{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4b8409d0-dc28-49cb-95bb-0c2e1679a9d5",
          "code": "94-44-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94-44-0",
          "code_system": "CAS",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0",
            "a9c4ab28-e22e-47a4-ab7c-e8b57d67eb85"
          ]
        },
        {
          "uuid": "471e875d-076b-44bd-a0eb-ea3c6ccd7253",
          "code": "C83549",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83549",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "456908a4-c2cb-4d3c-a571-c9b47ab8248b",
          "code": "C025653",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67025653",
          "code_system": "MESH",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "c32cacb3-0774-43f1-bfa2-57313339ffa8",
          "code": "202-332-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.121",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "2bf39686-10fe-47bc-8de0-9fa4503d174e",
          "code": "31767",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/31767/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "b27fe464-8531-485d-be57-ce06594edb3a",
          "code": "m7881",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7881?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "8d68b805-bc6b-4d0b-8793-c996ded976bb",
          "code": "SUB13026MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "8f544622-a742-4b04-980d-810b887a103a",
          "code": "CHEMBL209744",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL209744",
          "code_system": "ChEMBL",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "763ce110-584d-4d56-b3f4-07afa256b47d",
          "code": "7191",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7191",
          "code_system": "PUBCHEM",
          "references": [
            "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0"
          ]
        },
        {
          "uuid": "5abf756e-3284-46bd-4150-f0d903839f4c",
          "code": "DTXSID7046542",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7046542",
          "code_system": "EPA CompTox",
          "references": [
            "4017cc6a-67c8-a2c0-6133-d0334c2c3e37"
          ]
        },
        {
          "uuid": "2f6d1551-8a88-9b74-4956-728042db713b",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ad5f3689-fe55-450e-72ca-7f8c181bed11"
          ]
        },
        {
          "uuid": "485d6715-df6b-ffb6-ae30-94a8c5273252",
          "code": "3379",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3379",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ad5f3689-fe55-450e-72ca-7f8c181bed11"
          ]
        },
        {
          "uuid": "9fa99aea-9e73-4892-b971-d4cd60baed28",
          "code": "S497LCF9C9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "98ea1509-107c-d76b-2af6-80dce1343a57",
          "code": "31268",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31268",
          "code_system": "CHEBI",
          "references": [
            "ad5f3689-fe55-450e-72ca-7f8c181bed11"
          ]
        },
        {
          "uuid": "58f9a53e-c5a3-c5eb-728e-75f7519d824f",
          "code": "100000092407",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c774f0cb-fc5e-4c9f-b5b0-fb9f7cf9ef49"
          ]
        },
        {
          "uuid": "a01e887b-ed28-27a3-24bb-a777b59ecbbf",
          "code": "S497LCF9C9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(S497LCF9C9)",
          "code_system": "DAILYMED",
          "references": [
            "43bc43a8-ba28-82b8-e1cf-ec49c696197e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "caf8b50a-0002-4a9f-8bfa-ed5bf76b6b51",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e66dc8d2-6883-45a0-abcf-4e2314f1de10",
            "refuuid": "38ee7c5a-b1c4-4b84-9f56-f9a50c6c2cdd",
            "name": "Niacin",
            "unii": "2679MF687A",
            "linking_id": "2679MF687A",
            "ref_pname": "Niacin",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cce7cfd8-f712-4722-be81-2c6a76caf313",
          "name": "BENZYL NICOTINATE",
          "stdName": "BENZYL NICOTINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2458039e-1506-46ef-bc3c-8cba4ceaa6cb",
            "eb1b4458-98e4-4db1-aae7-7589b7ebd609",
            "c11968e6-edeb-4e53-bb59-98be10c5813f",
            "35f7d3d5-5e65-4c43-8634-91b87f685f92",
            "9785c220-e027-48d7-8d86-1d8f96da3c14",
            "c3640490-89ef-412d-90ea-d763c21239a1",
            "199f1961-1f69-4639-a450-18178107b032",
            "cb07f2d3-0f5e-4d47-892a-82ab1cbb477d",
            "de327d41-ea99-48fb-bccb-c95de408a248"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9d1c4335-3ce3-4908-9ae2-955a633aa418",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "92d1a60a-dca3-4508-8c8a-dc34bd9860bb",
          "name": "BENZYL NICOTINATE [JAN]",
          "stdName": "BENZYL NICOTINATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3640490-89ef-412d-90ea-d763c21239a1"
          ],
          "display_name": false
        },
        {
          "uuid": "b3dd3cb2-47c2-4014-89a6-801f5cae6fa0",
          "name": "BENZYL NICOTINATE [MART.]",
          "stdName": "BENZYL NICOTINATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb07f2d3-0f5e-4d47-892a-82ab1cbb477d"
          ],
          "display_name": false
        },
        {
          "uuid": "a4ef95d3-636c-400b-ae87-4e9a27617436",
          "name": "Benzyl nicotinate [WHO-DD]",
          "stdName": "BENZYL NICOTINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e98d30a2-e797-16ef-645b-bfdba4b7a047"
          ],
          "display_name": false
        },
        {
          "uuid": "b6c69a64-9091-48e7-a7b5-e8fd55ef04a4",
          "name": "NICOTINIC ACID BENZYL ESTER",
          "stdName": "NICOTINIC ACID BENZYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4fbffa5-c678-4c4f-9167-bd950bb8cfbe",
            "c78cae9e-d62b-4042-b799-c09375fd25a7",
            "0d404777-0c15-46d0-903e-a1e473c3019e"
          ],
          "display_name": false
        },
        {
          "uuid": "220a612b-3e9b-4a02-b6b1-ccb1d7f0a8c9",
          "name": "NICOTINIC ACID BENZYL ESTER [MI]",
          "stdName": "NICOTINIC ACID BENZYL ESTER [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c78cae9e-d62b-4042-b799-c09375fd25a7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2458039e-1506-46ef-bc3c-8cba4ceaa6cb",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c3640490-89ef-412d-90ea-d763c21239a1",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb07f2d3-0f5e-4d47-892a-82ab1cbb477d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c78cae9e-d62b-4042-b799-c09375fd25a7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb1b4458-98e4-4db1-aae7-7589b7ebd609",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4fbffa5-c678-4c4f-9167-bd950bb8cfbe",
          "citation": "rxnorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9785c220-e027-48d7-8d86-1d8f96da3c14",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c1dada5-e623-4a9d-8d6a-a588a9b0d3a0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389726000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4390e9fe-19ec-4886-a5a3-68b47d440d23",
          "citation": "SRS import [S497LCF9C9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S497LCF9C9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389726000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "199f1961-1f69-4639-a450-18178107b032",
          "citation": "BENZYL NICOTINATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de327d41-ea99-48fb-bccb-c95de408a248",
          "citation": "BENZYL NICOTINATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0d404777-0c15-46d0-903e-a1e473c3019e",
          "citation": "NICOTINIC ACID BENZYL ESTER [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35f7d3d5-5e65-4c43-8634-91b87f685f92",
          "citation": "BENZYL NICOTINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c11968e6-edeb-4e53-bb59-98be10c5813f",
          "citation": "BENZYL NICOTINATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4017cc6a-67c8-a2c0-6133-d0334c2c3e37",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94-44-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad5f3689-fe55-450e-72ca-7f8c181bed11",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a9c4ab28-e22e-47a4-ab7c-e8b57d67eb85",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "da869217-f585-2e90-7594-e3e2535a4c7c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e98d30a2-e797-16ef-645b-bfdba4b7a047",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c774f0cb-fc5e-4c9f-b5b0-fb9f7cf9ef49",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "43bc43a8-ba28-82b8-e1cf-ec49c696197e",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1c11eca8-92fb-4273-a6c0-523478ed730e",
          "id": "1c11eca8-92fb-4273-a6c0-523478ed730e",
          "molfile": "\n  Marvin  01132101382D          \n\n 16 17  0  0  0  0            999 V2000\n    2.2577   -6.2066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2628   -7.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9818   -7.4402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6903   -7.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4067   -7.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4119   -8.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1308   -8.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8420   -8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8420   -7.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1231   -7.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5543   -7.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5620   -8.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8508   -8.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1319   -8.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1293   -7.4402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8379   -7.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)COC(=O)c2cccnc2",
          "formula": "C13H11NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "37c6f4eb-6ea4-41d5-89bb-f491b634c9d0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "213.2324",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "40e94402-23a7-478c-b6bb-92a4147cc52c",
      "version": "13",
      "structure": {
        "id": "5d931fe6-29b4-4202-ad30-25ef9d9a48f9",
        "molfile": "\n  Marvin  01132104512D          \n\n 16 17  0  0  0  0            999 V2000\n    2.2628   -7.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5543   -7.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9818   -7.4402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2577   -6.2066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1293   -7.4402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6903   -7.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8379   -7.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4067   -7.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5620   -8.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1319   -8.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1231   -7.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4119   -8.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8508   -8.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1308   -8.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8420   -7.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8420   -8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  7  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  2  0  0  0  0\n 14 12  2  0  0  0  0\n 15 11  1  0  0  0  0\n 16 14  1  0  0  0  0\n  5 10  2  0  0  0  0\n 15 16  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)COC(=O)c2cccnc2",
        "formula": "C13H11NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "213.2324",
        "optical_activity": "NONE",
        "references": [
          "2458039e-1506-46ef-bc3c-8cba4ceaa6cb",
          "4390e9fe-19ec-4886-a5a3-68b47d440d23"
        ],
        "stereo_centers": 0
      },
      "unii": "S497LCF9C9"
    }
  ]
}