{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5f32c96f-2b93-ae54-8dcd-e703da498eed", "code": "918656-84-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=918656-84-5", "code_system": "CAS", "references": [ "1059da26-ece6-eef4-276d-e6243b9a636d" ] }, { "uuid": "19f1faa1-ba19-e358-60a9-fa8884e8a0f8", "code": "44438485", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44438485", "code_system": "PUBCHEM", "references": [ "8092621a-e550-4a62-7b99-deec899e9268" ] }, { "uuid": "176fcd5a-fd53-4ba4-a678-2df4e3ea9ea7", "code": "S0FNI6N4JS", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7e0af4ff-c2f0-156c-0b3b-19a430f85013", "code": "DTXSID40659112", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40659112", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "65222b13-1d34-38c0-f134-d897a50c2861", "type": "LABELED->NON-LABELED", "references": [ "1059da26-ece6-eef4-276d-e6243b9a636d" ], "related_substance": { "uuid": "b79a6c7d-7de8-c59d-f024-9ff76ce7ccbd", "refuuid": "92358dca-d41c-4c1a-823a-acbbf3fc3663", "name": "INER I-123", "unii": "8AAP8G8ODE", "linking_id": "8AAP8G8ODE", "ref_pname": "INER I-123", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "4818164e-624e-0657-0fdb-a0fff19a90c6", "name": "(2S)-2-((S)-(2-IODOPHENOXY)PHENYLMETHYL)MORPHOLINE", "stdName": "(2S)-2-((S)-(2-IODOPHENOXY)PHENYLMETHYL)MORPHOLINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1059da26-ece6-eef4-276d-e6243b9a636d" ], "display_name": false }, { "uuid": "19399ce9-40a9-b6ad-cf2b-bb4547473d65", "name": "INER", "stdName": "INER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e893dd0a-f81a-570a-835e-793c314391aa" ], "display_name": true }, { "uuid": "1932a766-03e4-6a0f-0a30-9a4c83a9fa27", "name": "MORPHOLINE, 2-((S)-(2-IODOPHENOXY)PHENYLMETHYL)-, (2S)-", "stdName": "MORPHOLINE, 2-((S)-(2-IODOPHENOXY)PHENYLMETHYL)-, (2S)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1059da26-ece6-eef4-276d-e6243b9a636d" ], "display_name": false } ], "references": [ { "uuid": "1059da26-ece6-eef4-276d-e6243b9a636d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e893dd0a-f81a-570a-835e-793c314391aa", "citation": "Tamagnan, Gilles D., et al. \"Development of SPECT imaging agents for the norepinephrine transporters:[123I] INER.\" Bioorganic & medicinal chemistry letters 17.2 (2007): 533-537.", "url": "https://www.sciencedirect.com/science/article/pii/S0960894X06011802", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8092621a-e550-4a62-7b99-deec899e9268", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "781bd67e-2220-777a-993a-6b575d5969b7", "id": "781bd67e-2220-777a-993a-6b575d5969b7", "molfile": "\n Marvin 01132106142D \n\n 21 23 0 0 1 0 999 V2000\n 15.6059 -4.4825 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 14.8915 -4.8950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1770 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1770 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4625 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7482 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7482 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4625 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4625 -5.7200 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6059 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8915 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8915 -2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6059 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -4.8950 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 16.3205 -5.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0349 -6.1325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7493 -5.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7493 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0349 -4.4825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 10 1 0 0 0 0\n 16 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 8 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 1 1 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)[C@@H]([C@@H]2CNCCO2)Oc3ccccc3I", "formula": "C17H18INO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9c51c8f8-2e82-4dc4-963b-9c5dd96e59dd" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "395.2354", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "eb0e2cfd-e768-5601-d877-806646aec97e", "version": "5", "structure": { "id": "f312e83b-4f9a-6851-167d-f3485f92d57b", "molfile": "\n Marvin 01132112362D \n\n 22 24 0 0 1 0 999 V2000\n 17.0349 -6.1325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -5.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -4.8950 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.0349 -4.4825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7493 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7493 -5.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6059 -4.4825 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.6059 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8915 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8915 -2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6059 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8915 -4.8950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1770 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4625 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7482 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7482 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4625 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1770 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4625 -5.7200 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3205 -4.0700 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 8 13 2 0 0 0 0\n 7 8 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 15 20 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 21 1 0 0 0 0\n 7 14 1 1 0 0 0\n 3 7 1 0 0 0 0\n 3 22 1 6 0 0 0\nM END", "smiles": "c1ccc(cc1)[C@@H]([C@]2([H])CNCCO2)Oc3ccccc3I", "formula": "C17H18INO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "395.2354", "optical_activity": "UNSPECIFIED", "references": [ "1059da26-ece6-eef4-276d-e6243b9a636d" ], "stereo_centers": 2 }, "unii": "S0FNI6N4JS" } ] }