{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5d01172d-2ebc-421d-aadf-5af8cd68bf28",
          "code": "509-84-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=509-84-2",
          "code_system": "CAS",
          "references": [
            "53fd676a-1c7b-4249-8843-26ae03a24758",
            "3d8522d9-2049-43c5-aa8b-eace2116d87c"
          ]
        },
        {
          "uuid": "c76e20fa-1b10-4a69-a640-1085f14161e8",
          "code": "C91044",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C91044",
          "code_system": "NCI_THESAURUS",
          "references": [
            "53fd676a-1c7b-4249-8843-26ae03a24758"
          ]
        },
        {
          "uuid": "abd8b0f6-e556-42d8-8ef3-42caa199b0a2",
          "code": "METETHOHEPTAZINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Metethoheptazine",
          "code_system": "WIKIPEDIA",
          "references": [
            "53fd676a-1c7b-4249-8843-26ae03a24758"
          ]
        },
        {
          "uuid": "574b2e65-a4d6-4407-bc3c-7bae54a54c04",
          "code": "570",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=570",
          "code_system": "INN",
          "references": [
            "53fd676a-1c7b-4249-8843-26ae03a24758"
          ]
        },
        {
          "uuid": "bcbfb9ae-b8f1-4e69-93f9-e65985f1c653",
          "code": "SUB08829MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "53fd676a-1c7b-4249-8843-26ae03a24758"
          ]
        },
        {
          "uuid": "ccaa0bd5-23a3-4b92-92ff-e8797427e02f",
          "code": "CHEMBL2105258",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105258",
          "code_system": "ChEMBL",
          "references": [
            "53fd676a-1c7b-4249-8843-26ae03a24758"
          ]
        },
        {
          "uuid": "62bf3fb2-135b-4ed8-9715-ef083aaf7cd9",
          "code": "176888",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/176888",
          "code_system": "PUBCHEM",
          "references": [
            "53fd676a-1c7b-4249-8843-26ae03a24758"
          ]
        },
        {
          "uuid": "fff1f447-9f5c-8893-d7de-d2dba4171248",
          "code": "C67413",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cb760947-7285-2faf-b6cf-0aa6af1640e8"
          ]
        },
        {
          "uuid": "72bf8034-d664-4067-a253-c65714cfebc6",
          "code": "S36J5ZY2TH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6ca58835-3c5d-b637-f25c-788545cfcf67",
          "code": "100000081224",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3290f0ac-014e-8776-9923-7ec49dda94d9"
          ]
        },
        {
          "uuid": "136b623e-fcbe-9762-a5e5-8d6bfa9190a9",
          "code": "DTXSID30862077",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30862077",
          "code_system": "EPA CompTox",
          "references": [
            "cb760947-7285-2faf-b6cf-0aa6af1640e8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "55a01e74-065f-4030-b165-0f650c8dce63",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d9b29811-9df0-494b-9405-92e3ffd1c427",
            "refuuid": "25fd768a-6411-492d-8147-5d0b85db4115",
            "name": "METETHOHEPTAZINE",
            "unii": "S36J5ZY2TH",
            "linking_id": "S36J5ZY2TH",
            "ref_pname": "METETHOHEPTAZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4d238cb1-4217-4b65-9a54-8ea1ddd94b47",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "32b6e9ee-2633-449b-9604-4ed7921ef5ad"
          ],
          "related_substance": {
            "uuid": "681bb67b-d311-4ecf-9bd1-017fe604890b",
            "refuuid": "7edbb226-d40a-41fd-a241-c2f645cedc74",
            "name": "METETHOHEPTAZINE HYDROCHLORIDE",
            "unii": "UQW847N3PE",
            "linking_id": "UQW847N3PE",
            "ref_pname": "METETHOHEPTAZINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cf06c5a8-1517-4669-8ba8-818e826a442e",
          "name": "HEXAHYDRO-1,3-DIMETHYL-4-PHENYL-AZEPINECARBOXYLIC ACID ETHYL ESTER",
          "stdName": "HEXAHYDRO-1,3-DIMETHYL-4-PHENYL-AZEPINECARBOXYLIC ACID ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88a88af2-7dfa-4843-a8a2-b54487515b2a"
          ],
          "display_name": false
        },
        {
          "uuid": "45adceba-0660-4e6f-9d6f-c6a222dd18f5",
          "name": "METETHOHEPTAZINE",
          "stdName": "METETHOHEPTAZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32b6e9ee-2633-449b-9604-4ed7921ef5ad",
            "88a88af2-7dfa-4843-a8a2-b54487515b2a",
            "7756d3db-2358-4d20-acf2-9d572baa7ef9"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d0c0e8c9-b6f7-45c0-af99-3e852adc75ce",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "4c5eb888-fb80-433f-955f-4aecb8bdeac6",
          "name": "metethoheptazine [INN]",
          "stdName": "METETHOHEPTAZINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32b6e9ee-2633-449b-9604-4ed7921ef5ad"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "88a88af2-7dfa-4843-a8a2-b54487515b2a",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "32b6e9ee-2633-449b-9604-4ed7921ef5ad",
          "citation": "INN Proposed List 5",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL05.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53fd676a-1c7b-4249-8843-26ae03a24758",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ed79b45-cc98-4840-833c-3d97d2727178",
          "citation": "SRS import [S36J5ZY2TH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S36J5ZY2TH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7756d3db-2358-4d20-acf2-9d572baa7ef9",
          "citation": "METETHOHEPTAZINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb760947-7285-2faf-b6cf-0aa6af1640e8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3d8522d9-2049-43c5-aa8b-eace2116d87c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3290f0ac-014e-8776-9923-7ec49dda94d9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dcc03e2e-0a69-47a9-8c02-e165aaeea140",
          "id": "dcc03e2e-0a69-47a9-8c02-e165aaeea140",
          "molfile": "\n  Marvin  01132111272D          \n\n 20 21  0  0  0  0            999 V2000\n    6.4247   -2.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6283   -3.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0377   -3.7936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3771   -4.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1979   -4.6277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8954   -5.2155    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8954   -6.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2504   -6.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4461   -6.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0882   -5.6280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2631   -5.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4461   -4.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2504   -4.7010    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9663   -3.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5884   -5.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5474   -6.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2403   -6.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9746   -6.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0157   -5.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3226   -5.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 13  6  1  0  0  0  0\n  6 15  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 20  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C1(CCCN(C)CC1C)c2ccccc2",
          "formula": "C17H25NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7f39329a-71f1-4573-b05c-4633352cbc7d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "275.3865",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "25fd768a-6411-492d-8147-5d0b85db4115",
      "version": "7",
      "structure": {
        "id": "ca83f357-0550-4583-ad81-c73d48cf597b",
        "molfile": "\n  Marvin  01132110272D          \n\n 20 21  0  0  0  0            999 V2000\n    4.4461   -6.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2504   -6.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8954   -6.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8954   -5.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5884   -5.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5474   -6.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2403   -6.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9746   -6.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0157   -5.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3226   -5.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2504   -4.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9663   -3.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4461   -4.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0882   -5.6280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2631   -5.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3771   -4.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1979   -4.6277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0377   -3.7936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6283   -3.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4247   -2.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n 11  4  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n  1 14  1  0  0  0  0\n  4 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C1(CCCN(C)CC1C)c2ccccc2",
        "formula": "C17H25NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "275.3865",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7ed79b45-cc98-4840-833c-3d97d2727178",
          "88a88af2-7dfa-4843-a8a2-b54487515b2a",
          "32b6e9ee-2633-449b-9604-4ed7921ef5ad"
        ],
        "stereo_centers": 2
      },
      "unii": "S36J5ZY2TH"
    }
  ]
}