{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b3fce188-3223-4dea-a11a-9025d87e8992", "code": "4430-25-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4430-25-5", "code_system": "CAS", "references": [ "6d14b06d-8248-456e-b6cd-871ab73134dd", "e8b3b9ba-5a78-4363-a7a3-4b04d54de7be" ] }, { "uuid": "797b6aa7-1a8c-441c-bad4-2c82292c38d7", "code": "224-622-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.385", "code_system": "ECHA (EC/EINECS)", "references": [ "6d14b06d-8248-456e-b6cd-871ab73134dd" ] }, { "uuid": "1f3bca4c-6cff-47d4-83f3-3a26ebe4db9f", "code": "78159", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/78159", "code_system": "PUBCHEM", "references": [ "6d14b06d-8248-456e-b6cd-871ab73134dd" ] }, { "uuid": "a4d1adac-7d54-f3ca-c3b3-bff9b1e16bf8", "code": "DTXSID9063451", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9063451", "code_system": "EPA CompTox", "references": [ "79f76b09-7fbc-477c-f9b0-6af120df9963" ] }, { "uuid": "6f0afd13-f298-450a-8c01-64625c949c0a", "code": "S6FO6931N7", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b16170eb-ba71-f582-ecc3-f7984f1fedba", "code": "11236", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=11236", "code_system": "NSC", "references": [ "a3fe7b17-1c23-8074-fbbe-fca98f889dcf" ] }, { "uuid": "d533775f-55e3-99dd-3112-3d65a993de5b", "code": "300000053780", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "657ce26a-28d5-01cd-13da-84caea3ea8be" ] } ], "substance_class": "chemical", "names": [ { "uuid": "2323d9a4-45b0-493a-b000-bd0c9806061d", "name": "4,4'-(4,5,6,7-TETRABROMO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMOPHENOL) S,S-DIOXIDE", "stdName": "4,4'-(4,5,6,7-TETRABROMO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMOPHENOL) S,S-DIOXIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "47a173a7-d6ab-426a-9c92-242bd5719be8", "cd4de33b-c029-4de0-b65d-14904d34ec48" ], "display_name": false }, { "uuid": "1f5d5746-fbdf-4aab-8e06-6e47e37d3f4d", "name": "NSC-11236", "stdName": "NSC-11236", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a0929446-0ee4-45fe-ba71-09b5fd38fe8e", "47a173a7-d6ab-426a-9c92-242bd5719be8" ], "display_name": false }, { "uuid": "c8d8d0ed-2c2c-4944-9384-df6002a0fe9f", "name": "PHENOL, 4,4'-(4,5,6,7-TETRABROMO-1,1-DIOXIDO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-", "stdName": "PHENOL, 4,4'-(4,5,6,7-TETRABROMO-1,1-DIOXIDO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a0929446-0ee4-45fe-ba71-09b5fd38fe8e", "47a173a7-d6ab-426a-9c92-242bd5719be8" ], "display_name": false }, { "uuid": "013a8fdf-7535-4c84-bc6d-e482923f9ceb", "name": "PHENOL, 4,4'-(4,5,6,7-TETRABROMO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-, S,S-DIOXIDE", "stdName": "PHENOL, 4,4'-(4,5,6,7-TETRABROMO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-, S,S-DIOXIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a0929446-0ee4-45fe-ba71-09b5fd38fe8e", "47a173a7-d6ab-426a-9c92-242bd5719be8" ], "display_name": false }, { "uuid": "b77d55bb-a083-4e16-bd64-20ce4b327542", "name": "TETRABROMOPHENOL BLUE", "stdName": "TETRABROMOPHENOL BLUE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "ebd8cd98-c5c7-480c-a0fc-5d0ee873253c", "47a173a7-d6ab-426a-9c92-242bd5719be8", "a9d60442-d1f9-4832-b565-bd7d0e07e8b9" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "013d267e-4817-4002-b8e3-272f1005f15b", "name_org": "INCI" } ] }, { "uuid": "28a0f6d1-c9cc-46ec-a1e0-0d5de070decb", "name": "TETRABROMPHENOL BLUE", "stdName": "TETRABROMPHENOL BLUE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a0929446-0ee4-45fe-ba71-09b5fd38fe8e", "47a173a7-d6ab-426a-9c92-242bd5719be8" ], "display_name": false } ], "references": [ { "uuid": "ebd8cd98-c5c7-480c-a0fc-5d0ee873253c", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "47a173a7-d6ab-426a-9c92-242bd5719be8", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a0929446-0ee4-45fe-ba71-09b5fd38fe8e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cd4de33b-c029-4de0-b65d-14904d34ec48", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6d14b06d-8248-456e-b6cd-871ab73134dd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392242000, "tags": [ "NOMEN" ] }, { "uuid": "7b69bc2d-fb37-4844-b218-a6563ffa0482", "citation": "SRS import [S6FO6931N7]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S6FO6931N7", "doc_type": "SRS", "public_domain": true, "document_date": 1493392242000, "tags": [ "NOMEN" ] }, { "uuid": "a9d60442-d1f9-4832-b565-bd7d0e07e8b9", "citation": "TETRABROMOPHENOL BLUE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "79f76b09-7fbc-477c-f9b0-6af120df9963", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4430-25-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e8b3b9ba-5a78-4363-a7a3-4b04d54de7be", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "a3fe7b17-1c23-8074-fbbe-fca98f889dcf", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "657ce26a-28d5-01cd-13da-84caea3ea8be", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "926aaf5f-917a-4385-ba75-1d418ec57e41", "id": "926aaf5f-917a-4385-ba75-1d418ec57e41", "molfile": "\n Marvin 01132107352D \n\n 33 36 0 0 0 0 999 V2000\n 4.2056 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8696 -0.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3563 -1.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1789 -1.3382 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0203 -2.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1977 -2.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7111 -1.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0471 -0.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5605 -0.1738 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -3.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3751 -3.6901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -4.3563 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -4.7675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1977 -5.1093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6495 -4.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6495 -3.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -2.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -2.0391 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0804 -3.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7929 -2.8617 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0804 -4.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7929 -4.5126 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -4.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -5.3411 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -2.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -3.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7126 -2.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.0181 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7126 -1.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -1.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -0.5445 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 8 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 10 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 16 1 0 0 0 0\n 10 25 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 2 0 0 0 0\n 12 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 23 2 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 33 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Br)O)Br)C2(c3cc(c(c(c3)Br)O)Br)c4c(c(c(c(c4S(=O)(=O)O2)Br)Br)Br)Br", "formula": "C19H6Br8O5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "79571d05-141c-41ff-a7d9-4de311c13163" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "985.543", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9f77da96-30c0-4f67-8c7d-19b397f96825", "version": "6", "structure": { "id": "92505787-6c5d-4bfb-968e-cfbe3584c383", "molfile": "\n Marvin 01132107352D \n\n 33 36 0 0 0 0 999 V2000\n 4.2056 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8696 -0.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3563 -1.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1789 -1.3382 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0203 -2.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1977 -2.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -3.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -2.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -3.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7126 -2.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.0181 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7126 -1.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -1.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -0.5445 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3751 -3.6901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -4.3563 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -4.7675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1977 -5.1093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6495 -4.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6495 -3.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -2.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -2.0391 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0804 -3.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7929 -2.8617 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0804 -4.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7929 -4.5126 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -4.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3621 -5.3411 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7111 -1.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0471 -0.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5605 -0.1738 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 32 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 31 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 17 1 0 0 0 0\n 7 22 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 16 2 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 18 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 29 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Br)O)Br)C2(c3cc(c(c(c3)Br)O)Br)c4c(c(c(c(c4S(=O)(=O)O2)Br)Br)Br)Br", "formula": "C19H6Br8O5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "985.543", "optical_activity": "NONE", "references": [ "7b69bc2d-fb37-4844-b218-a6563ffa0482", "cd4de33b-c029-4de0-b65d-14904d34ec48" ], "stereo_centers": 0 }, "unii": "S6FO6931N7" } ] }