{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "01bf4e8a-f0fc-495a-9439-2fd3f3cfe26c",
          "code": "N02AC04",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextropropoxyphene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02AC04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "e74bb777-324e-432a-b1c8-c3f90bbff680",
          "code": "N0000175684",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Opioid Receptor Interactions [MoA]|Opioid Agonists [MoA]|Full Opioid Agonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175684",
          "code_system": "NDF-RT",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "dd6cc7ec-6af3-4d46-93b9-275af564f71c",
          "code": "N0000175690",
          "comments": "Established Pharmacologic Class [EPC]|Opioid Agonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175690",
          "code_system": "NDF-RT",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "efa618d0-9d88-4afb-8c54-2691f1b5c6e5",
          "code": "QN02AC54",
          "comments": "VATC|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextropropoxyphene, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AC54&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "5d5da613-e9d8-49ec-8f63-d9abc71a53f5",
          "code": "QN02AC74",
          "comments": "VATC|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextropropoxyphene, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AC74&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "e5ae849d-332b-4d9b-a516-2a8b5915a074",
          "code": "QN02AC04",
          "comments": "VATC|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextropropoxyphene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AC04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "29ca8bd0-d419-405d-979b-19991eb08475",
          "code": "469-62-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=469-62-5",
          "code_system": "CAS",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a",
            "d6c06977-f68d-4115-852c-159098a0c0e8"
          ]
        },
        {
          "uuid": "5e691855-f814-453a-9619-7cb0ab342d71",
          "code": "C61912",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61912",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "2503f562-dbf5-4dfa-8b88-024b7111a26d",
          "code": "D011431",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011431",
          "code_system": "MESH",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "49cea1b0-d7c9-42c7-96d8-9a45f3240d3e",
          "code": "809",
          "comments": "LiverTox|Analgesic|Moderate pain|Opiate",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Propoxyphene.htm",
          "code_system": "LIVERTOX",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "3b093406-8d8a-404e-9599-154cb82f835e",
          "code": "DEXTROPROPOXYPHENE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dextropropoxyphene",
          "code_system": "WIKIPEDIA",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "6ffffe3d-182b-424b-aba0-7bdaf880f72d",
          "code": "77-50-9",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77-50-9",
          "code_system": "CAS",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a",
            "5a4468c3-9845-4411-b720-6a6e08042391"
          ]
        },
        {
          "uuid": "085fe0ea-fa28-4c07-a6e5-5e37c88cf448",
          "code": "N02AC54",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextropropoxyphene, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02AC54&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "99c340f4-6170-4a6c-8011-8e55f48eb881",
          "code": "N02AC74",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Diphenylpropylamine derivatives|dextropropoxyphene, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02AC74&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "c567d183-be1c-478c-b885-23b5ebc9f28a",
          "code": "740",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=740",
          "code_system": "INN",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "553fce15-3ea5-4e44-b60a-49a7de2ab786",
          "code": "9273",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.12 Schedule II.|Opiates",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "fba6a82d-f1f2-4234-9a11-79ff2fac478d",
          "code": "207-420-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.747",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "2ae59e79-c177-4963-b8ad-2261eb654001",
          "code": "9752",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Narcotic Drugs",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "986ce8c6-5fcb-4548-8873-7847aba87370",
          "code": "7593",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7593",
          "code_system": "IUPHAR",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "13c0b34e-60a7-459d-92a3-be4b08bfda12",
          "code": "8785",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8785/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "d555510b-31f4-4186-9794-130058766bae",
          "code": "m9222",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9222?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "98729ffc-e66a-454b-9149-7a3f9ff17a63",
          "code": "DB00647",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00647",
          "code_system": "DRUG BANK",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "3bb63a5f-264c-4113-81e6-3c03088d25ee",
          "code": "SUB07053MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "a48d8259-afb9-48e5-9058-f2cd359a5c4e",
          "code": "21 CFR 862.3700",
          "comments": "PART 862 -- CLINICAL CHEMISTRY AND CLINICAL TOXICOLOGY DEVICES|Subpart D--Clinical Toxicology Test Systems|Sec. 862.3700 Propoxyphene test system.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=862.3700",
          "code_system": "CFR",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "6b193fdc-9ca9-43e4-bfaf-21cd8cb40079",
          "code": "CHEMBL1213351",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1213351",
          "code_system": "ChEMBL",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "67a7c545-0a60-4582-ac3a-e4f62dfbb1d8",
          "code": "SUB15027MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "d5f44a18-fe70-4e91-b6a0-d78a1e030b78",
          "code": "10100",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10100",
          "code_system": "PUBCHEM",
          "references": [
            "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a"
          ]
        },
        {
          "uuid": "99ce1b61-fd36-a8c2-1d92-a29ddd632f68",
          "code": "DTXSID1023524",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1023524",
          "code_system": "EPA CompTox",
          "references": [
            "d4e28765-7803-ff76-0c26-80636e2ae064"
          ]
        },
        {
          "uuid": "e7567bd1-a7d6-efbd-ef13-235f44875292",
          "code": "3175",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3175",
          "code_system": "HSDB",
          "references": [
            "5f66aa07-82cc-a674-0642-4185f89a32aa"
          ]
        },
        {
          "uuid": "0778ca85-a6b2-2c20-c0c3-af07a65af633",
          "code": "C241",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C241",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3ac24ad1-a504-fabd-d991-4eba42b5b18e"
          ]
        },
        {
          "uuid": "327b6641-8f4e-6b75-6c60-09c80484e3c0",
          "code": "C67413",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3ac24ad1-a504-fabd-d991-4eba42b5b18e"
          ]
        },
        {
          "uuid": "d86efbc7-2f6f-4a57-b2c1-035956487dce",
          "code": "S2F83W92TK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9ce421de-5c51-7a33-24ce-5d80b1be2f05",
          "code": "Propoxyphene",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM382/",
          "code_system": "LACTMED",
          "references": [
            "3ac24ad1-a504-fabd-d991-4eba42b5b18e"
          ]
        },
        {
          "uuid": "f0b2d94d-5e64-ca50-9c35-0867f2bb0f97",
          "code": "844",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/844",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3ac24ad1-a504-fabd-d991-4eba42b5b18e"
          ]
        },
        {
          "uuid": "e4146be0-cc23-93d0-643b-909a7e9c7822",
          "code": "51173",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:51173",
          "code_system": "CHEBI",
          "references": [
            "3ac24ad1-a504-fabd-d991-4eba42b5b18e"
          ]
        },
        {
          "uuid": "3a586bca-601d-143a-3d29-847f6f9b0ac4",
          "code": "S2F83W92TK",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S2F83W92TK",
          "code_system": "DAILYMED",
          "references": [
            "cf901a05-5ad5-7b5f-dc39-29eee5180a4f"
          ]
        },
        {
          "uuid": "2f59ecf0-bfa7-6283-5a4e-07909ff1b872",
          "code": "100000082879",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3314e14d-2d27-2c55-ad2e-96d361e8ee5e"
          ]
        },
        {
          "uuid": "8a0b4b4d-e210-21b4-f0b7-f10ca40845ef",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "ae795dd1-e112-058f-9408-795b4b65e5fc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "54a1ab6e-ef11-45d9-bc3b-0f8c483e6a67",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a80d7a5b-ba4b-43d8-a176-1773c81d07b7",
            "refuuid": "95525cc1-fec3-46eb-85c6-0409ea4183ec",
            "name": "PROPOXYPHENE",
            "unii": "S2F83W92TK",
            "linking_id": "S2F83W92TK",
            "ref_pname": "PROPOXYPHENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d9f095e3-5ea2-47e1-9232-f5ca383d393e",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "819548e9-2d5c-4e85-accf-60b207c93b05",
            "refuuid": "b059b9f1-c2ab-4e15-9aba-a8734a08fb73",
            "name": "PROPOXYPHENE MALONATE",
            "unii": "W4494CHJ3W",
            "linking_id": "W4494CHJ3W",
            "ref_pname": "PROPOXYPHENE MALONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "82311b42-e67b-4a93-bcec-26e33f78c687",
          "amount": {
            "uuid": "d304a2bd-c927-49aa-bf3a-728c7d9868bd",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 90
          },
          "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "f690cf43-2706-4636-b181-4fd30a2003dc"
          ],
          "related_substance": {
            "uuid": "f1cdc6a5-25e3-4346-9786-162dd36abc7b",
            "refuuid": "dfc780d7-5a5b-4bca-bf2e-6a6ba1b1b732",
            "name": "PROPOXYPHENE HYDROCHLORIDE",
            "unii": "CB2TL9PS0T",
            "linking_id": "CB2TL9PS0T",
            "ref_pname": "PROPOXYPHENE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1ad5f893-18f4-4cc3-a83e-b5bf2f3f151f",
          "amount": {
            "uuid": "b3dfc440-7266-4b25-86c0-15ce0fc7764a",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 60
          },
          "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "f690cf43-2706-4636-b181-4fd30a2003dc"
          ],
          "related_substance": {
            "uuid": "7a8f02a4-6cb0-407e-83ca-7de36dc17dda",
            "refuuid": "638e8658-b084-412c-9ca6-f9eabcf815b8",
            "name": "PROPOXYPHENE NAPSYLATE",
            "unii": "38M219L1OJ",
            "linking_id": "38M219L1OJ",
            "ref_pname": "PROPOXYPHENE NAPSYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "87eb6ada-fcbe-4431-b4b1-57f9777fcac4",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5d07286a-970c-4185-b0eb-efefa9d1e075",
            "refuuid": "c1b2c249-c042-4e4f-bf3a-a0298cbbc0fb",
            "name": "PROPOXYPHENE NAPSYLATE ANHYDROUS",
            "unii": "5O7IW35N3C",
            "linking_id": "5O7IW35N3C",
            "ref_pname": "PROPOXYPHENE NAPSYLATE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9a4f0844-deb4-4d1e-807f-05acbd0b60fd",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f5ccdcfa-c974-4b30-9fd5-dba8cc1138a3",
            "refuuid": "4e0ec971-d907-4d35-9b56-a5355f260a82",
            "name": "PROPOXYPHENE PAMOATE",
            "unii": "MO8EO075MI",
            "linking_id": "MO8EO075MI",
            "ref_pname": "PROPOXYPHENE PAMOATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8ab1100a-f69f-4a81-9337-2e526c0c2c63",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "b33290f4-f6c5-43bb-a976-ff1f9ec127ef"
          ],
          "related_substance": {
            "uuid": "2b02ba96-b802-4a27-8d30-eeec43ca5869",
            "refuuid": "942616dd-5ff6-4176-9c1c-55ff08efe780",
            "name": "NORPROPOXYPHENE",
            "unii": "C812VVS96K",
            "linking_id": "C812VVS96K",
            "ref_pname": "NORPROPOXYPHENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c28f3b34-180b-491b-a0c0-b52ca0f92079",
          "type": "METABOLITE->PARENT",
          "references": [
            "e0d5eee8-167a-4c04-a206-a98b66ea9c77"
          ],
          "related_substance": {
            "uuid": "46cd1b57-739b-42b1-930b-9b22f9b1db73",
            "refuuid": "e08df319-c5cf-489c-bd8c-c1b23077c15c",
            "name": "CYCLIC DINORPROPOXYPHENE",
            "unii": "JG9053F241",
            "linking_id": "JG9053F241",
            "ref_pname": "CYCLIC DINORPROPOXYPHENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a96d3fe6-2358-4b88-840b-cb52dbc0f7ba",
          "amount": {
            "uuid": "0976db95-fbae-48ab-be75-87eff5473f87",
            "average": 76,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "references": [
            "3ef55e51-28dd-f629-366d-5ee3d6471201"
          ],
          "related_substance": {
            "uuid": "6badf8da-44f5-45d4-8bab-bdf369a4d7ee",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5c158272-57e6-4552-946c-e07176984553",
          "amount": {
            "uuid": "1a779af6-1c3b-4ce6-b799-686b80b400fa"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "cba7e4e9-fb0e-49db-9ea5-8ce884f9b079",
            "refuuid": "f26d732e-3fdb-4d78-b17a-e24793dc85e8",
            "name": "PROPOXYPHENE, (±)-",
            "unii": "II2G62OV6F",
            "linking_id": "II2G62OV6F",
            "ref_pname": "PROPOXYPHENE, (±)-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a8bf2602-dab4-45e1-be88-f47b1eac08c1",
          "name": "(+)-PROPOXYPHENE",
          "stdName": "(+)-PROPOXYPHENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fc1e011-36d3-46ef-aab3-a2c330d89f6e"
          ],
          "display_name": false
        },
        {
          "uuid": "cccdc7fb-bd86-4230-81d9-ded53f09fc35",
          "name": "(2S,3R)-(+)-4-(DIMETHYLAMINO)-3-METHYL-1,2-DIPHENYL-2-BUTANOL PROPIONATE (ESTER)",
          "stdName": "(2S,3R)-(+)-4-(DIMETHYLAMINO)-3-METHYL-1,2-DIPHENYL-2-BUTANOL PROPIONATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eb74a93-9278-4e43-b740-095c89224273"
          ],
          "display_name": false
        },
        {
          "uuid": "ffa6241c-1541-432e-b993-a37bab40cd62",
          "name": "ALGAFAN",
          "stdName": "ALGAFAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c18caa64-976e-489a-aa94-5c83a5062e91"
          ],
          "display_name": false
        },
        {
          "uuid": "667c15d9-d678-465e-8c81-728e16454fd5",
          "name": "BENZENEETHANOL, .ALPHA.-((1R)-2-(DIMETHYLAMINO)-1-METHYLETHYL)-.ALPHA.-PHENYL-, 1-PROPANOATE, (.ALPHA.S)-",
          "stdName": "BENZENEETHANOL, .ALPHA.-((1R)-2-(DIMETHYLAMINO)-1-METHYLETHYL)-.ALPHA.-PHENYL-, 1-PROPANOATE, (.ALPHA.S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c18caa64-976e-489a-aa94-5c83a5062e91"
          ],
          "display_name": false
        },
        {
          "uuid": "4d47b484-96bb-49f0-9050-989c8dc69dd6",
          "name": "D-PROPOXYPHENE",
          "stdName": "D-PROPOXYPHENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c18caa64-976e-489a-aa94-5c83a5062e91"
          ],
          "display_name": false
        },
        {
          "uuid": "3b07784e-a76d-4062-bd7f-91664ace43e8",
          "name": "DEPROMIC",
          "stdName": "DEPROMIC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c18caa64-976e-489a-aa94-5c83a5062e91"
          ],
          "display_name": false
        },
        {
          "uuid": "d5c51a8d-3976-41c3-8128-b4a3eff6fcb4",
          "name": "DEXTROPROPOXYPHEN",
          "stdName": "DEXTROPROPOXYPHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c18caa64-976e-489a-aa94-5c83a5062e91"
          ],
          "display_name": false
        },
        {
          "uuid": "5c0942f7-a381-424d-9169-356514cb069c",
          "name": "DEXTROPROPOXYPHENE",
          "stdName": "DEXTROPROPOXYPHENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ac238a1-b7b5-4dd8-972e-7436336bd878",
            "55b3ff40-fd4a-4148-8f81-9c6b561fb29b",
            "f244c9a9-1ca2-4863-8259-7cfdf4ea0ff9",
            "eab0a325-414c-44ee-bb4a-91a1ee554b92",
            "94d20fca-537a-4ff1-bea4-18bf71418df3",
            "1e6c3caf-50df-4bfe-9fae-b4352ed3d8bc",
            "1a2da55a-dc71-4ac3-9e29-f8831bd7de90"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0072094a-fba4-4367-8b9f-37bcf59f99bf",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "a32ddd91-8ab8-4976-9100-f81498f57f34",
          "name": "DEXTROPROPOXYPHENE [MART.]",
          "stdName": "DEXTROPROPOXYPHENE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e6c3caf-50df-4bfe-9fae-b4352ed3d8bc"
          ],
          "display_name": false
        },
        {
          "uuid": "392658ae-29ad-70b7-377d-6e7b51cf4850",
          "name": "Dextropropoxyphene [WHO-DD]",
          "stdName": "DEXTROPROPOXYPHENE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c8c5969-4076-0f29-dce6-8c20f94dd445"
          ],
          "display_name": false
        },
        {
          "uuid": "13e604b2-86e6-4452-8721-9765e5d89ab3",
          "name": "IDS-ND-004(SECT.2)",
          "stdName": "IDS-ND-004(SECT.2)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca4db565-13f7-4d8e-a99a-6e782ce16421"
          ],
          "display_name": false
        },
        {
          "uuid": "2f9fa3e1-12b8-4e0f-b2c2-15a630f32ba9",
          "name": "J5.928E",
          "stdName": "J5.928E",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22da4c64-32e8-4d35-9136-37eb0888ab0a"
          ],
          "display_name": false
        },
        {
          "uuid": "78db917a-2227-4ee3-be4d-9ba5e4ef5f75",
          "name": "PROPOXYPHENE",
          "stdName": "PROPOXYPHENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c41f7b5-375e-42d2-af2a-afd7fc438f60",
            "916a0b01-1520-4b90-b2ba-0a4d2227fcfc",
            "76d82449-ea4e-45e0-833f-dd4cccac0767",
            "a644401a-9a8a-4500-843c-b43bf1b05167",
            "5744cba4-f3df-4970-ab9b-8a7c0fb8d011",
            "ce950d7e-445c-4314-b306-0e4d7d8178c0",
            "2a44a867-2f60-4ee1-88e9-4d01e23f6319"
          ],
          "display_name": true
        },
        {
          "uuid": "7003a36c-2888-4d50-b6cf-b0006471f63f",
          "name": "PROPOXYPHENE [HSDB]",
          "stdName": "PROPOXYPHENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "916a0b01-1520-4b90-b2ba-0a4d2227fcfc"
          ],
          "display_name": false
        },
        {
          "uuid": "3c35d4b1-d5ed-4d2e-a24f-4a15b8873993",
          "name": "PROPOXYPHENE [MI]",
          "stdName": "PROPOXYPHENE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c41f7b5-375e-42d2-af2a-afd7fc438f60"
          ],
          "display_name": false
        },
        {
          "uuid": "cf03f5bd-3549-43bf-9861-337807d4fd62",
          "name": "PROPOXYPHENE [VANDF]",
          "stdName": "PROPOXYPHENE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce950d7e-445c-4314-b306-0e4d7d8178c0"
          ],
          "display_name": false
        },
        {
          "uuid": "75e74b8a-94f6-4101-adf5-0d2325ff3673",
          "name": "PROPOXYPHENE, (+)-",
          "stdName": "PROPOXYPHENE, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fc1e011-36d3-46ef-aab3-a2c330d89f6e"
          ],
          "display_name": false
        },
        {
          "uuid": "8146c23f-1f67-4cbc-84de-e5d188b59507",
          "name": "PROPOXYPHENE, D-",
          "stdName": "PROPOXYPHENE, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fc1e011-36d3-46ef-aab3-a2c330d89f6e"
          ],
          "display_name": false
        },
        {
          "uuid": "7fa06c13-6bdf-4dee-92ba-60ae4c3fe9d1",
          "name": "SK-65",
          "stdName": "SK-65",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22da4c64-32e8-4d35-9136-37eb0888ab0a"
          ],
          "display_name": false
        },
        {
          "uuid": "96b12c3e-3835-4c2e-a03c-e2d34ccb9dab",
          "name": "dextropropoxyphene [INN]",
          "stdName": "DEXTROPROPOXYPHENE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94d20fca-537a-4ff1-bea4-18bf71418df3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0fc1e011-36d3-46ef-aab3-a2c330d89f6e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a644401a-9a8a-4500-843c-b43bf1b05167",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ac238a1-b7b5-4dd8-972e-7436336bd878",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7eb74a93-9278-4e43-b740-095c89224273",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94d20fca-537a-4ff1-bea4-18bf71418df3",
          "citation": "INN Proposed List 7",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL07.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1e6c3caf-50df-4bfe-9fae-b4352ed3d8bc",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c41f7b5-375e-42d2-af2a-afd7fc438f60",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "916a0b01-1520-4b90-b2ba-0a4d2227fcfc",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca4db565-13f7-4d8e-a99a-6e782ce16421",
          "citation": "INCB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55b3ff40-fd4a-4148-8f81-9c6b561fb29b",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce950d7e-445c-4314-b306-0e4d7d8178c0",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22da4c64-32e8-4d35-9136-37eb0888ab0a",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.928E",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.928E",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c18caa64-976e-489a-aa94-5c83a5062e91",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8feea24e-d0c9-4ea5-a101-2e9e711a7e3a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f690cf43-2706-4636-b181-4fd30a2003dc",
          "citation": "INTERNATIONAL NARCOTICS CONTROL BOARD - YELLOW LIST; ANNEX TO FORMS A, B AND C; 52ND EDITION, DECEMBER 2013; HTTP://WWW.INCB.ORG/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a64d8f45-b9f1-4def-901d-1975c5bcba9a",
          "citation": "TOXICOLOGY AND APPLIED PHARMACOLOGY 19,427-44(1971)",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0d5eee8-167a-4c04-a206-a98b66ea9c77",
          "citation": "http://jpet.aspetjournals.org/content/290/1/314.full.pdf",
          "url": "http://jpet.aspetjournals.org/content/290/1/314.full.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "208f559a-6bb8-48b5-92be-935ca0ca1d19",
          "citation": "SRS import [S2F83W92TK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S2F83W92TK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f244c9a9-1ca2-4863-8259-7cfdf4ea0ff9",
          "citation": "DEXTROPROPOXYPHENE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a2da55a-dc71-4ac3-9e29-f8831bd7de90",
          "citation": "DEXTROPROPOXYPHENE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5744cba4-f3df-4970-ab9b-8a7c0fb8d011",
          "citation": "PROPOXYPHENE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a44a867-2f60-4ee1-88e9-4d01e23f6319",
          "citation": "PROPOXYPHENE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eab0a325-414c-44ee-bb4a-91a1ee554b92",
          "citation": "DEXTROPROPOXYPHENE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "76d82449-ea4e-45e0-833f-dd4cccac0767",
          "citation": "PROPOXYPHENE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f66aa07-82cc-a674-0642-4185f89a32aa",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+469-62-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3ef55e51-28dd-f629-366d-5ee3d6471201",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "d4e28765-7803-ff76-0c26-80636e2ae064",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=469-62-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "57443f4f-f1fd-a5f5-fb03-9076e92ef2c2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+469-62-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3ac24ad1-a504-fabd-d991-4eba42b5b18e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d6c06977-f68d-4115-852c-159098a0c0e8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5a4468c3-9845-4411-b720-6a6e08042391",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b33290f4-f6c5-43bb-a976-ff1f9ec127ef",
          "citation": "J Chromatogr 140:280;1977",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf901a05-5ad5-7b5f-dc39-29eee5180a4f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7c8c5969-4076-0f29-dce6-8c20f94dd445",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3314e14d-2d27-2c55-ad2e-96d361e8ee5e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ae795dd1-e112-058f-9408-795b4b65e5fc",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4f312144-201c-4f99-a37f-bbecfb078cdc",
          "id": "4f312144-201c-4f99-a37f-bbecfb078cdc",
          "molfile": "\n  Marvin  01132104082D          \n\n 25 26  0  0  1  0            999 V2000\n   -2.9375   -2.6000    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -2.9458   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2250   -3.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5125   -2.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8000   -3.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5208   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6500   -3.0125    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -4.3625   -2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3625   -1.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0792   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0792   -0.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3625   -0.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6458   -0.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6458   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9375   -3.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9333   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2125   -4.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6375   -4.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6375   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3708   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0917   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.8000   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.8000   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0917   -4.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3708   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 15  1  1  0  0  0\n  7 20  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 25 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CCC(=O)O[C@@](Cc1ccccc1)([C@H](C)CN(C)C)c2ccccc2",
          "formula": "C22H29NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "22926cd2-711b-4309-b95b-694a107f550e"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "339.472",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "95525cc1-fec3-46eb-85c6-0409ea4183ec",
      "version": "28",
      "structure": {
        "id": "56156759-0317-48c1-baf5-22efbcee258b",
        "molfile": "\n  Marvin  01132104292D          \n\n 25 26  0  0  1  0            999 V2000\n   -3.6500   -3.0125    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.9375   -2.6000    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.9375   -3.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9333   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3625   -2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2250   -3.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3708   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2125   -4.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5125   -2.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3625   -1.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9458   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6375   -4.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3708   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0917   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8000   -3.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5208   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6458   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0792   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6375   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.8000   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0917   -4.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0792   -0.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6458   -0.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.8000   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3625   -0.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  3  1  1  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  1  7  1  6  0  0  0\n  8  4  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n  2 11  1  6  0  0  0\n 12  4  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  7  2  0  0  0  0\n 15  9  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17 10  2  0  0  0  0\n 18 10  1  0  0  0  0\n 19 12  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 13  2  0  0  0  0\n 22 18  2  0  0  0  0\n 23 17  1  0  0  0  0\n 24 21  1  0  0  0  0\n 25 23  2  0  0  0  0\n 20 24  2  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
        "smiles": "CCC(=O)O[C@@](Cc1ccccc1)([C@H](C)CN(C)C)c2ccccc2",
        "formula": "C22H29NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "339.472",
        "optical_activity": "( + )",
        "references": [
          "208f559a-6bb8-48b5-92be-935ca0ca1d19",
          "a644401a-9a8a-4500-843c-b43bf1b05167",
          "94d20fca-537a-4ff1-bea4-18bf71418df3"
        ],
        "stereo_centers": 2
      },
      "unii": "S2F83W92TK"
    }
  ]
}