{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "11226b67-e04e-4965-999d-93da7f87946f", "code": "40470-68-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=40470-68-6", "code_system": "CAS", "references": [ "754beafb-0bcf-44fd-872b-ba4ebb72fcb8", "6e8ce79d-3e52-4670-9989-1f4821422060" ] }, { "uuid": "40584ef2-0b5e-4a95-b969-1ba53e1e9962", "code": "254-935-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.924", "code_system": "ECHA (EC/EINECS)", "references": [ "754beafb-0bcf-44fd-872b-ba4ebb72fcb8" ] }, { "uuid": "954e41fa-7af7-40fe-ad71-fe7ae7852305", "code": "6441620", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6441620", "code_system": "PUBCHEM", "references": [ "754beafb-0bcf-44fd-872b-ba4ebb72fcb8" ] }, { "uuid": "cccdf02f-1c63-4c19-8cca-7ff284139e6c", "code": "S3EQ1ZHS2A", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ] }, { "uuid": "91f5cd27-955f-0d69-bbcd-a0c8e965d6b3", "code": "DTXSID5068231", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5068231", "code_system": "EPA CompTox", "references": [ "3df87ec8-ead9-27d5-cdff-621215e24700" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f9ecf50b-a723-815b-2d12-3d6f7d10766b", "name": "1,1'-BIPHENYL, 4,4'-BIS(2-(2-METHOXYPHENYL)ETHENYL)-", "stdName": "1,1'-BIPHENYL, 4,4'-BIS(2-(2-METHOXYPHENYL)ETHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false }, { "uuid": "e06377db-6a4e-f5c3-1ab0-1c21aee48706", "name": "1-METHOXY-2-(2-(4-(4-(2-(2-METHOXYPHENYL)ETHENYL)PHENYL)PHENYL)ETHENYL)BENZENE", "stdName": "1-METHOXY-2-(2-(4-(4-(2-(2-METHOXYPHENYL)ETHENYL)PHENYL)PHENYL)ETHENYL)BENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false }, { "uuid": "9795db54-4063-1334-2528-883ae7d6ecb0", "name": "4,4'-BIS(2-(2-METHOXYPHENYL)ETHENYL)-1,1'-BIPHENYL", "stdName": "4,4'-BIS(2-(2-METHOXYPHENYL)ETHENYL)-1,1'-BIPHENYL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false }, { "uuid": "a523c64b-6178-4435-9f52-086897c4abe2", "name": "4,4-BIS(2-METHOXYSTYRYL)BIPHENYL", "stdName": "4,4-BIS(2-METHOXYSTYRYL)BIPHENYL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": true }, { "uuid": "fea978f7-144b-8347-024a-bd4313f4a2b8", "name": "CBS-127", "stdName": "CBS-127", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false }, { "uuid": "ed225ebd-f440-4ba7-b307-d844d195868d", "name": "CSFC-127", "stdName": "CSFC-127", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false }, { "uuid": "000c1a89-5c7a-4256-b2c3-91edacd65650", "name": "FLUORESCENT BRIGHTENER 378", "stdName": "FLUORESCENT BRIGHTENER 378", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false }, { "uuid": "fc865e1f-f091-10c9-a10a-deabf0844ba4", "name": "FLUORESCENT BRIGHTENER FP 127", "stdName": "FLUORESCENT BRIGHTENER FP 127", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false }, { "uuid": "13a21f2b-c042-cda7-fd89-7e855535d4b0", "name": "FP-127", "stdName": "FP-127", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "display_name": false } ], "references": [ { "uuid": "960c667b-5c60-409a-b97e-638e7c9f7606", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "754beafb-0bcf-44fd-872b-ba4ebb72fcb8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392545000, "tags": [ "NOMEN" ] }, { "uuid": "36d43119-e830-affa-c316-5ede1aacd7c5", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=40470-68-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7adc5bc4-48c4-9003-0908-6a39ed7ed64f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6e8ce79d-3e52-4670-9989-1f4821422060", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "3df87ec8-ead9-27d5-cdff-621215e24700", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e69fac71-dcd0-4ea5-92df-129bfdb5863d", "id": "e69fac71-dcd0-4ea5-92df-129bfdb5863d", "molfile": "\n Marvin 01132111562D \n\n 32 35 0 0 0 0 999 V2000\n 10.3479 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9308 -0.7184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3479 -1.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1707 -1.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5879 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1707 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3479 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9308 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1081 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6909 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8681 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4510 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6166 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2111 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6166 -3.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4510 -3.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3768 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9712 -3.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1368 -3.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7197 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8970 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4798 -3.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6571 -3.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2399 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4172 -2.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4172 -4.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2399 -4.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6571 -5.0175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2399 -5.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1368 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9712 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 16 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 17 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 32 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 31 2 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 2 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "COc1ccccc1/C=C/c2ccc(cc2)-c3ccc(cc3)/C=C/c4ccccc4OC", "formula": "C30H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "19eb25dd-ecd9-4d57-add1-c9b89cfdc1b0" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "418.5273", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "836cc4f0-0fc8-48dd-a978-6361fca7feb6", "version": "9", "structure": { "id": "0295d612-f83d-4ed6-8d27-8f5ff1f8808e", "molfile": "\n Marvin 01132100272D \n\n 32 35 0 0 0 0 999 V2000\n 14.9514 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5458 -4.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7114 -4.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2943 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7114 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5458 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7858 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1913 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0257 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4429 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0257 -4.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1913 -4.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2657 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6829 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5056 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9228 -2.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7456 -2.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1628 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7456 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9228 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5056 -1.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9228 -1.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4716 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0544 -4.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2316 -4.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8144 -5.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9917 -5.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5745 -4.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9917 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8144 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2316 -6.2479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8144 -6.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 6 2 0 0 0 0\n 1 7 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 23 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 13 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 2 0 0 0 0\n 16 17 2 0 0 0 0\n 16 21 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 2 0 0 0 0\n 26 27 2 0 0 0 0\n 26 31 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "COc1ccccc1/C=C/c2ccc(cc2)-c3ccc(cc3)/C=C/c4ccccc4OC", "formula": "C30H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "418.5273", "optical_activity": "NONE", "references": [ "960c667b-5c60-409a-b97e-638e7c9f7606", "7adc5bc4-48c4-9003-0908-6a39ed7ed64f" ], "stereo_centers": 0 }, "unii": "S3EQ1ZHS2A" } ] }