{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6c6aec01-d733-4d80-baf9-baccc512e255",
          "code": "m8762",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8762?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f67df4ab-3541-4470-b833-49e8019cdb6d"
          ]
        },
        {
          "uuid": "cf401934-d49b-41b5-a012-27a8956affe4",
          "code": "DB01022",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01022",
          "code_system": "DRUG BANK",
          "references": [
            "f67df4ab-3541-4470-b833-49e8019cdb6d"
          ]
        },
        {
          "uuid": "5f3ad689-3226-4b10-9764-b7f0ef419678",
          "code": "5284607",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5284607",
          "code_system": "PUBCHEM",
          "references": [
            "f67df4ab-3541-4470-b833-49e8019cdb6d"
          ]
        },
        {
          "uuid": "94b4a772-7d7e-48d6-9825-683f8fca4c91",
          "code": "84-80-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=84-80-0",
          "code_system": "CAS",
          "references": [
            "f67df4ab-3541-4470-b833-49e8019cdb6d",
            "41d49114-ca4b-4955-86aa-ca6bc2c1bcea"
          ]
        },
        {
          "uuid": "bf3a1e83-0f1f-452b-9349-31fe383bfc94",
          "code": "201-564-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.422",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f67df4ab-3541-4470-b833-49e8019cdb6d"
          ]
        },
        {
          "uuid": "245a0be1-8243-4f88-bfab-e0ec02e391cc",
          "code": "PHYTONADIONE, (E)-",
          "comments": "Description: A clear, yellow to amber-coloured, very viscous liquid; odourless or almost odourless. Miscibility: Practically immiscible with water; sparingly miscible with ethanol (~750 g/l) TS; freely miscible with chloroform R and ether R. Category: Anticoagulant.Storage: Phytomenadione should be kept in a tightly closed container, protected from light. Definition: Phytomenadione contains not less than 97.0% and not more than 102.0% of C31H46O2.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.321.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "f67df4ab-3541-4470-b833-49e8019cdb6d"
          ]
        },
        {
          "uuid": "798b3d33-f4d6-0325-6040-51676498c169",
          "code": "3162",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3162",
          "code_system": "HSDB",
          "references": [
            "cf603dd8-8c54-d1cf-17bc-b18baf41e343"
          ]
        },
        {
          "uuid": "d85dbc2c-3fb0-4cd5-2a5a-67661cd848c9",
          "code": "DTXSID8023472",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8023472",
          "code_system": "EPA CompTox",
          "references": [
            "05bcecf1-7589-d8f0-e109-d8719aee28f5"
          ]
        },
        {
          "uuid": "63adfb65-9622-4ad5-a223-ab1dc716e336",
          "code": "S5Z3U87QHF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c704597b-f2b6-4883-0cf7-a961240d5f55",
          "code": "Phytomenadione",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phytomenadione",
          "code_system": "WIKIPEDIA",
          "references": [
            "34a4d7f1-e26c-1f97-19a4-74937f06c7c5"
          ]
        },
        {
          "uuid": "41f87f2a-3be5-48bd-1953-bcc8673ce7f7",
          "code": "270681",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=270681",
          "code_system": "NSC",
          "references": [
            "8050b780-3166-5865-7aa7-295920ba3714"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f94056b1-e21b-4de4-8456-37610eafd6d9",
          "name": "2-METHYL-3-((2E,7R,11R)-3,7,11,15-TETRAMETHYL-2-HEXADECENYL)-1,4-NAPHTHALENEDIONE",
          "stdName": "2-METHYL-3-((2E,7R,11R)-3,7,11,15-TETRAMETHYL-2-HEXADECENYL)-1,4-NAPHTHALENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3dac047-fd4b-48bd-ba3e-55c61b038efb",
            "a12e4608-ecf6-43ad-a64f-42cd0b18a9ca"
          ],
          "display_name": false
        },
        {
          "uuid": "f6e4998b-0cb2-ad5e-de9f-d3ead3be8720",
          "name": "2-METHYL-3-((7R,11R,E)-3,7,11,15-TETRAMETHYLHEXADEC-2-EN-1-YL)NAPHTHALENE-1,4-DIONE",
          "stdName": "2-METHYL-3-((7R,11R,E)-3,7,11,15-TETRAMETHYLHEXADEC-2-EN-1-YL)NAPHTHALENE-1,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc22bd38-d950-3898-8c67-e61584003f63"
          ],
          "display_name": false
        },
        {
          "uuid": "f2720006-1b5f-42b9-a558-29e78e30276c",
          "name": "MONODION",
          "stdName": "MONODION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3dac047-fd4b-48bd-ba3e-55c61b038efb",
            "a4555318-7fe9-488f-b317-d7f823efbcfa"
          ],
          "display_name": false
        },
        {
          "uuid": "15c0a87e-3ad2-471c-b29f-50fe7baa30d4",
          "name": "NSC-270681",
          "stdName": "NSC-270681",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3dac047-fd4b-48bd-ba3e-55c61b038efb",
            "a4555318-7fe9-488f-b317-d7f823efbcfa"
          ],
          "display_name": false
        },
        {
          "uuid": "b2c2ffab-ca52-a193-709f-10933ba9d813",
          "name": "PHYLLOQUINONE E-FORM [MI]",
          "stdName": "PHYLLOQUINONE E-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a82e85-0f20-20fc-1d3d-4bf67080e384"
          ],
          "display_name": false
        },
        {
          "uuid": "b06a0dbd-98dc-42b6-a71c-19f732977719",
          "name": "PHYLLOQUINONE, (E)-",
          "stdName": "PHYLLOQUINONE, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3dac047-fd4b-48bd-ba3e-55c61b038efb",
            "d8726f93-478e-4b97-a509-6e58204e2ad7"
          ],
          "display_name": false
        },
        {
          "uuid": "cbe8da5f-2e3a-4bbb-931f-aae92fb7afd9",
          "name": "PHYTOMENADIONE, (E)-",
          "stdName": "PHYTOMENADIONE, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00b1eb3c-f440-46ea-9042-d9b64a60e28e",
            "a3dac047-fd4b-48bd-ba3e-55c61b038efb"
          ],
          "display_name": false
        },
        {
          "uuid": "5d6f1750-c7c1-434f-8198-c736513f6f6c",
          "name": "PHYTONADIONE [JAN]",
          "stdName": "PHYTONADIONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "070a70cc-aa13-6148-6ec8-575f1d37517e"
          ],
          "display_name": false
        },
        {
          "uuid": "a805f407-00a9-4c23-8194-634da100ea0b",
          "name": "PHYTONADIONE, (E)-",
          "stdName": "PHYTONADIONE, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3dac047-fd4b-48bd-ba3e-55c61b038efb",
            "d8726f93-478e-4b97-a509-6e58204e2ad7"
          ],
          "display_name": true
        },
        {
          "uuid": "50a15ead-d09c-47ac-b608-e4dc100bb197",
          "name": "SYNTHEX P",
          "stdName": "SYNTHEX P",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3dac047-fd4b-48bd-ba3e-55c61b038efb",
            "a4555318-7fe9-488f-b317-d7f823efbcfa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d8726f93-478e-4b97-a509-6e58204e2ad7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a3dac047-fd4b-48bd-ba3e-55c61b038efb",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00b1eb3c-f440-46ea-9042-d9b64a60e28e",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a12e4608-ecf6-43ad-a64f-42cd0b18a9ca",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4555318-7fe9-488f-b317-d7f823efbcfa",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f67df4ab-3541-4470-b833-49e8019cdb6d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389753000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a6bf714-1dee-44e3-82ec-a6e3738b664a",
          "citation": "SRS import [S5Z3U87QHF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S5Z3U87QHF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389753000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86d10959-63a6-4764-b2b4-1a844f8bc07f",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "070a70cc-aa13-6148-6ec8-575f1d37517e",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf603dd8-8c54-d1cf-17bc-b18baf41e343",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+84-80-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "05bcecf1-7589-d8f0-e109-d8719aee28f5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84-80-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "30a82e85-0f20-20fc-1d3d-4bf67080e384",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "bc22bd38-d950-3898-8c67-e61584003f63",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true
        },
        {
          "uuid": "41d49114-ca4b-4955-86aa-ca6bc2c1bcea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "34a4d7f1-e26c-1f97-19a4-74937f06c7c5",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "8050b780-3166-5865-7aa7-295920ba3714",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5b8f8795-ffba-4764-87e9-5639800c715d",
          "id": "5b8f8795-ffba-4764-87e9-5639800c715d",
          "molfile": "\n  Marvin  01132104452D          \n\n 33 34  0  0  1  0            999 V2000\n    6.6807   -3.4673    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.6807   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3957   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1107   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8259   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5409   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5420   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2556   -3.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9656   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2505   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5355   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8204   -3.4673    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.8204   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1054   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3903   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6752   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9602   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9602   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2452   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4699   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1827   -3.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1827   -2.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4674   -1.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9004   -1.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9041   -0.9923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6067   -2.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3179   -1.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0322   -2.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0308   -3.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3189   -3.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6092   -3.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9004   -3.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9026   -4.2962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 32 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 26 24  1  0  0  0  0\n 26 27  1  0  0  0  0\n 31 26  2  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  2  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC/C(=C/CC1=C(C)C(=O)c2ccccc2C1=O)/C",
          "formula": "C31H46O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f962f10d-9970-4e65-b15b-5f9c52c63982"
          },
          "defined_stereo": 2,
          "ez_centers": 1,
          "molecular_weight": "450.6969",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bf85033d-2a24-4520-b162-ca93cc045083",
      "version": "9",
      "structure": {
        "id": "ee942d6a-6ef5-49c7-bd08-a257fcb26c6f",
        "molfile": "\n  Marvin  01132112222D          \n\n 33 34  0  0  1  0            999 V2000\n   -1.9004   -3.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1827   -3.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1827   -2.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9004   -1.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6092   -3.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6067   -2.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3179   -1.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0322   -2.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0308   -3.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3189   -3.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9041   -0.9923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9026   -4.2962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4674   -1.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4699   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2452   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9602   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6752   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3903   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1054   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8204   -3.4673    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.5355   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2505   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9656   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6807   -3.4673    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3957   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1107   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8259   -3.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5409   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9602   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8204   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6807   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5420   -4.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2556   -3.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 15 16  2  0  0  0  0\n  7  8  2  0  0  0  0\n 16 17  1  0  0  0  0\n  2  3  2  0  0  0  0\n 17 18  1  0  0  0  0\n  8  9  1  0  0  0  0\n 18 19  1  0  0  0  0\n  3  4  1  0  0  0  0\n 19 20  1  0  0  0  0\n  9 10  2  0  0  0  0\n 20 21  1  0  0  0  0\n 10  5  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n  4 11  2  0  0  0  0\n 23 24  1  0  0  0  0\n  6  4  1  0  0  0  0\n 24 25  1  0  0  0  0\n  1 12  2  0  0  0  0\n 25 26  1  0  0  0  0\n  5  6  2  0  0  0  0\n 26 27  1  0  0  0  0\n  3 13  1  0  0  0  0\n 27 28  1  0  0  0  0\n  5  1  1  0  0  0  0\n 16 29  1  0  0  0  0\n  2 14  1  0  0  0  0\n 20 30  1  1  0  0  0\n  6  7  1  0  0  0  0\n 24 31  1  1  0  0  0\n 14 15  1  0  0  0  0\n 28 32  1  0  0  0  0\n  1  2  1  0  0  0  0\n 28 33  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC/C(=C/CC1=C(C)C(=O)c2ccccc2C1=O)/C",
        "formula": "C31H46O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 1,
        "molecular_weight": "450.6969",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "86d10959-63a6-4764-b2b4-1a844f8bc07f",
          "0a6bf714-1dee-44e3-82ec-a6e3738b664a"
        ],
        "stereo_centers": 2
      },
      "unii": "S5Z3U87QHF"
    }
  ]
}