{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8f2e2d86-85f4-47f5-88cf-a48430e7117f",
          "code": "1742-95-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1742-95-6",
          "code_system": "CAS",
          "references": [
            "6108ec50-a8eb-41d0-921e-f660adcb720c",
            "e7119b1a-14a9-4e12-a473-1127738ab5c9"
          ]
        },
        {
          "uuid": "4b603fe6-b11d-44fc-b674-faf884d847aa",
          "code": "217-110-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.555",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6108ec50-a8eb-41d0-921e-f660adcb720c"
          ]
        },
        {
          "uuid": "ce7652b4-50d8-4cd4-90e5-ceda4018772e",
          "code": "1720",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1720",
          "code_system": "PUBCHEM",
          "references": [
            "6108ec50-a8eb-41d0-921e-f660adcb720c"
          ]
        },
        {
          "uuid": "e1eb56a7-ced1-ec76-afe4-8b880f863e95",
          "code": "DTXSID6061941",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6061941",
          "code_system": "EPA CompTox",
          "references": [
            "e480400a-b97b-0299-7d2b-64ef7f9090af"
          ]
        },
        {
          "uuid": "acb3090c-2cd0-a7da-21b5-3daf2c5387cb",
          "code": "40071",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:40071",
          "code_system": "CHEBI",
          "references": [
            "699bbcc8-eaf0-5b00-4422-02e6b71d25c4"
          ]
        },
        {
          "uuid": "29b0bfe6-d60f-4467-8d8c-1092caa3a0a8",
          "code": "S529AR2S8B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3bcf7966-5f76-4dfa-a48e-1b955f9f3a0c",
          "name": "1H-BENZ(DE)ISOQUINOLINE-1,3(2H)-DIONE, 6-AMINO-",
          "stdName": "1H-BENZ(DE)ISOQUINOLINE-1,3(2H)-DIONE, 6-AMINO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7119b1a-14a9-4e12-a473-1127738ab5c9"
          ],
          "display_name": false
        },
        {
          "uuid": "1abe78d3-bfeb-48cf-9cd5-df648e2e5ddb",
          "name": "4-AMINO-1,8-NAPHTHALIMIDE",
          "stdName": "4-AMINO-1,8-NAPHTHALIMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a85e74b0-9606-4891-bf0b-76bd72d4d4c1",
            "e7119b1a-14a9-4e12-a473-1127738ab5c9"
          ],
          "display_name": true
        },
        {
          "uuid": "0a0b8cb9-751f-498e-9e9d-98059292f018",
          "name": "4-AMINONAPHTHALIMIDE",
          "stdName": "4-AMINONAPHTHALIMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7119b1a-14a9-4e12-a473-1127738ab5c9"
          ],
          "display_name": false
        },
        {
          "uuid": "15eabc21-a8f8-49eb-83d5-545c2520b396",
          "name": "6-AMINO-1H-BENZ(DE)ISOQUINOLINE-1,3(2H)-DIONE",
          "stdName": "6-AMINO-1H-BENZ(DE)ISOQUINOLINE-1,3(2H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7119b1a-14a9-4e12-a473-1127738ab5c9"
          ],
          "display_name": false
        },
        {
          "uuid": "8c5a10c9-b0c5-4d31-b0c4-457a92eeba2a",
          "name": "6-AMINO-BENZO(DE)ISOQUINOLINE-1,3-DIONE",
          "stdName": "6-AMINO-BENZO(DE)ISOQUINOLINE-1,3-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7119b1a-14a9-4e12-a473-1127738ab5c9"
          ],
          "display_name": false
        },
        {
          "uuid": "132adec9-c69a-40ac-ad7d-85a136c1a0c3",
          "name": "D-122",
          "stdName": "D-122",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7119b1a-14a9-4e12-a473-1127738ab5c9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a85e74b0-9606-4891-bf0b-76bd72d4d4c1",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6108ec50-a8eb-41d0-921e-f660adcb720c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392258000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e480400a-b97b-0299-7d2b-64ef7f9090af",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1742-95-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "699bbcc8-eaf0-5b00-4422-02e6b71d25c4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e7119b1a-14a9-4e12-a473-1127738ab5c9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "41c6a1c4-e727-458b-a10d-08913a047fc7",
          "id": "41c6a1c4-e727-458b-a10d-08913a047fc7",
          "molfile": "\n  Marvin  01132103282D          \n\n 16 18  0  0  0  0            999 V2000\n    4.2747   -1.2439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5651   -1.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5608   -2.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8426   -2.8897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1330   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4234   -2.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4234   -3.7019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7096   -2.4750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7096   -1.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4234   -1.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4277   -0.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1501    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8640   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8512   -1.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1373   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 15  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 16  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 16 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "c1cc2c(ccc3c2c(c1)C(=O)NC3=O)N",
          "formula": "C12H8N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "38fc3ec1-8184-451f-a4c8-66702503a868"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.2046",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b490ce3c-5f93-49ae-b309-817fddc35976",
      "version": "6",
      "structure": {
        "id": "5fb77f90-ce04-47d1-9926-1ee0f5b26375",
        "molfile": "\n  Marvin  01132104572D          \n\n 16 18  0  0  0  0            999 V2000\n    1.4234   -3.7019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2747   -1.2439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1373   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1330   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4234   -1.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8512   -1.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4234   -2.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8426   -2.8897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7096   -1.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4277   -0.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5651   -1.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8640   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7096   -2.4750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5608   -2.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1501    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  8  2  0  0  0  0\n  2 10  2  0  0  0  0\n  3 12  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  6 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 15  2  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
        "smiles": "c1cc2c(ccc3c2c(c1)C(=O)NC3=O)N",
        "formula": "C12H8N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "212.2046",
        "optical_activity": "NONE",
        "references": [
          "a85e74b0-9606-4891-bf0b-76bd72d4d4c1",
          "e7119b1a-14a9-4e12-a473-1127738ab5c9"
        ],
        "stereo_centers": 0
      },
      "unii": "S529AR2S8B"
    }
  ]
}