{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1197e9e9-5478-4f34-a006-c6f08a249184",
          "code": "324014",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/324014/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "297ae374-f967-4c04-8197-7dafbd782481"
          ]
        },
        {
          "uuid": "5e414e90-34d9-458f-8c19-9ae76097f139",
          "code": "73415776",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73415776",
          "code_system": "PUBCHEM",
          "references": [
            "297ae374-f967-4c04-8197-7dafbd782481"
          ]
        },
        {
          "uuid": "9cda03f9-3fac-4178-8c43-e2e134b281cd",
          "code": "S043P4DV22",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "26389625-9c96-6d61-f675-76decdbec109",
          "code": "100000172861",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ca5ea52b-093d-d800-fb8d-f3ed137380fe"
          ]
        },
        {
          "uuid": "4098f2a7-a8b2-b6b2-5f46-5eb9fc6a24f6",
          "code": "S043P4DV22",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S043P4DV22",
          "code_system": "DAILYMED",
          "references": [
            "fb635cf8-87e4-6a70-4508-f8801503706e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "72388e5c-848f-4e3b-81c8-c640c98a9b5c",
          "name": "BORON (AS CITRATE)",
          "stdName": "BORON (AS CITRATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af94ca9b-8e11-4e9e-9ad3-aa9b756f6f89",
            "a12cd5e8-2859-4898-be3b-1da7fa70d1c7"
          ],
          "display_name": false
        },
        {
          "uuid": "e06fb419-5688-4873-ac3f-c97a9321745e",
          "name": "BORON (AS CITRATE) [VANDF]",
          "stdName": "BORON (AS CITRATE) [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a12cd5e8-2859-4898-be3b-1da7fa70d1c7"
          ],
          "display_name": false
        },
        {
          "uuid": "dd71bfaf-8b64-472d-933b-8af440546efe",
          "name": "BORON CITRATE",
          "stdName": "BORON CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c2f4b97-ac73-4bc8-9040-d91b399261d6",
            "d92ef3ef-4e64-498b-8581-a13b89ef0bad",
            "62f63fa7-678e-48db-b339-ff0a09bc6c00"
          ],
          "display_name": true
        },
        {
          "uuid": "a49b781a-cb17-840a-4cfc-d60171401003",
          "name": "Boron citrate [WHO-DD]",
          "stdName": "BORON CITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "445d37fc-8653-8867-e06d-05b1ad8d2ec1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d92ef3ef-4e64-498b-8581-a13b89ef0bad",
          "citation": "RX-NORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a12cd5e8-2859-4898-be3b-1da7fa70d1c7",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62f63fa7-678e-48db-b339-ff0a09bc6c00",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "297ae374-f967-4c04-8197-7dafbd782481",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0295e54f-f9dd-4c9e-97be-5b713765d664",
          "citation": "SRS import [S043P4DV22]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S043P4DV22",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "657d9850-46f2-4684-9533-1275e011d4c0",
          "citation": "RxNorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c2f4b97-ac73-4bc8-9040-d91b399261d6",
          "citation": "BORON CITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af94ca9b-8e11-4e9e-9ad3-aa9b756f6f89",
          "citation": "BORON (AS CITRATE) [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fb635cf8-87e4-6a70-4508-f8801503706e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "445d37fc-8653-8867-e06d-05b1ad8d2ec1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ca5ea52b-093d-d800-fb8d-f3ed137380fe",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ab07bb44-6d7c-44f6-abc7-174ce2763d00",
          "id": "ab07bb44-6d7c-44f6-abc7-174ce2763d00",
          "molfile": "\n  Marvin  01132108522D          \n\n 14 15  0  0  0  0            999 V2000\n   12.3364  -11.1736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3364  -11.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6302  -12.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9162  -11.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9162  -11.1736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1950  -12.4058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9137  -15.3218    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9592  -13.0636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7642  -11.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7642  -11.1736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0506  -12.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0504  -13.2324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3364  -12.8192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6228  -13.2174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n 13  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\nM  END",
          "smiles": "C1C(=O)OB2OC(=O)CC1(C(=O)O2)O",
          "formula": "C6H5BO7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b720f7b4-6122-4478-bcae-1158080944ce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "199.911",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5060762e-f95d-44ef-9349-17dd04233128",
      "version": "6",
      "structure": {
        "id": "108c6b8d-d5fc-4fb4-b526-97351ad14738",
        "molfile": "\n  Marvin  01132101052D          \n\n 14 15  0  0  0  0            999 V2000\n   11.6228  -13.2174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3364  -12.8192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0504  -13.2324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9137  -15.3218    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9592  -13.0636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7642  -11.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0506  -12.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3364  -11.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6302  -12.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9162  -11.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9162  -11.1736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1950  -12.4058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3364  -11.1736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7642  -11.1736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12  4  1  0  0  0  0\n  2  8  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  6  2  0  0  0  0\nM  END",
        "smiles": "C1C(=O)OB2OC(=O)CC1(C(=O)O2)O",
        "formula": "C6H5BO7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "199.911",
        "optical_activity": "NONE",
        "references": [
          "657d9850-46f2-4684-9533-1275e011d4c0",
          "0295e54f-f9dd-4c9e-97be-5b713765d664"
        ],
        "stereo_centers": 0
      },
      "unii": "S043P4DV22"
    }
  ]
}