{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c9ba1a5f-a342-4554-a2b3-afc277166a8a", "code": "55306-04-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=55306-04-2", "code_system": "CAS", "references": [ "c43c2eeb-ad20-4cff-91e0-b60d4b17b622", "bc7c940c-b1f5-42ee-9a74-4449ae0f2eae" ] }, { "uuid": "681712c8-89e5-436b-a30d-71776723afc5", "code": "C479759", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67479759", "code_system": "MESH", "references": [ "c43c2eeb-ad20-4cff-91e0-b60d4b17b622" ] }, { "uuid": "4c8a911d-8bf7-4f27-b9dd-f25056008f1f", "code": "76972524", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76972524", "code_system": "PUBCHEM", "references": [ "c43c2eeb-ad20-4cff-91e0-b60d4b17b622" ] }, { "uuid": "9c90fc04-7906-44b3-85d7-ce6cfbfe8e42", "code": "259-586-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.151", "code_system": "ECHA (EC/EINECS)", "references": [ "c43c2eeb-ad20-4cff-91e0-b60d4b17b622" ] }, { "uuid": "530bc249-7b7f-4d48-bc65-9246a80b6f98", "code": "S4A9325KV4", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "02a0d9b3-6c29-1817-b879-82ec6abd2b74", "code": "DTXSID001019848", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001019848", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "8c5ae79c-a549-4719-9115-30605c76341f", "name": "OLEAN-12-EN-28-OIC ACID, 2,3,19,23-TETRAHYDROXY, GLUCOPYRANOSYL ESTER", "stdName": "OLEAN-12-EN-28-OIC ACID, 2,3,19,23-TETRAHYDROXY, GLUCOPYRANOSYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cadc48b6-64bd-4a7e-b651-2403f925139c", "fc2fc1a4-188e-482a-908e-af1876323fcf" ], "display_name": false }, { "uuid": "79a80275-0047-4eaa-9bc4-f6af25fcb49d", "name": "OLEAN-12-EN-28-OIC ACID, 2,3,19,23-TETRAHYDROXY-, .BETA.-D-GLUCOPYRANOSYL ESTER, (2.ALPHA.,3.BETA.,4.BETA.,19.ALPHA.)-", "stdName": "OLEAN-12-EN-28-OIC ACID, 2,3,19,23-TETRAHYDROXY-, .BETA.-D-GLUCOPYRANOSYL ESTER, (2.ALPHA.,3.BETA.,4.BETA.,19.ALPHA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cadc48b6-64bd-4a7e-b651-2403f925139c", "979d77a6-6d9e-4061-a13e-ee7b8bb21287" ], "display_name": false }, { "uuid": "2b4d3713-137f-4780-b618-782e37c0e04c", "name": "SERICOSIDE", "stdName": "SERICOSIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "cadc48b6-64bd-4a7e-b651-2403f925139c", "6299669e-9695-4e3a-8994-2e57470c92c9", "fc2fc1a4-188e-482a-908e-af1876323fcf" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "66dd378a-47af-4cd5-b88f-7319b791448b", "name_org": "INCI" } ] }, { "uuid": "bf2cbfa2-e652-4f4f-aff7-00c37f0f97f8", "name": "SERICOSIDE VINYALS", "stdName": "SERICOSIDE VINYALS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "cadc48b6-64bd-4a7e-b651-2403f925139c", "fc2fc1a4-188e-482a-908e-af1876323fcf" ], "display_name": false } ], "references": [ { "uuid": "fc2fc1a4-188e-482a-908e-af1876323fcf", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "cadc48b6-64bd-4a7e-b651-2403f925139c", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "979d77a6-6d9e-4061-a13e-ee7b8bb21287", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c43c2eeb-ad20-4cff-91e0-b60d4b17b622", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391577000, "tags": [ "NOMEN" ] }, { "uuid": "54b9f69c-e08d-486b-b2d1-6e01df647202", "citation": "SRS import [S4A9325KV4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S4A9325KV4", "doc_type": "SRS", "public_domain": true, "document_date": 1493391577000, "tags": [ "NOMEN" ] }, { "uuid": "6299669e-9695-4e3a-8994-2e57470c92c9", "citation": "SERICOSIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "bc7c940c-b1f5-42ee-9a74-4449ae0f2eae", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0aaa1d2a-e354-41a5-b4da-323d70a3e60b", "id": "0aaa1d2a-e354-41a5-b4da-323d70a3e60b", "molfile": "\n Marvin 01132100482D \n\n 47 52 0 0 1 0 999 V2000\n 4.1461 -5.6586 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.4315 -5.2463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8607 -5.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5754 -5.6586 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.5754 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5754 -6.4832 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.2899 -6.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0045 -6.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0045 -5.6586 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.0045 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2899 -5.2463 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.2899 -4.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0045 -4.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7192 -4.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4338 -4.0095 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.4338 -3.1849 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.7192 -2.7726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1210 -2.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5332 -2.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7087 -2.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -3.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -4.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1210 -4.4218 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 9.1210 -5.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4338 -5.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7192 -5.2463 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.7192 -6.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -5.6586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5502 -4.4218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2648 -4.8340 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.9794 -4.4218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6940 -4.8340 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.4087 -4.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1233 -4.8340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6940 -5.6586 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 13.4087 -6.0709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9794 -6.0709 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.9794 -6.8954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2648 -5.6586 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 10.5502 -6.0709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8607 -6.8954 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.4484 -7.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2730 -7.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0975 -7.6101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1461 -6.4832 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.4315 -6.8954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 46 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 6 4 1 0 0 0 0\n 4 11 1 0 0 0 0\n 6 7 1 1 0 0 0\n 42 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 1 0 0 0\n 11 9 1 0 0 0 0\n 9 26 1 0 0 0 0\n 11 12 1 1 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 6 0 0 0\n 26 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 23 1 0 0 0 0\n 16 17 1 6 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 21 18 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 1 1 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 6 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 31 30 1 6 0 0 0\n 31 32 1 0 0 0 0\n 40 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 6 0 0 0\n 33 36 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 37 1 1 0 0 0\n 36 38 1 0 0 0 0\n 38 39 1 6 0 0 0\n 38 40 1 0 0 0 0\n 40 41 1 1 0 0 0\n 42 43 1 6 0 0 0\n 42 44 1 0 0 0 0\n 46 42 1 0 0 0 0\n 44 45 1 0 0 0 0\n 46 47 1 1 0 0 0\nM END", "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@H]([C@@H]([C@](C)(CO)[C@@H]5CC[C@]43C)O)O)[C@@H]2[C@@H]1O)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O", "formula": "C36H58O11", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "45496d42-c0ae-4439-b511-10c5aa8e4a3d" }, "defined_stereo": 16, "ez_centers": 0, "molecular_weight": "666.8405", "optical_activity": "UNSPECIFIED", "stereo_centers": 16 } ], "definition_level": "COMPLETE", "uuid": "29f40fd2-8c3d-468b-be4d-a9b4d574b4e2", "version": "5", "structure": { "id": "7302437b-b48e-4a21-9b95-aacd879bab0e", "molfile": "\n Marvin 01132105582D \n\n 49 54 0 0 1 0 999 V2000\n 4.1461 -6.4832 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.8607 -6.8954 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.5754 -6.4832 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.5754 -5.6586 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.2899 -5.2463 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.0045 -5.6586 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.7192 -5.2463 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.4338 -4.0095 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.1210 -4.4218 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.2648 -4.8340 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.6940 -4.8340 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.6940 -5.6586 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.9794 -6.0709 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.2648 -5.6586 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.4338 -3.1849 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.1461 -5.6586 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.4315 -6.8954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4484 -7.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2730 -7.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0975 -7.6101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5754 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2899 -6.0709 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0045 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0045 -6.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2899 -6.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7192 -4.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4338 -4.8340 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5502 -4.4218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9794 -4.4218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4087 -4.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1233 -4.8340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4087 -6.0709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9794 -6.8954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5502 -6.0709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -5.6586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1210 -5.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4338 -5.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -4.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8356 -3.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1210 -2.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5332 -2.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7087 -2.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7192 -2.7726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0045 -4.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2899 -4.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7192 -6.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8607 -5.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4315 -5.2463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 15 8 1 0 0 0 0\n 1 16 1 0 0 0 0\n 1 17 1 1 0 0 0\n 2 18 1 6 0 0 0\n 2 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 4 21 1 1 0 0 0\n 5 22 1 6 0 0 0\n 6 23 1 1 0 0 0\n 24 6 1 0 0 0 0\n 3 25 1 1 0 0 0\n 25 24 1 0 0 0 0\n 7 26 1 0 0 0 0\n 8 26 1 0 0 0 0\n 8 27 1 1 0 0 0\n 9 28 1 1 0 0 0\n 10 29 1 6 0 0 0\n 28 29 1 0 0 0 0\n 10 30 1 0 0 0 0\n 11 30 1 0 0 0 0\n 11 31 1 6 0 0 0\n 31 32 1 0 0 0 0\n 12 33 1 1 0 0 0\n 13 34 1 6 0 0 0\n 14 35 1 1 0 0 0\n 28 36 2 0 0 0 0\n 37 9 1 0 0 0 0\n 7 38 1 0 0 0 0\n 38 37 1 0 0 0 0\n 9 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 15 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 1 0 0 0 0\n 15 44 1 6 0 0 0\n 26 45 2 0 0 0 0\n 45 46 1 0 0 0 0\n 46 5 1 0 0 0 0\n 7 47 1 6 0 0 0\n 48 4 1 0 0 0 0\n 16 48 1 0 0 0 0\n 16 49 1 6 0 0 0\nM END", "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)C[C@H]([C@@H]([C@](C)(CO)[C@@H]5CC[C@]43C)O)O)[C@]2([H])[C@@H]1O)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O", "formula": "C36H58O11", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 16, "ez_centers": 0, "molecular_weight": "666.8405", "optical_activity": "UNSPECIFIED", "references": [ "979d77a6-6d9e-4061-a13e-ee7b8bb21287", "54b9f69c-e08d-486b-b2d1-6e01df647202" ], "stereo_centers": 16 }, "unii": "S4A9325KV4" } ] }