{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6bc1b2d9-10ae-4823-a77f-55d12cb83055",
          "code": "201-480-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.346",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac"
          ]
        },
        {
          "uuid": "05ce8ad4-18a0-41f5-9661-f8e6dd8cbcbd",
          "code": "222284",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/222284",
          "code_system": "PUBCHEM",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac"
          ]
        },
        {
          "uuid": "025d93c7-cd47-4698-b7f7-06a4cec15291",
          "code": "83-46-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=83-46-5",
          "code_system": "CAS",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac",
            "2bf54988-0b2a-462e-b477-0bf72313a86a"
          ]
        },
        {
          "uuid": "a832e8f1-9bee-4803-a344-400f2a72f680",
          "code": "C63662",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63662",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac"
          ]
        },
        {
          "uuid": "04ef0f31-c294-4f4c-b544-11c7fca3110e",
          "code": "BETA-SITOSTEROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Beta-Sitosterol",
          "code_system": "WIKIPEDIA",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac"
          ]
        },
        {
          "uuid": "1963f3b8-61d9-4dbc-b849-879a8dd5d56f",
          "code": "5779-62-4",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5779-62-4",
          "code_system": "CAS",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac",
            "b249f06e-847c-45a8-a450-a80096b51d0c"
          ]
        },
        {
          "uuid": "45b2190d-4760-48f2-804b-488e250928b5",
          "code": "47070",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/47070/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac"
          ]
        },
        {
          "uuid": "65b6db8a-7ca2-4347-b5b5-0e64c8cbc9c2",
          "code": "m9964",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9964?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac"
          ]
        },
        {
          "uuid": "5c0557a9-66ac-412f-b80b-071bd4ba7ab3",
          "code": "SUB27060",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a5a957dc-541f-43e8-be93-de50b928aaac"
          ]
        },
        {
          "uuid": "69ab462f-560c-a404-8001-e872a8d120fe",
          "code": "8003-23-4",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=8003-23-4",
          "code_system": "CAS",
          "references": [
            "2bf54988-0b2a-462e-b477-0bf72313a86a"
          ]
        },
        {
          "uuid": "08c32c77-74ee-7cf2-9e40-0f84dcdb4ff8",
          "code": "15764-35-9",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15764-35-9",
          "code_system": "CAS",
          "references": [
            "2bf54988-0b2a-462e-b477-0bf72313a86a"
          ]
        },
        {
          "uuid": "2ed84f41-3701-701e-de56-3cf8b1a7393d",
          "code": "182512-23-8",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=182512-23-8",
          "code_system": "CAS",
          "references": [
            "2bf54988-0b2a-462e-b477-0bf72313a86a"
          ]
        },
        {
          "uuid": "b84206c4-9837-cc02-fcef-bc246b6af662",
          "code": "76772-70-8",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76772-70-8",
          "code_system": "CAS",
          "references": [
            "2bf54988-0b2a-462e-b477-0bf72313a86a"
          ]
        },
        {
          "uuid": "ce660a99-89ea-967f-6fc0-10b0cbc7c9d5",
          "code": "DTXSID5022481",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5022481",
          "code_system": "EPA CompTox",
          "references": [
            "492758a0-83d6-9126-63a2-366ed5027c19"
          ]
        },
        {
          "uuid": "3e3228bf-c469-9072-c49d-de1bd7ab80bc",
          "code": "C68437",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Lipid[C2317]|Dietary Steroid[C68341]|Dietary Sterol[C68342]|Phytosterol[C28178]|Unsaturated Phytosterol",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68437",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fe69e013-f0ea-cc3a-b322-755b5af37c07"
          ]
        },
        {
          "uuid": "4e950eb4-2e88-357d-7386-dc9baf1fe2e5",
          "code": "75741-9",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Beta sitosterol [Mass/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/75741-9/",
          "code_system": "LOINC",
          "references": [
            "fe69e013-f0ea-cc3a-b322-755b5af37c07"
          ]
        },
        {
          "uuid": "3dce734b-116e-99a6-66b9-4c72ecca9012",
          "code": "1062 (Number of products:256)",
          "comments": "Dietary Supplement Label Database|Botanical|Beta Sitosterol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1062&item=Beta Sitosterol",
          "code_system": "DSLD",
          "references": [
            "fe69e013-f0ea-cc3a-b322-755b5af37c07"
          ]
        },
        {
          "uuid": "e58196a0-1ad8-fb2f-79e0-cfe80452a383",
          "code": "2256 (Number of products:9)",
          "comments": "Dietary Supplement Label Database|TBD|Beta-Sitosterol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2256&item=Beta-Sitosterol",
          "code_system": "DSLD",
          "references": [
            "fe69e013-f0ea-cc3a-b322-755b5af37c07"
          ]
        },
        {
          "uuid": "3d763d71-3570-21ce-41a4-8bb8dd5f479f",
          "code": "DB14038",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB14038",
          "code_system": "DRUG BANK",
          "references": [
            "fe69e013-f0ea-cc3a-b322-755b5af37c07"
          ]
        },
        {
          "uuid": "b27aa943-dc13-40dd-9386-58db3e17f021",
          "code": "S347WMO6M4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f948042f-c970-9b52-dd1f-c8b1e3bf3723",
          "code": "1612947",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1612947",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "fe69e013-f0ea-cc3a-b322-755b5af37c07"
          ]
        },
        {
          "uuid": "62502a1d-9f17-cdf5-56fd-e5f52fae6cc3",
          "code": "27693",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27693",
          "code_system": "CHEBI",
          "references": [
            "fe69e013-f0ea-cc3a-b322-755b5af37c07"
          ]
        },
        {
          "uuid": "3bdb841b-71ec-eea4-20e8-31a6985273ea",
          "code": "100000090258",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ce4e8ae3-db1c-2d60-cbc4-e1fdc02aa5ff"
          ]
        },
        {
          "uuid": "02731da1-24be-6a6d-7139-5c008113d3f0",
          "code": "18173",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=18173",
          "code_system": "NSC",
          "references": [
            "39ae600f-4e43-0060-77d6-95caa1e9196e"
          ]
        },
        {
          "uuid": "b5c4f515-a8b7-6cde-04f6-eca88e025ffd",
          "code": "49083",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=49083",
          "code_system": "NSC",
          "references": [
            "39ae600f-4e43-0060-77d6-95caa1e9196e"
          ]
        },
        {
          "uuid": "48577ab1-154f-aac7-2504-5d8a283f2916",
          "code": "8096",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8096",
          "code_system": "NSC",
          "references": [
            "39ae600f-4e43-0060-77d6-95caa1e9196e"
          ]
        },
        {
          "uuid": "4c878ae0-82d7-0217-fabd-1be9247bc11a",
          "code": "S347WMO6M4",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S347WMO6M4",
          "code_system": "DAILYMED",
          "references": [
            "6b663557-6988-efbd-ad3b-77c1aa0a82ba"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "91940e21-69b4-485e-a902-ba1cb33082dc",
          "amount": {
            "uuid": "7cb77bf5-d524-42ba-80f3-5f29a743d794"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a8f7e8e0-4db6-4d02-a25b-5fea038a185d",
            "refuuid": "81072a55-5bfd-4738-ab96-65203ada607d",
            "name": "β-sitosterol",
            "unii": "S347WMO6M4",
            "linking_id": "S347WMO6M4",
            "ref_pname": "β-sitosterol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6d9a5e98-66e4-4f80-93b3-db3c38c49d54",
          "amount": {
            "uuid": "f11f85a8-3deb-4791-88a5-2f6063f2a445"
          },
          "comments": "CALENDULA OFFICINALIS FLOWER terpenoid",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "5a1e3f99-5a65-4ef5-945f-5f5021476755"
          ],
          "related_substance": {
            "uuid": "b9fe1111-2bc2-4cd6-910f-90a37d2d3b5a",
            "refuuid": "e2dbbdeb-f16f-4daa-8570-a3f703139cb9",
            "name": "CALENDULA OFFICINALIS FLOWER",
            "unii": "P0M7O4Y7YD",
            "linking_id": "P0M7O4Y7YD",
            "ref_pname": "CALENDULA OFFICINALIS FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a5daa812-786a-48c6-bd93-e5ccc8a90faa",
          "amount": {
            "uuid": "432889a7-7dc7-4c92-90f7-a43fc5da019d"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "4575605f-784f-46e9-984b-f1906134ad97"
          ],
          "related_substance": {
            "uuid": "bc2cdfc1-6a36-4f6b-b7e4-753b551e72aa",
            "refuuid": "6f4c446b-8b2d-4b3a-b5e4-124bd57ca28a",
            "name": "ARCTIUM LAPPA ROOT",
            "unii": "597E9BI3Z3",
            "linking_id": "597E9BI3Z3",
            "ref_pname": "ARCTIUM LAPPA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "573a8901-bc39-4bbd-ab7a-d771de4f623e",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "4575605f-784f-46e9-984b-f1906134ad97"
          ],
          "related_substance": {
            "uuid": "13059eb6-7270-415b-adc6-0bf38a2f4da0",
            "refuuid": "f83ae2dd-51b1-4ee2-8394-545f4739ed43",
            "name": "EUPATORIUM PERFOLIATUM WHOLE",
            "unii": "0LMC25OLZY",
            "linking_id": "0LMC25OLZY",
            "ref_pname": "EUPATORIUM PERFOLIATUM WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a7152c2c-310a-4a60-8ad8-6b4ad26664c7",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "e3be0fe7-f821-4d57-a6ac-0c1f14210504"
          ],
          "related_substance": {
            "uuid": "9133ac09-835a-4cc8-954f-6ac07e2ad8e7",
            "refuuid": "d817b973-d348-4e82-a90e-43f268c93597",
            "name": "IRIS VERSICOLOR ROOT",
            "unii": "X43D4L3DQC",
            "linking_id": "X43D4L3DQC",
            "ref_pname": "IRIS VERSICOLOR ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c1c70ae-8b92-4de2-a810-afc156853de3",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "938935ad-acd6-4d49-aa92-06b6807a2dac"
          ],
          "related_substance": {
            "uuid": "bad420ad-69fa-4488-b01a-a256d57b3b61",
            "refuuid": "d83c3292-d70d-4b1e-b922-705b8ce4f17b",
            "name": "PAEONIA X SUFFRUTICOSA ROOT",
            "unii": "7M7E9A2C8J",
            "linking_id": "7M7E9A2C8J",
            "ref_pname": "PAEONIA X SUFFRUTICOSA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "57345fef-073a-4ad5-abdc-abd977fc0d31",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "5a1e3f99-5a65-4ef5-945f-5f5021476755"
          ],
          "related_substance": {
            "uuid": "a91b1ddc-3ac9-4049-bfb0-333f37fdd39e",
            "refuuid": "2f00e021-a109-40d1-bf86-43b69127d5f4",
            "name": "CENTAURIUM ERYTHRAEA WHOLE",
            "unii": "T0N9DND3W1",
            "linking_id": "T0N9DND3W1",
            "ref_pname": "CENTAURIUM ERYTHRAEA WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8db66548-209e-438a-ad2c-ca065c1d1625",
          "amount": {
            "uuid": "8162051d-b412-4ba3-a1ed-63b36f255f1e"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "6c3be513-3f63-48ac-b737-db6ec05bd6df",
            "refuuid": "340e70c5-4426-43ba-b88f-e257287e0b39",
            "name": "COMFREY ROOT",
            "unii": "M9VVZ08EKQ",
            "linking_id": "M9VVZ08EKQ",
            "ref_pname": "COMFREY ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "927cfcfc-8e0b-4eb0-b30e-6b4865e1c8d0",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "4f3c6e67-c539-47f7-9374-aade9a7bab84"
          ],
          "related_substance": {
            "uuid": "7b582bef-ef86-4f96-b59b-2f829c8891a4",
            "refuuid": "dcdc662c-132a-46f6-b2a5-3d5ad265f895",
            "name": "COMFREY LEAF",
            "unii": "DG4F8T839X",
            "linking_id": "DG4F8T839X",
            "ref_pname": "COMFREY LEAF",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2debaa46-91cd-4d78-b9c8-442882f6c7fd",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "4f3c6e67-c539-47f7-9374-aade9a7bab84"
          ],
          "related_substance": {
            "uuid": "23d91766-3c72-409f-a59d-1ae34e48c8cc",
            "refuuid": "4970c3f6-62a4-4374-856c-03a20cc08401",
            "name": "VIBURNUM OPULUS BARK",
            "unii": "T1UG6H6805",
            "linking_id": "T1UG6H6805",
            "ref_pname": "VIBURNUM OPULUS BARK",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a658de41-a89f-485f-9957-409b48ff5651",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "cc9a5c4b-11a7-a3cd-f1d2-e7bb74b7afcc"
          ],
          "related_substance": {
            "uuid": "84ea79c7-d357-4a4a-a98b-1c3c5f30b636",
            "refuuid": "fd7d71f2-144e-409f-a396-9050f38aef8f",
            "name": "DIOSCOREA POLYSTACHYA TUBER",
            "unii": "T6RBU9VD4G",
            "linking_id": "T6RBU9VD4G",
            "ref_pname": "DIOSCOREA POLYSTACHYA TUBER",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "04ef5364-7790-45e2-a8cc-72db14d0b31b",
          "name": "(3.BETA.)-STIGMAST-5-EN-3-OL",
          "stdName": "(3.BETA.)-STIGMAST-5-EN-3-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "fa2ff533-1b2c-4ee6-974f-aa37c7c43d74",
          "name": ".ALPHA.-DIHYDROFUCOSTEROL",
          "stdName": ".ALPHA.-DIHYDROFUCOSTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "04bca379-f3f0-41a2-8602-0e6a4ccdfb00",
          "name": ".ALPHA.-PHYTOSTEROL",
          "stdName": ".ALPHA.-PHYTOSTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "9ef50c1d-1ef1-4051-a213-59da80adb4fc"
          ],
          "display_name": false
        },
        {
          "uuid": "b13e8df0-a98d-40a8-9435-3170164c0b72",
          "name": ".BETA.-SITOSTEROL (CONSTITUENT OF ECHINACEA ANGUSTIFOLIA ROOT, ECHINACEA PALLIDA ROOT, ECHINACEA PURPUREA ROOT AND ECHINACEA PURPUREA AERIAL PARTS) [DSC]",
          "stdName": ".BETA.-SITOSTEROL (CONSTITUENT OF ECHINACEA ANGUSTIFOLIA ROOT, ECHINACEA PALLIDA ROOT, ECHINACEA PURPUREA ROOT AND ECHINACEA PURPUREA AERIAL PARTS) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "626e4d31-f846-4339-b9cc-3d1b33efd342"
          ],
          "display_name": false
        },
        {
          "uuid": "f2c03434-1644-4d6b-8b97-6671e4677f57",
          "name": ".BETA.-SITOSTEROL (CONSTITUENT OF PYGEUM) [DSC]",
          "stdName": ".BETA.-SITOSTEROL (CONSTITUENT OF PYGEUM) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "97099e2c-755a-4197-88dc-4f825ac5a679"
          ],
          "display_name": false
        },
        {
          "uuid": "35080cf8-d576-409d-aebf-e31e838e0ac5",
          "name": ".BETA.-SITOSTEROL [MI]",
          "stdName": ".BETA.-SITOSTEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "d6f9d7c1-cf5c-476a-bac9-3c3ad292f8fb"
          ],
          "display_name": false
        },
        {
          "uuid": "ddde8975-304d-4afd-a82e-d427db5a8b63",
          "name": ".DELTA.(SUP 5)-STIGMASTEN-3.BETA.-OL",
          "stdName": ".DELTA.(SUP 5)-STIGMASTEN-3.BETA.-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "9ef50c1d-1ef1-4051-a213-59da80adb4fc"
          ],
          "display_name": false
        },
        {
          "uuid": "60107b7d-9f81-476b-a253-59a44597246b",
          "name": "22,23-DIHYDROSTIGMASTEROL",
          "stdName": "22,23-DIHYDROSTIGMASTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "9ef50c1d-1ef1-4051-a213-59da80adb4fc"
          ],
          "display_name": false
        },
        {
          "uuid": "cd9e9f8b-78c8-4524-a1af-45534b2fb3c8",
          "name": "24.BETA.-ETHYL-.DELTA.(SUP 5)-CHOLESTEN-3.BETA.-OL",
          "stdName": "24.BETA.-ETHYL-.DELTA.(SUP 5)-CHOLESTEN-3.BETA.-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "9ef50c1d-1ef1-4051-a213-59da80adb4fc"
          ],
          "display_name": false
        },
        {
          "uuid": "232f019e-b010-4c7c-978e-e5eb8451695c",
          "name": "AZUPROSTAT",
          "stdName": "AZUPROSTAT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "197c1bf5-120c-49db-bf7b-27829673cccb"
          ],
          "display_name": false
        },
        {
          "uuid": "23e92b60-372e-45e5-88d2-87ebc24fe06b",
          "name": "BETA SITOSTEROL",
          "stdName": "BETA SITOSTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "87dc8b4e-679b-4fef-ba2a-b7a0cd65d07a",
            "f7dab022-0cc9-4bf0-814a-f5219e04066f",
            "118d10c7-a213-40a2-b9be-436f3de6afa6"
          ],
          "display_name": false
        },
        {
          "uuid": "d646aef3-bacc-4d46-a273-859085671207",
          "name": "BETA SITOSTEROL [VANDF]",
          "stdName": "BETA SITOSTEROL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "87dc8b4e-679b-4fef-ba2a-b7a0cd65d07a"
          ],
          "display_name": false
        },
        {
          "uuid": "0ce49397-ac4e-4d9d-b856-877b2dd208bb",
          "name": "BETA-SISTOSTEROL",
          "stdName": "BETA-SISTOSTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "4696cc54-cf7c-46e2-bc4a-8af7b2f47cbe"
          ],
          "display_name": false
        },
        {
          "uuid": "f2c860cf-b571-414d-9b2c-700eb7633708",
          "name": "BETA-SITOSTEROL",
          "stdName": "BETA-SITOSTEROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "15bd49c1-b38f-4629-8b8c-10d9216700b9",
            "d74b75ef-9295-4cdb-aad5-21bc9400972e",
            "90bd0d35-e7ab-4255-ab42-9f09b09e28e5",
            "a296a5e2-59c1-408f-84ba-916ebd530095",
            "cd75310c-0945-40e6-a6fb-fbc62e52bc59"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "180e46e2-1d62-425f-af62-08f683b4b4bb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4a8438f6-1125-4e42-a8f6-51809e1cd2c8",
          "name": "BETA-SITOSTEROL (CONSTITUENT OF SAW PALMETTO) [DSC]",
          "stdName": "BETA-SITOSTEROL (CONSTITUENT OF SAW PALMETTO) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "97099e2c-755a-4197-88dc-4f825ac5a679"
          ],
          "display_name": false
        },
        {
          "uuid": "25ba844e-faa4-411a-8f6b-aa96fa2a29a7",
          "name": "BETA-SITOSTEROL (CONSTITUENT OF STINGING NETTLE) [DSC]",
          "stdName": "BETA-SITOSTEROL (CONSTITUENT OF STINGING NETTLE) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "97099e2c-755a-4197-88dc-4f825ac5a679"
          ],
          "display_name": false
        },
        {
          "uuid": "a08b6928-58d2-43c7-9898-1083e3682858",
          "name": "BETA-SITOSTEROL [USP-RS]",
          "stdName": "BETA-SITOSTEROL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "d74b75ef-9295-4cdb-aad5-21bc9400972e"
          ],
          "display_name": false
        },
        {
          "uuid": "1278deeb-1a68-4328-b8f8-7888ce0f36b3",
          "name": "BETAPROST",
          "stdName": "BETAPROST",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "197c1bf5-120c-49db-bf7b-27829673cccb"
          ],
          "display_name": false
        },
        {
          "uuid": "c3661df8-16f8-24b9-529a-8d45b3ab1661",
          "name": "Beta-sitosterol [WHO-DD]",
          "stdName": "BETA-SITOSTEROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d47ec5b6-ce56-d468-7dac-1d92c396f636"
          ],
          "display_name": false
        },
        {
          "uuid": "de1e8240-0c2c-416d-b01c-d982e77f0eff",
          "name": "CINCHOL",
          "stdName": "CINCHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "9ef50c1d-1ef1-4051-a213-59da80adb4fc"
          ],
          "display_name": false
        },
        {
          "uuid": "66f9627c-c51d-4ee5-a8ba-b181097153a7",
          "name": "CUPREOL",
          "stdName": "CUPREOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "9ef50c1d-1ef1-4051-a213-59da80adb4fc"
          ],
          "display_name": false
        },
        {
          "uuid": "3e20c77a-f611-4a0d-8249-a083346fc641",
          "name": "HARZOL",
          "stdName": "HARZOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "7ba1fa99-04c3-4998-b3a5-91cdafd4b237",
          "name": "NSC-18173",
          "stdName": "NSC-18173",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "197c1bf5-120c-49db-bf7b-27829673cccb"
          ],
          "display_name": false
        },
        {
          "uuid": "fd7c1a30-0b69-4468-9463-0f65f3ed8ffd",
          "name": "NSC-49083",
          "stdName": "NSC-49083",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "197c1bf5-120c-49db-bf7b-27829673cccb"
          ],
          "display_name": false
        },
        {
          "uuid": "db0a6a0a-4582-499a-b33a-dac28c9d77de",
          "name": "NSC-8096",
          "stdName": "NSC-8096",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "9d99bcd4-d184-43b5-a262-8b7572067138"
          ],
          "display_name": false
        },
        {
          "uuid": "1d1779ff-fe06-42da-a1cd-0e82016168e5",
          "name": "PROSTASAL",
          "stdName": "PROSTASAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "98cd0c92-6d44-4e2b-821b-6adb17d20881",
          "name": "QUEBRACHOL",
          "stdName": "QUEBRACHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "77b9c6be-249f-4c0d-993f-25faaa946975",
          "name": "RHAMNOL",
          "stdName": "RHAMNOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "389fc3f0-665a-4ec5-ae97-ffd3a94228d7",
          "name": "SITOSTERIN",
          "stdName": "SITOSTERIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "b0d22750-78b8-448c-bef3-64d8b4f22a5b",
          "name": "SITOSTEROL [MART.]",
          "stdName": "SITOSTEROL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c51c744-fd5a-497d-9cbe-bd6726291c13"
          ],
          "display_name": false
        },
        {
          "uuid": "26b9c166-f4c4-4aa6-b863-2ded41a36b1b",
          "name": "SITOSTEROL, .BETA.",
          "stdName": "SITOSTEROL, .BETA.",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "a5fa3513-5f85-41af-8c17-2a6295fda6ba"
          ],
          "display_name": false
        },
        {
          "uuid": "4bec90d2-ab7e-417b-bd62-ff9d4774378f",
          "name": "SITOSTEROL, BETA",
          "stdName": "SITOSTEROL, BETA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "a5fa3513-5f85-41af-8c17-2a6295fda6ba"
          ],
          "display_name": false
        },
        {
          "uuid": "ef6a559b-8c66-41ae-bf6b-18b2b0975e35",
          "name": "SITOSTEROL, BETA-",
          "stdName": "SITOSTEROL, BETA-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "5e60b133-58a5-4ed2-9506-9c9e277721c2"
          ],
          "display_name": false
        },
        {
          "uuid": "9864060f-1113-46ab-8dd4-1ebc534d6fcb",
          "name": "SKF 14463",
          "stdName": "SKF 14463",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "197c1bf5-120c-49db-bf7b-27829673cccb"
          ],
          "display_name": false
        },
        {
          "uuid": "f1fe9eed-0a15-4060-ac42-058531620614",
          "name": "β-sitosterol",
          "stdName": ".BETA.-SITOSTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
            "791b8024-bd40-48bd-870e-d584cb34c364",
            "9ef50c1d-1ef1-4051-a213-59da80adb4fc",
            "d6f9d7c1-cf5c-476a-bac9-3c3ad292f8fb"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "9ef50c1d-1ef1-4051-a213-59da80adb4fc",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "beadc701-b17f-4c6a-86ca-f1c9c7c39245",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7dab022-0cc9-4bf0-814a-f5219e04066f",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e60b133-58a5-4ed2-9506-9c9e277721c2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90bd0d35-e7ab-4255-ab42-9f09b09e28e5",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c51c744-fd5a-497d-9cbe-bd6726291c13",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6f9d7c1-cf5c-476a-bac9-3c3ad292f8fb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd75310c-0945-40e6-a6fb-fbc62e52bc59",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4696cc54-cf7c-46e2-bc4a-8af7b2f47cbe",
          "citation": "http://www.proenutrition.com/es/linea-salud--bienestar/373-esteroles-vegetales-beta-sistosterol.html",
          "url": "http://www.proenutrition.com/es/linea-salud--bienestar/373-esteroles-vegetales-beta-sistosterol.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d74b75ef-9295-4cdb-aad5-21bc9400972e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87dc8b4e-679b-4fef-ba2a-b7a0cd65d07a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d99bcd4-d184-43b5-a262-8b7572067138",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88c67753-867f-4ae8-9733-baac6a002ca8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97099e2c-755a-4197-88dc-4f825ac5a679",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "626e4d31-f846-4339-b9cc-3d1b33efd342",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "197c1bf5-120c-49db-bf7b-27829673cccb",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a5fa3513-5f85-41af-8c17-2a6295fda6ba",
          "citation": "cfsan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5a957dc-541f-43e8-be93-de50b928aaac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389682000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a1e3f99-5a65-4ef5-945f-5f5021476755",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4575605f-784f-46e9-984b-f1906134ad97",
          "citation": "HERBAL MEDICINES 4TH ED 2013",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9f21e0b-31d5-470f-ab52-3e354cb0b02d",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3be0fe7-f821-4d57-a6ac-0c1f14210504",
          "citation": "HERBAL MEDICINES 3RD ED 2007",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "938935ad-acd6-4d49-aa92-06b6807a2dac",
          "citation": "LIN, HC ET AL, TWO NOVEL COMPOUNDS FROM PAEONIA SUFFRUCTICOSA., JOURNAL OF NATURAL PRODUCTS, 61(3)343-346,1998",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/np9704258",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f3c6e67-c539-47f7-9374-aade9a7bab84",
          "citation": "HERBAL MEDICINES 4TH ED",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6caf675-60cf-456f-9e2e-91bea5705af0",
          "citation": "SRS import [S347WMO6M4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S347WMO6M4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389682000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25882198-5029-4884-b841-0517c09b3c85",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "791b8024-bd40-48bd-870e-d584cb34c364",
          "citation": ".BETA.-SITOSTEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a296a5e2-59c1-408f-84ba-916ebd530095",
          "citation": "BETA-SITOSTEROL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15bd49c1-b38f-4629-8b8c-10d9216700b9",
          "citation": "BETA-SITOSTEROL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "118d10c7-a213-40a2-b9be-436f3de6afa6",
          "citation": "BETA SITOSTEROL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "492758a0-83d6-9126-63a2-366ed5027c19",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=83-46-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cc9a5c4b-11a7-a3cd-f1d2-e7bb74b7afcc",
          "citation": "HMC",
          "doc_type": "USP HERBAL MEDICINES COMPENDIUM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "fe69e013-f0ea-cc3a-b322-755b5af37c07",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9a0a7e87-a7b5-4c32-b4fd-019b441a1fc2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "05c0294a-cca1-4567-ab5f-5cf022bd663e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ea2a5c0d-51f9-494a-987b-a09fc71e9d61",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6c81792e-41ac-4fe1-bdcf-cb8ae6ebf8dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b249f06e-847c-45a8-a450-a80096b51d0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2bf54988-0b2a-462e-b477-0bf72313a86a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6b663557-6988-efbd-ad3b-77c1aa0a82ba",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "39ae600f-4e43-0060-77d6-95caa1e9196e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d47ec5b6-ce56-d468-7dac-1d92c396f636",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ce4e8ae3-db1c-2d60-cbc4-e1fdc02aa5ff",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "00cb33cd-e186-48a7-b456-5ee5bb3fb493",
          "id": "00cb33cd-e186-48a7-b456-5ee5bb3fb493",
          "molfile": "\n  Marvin  01132100212D          \n\n 30 33  0  0  1  0            999 V2000\n   10.3958   -3.9712    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.9516   -4.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6787   -5.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5713   -4.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4390   -4.9628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6147   -5.1289    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.0587   -4.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3417   -5.9233    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.0613   -6.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0613   -7.1369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6436   -7.1369    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.9448   -7.5462    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.9448   -8.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2458   -8.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5479   -8.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8490   -8.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1295   -8.3499    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3957   -8.7636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1295   -7.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8490   -7.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5479   -7.5462    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.5479   -6.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2459   -7.1370    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.2459   -6.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9448   -5.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6436   -6.3334    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.4670   -5.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6688   -3.1721    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4931   -3.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1127   -2.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1 28  1  6  0  0  0\n  3  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  1  0  0  0\n 26  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 12 11  1  0  0  0  0\n 11 26  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 23  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 21 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\n 23 21  1  0  0  0  0\n 23 24  1  1  0  0  0\n 24 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  1  0  0  0\n 29 28  1  0  0  0  0\n 30 28  1  0  0  0  0\nM  END",
          "smiles": "CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O)[C@@H](C)C",
          "formula": "C29H50O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "811b2aa4-40a3-4c80-8984-c71a0ac73a50"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "414.7078",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81072a55-5bfd-4738-ab96-65203ada607d",
      "version": "42",
      "structure": {
        "id": "356910dd-02e3-49eb-a7d5-b724c6c1f0a8",
        "molfile": "\n  Marvin  01132102512D          \n\n 34 37  0  0  1  0            999 V2000\n    7.6436   -6.3334    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6436   -7.1369    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9448   -7.5462    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2459   -7.1370    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.5479   -7.5462    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5479   -8.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8490   -8.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1295   -8.3499    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3957   -8.7636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1295   -7.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8490   -7.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2458   -8.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9448   -8.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5479   -6.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2459   -7.9770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2459   -6.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9448   -5.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9448   -6.7063    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0613   -7.1369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0613   -6.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3417   -5.9233    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6147   -5.1289    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.4390   -4.9628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5713   -4.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3958   -3.9712    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6688   -3.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4931   -3.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1127   -2.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9516   -4.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6787   -5.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0587   -4.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2370   -5.7814    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8644   -7.9474    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4670   -5.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  6  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  3  1  0  0  0  0\n  5 14  1  1  0  0  0\n  4 15  1  6  0  0  0\n 16  4  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17  1  1  0  0  0  0\n  3 18  1  1  0  0  0\n 19  2  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21  1  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\n 25 29  1  6  0  0  0\n 30 29  1  0  0  0  0\n 22 31  1  6  0  0  0\n 21 32  1  6  0  0  0\n  2 33  1  6  0  0  0\n  1 34  1  1  0  0  0\nM  END",
        "smiles": "CC[C@H](CC[C@@H](C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)O)C(C)C",
        "formula": "C29H50O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "414.7078",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "25882198-5029-4884-b841-0517c09b3c85",
          "c6caf675-60cf-456f-9e2e-91bea5705af0"
        ],
        "stereo_centers": 9
      },
      "unii": "S347WMO6M4"
    }
  ]
}