{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b7a3f4c1-8036-4244-83e5-7bfe392f33db",
          "code": "88-24-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=88-24-4",
          "code_system": "CAS",
          "references": [
            "9a1c2892-b604-4163-b21b-f664f25b0be1",
            "caea3a68-b4ae-427f-8045-72d5505dd402"
          ]
        },
        {
          "uuid": "8a854e37-dad9-4ad2-b0f2-4d7ae594dc55",
          "code": "201-814-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.649",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9a1c2892-b604-4163-b21b-f664f25b0be1"
          ]
        },
        {
          "uuid": "10811a25-35c4-4169-b51d-492617042322",
          "code": "6928",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6928",
          "code_system": "PUBCHEM",
          "references": [
            "9a1c2892-b604-4163-b21b-f664f25b0be1"
          ]
        },
        {
          "uuid": "be318054-69de-4ad7-b4ea-26c1a2a400a6",
          "code": "5257",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5257",
          "code_system": "HSDB",
          "references": [
            "bed79666-d55b-0476-732f-409b12f851aa"
          ]
        },
        {
          "uuid": "88a1d0d7-31d3-c919-f139-1230089d81ac",
          "code": "DTXSID7038864",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7038864",
          "code_system": "EPA CompTox",
          "references": [
            "2cbafd17-db15-2e98-b471-1b2da2f02e87"
          ]
        },
        {
          "uuid": "4134e982-68d6-4504-8042-2ce9a89f28b6",
          "code": "RZW97F6CTS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "13a963da-9e85-9276-efdb-4b5e9e5936d1",
          "code": "7782",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7782",
          "code_system": "NSC",
          "references": [
            "e5b3d847-eb12-edab-a1c2-4a3a98d8e5f6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b318ae5a-9b67-42f3-a0fd-46f9628ad884",
          "name": "2,2'-METHYLENEBIS(4-ETHYL-6-TERT-BUTYLPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(4-ETHYL-6-TERT-BUTYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "04dfb5ac-3d48-4496-9bee-a592df002d1f"
          ],
          "display_name": true
        },
        {
          "uuid": "c66e1356-6b33-4613-9a9c-341f7c3f3bc4",
          "name": "2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-ETHYLPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-ETHYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "6445acd5-4425-4603-9e23-47d447d6d565",
          "name": "2,2'-METHYLENEBIS(6-T-BUTYL-4-ETHYLPHENOL) [HSDB]",
          "stdName": "2,2'-METHYLENEBIS(6-T-BUTYL-4-ETHYLPHENOL) [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "05003438-7b83-456d-942e-f37902b46c9a"
          ],
          "display_name": false
        },
        {
          "uuid": "2aef00a9-0cc8-4458-b9cb-42781c50cc4c",
          "name": "2,2'-METHYLENEBIS(6-TERT-BUTYL-4-ETHYLPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(6-TERT-BUTYL-4-ETHYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "a8d09167-b82b-4cc1-933f-1e3f0b4276ee",
          "name": "2,2'-METHYLENEBIS(ETHYL-6-TERT-BUTYLPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(ETHYL-6-TERT-BUTYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "7719a3f0-4ffe-470c-bd42-0010edfd77d3"
          ],
          "display_name": false
        },
        {
          "uuid": "7da0af16-b372-46d6-93f4-a04ad5a573f6",
          "name": "2,2-METHYLENEBIS(4-ETHYL-6-T-BUTYLPHENOL)",
          "stdName": "2,2-METHYLENEBIS(4-ETHYL-6-T-BUTYLPHENOL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "fda70fdb-265e-4999-9766-df91095ee473",
          "name": "2,2-METHYLENEBIS(4-ETHYL-6-TERT-BUTYLPHENOL)",
          "stdName": "2,2-METHYLENEBIS(4-ETHYL-6-TERT-BUTYLPHENOL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "1e88c020-075a-4e6b-9d4f-22ba2a7046fd",
          "name": "ANTIOXIDANT 425",
          "stdName": "ANTIOXIDANT 425",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "cc6473d3-09ca-4f19-b4eb-23c608bed268",
          "name": "BIS(2-HYDROXY-3-TERT-BUTYL-5-ETHYLPHENYL)METHANE",
          "stdName": "BIS(2-HYDROXY-3-TERT-BUTYL-5-ETHYLPHENYL)METHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "9786e08f-fe63-42fb-9466-cf3ff9048db4",
          "name": "BIS(3-TERT-BUTYL-5-ETHYL-2-HYDROXYPHENYL)METHANE",
          "stdName": "BIS(3-TERT-BUTYL-5-ETHYL-2-HYDROXYPHENYL)METHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "55c54286-3c74-47d1-b46c-35ad473863c7",
          "name": "METHYLENEBIS(4-ETHYL-6-TERT-BUTYLPHENOL), 2-2'-",
          "stdName": "METHYLENEBIS(4-ETHYL-6-TERT-BUTYLPHENOL), 2-2'-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64b2b5f6-9635-4365-936b-2004d6d6e500"
          ],
          "display_name": false
        },
        {
          "uuid": "6551bf6c-b28d-4c5a-9ee4-fcae7132506f",
          "name": "NSC-7782",
          "stdName": "NSC-7782",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "04dfb5ac-3d48-4496-9bee-a592df002d1f"
          ],
          "display_name": false
        },
        {
          "uuid": "dde4b7a6-5f43-4a7f-9ab1-726467ceedd1",
          "name": "PHENOL, 2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-ETHYL-",
          "stdName": "PHENOL, 2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-ETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "1fd9586a-c35c-4b45-947b-06cc495dd2d0",
          "name": "PHENOL, 2,2'-METHYLENEBIS(6-TERT-BUTYL-4-ETHYL-",
          "stdName": "PHENOL, 2,2'-METHYLENEBIS(6-TERT-BUTYL-4-ETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "d499d9fc-261e-48d1-a796-bcb174456b51"
          ],
          "display_name": false
        },
        {
          "uuid": "acfa1c81-6951-4d0c-817d-33f590554ad4",
          "name": "YOSHINOX 425",
          "stdName": "YOSHINOX 425",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
            "055d0a00-ece9-4b74-a708-8e57eaa1eb3f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "64b2b5f6-9635-4365-936b-2004d6d6e500",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "05003438-7b83-456d-942e-f37902b46c9a",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edabb919-03bc-4fc5-ad54-cba640d9a8f0",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04dfb5ac-3d48-4496-9bee-a592df002d1f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d499d9fc-261e-48d1-a796-bcb174456b51",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "055d0a00-ece9-4b74-a708-8e57eaa1eb3f",
          "citation": "http://www.otcltd.com/pro/view.asp?idx=65&page=1&bbs_code=13&key=0&menuName=&menu_display=",
          "url": "http://www.otcltd.com/pro/view.asp?idx=65&page=1&bbs_code=13&key=0&menuName=&menu_display=",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7719a3f0-4ffe-470c-bd42-0010edfd77d3",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a1c2892-b604-4163-b21b-f664f25b0be1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390877000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f32c7f99-9615-41cf-9d66-baca167e3f6d",
          "citation": "SRS import [RZW97F6CTS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RZW97F6CTS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390877000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86fb68ff-9dbd-4a19-9f66-405de5674389",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bed79666-d55b-0476-732f-409b12f851aa",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+88-24-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2cbafd17-db15-2e98-b471-1b2da2f02e87",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=88-24-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "caea3a68-b4ae-427f-8045-72d5505dd402",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e5b3d847-eb12-edab-a1c2-4a3a98d8e5f6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "19a1d0e0-1123-4186-ab81-008d6b7b0f15",
          "id": "19a1d0e0-1123-4186-ab81-008d6b7b0f15",
          "molfile": "\n  Marvin  01132101312D          \n\n 27 28  0  0  0  0            999 V2000\n    4.3115   -7.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -6.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -5.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7405   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7405   -4.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4549   -4.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0869   -4.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9436   -5.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5756   -6.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4323   -6.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6571   -7.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3509   -5.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4942   -5.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8621   -4.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0054   -3.7456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2694   -4.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7426   -5.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9839   -4.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9208   -4.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -4.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -3.4849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3115   -4.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3115   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5971   -4.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8105   -3.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2483   -5.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8217   -4.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 23  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5 20  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 12  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\nM  END",
          "smiles": "CCc1cc(Cc2cc(CC)cc(c2O)C(C)(C)C)c(c(c1)C(C)(C)C)O",
          "formula": "C25H36O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1bebbc85-017a-4831-af14-45a3b33a6071"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "368.5531",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "afb393ef-4a9e-43a0-9a7d-56a4fb7ac6c7",
      "version": "7",
      "structure": {
        "id": "c2e9fa84-1182-4229-bf4a-a1344d8437c1",
        "molfile": "\n  Marvin  01132110042D          \n\n 27 28  0  0  0  0            999 V2000\n    8.4942   -5.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8621   -4.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0869   -4.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4549   -4.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7405   -4.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -4.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3115   -4.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3115   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -5.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7405   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -6.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3115   -7.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5971   -4.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8105   -3.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2483   -5.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8217   -4.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0259   -3.4849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9436   -5.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5756   -6.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3509   -5.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4323   -6.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6571   -7.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0054   -3.7456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2694   -4.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7426   -5.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9839   -4.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9208   -4.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n  6 17  1  0  0  0  0\n  3 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n  1 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n  2 23  1  0  0  0  0\n  1 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\nM  END",
        "smiles": "CCc1cc(Cc2cc(CC)cc(c2O)C(C)(C)C)c(c(c1)C(C)(C)C)O",
        "formula": "C25H36O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "368.5531",
        "optical_activity": "NONE",
        "references": [
          "f32c7f99-9615-41cf-9d66-baca167e3f6d",
          "86fb68ff-9dbd-4a19-9f66-405de5674389"
        ],
        "stereo_centers": 0
      },
      "unii": "RZW97F6CTS"
    }
  ]
}