f90bb",
          "code": "S73ZQI0GXM",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S73ZQI0GXM",
          "code_system": "DAILYMED",
          "references": [
            "ad37441b-fe3e-f892-42dd-ce4d1d6ddaa2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "feefc34d-66a9-4748-bc13-5610ae2881ca",
          "name": "1,1,1,3,5,5,5-HEPTAMETHYL-3-(TRIMETHYLSILOXY)TRISILOXANE",
          "stdName": "1,1,1,3,5,5,5-HEPTAMETHYL-3-(TRIMETHYLSILOXY)TRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "343bd695-07ef-4723-a712-10192c571104",
            "b3fa0fea-c45d-4eae-9b77-6cd89b974f74"
          ],
          "display_name": false
        },
        {
          "uuid": "eea13f84-14cc-48b3-8282-c73b7cb8063a",
          "name": "METHYL TRIMETHICONE",
          "stdName": "METHYL TRIMETHICONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49f513f4-640e-4de2-948f-50df1075c311",
            "b3fa0fea-c45d-4eae-9b77-6cd89b974f74",
            "dc21e687-e0b8-4015-84ac-d8530bae4c22",
            "0fcd71cc-2ddf-4879-a530-d92add3541d1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "18ee6375-159b-4033-a1ed-fc7b1420b565",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ae0855b2-d90c-4d74-a74c-1338bdec74fa",
          "name": "METHYLTRIS(TRIMETHYLSILOXY)SILANE",
          "stdName": "METHYLTRIS(TRIMETHYLSILOXY)SILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "343bd695-07ef-4723-a712-10192c571104",
            "b3fa0fea-c45d-4eae-9b77-6cd89b974f74"
          ],
          "display_name": false
        },
        {
          "uuid": "37c056e8-4204-4a8e-a53d-e159667eb37d",
          "name": "TMF-1.5",
          "stdName": "TMF-1.5",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b22d0f9-5747-451e-905e-918056c53efd",
            "b3fa0fea-c45d-4eae-9b77-6cd89b974f74"
          ],
          "display_name": false
        },
        {
          "uuid": "c7f2a436-05dd-47ee-ba8c-01a9a7239bbc",
          "name": "TRIS(TRIMETHYLSILOXY)METHYLSILANE",
          "stdName": "TRIS(TRIMETHYLSILOXY)METHYLSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "343bd695-07ef-4723-a712-10192c571104",
            "b3fa0fea-c45d-4eae-9b77-6cd89b974f74"
          ],
          "display_name": false
        },
        {
          "uuid": "96d26a6c-22bb-4ced-b0b4-0ce246e446f4",
          "name": "TRISILOXANE, 1,1,1,3,5,5,5-HEPTAMETHYL-3-((TRIMETHYLSILYL)OXY)-",
          "stdName": "TRISILOXANE, 1,1,1,3,5,5,5-HEPTAMETHYL-3-((TRIMETHYLSILYL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "343bd695-07ef-4723-a712-10192c571104",
            "b3fa0fea-c45d-4eae-9b77-6cd89b974f74"
          ],
          "display_name": false
        },
        {
          "uuid": "47dec55b-16e7-48c3-8dda-71fabcb1033c",
          "name": "TRISILOXANE, 1,1,1,3,5,5,5-HEPTAMETHYL-3-(TRIMETHYLSILOXY)-",
          "stdName": "TRISILOXANE, 1,1,1,3,5,5,5-HEPTAMETHYL-3-(TRIMETHYLSILOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "343bd695-07ef-4723-a712-10192c571104",
            "b3fa0fea-c45d-4eae-9b77-6cd89b974f74"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0fcd71cc-2ddf-4879-a530-d92add3541d1",
          "citation": "http://www.nicnas.gov.au/publications/CAR/new/Ltd/LtdFULLR/ltd1000FR/ltd1372FR.pdf",
          "url": "http://www.nicnas.gov.au/publications/CAR/new/Ltd/LtdFULLR/ltd1000FR/ltd1372FR.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b3fa0fea-c45d-4eae-9b77-6cd89b974f74",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "343bd695-07ef-4723-a712-10192c571104",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49f513f4-640e-4de2-948f-50df1075c311",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b22d0f9-5747-451e-905e-918056c53efd",
          "citation": "http://www.silicone.jp/e/catalog/pdf/pc_us.pdf",
          "url": "http://www.silicone.jp/e/catalog/pdf/pc_us.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09b7293e-0bc9-4cde-8fd8-625f0150e81d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390900000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "834fef1a-825c-4ffb-af4e-a1af4572406a",
          "citation": "SRS import [S73ZQI0GXM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S73ZQI0GXM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390900000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc21e687-e0b8-4015-84ac-d8530bae4c22",
          "citation": "METHYL TRIMETHICONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7baf569a-5324-3294-092d-371fe7b6d57a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17928-28-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85f6fbe6-e908-458f-858a-ad085f9190d5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ad37441b-fe3e-f892-42dd-ce4d1d6ddaa2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3afe3e27-0787-480a-96fc-8e53ecd603c0",
          "id": "3afe3e27-0787-480a-96fc-8e53ecd603c0",
          "molfile": "\n  Marvin  01132103082D          \n\n 17 16  0  0  0  0            999 V2000\n   12.4261   -8.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2215   -8.9529    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   12.0972   -9.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9088   -9.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0920   -8.8307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2795   -8.9739    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   10.3515   -9.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3466   -7.7095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5497   -7.4959    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5497   -6.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7278   -7.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4064   -8.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4671   -9.1172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1849   -9.8924    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.8607  -10.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4372   -9.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7724  -10.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  6 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\nM  END",
          "smiles": "C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
          "formula": "C10H30O3Si4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cbf1508b-55ea-4454-9333-d285de1208f1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "310.6853",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "44186334-e33c-4a5e-9b7e-eb1dcee72361",
      "version": "5",
      "structure": {
        "id": "8d8173ff-df05-4b82-9a7e-f8687a6fca3a",
        "molfile": "\n  Marvin  01132107212D          \n\n 17 16  0  0  0  0            999 V2000\n   10.2795   -8.9739    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   11.0920   -8.8307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3466   -7.7095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4671   -9.1172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3515   -9.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2215   -8.9529    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5497   -7.4959    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.1849   -9.8924    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   12.4261   -8.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0972   -9.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9088   -9.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5497   -6.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7278   -7.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4064   -8.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8607  -10.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4372   -9.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7724  -10.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n  7 14  1  0  0  0  0\n  8 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n  8 17  1  0  0  0  0\nM  END",
        "smiles": "C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
        "formula": "C10H30O3Si4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "310.6853",
        "optical_activity": "NONE",
        "references": [
          "343bd695-07ef-4723-a712-10192c571104",
          "834fef1a-825c-4ffb-af4e-a1af4572406a"
        ],
        "stereo_centers": 0
      },
      "unii": "S73ZQI0GXM"
    }
  ]
}