{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bf1376ce-9183-4065-a047-ae7851e56891",
          "code": "42131-25-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=42131-25-9",
          "code_system": "CAS",
          "references": [
            "2c775230-717a-436f-9a2c-b7fb48237a14",
            "b51b4043-e6f4-4626-ac59-0e386f0282e7"
          ]
        },
        {
          "uuid": "651b61cc-2991-483c-a9cf-10700581a6d7",
          "code": "1367167",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1367167/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2c775230-717a-436f-9a2c-b7fb48237a14"
          ]
        },
        {
          "uuid": "8d656118-3489-4535-91de-147b912d3935",
          "code": "100986",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/100986",
          "code_system": "PUBCHEM",
          "references": [
            "2c775230-717a-436f-9a2c-b7fb48237a14"
          ]
        },
        {
          "uuid": "46420b39-0862-4afe-ac5c-fa8bbe97b56d",
          "code": "S4V5BS6GCX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "15a767e7-f942-cf6c-cd2b-3e2e1da64d2e",
          "code": "S4V5BS6GCX",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S4V5BS6GCX",
          "code_system": "DAILYMED",
          "references": [
            "e2e2cadb-6277-00c5-b947-9bb3f22eae13"
          ]
        },
        {
          "uuid": "0c59f95d-246e-5e25-c0d1-3b69519e481c",
          "code": "DTXSID80962298",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80962298",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "33e78dc7-c021-e3b0-d7a4-2527bcc6755f",
          "code": "300000054084",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ef08704e-5894-d9f5-4351-52d698bb37d3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0d956b3b-f61b-42f5-ba7d-6e37003fef65",
          "name": "3,5,5-TRIMETHYLHEXYL-3,5,5-TRIMETHYLHEXANOATE",
          "stdName": "3,5,5-TRIMETHYLHEXYL-3,5,5-TRIMETHYLHEXANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0836367d-36c8-4b97-8240-c8532299c5d8",
            "f4b7154a-29f7-4940-9e90-25e73679b93e"
          ],
          "display_name": false
        },
        {
          "uuid": "ee2fbdf1-421d-4fdd-8a5c-cd941f636d32",
          "name": "DERMOL 99",
          "stdName": "DERMOL 99",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0836367d-36c8-4b97-8240-c8532299c5d8",
            "f4b7154a-29f7-4940-9e90-25e73679b93e"
          ],
          "display_name": false
        },
        {
          "uuid": "3fbe1cc7-5736-459f-a66e-4f44076b6f9a",
          "name": "HATCOL 5131",
          "stdName": "HATCOL 5131",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0836367d-36c8-4b97-8240-c8532299c5d8",
            "f4b7154a-29f7-4940-9e90-25e73679b93e"
          ],
          "display_name": false
        },
        {
          "uuid": "fc158995-f3b1-4376-be6a-ca2f8c89fb37",
          "name": "HEXANOIC ACID, 3,5,5-TRIMETHYL-, 3,5,5-TRIMETHYLHEXYL ESTER",
          "stdName": "HEXANOIC ACID, 3,5,5-TRIMETHYL-, 3,5,5-TRIMETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0836367d-36c8-4b97-8240-c8532299c5d8",
            "f4b7154a-29f7-4940-9e90-25e73679b93e"
          ],
          "display_name": false
        },
        {
          "uuid": "44b7b791-fdd5-40ba-b36e-4e7f2579e5bc",
          "name": "ISONONANOIC ACID, ISONONYL ESTER",
          "stdName": "ISONONANOIC ACID, ISONONYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0836367d-36c8-4b97-8240-c8532299c5d8",
            "f4b7154a-29f7-4940-9e90-25e73679b93e"
          ],
          "display_name": false
        },
        {
          "uuid": "92053f68-25cc-4fd5-a048-bdc045f61a7e",
          "name": "ISONONYL ISONONANOATE",
          "stdName": "ISONONYL ISONONANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83f377ce-c08c-4c43-888e-53b85ce5f6fb",
            "f4b7154a-29f7-4940-9e90-25e73679b93e",
            "6c5abe2b-8f8a-477f-b3f4-a432a0157e2b",
            "20d0b184-c158-4efa-8da4-891c4fbd4831",
            "30b0248c-b66e-4083-a5b2-957a7a068fa5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f90b5916-29a1-435d-92c0-99ea9382780c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5899b7d4-a69d-441a-0631-ca34cc3ee2e3",
          "name": "Isononyl isononanoate [WHO-DD]",
          "stdName": "ISONONYL ISONONANOATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7f375fe-6fd7-f1f8-1b00-331926e6c0fc"
          ],
          "display_name": false
        },
        {
          "uuid": "54191055-7e40-48d0-adee-3a094afc0d0f",
          "name": "KAK 99",
          "stdName": "KAK 99",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4b7154a-29f7-4940-9e90-25e73679b93e",
            "558e4ecf-4f90-4a53-b02e-41d783ccae93"
          ],
          "display_name": false
        },
        {
          "uuid": "6b39182f-cb7f-4cf5-9a1d-da6e20592345",
          "name": "LANOL 99",
          "stdName": "LANOL 99",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4b7154a-29f7-4940-9e90-25e73679b93e",
            "558e4ecf-4f90-4a53-b02e-41d783ccae93"
          ],
          "display_name": false
        },
        {
          "uuid": "338cbb5b-7a43-463a-a02b-d20c1d9c5ef1",
          "name": "SALACOS 99",
          "stdName": "SALACOS 99",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4b7154a-29f7-4940-9e90-25e73679b93e",
            "558e4ecf-4f90-4a53-b02e-41d783ccae93"
          ],
          "display_name": false
        },
        {
          "uuid": "2bb48513-934d-407d-a647-98ecb9fcf85e",
          "name": "TEGOSOFT INI",
          "stdName": "TEGOSOFT INI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0836367d-36c8-4b97-8240-c8532299c5d8",
            "f4b7154a-29f7-4940-9e90-25e73679b93e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "20d0b184-c158-4efa-8da4-891c4fbd4831",
          "citation": "pcpc-db",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "30b0248c-b66e-4083-a5b2-957a7a068fa5",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0836367d-36c8-4b97-8240-c8532299c5d8",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4b7154a-29f7-4940-9e90-25e73679b93e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83f377ce-c08c-4c43-888e-53b85ce5f6fb",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "558e4ecf-4f90-4a53-b02e-41d783ccae93",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c775230-717a-436f-9a2c-b7fb48237a14",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390859000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34fad592-bd52-4fde-b764-3bc929263c7d",
          "citation": "SRS import [S4V5BS6GCX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S4V5BS6GCX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390859000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c5abe2b-8f8a-477f-b3f4-a432a0157e2b",
          "citation": "ISONONYL ISONONANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7f375fe-6fd7-f1f8-1b00-331926e6c0fc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b51b4043-e6f4-4626-ac59-0e386f0282e7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e2e2cadb-6277-00c5-b947-9bb3f22eae13",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ef08704e-5894-d9f5-4351-52d698bb37d3",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ce0aae58-a673-4ebc-88b2-9c7586aa4043",
          "id": "ce0aae58-a673-4ebc-88b2-9c7586aa4043",
          "molfile": "\n  Marvin  01132110382D          \n\n 20 19  0  0  0  0            999 V2000\n    8.0304  -11.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555  -11.7522    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.2680  -11.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555  -10.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680   -9.6089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555   -8.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0304   -8.8944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680   -8.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555   -7.4655    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.0304   -7.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680   -6.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555   -6.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1410   -6.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5699   -5.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429   -5.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680  -12.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555  -13.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5699  -13.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1410  -12.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429  -13.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 16  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
          "smiles": "CC(CCOC(=O)CC(C)CC(C)(C)C)CC(C)(C)C",
          "formula": "C18H36O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "46fc3928-deeb-4f8d-b51b-46c49c105750"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "284.4779",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "1e5fddb0-3baf-48f8-bbf7-bc7100a22f01",
      "version": "10",
      "structure": {
        "id": "cad825ba-6214-4953-9ce5-c89498cbad76",
        "molfile": "\n  Marvin  01132110282D          \n\n 20 19  0  0  0  0            999 V2000\n    8.0304  -11.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555  -11.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680  -11.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555  -10.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680   -9.6089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555   -8.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0304   -8.8944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680   -8.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555   -7.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0304   -7.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680   -6.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555   -6.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1410   -6.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5699   -5.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429   -5.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2680  -12.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8555  -13.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5699  -13.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1410  -12.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429  -13.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n  2 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
        "smiles": "CC(CCOC(=O)CC(C)CC(C)(C)C)CC(C)(C)C",
        "formula": "C18H36O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "284.4779",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0836367d-36c8-4b97-8240-c8532299c5d8",
          "34fad592-bd52-4fde-b764-3bc929263c7d"
        ],
        "stereo_centers": 2
      },
      "unii": "S4V5BS6GCX"
    }
  ]
}