{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "49dea898-a00b-4773-98cb-f3dfcb619800",
          "code": "220899-03-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=220899-03-6",
          "code_system": "CAS",
          "references": [
            "7dea92da-c9cd-4bf0-919a-f4eb4fb9f40b",
            "7493505e-8d7b-45ef-ac46-64fba4a404b2"
          ]
        },
        {
          "uuid": "8dec8033-af4a-4c22-bb2b-167348f532da",
          "code": "C511340",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67511340",
          "code_system": "MESH",
          "references": [
            "7dea92da-c9cd-4bf0-919a-f4eb4fb9f40b"
          ]
        },
        {
          "uuid": "f63deac3-b9d2-4104-9b8d-ee0eabf88964",
          "code": "325",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2710",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7dea92da-c9cd-4bf0-919a-f4eb4fb9f40b"
          ]
        },
        {
          "uuid": "c1c18cb7-af56-43de-8008-d0b161d39fb7",
          "code": "m7500",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7500?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7dea92da-c9cd-4bf0-919a-f4eb4fb9f40b"
          ]
        },
        {
          "uuid": "370e5804-26d0-44bb-ab7f-f09a9a34cc5e",
          "code": "6451057",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6451057",
          "code_system": "PUBCHEM",
          "references": [
            "7dea92da-c9cd-4bf0-919a-f4eb4fb9f40b"
          ]
        },
        {
          "uuid": "e5e919d0-405a-9ae3-267d-db4d101641b8",
          "code": "DTXSID9058020",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9058020",
          "code_system": "EPA CompTox",
          "references": [
            "f512d348-df38-877a-943e-dd107c2055fc"
          ]
        },
        {
          "uuid": "fdb843f1-a621-48f8-913c-45c47faabd44",
          "code": "S04CWW41HM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "27645ef1-adb4-5a1d-168b-47c6e4279198",
          "code": "83345",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83345",
          "code_system": "CHEBI",
          "references": [
            "31f25e08-9789-fec4-990e-47c1d2edde34"
          ]
        },
        {
          "uuid": "c1a8f980-7f9f-2a33-08bb-929404511fa2",
          "code": "metrafenone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/metrafenone.html",
          "code_system": "ALANWOOD",
          "references": [
            "9e5647ef-b28e-3523-332b-627d1cddb0be"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c0cb8025-38d5-432e-9ad3-ab648311c0ac",
          "name": "(3-BROMO-6-METHOXY-2-METHYLPHENYL)(2,3,4-TRIMETHOXY-6-METHYLPHENYL)METHANONE",
          "stdName": "(3-BROMO-6-METHOXY-2-METHYLPHENYL)(2,3,4-TRIMETHOXY-6-METHYLPHENYL)METHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa6c3634-cd4b-4b28-9aea-6601edf8a442",
            "5833c7f9-93e0-49b8-818f-6e5f6dc502f3"
          ],
          "display_name": false
        },
        {
          "uuid": "3992a55f-be38-40b0-9688-c4619db9222e",
          "name": "3'-BROMO-2,3,4,6'-TETRAMETHOXY-2',6-DIMETHYLBENZOPHENONE",
          "stdName": "3'-BROMO-2,3,4,6'-TETRAMETHOXY-2',6-DIMETHYLBENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5833c7f9-93e0-49b8-818f-6e5f6dc502f3",
            "8a513f10-65f8-4ff6-8e09-f265bad17d00"
          ],
          "display_name": false
        },
        {
          "uuid": "7677a0e4-42e9-423c-9ee2-d2089e0c8e9e",
          "name": "BAS 560 F",
          "stdName": "BAS 560 F",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fe15d10-5104-4bcb-a582-69b0d0daa2b2",
            "886b2b60-1765-49d0-9bb9-1ee49d3a591c"
          ],
          "display_name": false
        },
        {
          "uuid": "e49d66a9-6385-44e4-a21d-bc6849c681c0",
          "name": "CL-375839",
          "stdName": "CL-375839",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fe15d10-5104-4bcb-a582-69b0d0daa2b2",
            "886b2b60-1765-49d0-9bb9-1ee49d3a591c"
          ],
          "display_name": false
        },
        {
          "uuid": "71deabf8-46a7-4eff-afa9-74be9ff82ffd",
          "name": "METRAFENONE",
          "stdName": "METRAFENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "049c756b-f0a3-42cd-a79e-f45147d82eec",
            "c07336ef-f0e7-4de4-b894-ca58b28b340a",
            "886b2b60-1765-49d0-9bb9-1ee49d3a591c",
            "613b937a-fe65-440d-857b-5a5a45d440e2",
            "485f3e4a-1638-4b18-b67c-b69680c0d20a",
            "106d8e10-ae56-4da0-918e-45a478e13793"
          ],
          "display_name": true
        },
        {
          "uuid": "3a81a957-bc70-4895-8f1d-d68e1b10ccde",
          "name": "METRAFENONE [ISO]",
          "stdName": "METRAFENONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "049c756b-f0a3-42cd-a79e-f45147d82eec",
            "886b2b60-1765-49d0-9bb9-1ee49d3a591c"
          ],
          "display_name": false
        },
        {
          "uuid": "8a930abc-7904-469f-8161-2ae463960fc2",
          "name": "METRAFENONE [MI]",
          "stdName": "METRAFENONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "886b2b60-1765-49d0-9bb9-1ee49d3a591c",
            "485f3e4a-1638-4b18-b67c-b69680c0d20a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "613b937a-fe65-440d-857b-5a5a45d440e2",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5833c7f9-93e0-49b8-818f-6e5f6dc502f3",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a513f10-65f8-4ff6-8e09-f265bad17d00",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa6c3634-cd4b-4b28-9aea-6601edf8a442",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "049c756b-f0a3-42cd-a79e-f45147d82eec",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "886b2b60-1765-49d0-9bb9-1ee49d3a591c",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "485f3e4a-1638-4b18-b67c-b69680c0d20a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fe15d10-5104-4bcb-a582-69b0d0daa2b2",
          "citation": "https://www.epa.gov/sites/production/files/2015-01/documents/47267435-metrafenone-ecm-soil.pdf",
          "url": "https://www.epa.gov/sites/production/files/2015-01/documents/47267435-metrafenone-ecm-soil.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dea92da-c9cd-4bf0-919a-f4eb4fb9f40b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11f80262-9a74-4981-927f-428b5cd07375",
          "citation": "http://www.pesticideinfo.org/Summary_Chemical.jsp?Rec_Id=PC41978",
          "url": "http://www.pesticideinfo.org/Summary_Chemical.jsp?Rec_Id=PC41978",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45ecd766-8323-4816-bc40-a06389746f28",
          "citation": "SRS import [S04CWW41HM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S04CWW41HM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "106d129b-fefd-4a98-84b5-f53118ffb9a0",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c07336ef-f0e7-4de4-b894-ca58b28b340a",
          "citation": "METRAFENONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "106d8e10-ae56-4da0-918e-45a478e13793",
          "citation": "METRAFENONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f512d348-df38-877a-943e-dd107c2055fc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=220899-03-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e5647ef-b28e-3523-332b-627d1cddb0be",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "7493505e-8d7b-45ef-ac46-64fba4a404b2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "31f25e08-9789-fec4-990e-47c1d2edde34",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "25a04674-591f-4950-a366-aa4bef4f6a44",
          "id": "25a04674-591f-4950-a366-aa4bef4f6a44",
          "molfile": "\n  Marvin  01132102052D          \n\n 25 26  0  0  0  0            999 V2000\n    4.9308   -6.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3433   -5.8752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -5.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5808   -6.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -6.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5060   -7.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8183   -5.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6433   -5.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0558   -5.1607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2753   -6.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0505   -6.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1939   -5.3110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9691   -5.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6825   -6.6537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5393   -7.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7641   -7.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0025   -8.5261    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.1321   -7.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8079   -7.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8183   -4.4462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -3.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5808   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -4.4462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3433   -4.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 23  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n 20  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 18 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 23  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(c(c1C(=O)c2c(C)c(ccc2OC)Br)OC)OC)OC",
          "formula": "C19H21BrO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c6112f2c-c541-4bf5-90bd-73443a8cfb89"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "409.2713",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "10bc3aa0-f520-412a-b5df-e612882c7a18",
      "version": "5",
      "structure": {
        "id": "92af9605-d9d0-4da3-ae8f-cf8cafe14d6d",
        "molfile": "\n  Marvin  01132107362D          \n\n 25 26  0  0  0  0            999 V2000\n    9.1321   -7.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7641   -7.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5393   -7.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6825   -6.6537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0505   -6.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2753   -6.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6433   -5.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0558   -5.1607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8183   -5.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5808   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -5.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5808   -6.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -6.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5060   -7.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3433   -5.8752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9308   -6.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -4.4462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3433   -4.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8183   -4.4462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -3.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1939   -5.3110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9691   -5.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0025   -8.5261    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    8.8079   -7.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 11 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 10 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n  5 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n  2 24  1  0  0  0  0\n  1 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(c(c(c1C(=O)c2c(C)c(ccc2OC)Br)OC)OC)OC",
        "formula": "C19H21BrO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "409.2713",
        "optical_activity": "NONE",
        "references": [
          "45ecd766-8323-4816-bc40-a06389746f28",
          "106d129b-fefd-4a98-84b5-f53118ffb9a0"
        ],
        "stereo_centers": 0
      },
      "unii": "S04CWW41HM"
    }
  ]
}