{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ce543f95-7978-48ac-8c10-aac5b1512422",
          "code": "9014-90-8",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=9014-90-8",
          "code_system": "CAS",
          "references": [
            "70312bd7-6d2d-442d-9d22-7ea801479db9",
            "d91a09f5-0f42-484a-9263-9a96332b773d"
          ]
        },
        {
          "uuid": "13ba2aca-1cbf-4785-8d6f-5cd484e478d4",
          "code": "31631-25-1",
          "type": "GENERIC (FAMILY)",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31631-25-1",
          "code_system": "CAS",
          "references": [
            "70312bd7-6d2d-442d-9d22-7ea801479db9",
            "8fd6b815-c556-4fcb-b50c-bea5a74e0686"
          ]
        },
        {
          "uuid": "97378b8b-3684-1902-440d-e1755f428b3d",
          "code": "18724656",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18724656",
          "code_system": "PUBCHEM",
          "references": [
            "7fa1aa9f-d682-2c96-c8ac-50b16472e092"
          ]
        },
        {
          "uuid": "4ffa723d-4fcf-4706-9a12-d7615643c66e",
          "code": "S3I05FX666",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7438623b-f39e-48a7-b42f-ce06daf19da6",
          "name": "SODIUM NONOXYNOL SULFATE",
          "stdName": "SODIUM NONOXYNOL SULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ccd5db1c-e3f8-4ddc-aa25-191cc8b02f27",
            "37cbd8f1-5879-478d-9378-4401aae0a8a2"
          ],
          "display_name": false
        },
        {
          "uuid": "e9b82503-f0fb-4f0e-aaf9-8945a9933e92",
          "name": "SODIUM NONOXYNOL-1 SULFATE",
          "stdName": "SODIUM NONOXYNOL-1 SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ccd5db1c-e3f8-4ddc-aa25-191cc8b02f27",
            "e6a59062-9d5f-4c4d-9738-3f4847ace6ad",
            "74712a1b-5101-45de-a5db-b2c756751173"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4de54035-247c-4593-84a0-6de20688712b",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "8fd6b815-c556-4fcb-b50c-bea5a74e0686",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d91a09f5-0f42-484a-9263-9a96332b773d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e6a59062-9d5f-4c4d-9738-3f4847ace6ad",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ccd5db1c-e3f8-4ddc-aa25-191cc8b02f27",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37cbd8f1-5879-478d-9378-4401aae0a8a2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70312bd7-6d2d-442d-9d22-7ea801479db9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b38915de-620f-46c3-bc34-6b03c90065b3",
          "citation": "SRS import [S3I05FX666]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S3I05FX666",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74712a1b-5101-45de-a5db-b2c756751173",
          "citation": "SODIUM NONOXYNOL-1 SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "375a22ce-3ebd-cfc7-65df-b820a7c4f2df",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=9014-90-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7fa1aa9f-d682-2c96-c8ac-50b16472e092",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f6ca1825-0514-46b7-9394-d7bcf725a559",
          "id": "f6ca1825-0514-46b7-9394-d7bcf725a559",
          "molfile": "\n  Marvin  01132112472D          \n\n  1  0  0  0  0  0            999 V2000\n    3.9582   -5.1356    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c4f092cd-3ca6-4d9f-bb59-a9b683082f90"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "535879a1-52e9-4321-878c-11aa05e33691",
          "id": "535879a1-52e9-4321-878c-11aa05e33691",
          "molfile": "\n  Marvin  01132104202D          \n\n 23 23  0  0  0  0            999 V2000\n   18.3756   -7.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6616   -6.7413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9477   -7.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2337   -6.7456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5197   -7.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8057   -6.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0917   -7.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3778   -6.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6638   -7.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9535   -6.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2355   -7.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5193   -6.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5205   -5.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4446   -5.5139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7307   -5.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0167   -5.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0898   -5.9356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4558   -5.4792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1510   -5.1231    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.7436   -5.8001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4558   -4.6981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2337   -5.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9506   -5.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 23  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 22 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 18 21  2  0  0  0  0\n 23 22  1  0  0  0  0\nM  CHG  1  19  -1\nM  END",
          "smiles": "CCCCCCCCCc1ccc(cc1)OCCOS(=O)(=O)[O-]",
          "formula": "C17H27O5S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6783414d-8d75-4f34-82c4-9c8e679fa233"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "343.46",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "25e2c2ce-b153-4bf5-8d96-06ca1f515442",
      "version": "8",
      "structure": {
        "id": "feba5153-9f74-4485-a820-1642d1181642",
        "molfile": "\n  Marvin  01132113112D          \n\n 24 23  0  0  0  0            999 V2000\n    9.4446   -5.5139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7307   -5.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0167   -5.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0898   -5.9356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5193   -6.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2355   -7.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3756   -7.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6616   -6.7413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9477   -7.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2337   -6.7456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5197   -7.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8057   -6.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0917   -7.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3778   -6.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6638   -7.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9535   -6.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9506   -5.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5205   -5.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2337   -5.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4558   -5.4792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7436   -5.8001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4558   -4.6981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1510   -5.1231    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.9582   -5.1356    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n  6 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18  5  2  0  0  0  0\n  1 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n  4 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  1  0  0  0  0\nM  CHG  2  23  -1  24   1\nM  END",
        "smiles": "CCCCCCCCCc1ccc(cc1)OCCOS(=O)(=O)[O-].[Na+]",
        "formula": "C17H27O5S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "366.4498",
        "optical_activity": "NONE",
        "references": [
          "e6a59062-9d5f-4c4d-9738-3f4847ace6ad",
          "b38915de-620f-46c3-bc34-6b03c90065b3"
        ],
        "stereo_centers": 0
      },
      "unii": "S3I05FX666"
    }
  ]
}