{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "22e5ede7-694e-4f9b-aacc-bcc681134d82",
          "code": "N06BX15",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|pipradrol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BX15&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "b000848d-0887-43fb-80a1-e1474c977995",
          "code": "QN06BX15",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|pipradrol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BX15&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "1ef9979a-dfca-4b7f-9240-e3a27debe671",
          "code": "467-60-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=467-60-7",
          "code_system": "CAS",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe",
            "ad1adb61-4307-4a98-b9d5-d2dd73de3b11"
          ]
        },
        {
          "uuid": "838ceba0-1d5e-4426-ad90-bb1aef654f2f",
          "code": "C084823",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67084823",
          "code_system": "MESH",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "0d2c218d-a80d-43d9-b530-4c3f988d4652",
          "code": "PIPRADROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pipradrol",
          "code_system": "WIKIPEDIA",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "330b0ad2-4424-4668-95d4-19ec96e2f2f8",
          "code": "550",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=550",
          "code_system": "INN",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "a95461a9-feb4-4f24-aa40-8db78462b389",
          "code": "1750",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Stimulants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "5fecd21d-7b36-449d-99a9-20c00b1ff9c8",
          "code": "18717-93-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18717-93-6",
          "code_system": "CAS",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe",
            "0fd0dde2-68d8-4b84-b899-ce1a359d9ea6"
          ]
        },
        {
          "uuid": "011be785-3591-47d0-9c69-6f2a03f6751c",
          "code": "m8867",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8867?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "9df932c5-d771-439f-8b61-f32198e01741",
          "code": "SUB09883MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "387a093e-cae3-4cc7-bef2-f0f6c9d74e53",
          "code": "CHEMBL2110938",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110938",
          "code_system": "ChEMBL",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "f477026d-d11a-476e-833b-f08565b67fd1",
          "code": "207-394-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.723",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "113f9ca8-052a-4beb-8d1a-e0cdad274fe3",
          "code": "10083",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10083",
          "code_system": "PUBCHEM",
          "references": [
            "bf1236b5-3dfe-42a0-99ec-367440e5fdbe"
          ]
        },
        {
          "uuid": "f56b4464-10bf-5edd-42f4-6fcdd6a9be9f",
          "code": "DTXSID2023486",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023486",
          "code_system": "EPA CompTox",
          "references": [
            "6f3ce884-161d-9e5a-6e59-dd6c9eb24e0f"
          ]
        },
        {
          "uuid": "0b60fd00-ebc2-cce9-5f60-5168f50be8d0",
          "code": "8016",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8016",
          "code_system": "HSDB",
          "references": [
            "de4c0b26-3bc5-010d-e387-6689bd8ff798"
          ]
        },
        {
          "uuid": "be9c4cea-303d-389e-3dff-2294df87a95e",
          "code": "C170324",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C170324",
          "code_system": "NCI_THESAURUS",
          "references": [
            "25a3d3d2-cd60-c9f8-3e2f-0e6cb6670b74"
          ]
        },
        {
          "uuid": "0121e43e-ecd1-41c5-8bcd-a04d6c0b566e",
          "code": "S6I030E0DA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53be3efc-d094-9a38-cbbf-74251ef334ea",
          "code": "2195",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2195",
          "code_system": "DRUG CENTRAL",
          "references": [
            "25a3d3d2-cd60-c9f8-3e2f-0e6cb6670b74"
          ]
        },
        {
          "uuid": "4c643c2e-977b-cb50-7491-46fb54a3ec42",
          "code": "DB11584",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11584",
          "code_system": "DRUG BANK",
          "references": [
            "25a3d3d2-cd60-c9f8-3e2f-0e6cb6670b74"
          ]
        },
        {
          "uuid": "f63c9187-6fbc-1e18-3eb5-194d405af68c",
          "code": "Designer-drugs-Pipradrol",
          "comments": "Wikipedia|List of designer drugs|Stimulants|Tropanes and Piperidines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "25a3d3d2-cd60-c9f8-3e2f-0e6cb6670b74"
          ]
        },
        {
          "uuid": "889d8bee-b6a8-b842-3ebc-1803cb09c69a",
          "code": "100000082198",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "28ff6bd9-bfe8-5f7b-5aa3-6250ca855967"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7d8c73e1-7e71-49b0-b140-200abe27fbcc",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8f9dbef5-8b9c-48c1-8a00-7cdea568783e",
            "refuuid": "e8c86dc7-4e15-4ded-b635-5d8960f66fa1",
            "name": "PIPRADROL",
            "unii": "S6I030E0DA",
            "linking_id": "S6I030E0DA",
            "ref_pname": "PIPRADROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d0a1df22-586a-4ac9-9d93-ebd100a5c195",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "583e8736-9d98-4b40-8d1e-cd19da7bd7b3",
            "refuuid": "bd9b7111-f6d0-4aef-9589-97dbece5ecf8",
            "name": "PIPRADROL HYDROCHLORIDE",
            "unii": "F6E46VR9Y2",
            "linking_id": "F6E46VR9Y2",
            "ref_pname": "PIPRADROL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "81af278c-ba68-4e00-9fa7-525d8102b9e1",
          "name": "(±)-.ALPHA.,.ALPHA.-DIPHENYL-.ALPHA.-(2-PIPERIDINYL)METHANOL",
          "stdName": "(+/-)-.ALPHA.,.ALPHA.-DIPHENYL-.ALPHA.-(2-PIPERIDINYL)METHANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "07578da6-ed4a-40b4-963b-7d3de9928c6a",
          "name": ".ALPHA.,.ALPHA.-DIPHENYL-.ALPHA.-(2-PIPERIDYL)METHANOL",
          "stdName": ".ALPHA.,.ALPHA.-DIPHENYL-.ALPHA.-(2-PIPERIDYL)METHANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "907e104c-166b-471d-ad83-4b9e2faac997",
          "name": ".ALPHA.,.ALPHA.-DIPHENYL-2-PIPERIDINEMETHANOL",
          "stdName": ".ALPHA.,.ALPHA.-DIPHENYL-2-PIPERIDINEMETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "31f82149-51e3-439c-9cbe-a10d9320fa25",
          "name": ".ALPHA.-(2-PIPERIDYL)BENZHYDROL",
          "stdName": ".ALPHA.-(2-PIPERIDYL)BENZHYDROL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "30bbb2c7-fab3-4ee8-9f4a-788c09fe094f",
          "name": ".ALPHA.-(2-PIPERIDYL)BENZHYDRYL ALCOHOL",
          "stdName": ".ALPHA.-(2-PIPERIDYL)BENZHYDRYL ALCOHOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "8457cb8d-7412-406f-8b55-4cf68b73fdf1",
          "name": "2-PIPERIDINEMETHANOL, .ALPHA.,.ALPHA.-DIPHENYL-",
          "stdName": "2-PIPERIDINEMETHANOL, .ALPHA.,.ALPHA.-DIPHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "69307a2e-4708-4c87-b720-ab085619189e",
          "name": "ALPHA-PIPRADOL",
          "stdName": "ALPHA-PIPRADOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "67672be3-670d-4aee-8aeb-34653eafa864",
          "name": "GERODYL",
          "stdName": "GERODYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "f0e98a0a-ca75-4922-9f60-0ca3eb6ce99e",
          "name": "MRD-108",
          "stdName": "MRD-108",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "985b114a-c019-4f30-90de-c6e79a1c11ff",
          "name": "PIPRADOL",
          "stdName": "PIPRADOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "2347b005-a559-4736-a740-b51f21c9ff35",
          "name": "PIPRADROL",
          "stdName": "PIPRADROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "eb923ee9-831a-42ff-9da6-d77f7e332878",
            "e7d37831-2fe6-4759-a98e-c7e867cbf65b",
            "b484d86d-82ba-4201-8237-212a3ca50c7e",
            "9f1d420f-c1d4-4066-bd49-fc19f1d59c10",
            "a22b25f6-a391-45fb-be28-299137e5434d",
            "af847f7e-68a3-43a0-a310-af7a9f68d2c3"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "74918f7a-bf21-4b80-b5d8-df2ce15cc6fb",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d85c36d4-5afa-4ff4-a20b-7f1687d826d4",
          "name": "PIPRADROL [MI]",
          "stdName": "PIPRADROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "b484d86d-82ba-4201-8237-212a3ca50c7e"
          ],
          "display_name": false
        },
        {
          "uuid": "0fefc6f7-3bf0-4c5e-ab91-b5559bfd6284",
          "name": "PIPRALON",
          "stdName": "PIPRALON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "6e48892c-c1af-48bc-b1ba-2a43fae5d00e",
          "name": "PIRIDROL",
          "stdName": "PIRIDROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "6996ffd0-9393-47ed-9307-86465491a2f9",
          "name": "PYRIDROL",
          "stdName": "PYRIDROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "a56500cc-b0a6-4f48-8918-a1c8f72ccf6d",
          "name": "PYRIDROLE",
          "stdName": "PYRIDROLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
            "081ba541-47a8-49ef-a0a3-f85bb5693708"
          ],
          "display_name": false
        },
        {
          "uuid": "29ee091f-48fb-b0a6-f798-db3a2af78c31",
          "name": "Pipradrol [WHO-DD]",
          "stdName": "PIPRADROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff0b5358-2e97-ccc2-daa1-eabceb278abc"
          ],
          "display_name": false
        },
        {
          "uuid": "c6ed3328-e7a4-4aff-818f-b9a4bda88464",
          "name": "pipradrol [INN]",
          "stdName": "PIPRADROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7d37831-2fe6-4759-a98e-c7e867cbf65b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e7d37831-2fe6-4759-a98e-c7e867cbf65b",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b484d86d-82ba-4201-8237-212a3ca50c7e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b3600f6-4ccf-4b8e-8bb6-7218db1e7a6e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f1d420f-c1d4-4066-bd49-fc19f1d59c10",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "081ba541-47a8-49ef-a0a3-f85bb5693708",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf1236b5-3dfe-42a0-99ec-367440e5fdbe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e280028b-eddf-459d-91a0-3370dad6b19e",
          "citation": "SRS import [S6I030E0DA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S6I030E0DA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af847f7e-68a3-43a0-a310-af7a9f68d2c3",
          "citation": "PIPRADROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a22b25f6-a391-45fb-be28-299137e5434d",
          "citation": "PIPRADROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb923ee9-831a-42ff-9da6-d77f7e332878",
          "citation": "PIPRADROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de4c0b26-3bc5-010d-e387-6689bd8ff798",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+467-60-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6f3ce884-161d-9e5a-6e59-dd6c9eb24e0f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=467-60-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "25a3d3d2-cd60-c9f8-3e2f-0e6cb6670b74",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0fd0dde2-68d8-4b84-b899-ce1a359d9ea6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ad1adb61-4307-4a98-b9d5-d2dd73de3b11",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ff0b5358-2e97-ccc2-daa1-eabceb278abc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "28ff6bd9-bfe8-5f7b-5aa3-6250ca855967",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ac910b58-227e-4725-8e7b-ba109cf5e0bc",
          "id": "ac910b58-227e-4725-8e7b-ba109cf5e0bc",
          "molfile": "\n  Marvin  01132108572D          \n\n 20 22  0  0  0  0            999 V2000\n    6.4541   -3.5750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7416   -3.9916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0250   -4.4041    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.0250   -5.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3166   -5.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6000   -5.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6000   -4.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3166   -3.9875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7416   -3.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4583   -2.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4625   -1.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7500   -1.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0333   -1.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0333   -2.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4541   -4.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4500   -5.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1625   -5.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8791   -5.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8791   -4.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1666   -3.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n 15  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(c2ccccc2)(C3CCCCN3)O",
          "formula": "C18H21NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2b46deb5-998a-4ead-bc34-0f040e064e5b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "267.3661",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e8c86dc7-4e15-4ded-b635-5d8960f66fa1",
      "version": "14",
      "structure": {
        "id": "633f0316-e055-48b5-a20b-ffe02c8b67dc",
        "molfile": "\n  Marvin  01132105092D          \n\n 20 22  0  0  0  0            999 V2000\n    5.7416   -3.9916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3166   -3.9875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0250   -4.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4541   -4.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7416   -3.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4541   -3.5750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6000   -4.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4583   -2.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0333   -2.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4500   -5.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1666   -3.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0250   -5.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6000   -5.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4625   -1.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0333   -1.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1625   -5.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8791   -4.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3166   -5.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7500   -1.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8791   -5.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  5  2  0  0  0  0\n  9  5  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15  9  2  0  0  0  0\n 16 10  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18 12  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 19 14  2  0  0  0  0\n 20 16  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(c2ccccc2)(C3CCCCN3)O",
        "formula": "C18H21NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "267.3661",
        "optical_activity": "( + / - )",
        "references": [
          "e280028b-eddf-459d-91a0-3370dad6b19e",
          "e7d37831-2fe6-4759-a98e-c7e867cbf65b"
        ],
        "stereo_centers": 1
      },
      "unii": "S6I030E0DA"
    }
  ]
}