{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0e16db15-c2f7-4a15-9ab9-3a98996b6dac",
          "code": "3290-92-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3290-92-4",
          "code_system": "CAS",
          "references": [
            "f4b58b63-9b38-47c5-b579-cdec91317ee8",
            "931de805-24bd-4512-a7ee-35834e670c18"
          ]
        },
        {
          "uuid": "be0244fa-f007-42b2-a07e-4d9f7f91a0cd",
          "code": "C028643",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67028643",
          "code_system": "MESH",
          "references": [
            "f4b58b63-9b38-47c5-b579-cdec91317ee8"
          ]
        },
        {
          "uuid": "e3d749f2-9fd8-43eb-943e-7b610a11f9eb",
          "code": "18689",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18689",
          "code_system": "PUBCHEM",
          "references": [
            "f4b58b63-9b38-47c5-b579-cdec91317ee8"
          ]
        },
        {
          "uuid": "433a0531-fce5-4acc-829c-757541d4a523",
          "code": "221-950-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.956",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f4b58b63-9b38-47c5-b579-cdec91317ee8"
          ]
        },
        {
          "uuid": "f7fa0b89-e8d0-afdc-2390-07a1bc129f08",
          "code": "DTXSID3027530",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3027530",
          "code_system": "EPA CompTox",
          "references": [
            "62a970a9-3829-1c30-2211-b1d4f27a12e4"
          ]
        },
        {
          "uuid": "20929039-ee4d-4bc9-85d4-01a44314936a",
          "code": "S734UC120F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "298e0f63-4b62-06b9-68b6-f56bea671c5c",
          "code": "84261",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=84261",
          "code_system": "NSC",
          "references": [
            "85a1e93b-b954-91b1-6575-618f4bbbc212"
          ]
        },
        {
          "uuid": "0235e6b7-df15-15e9-c795-4279af59052b",
          "code": "100000139275",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0a51ab85-5c94-3ada-8753-a03a2833fcda"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "73a19c40-83e7-4d68-b708-839de56caef6",
          "name": "1,1,1-TRIMETHYLOLPROPANE TRIMETHACRYLATE",
          "stdName": "1,1,1-TRIMETHYLOLPROPANE TRIMETHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f8ae722-1147-4025-9218-60fa27f15616",
            "8a6ef922-bec0-4966-bd97-1f6d555c27ea"
          ],
          "display_name": false
        },
        {
          "uuid": "949d4cf0-f7d0-4e58-b7f6-57631fb09bd7",
          "name": "2,2-BIS(METHACRYLOYLOXYMETHYL)BUTYL METHACRYLATE",
          "stdName": "2,2-BIS(METHACRYLOYLOXYMETHYL)BUTYL METHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adc7e10b-f9d7-425f-84d0-094533f30566",
            "8a6ef922-bec0-4966-bd97-1f6d555c27ea"
          ],
          "display_name": false
        },
        {
          "uuid": "4df0927b-7d4f-45e7-bd81-23c28aeea299",
          "name": "2-ETHYL-1,3-DIMETHACRYLOXY-2-(METHACRYLOXYMETHYL)PROPANE",
          "stdName": "2-ETHYL-1,3-DIMETHACRYLOXY-2-(METHACRYLOXYMETHYL)PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adc7e10b-f9d7-425f-84d0-094533f30566",
            "8a6ef922-bec0-4966-bd97-1f6d555c27ea"
          ],
          "display_name": false
        },
        {
          "uuid": "3b63fbd9-a15d-4819-8f11-03437f35dd61",
          "name": "NSC-84261",
          "stdName": "NSC-84261",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a6ef922-bec0-4966-bd97-1f6d555c27ea",
            "d279cbf0-6f4c-4c93-bf3a-835d0dc22ff4"
          ],
          "display_name": false
        },
        {
          "uuid": "0968f9f3-1bdc-4f94-a0ed-1aef0989a2ba",
          "name": "TMPTMA",
          "stdName": "TMPTMA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adc7e10b-f9d7-425f-84d0-094533f30566",
            "8a6ef922-bec0-4966-bd97-1f6d555c27ea"
          ],
          "display_name": false
        },
        {
          "uuid": "91e529a7-804f-41eb-9396-433b03b736d5",
          "name": "TRIMETHYLOLPROPANE TRIMETHACRYLATE",
          "stdName": "TRIMETHYLOLPROPANE TRIMETHACRYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01a623de-f58f-4257-9542-519b5ec245d8",
            "adc7e10b-f9d7-425f-84d0-094533f30566",
            "8a6ef922-bec0-4966-bd97-1f6d555c27ea",
            "e084e2ba-58e4-41d0-a5e2-a1b54c302daa"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ae5b9e59-8a56-440f-890a-c963a3993b0e",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "adc7e10b-f9d7-425f-84d0-094533f30566",
          "citation": "http://www.chemblink.com/products/3290-92-4.htm",
          "url": "http://www.chemblink.com/products/3290-92-4.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8a6ef922-bec0-4966-bd97-1f6d555c27ea",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01a623de-f58f-4257-9542-519b5ec245d8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f8ae722-1147-4025-9218-60fa27f15616",
          "citation": "CHEMSPIDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d279cbf0-6f4c-4c93-bf3a-835d0dc22ff4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4b58b63-9b38-47c5-b579-cdec91317ee8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390746000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ca21e6c-4eb8-40c3-95de-8ac779a9f15c",
          "citation": "SRS import [S734UC120F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S734UC120F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390746000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d18f1b5e-f903-4c46-89f5-fcc6e06f7669",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e084e2ba-58e4-41d0-a5e2-a1b54c302daa",
          "citation": "TRIMETHYLOLPROPANE TRIMETHACRYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62a970a9-3829-1c30-2211-b1d4f27a12e4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3290-92-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "931de805-24bd-4512-a7ee-35834e670c18",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "85a1e93b-b954-91b1-6575-618f4bbbc212",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0a51ab85-5c94-3ada-8753-a03a2833fcda",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f990d5eb-8579-4668-8084-56c03ee2d184",
          "id": "f990d5eb-8579-4668-8084-56c03ee2d184",
          "molfile": "\n  Marvin  01132112562D          \n\n 24 23  0  0  0  0            999 V2000\n    9.6572   -0.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1685   -1.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3830   -1.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4543   -2.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7787   -3.2867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -4.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5967   -4.4556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1741   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4272   -4.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2499   -5.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5725   -2.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0420   -1.5020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2267   -1.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9465   -2.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6962   -1.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9810   -0.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8856   -1.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2104   -1.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6195   -2.7033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8605   -1.9896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8605   -3.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6831   -3.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -4.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 11  1  0  0  0  0\n 18  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\nM  END",
          "smiles": "CCC(COC(=O)C(=C)C)(COC(=O)C(=C)C)COC(=O)C(=C)C",
          "formula": "C18H26O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b64b732d-c1f2-4f4c-81ea-ea06128f79bd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "338.3961",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8f39b9be-cf92-40a6-9fb5-0f191b72ead6",
      "version": "6",
      "structure": {
        "id": "7ff74e76-6a58-4b1f-9997-eebea26894f5",
        "molfile": "\n  Marvin  01132106392D          \n\n 24 23  0  0  0  0            999 V2000\n    7.4272   -4.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1741   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2499   -5.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -4.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7787   -3.2867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4543   -2.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3830   -1.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5725   -2.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0420   -1.5020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2267   -1.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6962   -1.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8856   -1.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9810   -0.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9465   -2.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1685   -1.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6572   -0.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2104   -1.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6195   -2.7033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8605   -3.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6831   -3.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -4.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8605   -1.9896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5967   -4.4556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 10 14  2  0  0  0  0\n  7 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17  7  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 19 23  2  0  0  0  0\n  4 24  2  0  0  0  0\nM  END",
        "smiles": "CCC(COC(=O)C(=C)C)(COC(=O)C(=C)C)COC(=O)C(=C)C",
        "formula": "C18H26O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.3961",
        "optical_activity": "NONE",
        "references": [
          "d18f1b5e-f903-4c46-89f5-fcc6e06f7669",
          "7ca21e6c-4eb8-40c3-95de-8ac779a9f15c"
        ],
        "stereo_centers": 0
      },
      "unii": "S734UC120F"
    }
  ]
}