{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0dc87245-f118-4074-bde7-da4940562147",
          "code": "947753-66-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=947753-66-4",
          "code_system": "CAS",
          "references": [
            "750857f8-f565-3970-154c-c90f6613cc9c"
          ]
        },
        {
          "uuid": "1feb1d9c-5563-4443-ab84-ef0335079c1a",
          "code": "1311616",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311616/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8471ed56-88b6-4b11-be52-1c26af4a40a7"
          ]
        },
        {
          "uuid": "48e93942-9e11-4838-8b51-bbad4463354c",
          "code": "66661267",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66661267",
          "code_system": "PUBCHEM",
          "references": [
            "8471ed56-88b6-4b11-be52-1c26af4a40a7"
          ]
        },
        {
          "uuid": "b5c58088-00f0-751f-c2dd-14cb856cabf2",
          "code": "DB11226",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11226",
          "code_system": "DRUG BANK",
          "references": [
            "a0451891-4260-1719-7c7b-7de46deeb57d"
          ]
        },
        {
          "uuid": "68348851-72ae-44a3-80a0-0e21b52749c1",
          "code": "S3KFG6Q5X8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4d1525e0-0d2e-51d2-7375-f77986be32e1",
          "code": "S3KFG6Q5X8",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S3KFG6Q5X8",
          "code_system": "DAILYMED",
          "references": [
            "45ca8460-7f93-e243-6204-216a980977ed"
          ]
        },
        {
          "uuid": "3c5105f9-c383-2b08-f903-86f965698a3e",
          "code": "DTXSID70915314",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70915314",
          "code_system": "EPA CompTox",
          "references": [
            "5d050485-70ca-a9c4-fe3d-1c57b19c0245"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df69996c-528f-477a-a9dc-993ddc71cfbc",
          "name": "(±)-ETHYLHEXYL METHOXYCRYLENE",
          "stdName": "(+/-)-ETHYLHEXYL METHOXYCRYLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e99ac1a-8f48-46ed-abeb-7c12376c24cd",
            "218029c7-dad3-4290-9b06-57d394e535ac"
          ],
          "display_name": false
        },
        {
          "uuid": "8f03c30d-b207-466b-9f0a-cb426d74ef75",
          "name": "2-PROPENOIC ACID, 2-CYANO-3-(4-METHOXYPHENYL)-3-PHENYL-, 2-ETHYLHEXYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-CYANO-3-(4-METHOXYPHENYL)-3-PHENYL-, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e99ac1a-8f48-46ed-abeb-7c12376c24cd",
            "fa7b6a38-ee4d-44d8-8181-94aa90164b7b"
          ],
          "display_name": false
        },
        {
          "uuid": "fd21303e-c49f-420a-8a8c-a4176c9136a4",
          "name": "ETHYLHEXYL METHOXYCRYLENE",
          "stdName": "ETHYLHEXYL METHOXYCRYLENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa14a022-20b9-4e64-b501-80fde628e0a7",
            "4e99ac1a-8f48-46ed-abeb-7c12376c24cd",
            "fe3e110c-7108-436a-a463-0851c02a6a12"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "81cce38f-ed3d-4d59-bb3a-e74fddec19f0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9c8dca95-9383-405c-b884-45089f3bbc3d",
          "name": "ETHYLHEXYL METHOXYCRYLENE, (±)-",
          "stdName": "ETHYLHEXYL METHOXYCRYLENE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e99ac1a-8f48-46ed-abeb-7c12376c24cd",
            "218029c7-dad3-4290-9b06-57d394e535ac"
          ],
          "display_name": false
        },
        {
          "uuid": "ce94fcc7-3f1a-47ef-a7bf-4f00954c7fe1",
          "name": "RX-14180",
          "stdName": "RX-14180",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e99ac1a-8f48-46ed-abeb-7c12376c24cd",
            "fa7b6a38-ee4d-44d8-8181-94aa90164b7b"
          ],
          "display_name": false
        },
        {
          "uuid": "c8ced48e-fae6-48e3-ad00-91c5796a231b",
          "name": "SOLASTAY S1",
          "stdName": "SOLASTAY S1",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa14a022-20b9-4e64-b501-80fde628e0a7",
            "4e99ac1a-8f48-46ed-abeb-7c12376c24cd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fa14a022-20b9-4e64-b501-80fde628e0a7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4e99ac1a-8f48-46ed-abeb-7c12376c24cd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "218029c7-dad3-4290-9b06-57d394e535ac",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa7b6a38-ee4d-44d8-8181-94aa90164b7b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8471ed56-88b6-4b11-be52-1c26af4a40a7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a7193bc-35c8-4fc2-8b42-f6eecb750337",
          "citation": "SRS import [S3KFG6Q5X8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S3KFG6Q5X8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe3e110c-7108-436a-a463-0851c02a6a12",
          "citation": "ETHYLHEXYL METHOXYCRYLENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "750857f8-f565-3970-154c-c90f6613cc9c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a0451891-4260-1719-7c7b-7de46deeb57d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "45ca8460-7f93-e243-6204-216a980977ed",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5d050485-70ca-a9c4-fe3d-1c57b19c0245",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0d37de14-aece-4540-9b18-999063435e73",
          "id": "0d37de14-aece-4540-9b18-999063435e73",
          "molfile": "\n  Marvin  01132100562D          \n\n 29 30  0  0  0  0            999 V2000\n   12.4922   -3.5773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7821   -3.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0644   -3.5858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3498   -4.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6322   -3.5945    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.6322   -2.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9114   -2.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9221   -4.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2046   -3.6032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4946   -4.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4946   -4.8444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7768   -3.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7768   -2.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7768   -1.9626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0622   -4.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0622   -4.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7906   -5.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7906   -6.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0760   -6.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3552   -6.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3552   -5.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3446   -3.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6346   -4.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9139   -3.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9139   -2.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1953   -2.3899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4816   -2.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6238   -2.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3446   -2.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 15 12  2  3  0  0  0\n 13 14  3  0  0  0  0\n 15 16  1  0  0  0  0\n 15 22  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 21  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 29  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 28 25  2  0  0  0  0\n 26 27  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)C(=C(c1ccccc1)c2ccc(cc2)OC)C#N",
          "formula": "C25H29NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31a54e86-9a2b-4270-a3f8-120d1c3a81fe"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "391.5036",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "855815ec-e07e-48ee-bdfd-0438a5753de1",
      "version": "10",
      "structure": {
        "id": "957510cc-6ea1-4ed8-abee-8192a9760eae",
        "molfile": "\n  Marvin  01132107452D          \n\n 29 30  0  0  0  0            999 V2000\n   13.8706   -3.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5848   -3.4582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3022   -3.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0118   -3.4496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7289   -3.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4385   -3.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1557   -3.8487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8699   -3.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5871   -3.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2968   -3.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4385   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7181   -2.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3022   -4.6900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4115   -3.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3209   -2.6642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1535   -3.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4439   -3.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7236   -3.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7236   -2.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4331   -2.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1535   -2.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0054   -2.2370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2921   -2.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8706   -4.6988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5986   -5.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5986   -5.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8844   -6.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1641   -5.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1641   -5.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  3  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  3 13  2  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  3  0  0  0  0\n  1 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 16 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n  1 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  2  0  0  0  0\n 24 29  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)C(=C(c1ccccc1)c2ccc(cc2)OC)C#N",
        "formula": "C25H29NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "391.5036",
        "optical_activity": "( + / - )",
        "references": [
          "fa7b6a38-ee4d-44d8-8181-94aa90164b7b",
          "6a7193bc-35c8-4fc2-8b42-f6eecb750337"
        ],
        "stereo_centers": 1
      },
      "unii": "S3KFG6Q5X8"
    }
  ]
}