{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c69fe9b5-ea80-47fd-9c96-a363ebd4fb10",
          "code": "60568-05-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60568-05-0",
          "code_system": "CAS",
          "references": [
            "b501ab90-f3f4-4aaa-8c85-0189be115096",
            "388df0b3-547b-4e04-97ed-2cedbf8d4dfd"
          ]
        },
        {
          "uuid": "893c7500-a802-47e3-832b-3a1dc93a6a0c",
          "code": "122601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:729",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b501ab90-f3f4-4aaa-8c85-0189be115096"
          ]
        },
        {
          "uuid": "a1e8dd4c-7663-4d82-9098-766502db0662",
          "code": "262-302-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.620",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b501ab90-f3f4-4aaa-8c85-0189be115096"
          ]
        },
        {
          "uuid": "56b80ee8-f208-4682-a2fa-86da604a4060",
          "code": "43359",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/43359",
          "code_system": "PUBCHEM",
          "references": [
            "b501ab90-f3f4-4aaa-8c85-0189be115096"
          ]
        },
        {
          "uuid": "d7578e13-b364-6c1c-3b8a-2d97d5716ca2",
          "code": "DTXSID2024119",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2024119",
          "code_system": "EPA CompTox",
          "references": [
            "98c6ec28-a9b4-2592-0ac6-afd626162105"
          ]
        },
        {
          "uuid": "f54561a6-977d-4642-8ba6-28734c23848c",
          "code": "S3UB8K4YYS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4ffad3a4-a0bc-ee35-e889-af43359cfc80",
          "code": "furmecyclox",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/furmecyclox.html",
          "code_system": "ALANWOOD",
          "references": [
            "2fe0e8c8-1050-1f41-2b8c-7e27d84e4c5e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e475c2ac-5ac3-4704-b11f-553aace0307f",
          "name": "3-FURANCARBOXAMIDE, N-CYCLOHEXYL-N-METHOXY-2,5-DIMETHYL-",
          "stdName": "3-FURANCARBOXAMIDE, N-CYCLOHEXYL-N-METHOXY-2,5-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4548ab5e-4195-42b4-a24f-c1e30e5e1e42",
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d"
          ],
          "display_name": false
        },
        {
          "uuid": "ce335d4b-0e4f-46ff-a05c-530e8a7a595d",
          "name": "BAS-389F",
          "stdName": "BAS-389F",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d",
            "bc0fc34a-f75f-473f-91c2-526b0786610c"
          ],
          "display_name": false
        },
        {
          "uuid": "452482b0-8740-4fa4-8699-64a720842463",
          "name": "CAMPOGRAN",
          "stdName": "CAMPOGRAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4548ab5e-4195-42b4-a24f-c1e30e5e1e42",
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d"
          ],
          "display_name": false
        },
        {
          "uuid": "caae5721-226b-4136-a811-b75c5d87e111",
          "name": "FURMECYCLOX",
          "stdName": "FURMECYCLOX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12579a3f-9ee0-4e8d-9e4f-33f6a77d9b6c",
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d",
            "d1bf50ed-961b-43fa-b2a5-3dc2e646df84",
            "19507576-77aa-4a6d-a758-7344f447ef6c"
          ],
          "display_name": true
        },
        {
          "uuid": "413cd7f4-38b5-4973-b338-0af95f83d993",
          "name": "FURMECYCLOX [ISO]",
          "stdName": "FURMECYCLOX [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d",
            "d1bf50ed-961b-43fa-b2a5-3dc2e646df84"
          ],
          "display_name": false
        },
        {
          "uuid": "4ac98e9b-eba0-4900-b0c5-074249d94d15",
          "name": "FURMETAMID",
          "stdName": "FURMETAMID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4548ab5e-4195-42b4-a24f-c1e30e5e1e42",
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d"
          ],
          "display_name": false
        },
        {
          "uuid": "94e12b79-fd68-4eed-9d61-632d455a65d6",
          "name": "GUS-215",
          "stdName": "GUS-215",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d",
            "89ddcb61-bd6b-4027-b4f0-661ad06ab122"
          ],
          "display_name": false
        },
        {
          "uuid": "db1981d0-af19-4f19-ad67-b623371c51ce",
          "name": "METHYL N-CYCLOHEXYL-2,5-DIMETHYL-3-FUROHYDROXAMATE",
          "stdName": "METHYL N-CYCLOHEXYL-2,5-DIMETHYL-3-FUROHYDROXAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b3f71b3-2463-4b04-8c33-819cfeeb938e",
            "a40caff5-fef6-47b9-b417-61866227334c"
          ],
          "display_name": false
        },
        {
          "uuid": "73f3e98b-184b-442b-9d05-b63e72408f6f",
          "name": "N-CYCLOHEXYL-N-METHOXY-2,5-DIMETHYL-3-FURANCARBOXAMIDE",
          "stdName": "N-CYCLOHEXYL-N-METHOXY-2,5-DIMETHYL-3-FURANCARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a40caff5-fef6-47b9-b417-61866227334c",
            "8bb6fc41-7e4e-4af6-865a-e19287f1c795"
          ],
          "display_name": false
        },
        {
          "uuid": "94d2526a-8952-47e1-98ed-4e9bf8f6333d",
          "name": "XYLIGEN B",
          "stdName": "XYLIGEN B",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4548ab5e-4195-42b4-a24f-c1e30e5e1e42",
            "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "12579a3f-9ee0-4e8d-9e4f-33f6a77d9b6c",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a40caff5-fef6-47b9-b417-61866227334c",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bb6fc41-7e4e-4af6-865a-e19287f1c795",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b3f71b3-2463-4b04-8c33-819cfeeb938e",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1bf50ed-961b-43fa-b2a5-3dc2e646df84",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5cf16d5-9d6c-4ae8-ba0a-d055e58e761d",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4548ab5e-4195-42b4-a24f-c1e30e5e1e42",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc0fc34a-f75f-473f-91c2-526b0786610c",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89ddcb61-bd6b-4027-b4f0-661ad06ab122",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b501ab90-f3f4-4aaa-8c85-0189be115096",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10501bde-dc5c-454f-a980-774bd87ff0fc",
          "citation": "SRS import [S3UB8K4YYS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S3UB8K4YYS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21060f9e-f4eb-471b-a3ff-eaed36642e0a",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19507576-77aa-4a6d-a758-7344f447ef6c",
          "citation": "FURMECYCLOX [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98c6ec28-a9b4-2592-0ac6-afd626162105",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60568-05-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2fe0e8c8-1050-1f41-2b8c-7e27d84e4c5e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "388df0b3-547b-4e04-97ed-2cedbf8d4dfd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4dcdf8ba-964f-444a-9cf0-48bf19608c23",
          "id": "4dcdf8ba-964f-444a-9cf0-48bf19608c23",
          "molfile": "\n  Marvin  01132104042D          \n\n 18 19  0  0  0  0            999 V2000\n    8.2658   -3.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5500   -3.8010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5500   -4.6096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2742   -5.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2742   -5.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0001   -6.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7459   -5.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7459   -4.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9681   -4.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8232   -5.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8232   -5.8712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3294   -4.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5274   -4.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2939   -3.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5443   -3.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9194   -3.1966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5637   -3.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2668   -3.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(C)o1)C(=O)N(C2CCCCC2)OC",
          "formula": "C14H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6c0c8e02-ad40-4180-832a-55fe6652616c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "251.322",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5511cafc-08d7-40a3-947f-02e13712edcd",
      "version": "4",
      "structure": {
        "id": "3aa7e234-99cd-4060-b0f1-726156f24a41",
        "molfile": "\n  Marvin  01132103072D          \n\n 18 19  0  0  0  0            999 V2000\n    6.3294   -4.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8232   -5.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5500   -4.6096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2742   -5.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2742   -5.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0001   -6.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7459   -5.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7459   -4.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9681   -4.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5500   -3.8010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2658   -3.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8232   -5.8712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5274   -4.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2939   -3.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5443   -3.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9194   -3.1966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5637   -3.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2668   -3.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  2 12  2  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n  1 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(c(C)o1)C(=O)N(C2CCCCC2)OC",
        "formula": "C14H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "251.322",
        "optical_activity": "NONE",
        "references": [
          "21060f9e-f4eb-471b-a3ff-eaed36642e0a",
          "10501bde-dc5c-454f-a980-774bd87ff0fc"
        ],
        "stereo_centers": 0
      },
      "unii": "S3UB8K4YYS"
    }
  ]
}