{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3a8bab62-6045-408f-bbe6-84e83d693722",
          "code": "119520-05-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119520-05-7",
          "code_system": "CAS",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392",
            "bedd8f12-e4ac-4fdb-9cd4-fbe5806eaddc"
          ]
        },
        {
          "uuid": "43f403d8-6136-42cb-a2a5-31b190e97b20",
          "code": "C74221",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74221",
          "code_system": "NCI_THESAURUS",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "30463e60-84f2-4c50-888e-00b5836cab3a",
          "code": "ZILPATEROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zilpaterol",
          "code_system": "WIKIPEDIA",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "f3874731-40d6-4309-b11a-776737cf3fc6",
          "code": "6349",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6349",
          "code_system": "INN",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "3eed6202-2f64-41ac-a92c-88ff7f25b16a",
          "code": "117827-79-9",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=117827-79-9",
          "code_system": "CAS",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392",
            "db1247c5-3658-4cd3-a73f-bc3bdc512bee"
          ]
        },
        {
          "uuid": "da8711dc-860b-4ffb-aad7-431792d64fad",
          "code": "1727538",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1727538/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "f55ba576-16ab-40b1-bfbb-1621019d0908",
          "code": "m11594",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11594?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "47d8d1c9-986f-448c-b4c4-3feea8eb5da0",
          "code": "SUB00158MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "374df846-165e-41e2-b272-842d983af3e0",
          "code": "21 CFR 556.765",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 556 -- TOLERANCES FOR RESIDUES OF NEW ANIMAL DRUGS IN FOOD|Subpart B--Specific Tolerances for Residues of New Animal Drugs|Sec. 556.765 Zilpaterol.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=556.765",
          "code_system": "CFR",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "a7559864-5c44-48a6-a271-96b52920b47f",
          "code": "CHEMBL2218907",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2218907",
          "code_system": "ChEMBL",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "376a4dfe-6aca-4ed9-8672-bf9e9ba7cc01",
          "code": "3086576",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3086576",
          "code_system": "PUBCHEM",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "122e9b40-7844-41da-9429-4be99f7f8536",
          "code": "21 CFR 558.665",
          "comments": "PART 558--NEW ANIMAL DRUGS FOR USE IN ANIMAL FEEDS|Subpart B--Specific New Animal Drugs for Use in Animal Feeds|Sec. 558.665 Zilpaterol.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=558.665",
          "code_system": "CFR",
          "references": [
            "996c2c40-356d-46ad-b1d6-9f5e4e4a5392"
          ]
        },
        {
          "uuid": "178ea169-f9bd-ba31-a848-8a751b1bc1cd",
          "code": "C319",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Anti-asthmatic Agent[C29712]|Bronchodilator",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C319",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1a6d7fb4-4203-36b3-cab5-8424ba936df1"
          ]
        },
        {
          "uuid": "35001505-5892-4e0c-ad9e-abd8ee456d8b",
          "code": "S384A1Y12J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "19f395ce-1be1-1708-2cfd-8c4aff7c8fd0",
          "code": "DTXSID50904261",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50904261",
          "code_system": "EPA CompTox",
          "references": [
            "1a6d7fb4-4203-36b3-cab5-8424ba936df1"
          ]
        },
        {
          "uuid": "d47328d3-ed92-066a-5e94-7465a28e630a",
          "code": "100000079046",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "18a9f0f6-71f0-8cc6-dc97-32817719e0f7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "39094714-653d-473d-8105-4e3ef201061f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d9ceda77-9d5c-4bae-bacd-f03b0690b7bb",
            "refuuid": "822f7b46-2403-4287-abc0-63c145c48c15",
            "name": "ZILPATEROL",
            "unii": "S384A1Y12J",
            "linking_id": "S384A1Y12J",
            "ref_pname": "ZILPATEROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "219eaffc-9e52-4e87-b7d7-6cad31a731f1",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a1cabb25-1e71-4f9f-b312-06dae8aaa295",
            "refuuid": "75e998c4-e55f-47df-bdbe-ac4c79764488",
            "name": "ZILPATEROL HYDROCHLORIDE",
            "unii": "EX8IEP25JU",
            "linking_id": "EX8IEP25JU",
            "ref_pname": "ZILPATEROL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "202e25b2-000b-483b-a06f-2dc8a5fc20e8",
          "name": "(±)-TRANS-4,5,6,7-TETRAHYDRO-7-HYDROXY-6-(ISOPROPYLAMINO)IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE",
          "stdName": "(+/-)-TRANS-4,5,6,7-TETRAHYDRO-7-HYDROXY-6-(ISOPROPYLAMINO)IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a7c2e9b-2c69-4933-8003-5debe66ced27"
          ],
          "display_name": false
        },
        {
          "uuid": "40072099-3615-42b1-b237-c3c6cd6c1666",
          "name": "IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE, 4,5,6,7-TETRAHYDRO-7-HYDROXY-6-((1-METHYLETHYL)AMINO)-, (6R,7R)-REL-",
          "stdName": "IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE, 4,5,6,7-TETRAHYDRO-7-HYDROXY-6-((1-METHYLETHYL)AMINO)-, (6R,7R)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "726978f5-4e50-4b12-bc5a-683218cc4d3b",
            "7e9b8e1c-085d-4849-965f-8fa11e52eed8"
          ],
          "display_name": false
        },
        {
          "uuid": "221b488f-101e-4b56-a38f-cbda5963f908",
          "name": "IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE, 4,5,6,7-TETRAHYDRO-7-HYDROXY-6-((1-METHYLETHYL)AMINO)-, TRANS-(±)-",
          "stdName": "IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE, 4,5,6,7-TETRAHYDRO-7-HYDROXY-6-((1-METHYLETHYL)AMINO)-, TRANS-(+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "726978f5-4e50-4b12-bc5a-683218cc4d3b",
            "7e9b8e1c-085d-4849-965f-8fa11e52eed8"
          ],
          "display_name": false
        },
        {
          "uuid": "39a0e3b0-0864-420a-91f8-b086e25f670d",
          "name": "REL-(6R,7R)-4,5,6,7-TETRAHYDRO-7-HYDROXY-6-((1-METHYLETHYL)AMINO)IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE",
          "stdName": "REL-(6R,7R)-4,5,6,7-TETRAHYDRO-7-HYDROXY-6-((1-METHYLETHYL)AMINO)IMIDAZO(4,5,1-JK)(1)BENZAZEPIN-2(1H)-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "726978f5-4e50-4b12-bc5a-683218cc4d3b",
            "7e9b8e1c-085d-4849-965f-8fa11e52eed8"
          ],
          "display_name": false
        },
        {
          "uuid": "9dec5130-800d-4db4-89c4-f00dd11fcc65",
          "name": "RU-42173",
          "stdName": "RU-42173",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e704371-e5ca-4a7a-ba69-bb0801c41341",
            "7e9b8e1c-085d-4849-965f-8fa11e52eed8"
          ],
          "display_name": false
        },
        {
          "uuid": "b2ccaec2-a5ff-49b4-97d5-33a45b32af54",
          "name": "TRANS-(±)-ZILPATEROL",
          "stdName": "TRANS-(+/-)-ZILPATEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "726978f5-4e50-4b12-bc5a-683218cc4d3b",
            "7e9b8e1c-085d-4849-965f-8fa11e52eed8"
          ],
          "display_name": false
        },
        {
          "uuid": "8fee7a0d-8587-43b8-80ba-c912d5191ba6",
          "name": "ZILPATEROL",
          "stdName": "ZILPATEROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cad7b9e4-97f4-4a70-9ddf-7bd74458e125",
            "57019ce4-2119-43ac-a3b6-e9f44db2b801",
            "7e9b8e1c-085d-4849-965f-8fa11e52eed8",
            "f728b709-5635-442a-8ad3-f846f84582c6",
            "d9ed3d03-3739-4471-bd56-f7173ecf624b",
            "52a0e658-9d90-4be2-b700-b37b5ea5b468",
            "9d00b494-fb4f-4b88-b4a8-f9415ad97608",
            "87647b21-5bc6-4af6-a178-e1ddc8da3a99"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "332762b0-b25b-4901-b8a8-690b8e6773f0",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3e672b66-cb4d-432c-9ef0-29f4b6e5f511",
          "name": "ZILPATEROL [GREEN BOOK]",
          "stdName": "ZILPATEROL [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57019ce4-2119-43ac-a3b6-e9f44db2b801"
          ],
          "display_name": false
        },
        {
          "uuid": "2e9ae3ae-51d0-434f-b17b-4f742df24192",
          "name": "ZILPATEROL [MI]",
          "stdName": "ZILPATEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e9b8e1c-085d-4849-965f-8fa11e52eed8",
            "52a0e658-9d90-4be2-b700-b37b5ea5b468"
          ],
          "display_name": false
        },
        {
          "uuid": "fe491908-2a98-4763-a40f-351b79277b4f",
          "name": "zilpaterol [INN]",
          "stdName": "ZILPATEROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cad7b9e4-97f4-4a70-9ddf-7bd74458e125"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f728b709-5635-442a-8ad3-f846f84582c6",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1a7c2e9b-2c69-4933-8003-5debe66ced27",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e704371-e5ca-4a7a-ba69-bb0801c41341",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e9b8e1c-085d-4849-965f-8fa11e52eed8",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cad7b9e4-97f4-4a70-9ddf-7bd74458e125",
          "citation": "INN Proposed List 60",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL60.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "52a0e658-9d90-4be2-b700-b37b5ea5b468",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57019ce4-2119-43ac-a3b6-e9f44db2b801",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "726978f5-4e50-4b12-bc5a-683218cc4d3b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "996c2c40-356d-46ad-b1d6-9f5e4e4a5392",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390552000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79b4d6ad-c6cc-4d11-9fa7-4bbbbbf3c1c3",
          "citation": "SRS import [S384A1Y12J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S384A1Y12J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390552000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df513657-08bc-4d4f-8e04-a31a83e54394",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d00b494-fb4f-4b88-b4a8-f9415ad97608",
          "citation": "ZILPATEROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9ed3d03-3739-4471-bd56-f7173ecf624b",
          "citation": "ZILPATEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87647b21-5bc6-4af6-a178-e1ddc8da3a99",
          "citation": "ZILPATEROL [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a6d7fb4-4203-36b3-cab5-8424ba936df1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "db1247c5-3658-4cd3-a73f-bc3bdc512bee",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bedd8f12-e4ac-4fdb-9cd4-fbe5806eaddc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "eb28e32d-fcf0-7602-c96d-cad184223a65",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "18a9f0f6-71f0-8cc6-dc97-32817719e0f7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a4c4b360-3e4f-4d22-9eaf-96d87fe8bf09",
          "id": "a4c4b360-3e4f-4d22-9eaf-96d87fe8bf09",
          "molfile": "\n  Marvin  01132108332D          \n\n 19 21  0  0  0  0            999 V2000\n    0.7078   -1.0854    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.6087   -0.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0876    0.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8601   -0.1111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1279   -0.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6908   -1.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0831   -2.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9113   -2.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3438   -1.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9517   -0.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2282   -0.1376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5755    0.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6039    1.1904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1287   -1.6713    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.4054   -2.4490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4889   -1.3525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1108   -0.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8918   -1.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9515    0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 14  1  1  0  0  0  0\n  1 16  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 12  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n 14  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 15  1  6  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)N[C@@H]1CCn2c3c(cccc3[nH]c2=O)[C@H]1O",
          "formula": "C14H19N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8097b8d4-1b09-4931-b969-97f387be5167"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "261.3201",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "822f7b46-2403-4287-abc0-63c145c48c15",
      "version": "9",
      "structure": {
        "id": "7f208241-b6ec-41ca-ba94-a56680eb2628",
        "molfile": "\n  Marvin  01132106362D          \n\n 19 21  0  0  0  0            999 V2000\n   -2.3438   -1.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9113   -2.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0831   -2.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9517   -0.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5755    0.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2282   -0.1376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6908   -1.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1279   -0.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8601   -0.1111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1287   -1.6713    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.0876    0.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7078   -1.0854    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.6087   -0.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6039    1.1904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4054   -2.4490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4889   -1.3525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1108   -0.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8918   -1.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9515    0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  8  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  1  2  1  0  0  0  0\n  9 11  1  0  0  0  0\n  4  1  2  0  0  0  0\n 10 12  1  0  0  0  0\n  9  5  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 13  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 14  2  0  0  0  0\n  6  4  1  0  0  0  0\n 10 15  1  6  0  0  0\n  2  3  2  0  0  0  0\n 12 16  1  1  0  0  0\n  3  7  1  0  0  0  0\n 16 17  1  0  0  0  0\n  7  8  2  0  0  0  0\n 17 18  1  0  0  0  0\n  4  8  1  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
        "smiles": "CC(C)N[C@@H]1CCn2c3c(cccc3[nH]c2=O)[C@H]1O",
        "formula": "C14H19N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "261.3201",
        "optical_activity": "( + / - )",
        "references": [
          "df513657-08bc-4d4f-8e04-a31a83e54394",
          "79b4d6ad-c6cc-4d11-9fa7-4bbbbbf3c1c3",
          "cad7b9e4-97f4-4a70-9ddf-7bd74458e125"
        ],
        "stereo_centers": 2
      },
      "unii": "S384A1Y12J"
    }
  ]
}