{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c17a4835-3930-4234-992c-84cb371fe673",
          "code": "7365-45-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7365-45-9",
          "code_system": "CAS",
          "references": [
            "5372c17a-84b6-4ba1-b989-cb4e2364738f",
            "0704500e-7196-46fa-89a8-847681b9b57f"
          ]
        },
        {
          "uuid": "7333e9e5-70f0-4916-be10-499244f5fc5d",
          "code": "HEPES",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/HEPES",
          "code_system": "WIKIPEDIA",
          "references": [
            "5372c17a-84b6-4ba1-b989-cb4e2364738f"
          ]
        },
        {
          "uuid": "0108820b-bdb7-4053-9352-f0bc2386a822",
          "code": "230-907-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.098",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5372c17a-84b6-4ba1-b989-cb4e2364738f"
          ]
        },
        {
          "uuid": "ba0a6b0b-b0a1-46ef-8062-43b31a14b1ca",
          "code": "C80933",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80933",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5372c17a-84b6-4ba1-b989-cb4e2364738f"
          ]
        },
        {
          "uuid": "659ec64f-5669-4dd7-bf78-e6f9c35c9811",
          "code": "1312611",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1312611/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5372c17a-84b6-4ba1-b989-cb4e2364738f"
          ]
        },
        {
          "uuid": "b319c26d-40d4-49dc-b247-25c846c5db76",
          "code": "m5959",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5959?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5372c17a-84b6-4ba1-b989-cb4e2364738f"
          ]
        },
        {
          "uuid": "ea86d5f9-d7b6-4eb0-8afe-69037ec71e13",
          "code": "SUB40482",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5372c17a-84b6-4ba1-b989-cb4e2364738f"
          ]
        },
        {
          "uuid": "1aaa62c2-ba89-ce9d-002f-6229e508a487",
          "code": "DTXSID5040382",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5040382",
          "code_system": "EPA CompTox",
          "references": [
            "81f2fde1-d065-5cdd-b6de-9e6900f75d30"
          ]
        },
        {
          "uuid": "d4900333-c1e6-0bc6-3782-8e2dfadaf5b3",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5b96f4fb-a081-2b19-9630-e26059e1618a"
          ]
        },
        {
          "uuid": "49a7a793-b672-6596-4f8d-1281c63e26b8",
          "code": "23830",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23830",
          "code_system": "PUBCHEM",
          "references": [
            "6dc2408c-7d17-1ff6-fded-1fee8fd424e4"
          ]
        },
        {
          "uuid": "abc9efe0-473d-47f6-8afc-70336a8b4a05",
          "code": "RWW266YE9I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3a8c72fe-03b2-328d-3edc-679ab5f14806",
          "code": "42334",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:42334",
          "code_system": "CHEBI",
          "references": [
            "5b96f4fb-a081-2b19-9630-e26059e1618a"
          ]
        },
        {
          "uuid": "2cfd0973-15b4-de5a-d9c7-49966757d483",
          "code": "166663",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=166663",
          "code_system": "NSC",
          "references": [
            "8bed56b6-f7d4-300d-1eb8-da3960e20bd9"
          ]
        },
        {
          "uuid": "a80eabfc-400f-dbea-a420-79a9914d5836",
          "code": "100000129773",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a320a766-881b-b888-8c01-4ba737bd4789"
          ]
        },
        {
          "uuid": "cad12567-aaf3-6cb7-6d3d-d824e6f94f03",
          "code": "RWW266YE9I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=RWW266YE9I",
          "code_system": "DAILYMED",
          "references": [
            "baf63418-1a4f-a2b8-8d76-879c6d9f38dd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ecf0a30b-1e5c-4283-ba0b-e36ae8b1a7e4",
          "name": "1-PIPERAZINEETHANESULFONIC ACID, 4-(2-HYDROXYETHYL)-",
          "stdName": "1-PIPERAZINEETHANESULFONIC ACID, 4-(2-HYDROXYETHYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "072f41da-3412-4075-9d2e-4a672df238b5",
            "64d0d9a4-666f-4894-a5e6-42f444e4f37f"
          ],
          "display_name": false
        },
        {
          "uuid": "691fad6f-7b5b-480e-83ec-d1de01eeec67",
          "name": "2-(4-(2-HYDROXYETHYL)PIPERAZIN-1-YL)ETHANESULFONIC ACID",
          "stdName": "2-(4-(2-HYDROXYETHYL)PIPERAZIN-1-YL)ETHANESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "072f41da-3412-4075-9d2e-4a672df238b5",
            "64d0d9a4-666f-4894-a5e6-42f444e4f37f"
          ],
          "display_name": false
        },
        {
          "uuid": "38974d25-167e-48b3-b5d8-69f7de8e5e51",
          "name": "4-(2-HYDROXYETHYL)-1-PIPERAZINEETHANE SULFONIC ACID",
          "stdName": "4-(2-HYDROXYETHYL)-1-PIPERAZINEETHANE SULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfe4ac21-c944-4121-821e-41e292379ff1",
            "072f41da-3412-4075-9d2e-4a672df238b5"
          ],
          "display_name": false
        },
        {
          "uuid": "64dae7ce-5320-4271-ad3d-c490882efa1d",
          "name": "4-(2-HYDROXYETHYL)PIPERAZIN-1-YLETHANESULPHONIC ACID",
          "stdName": "4-(2-HYDROXYETHYL)PIPERAZIN-1-YLETHANESULPHONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfe4ac21-c944-4121-821e-41e292379ff1",
            "072f41da-3412-4075-9d2e-4a672df238b5"
          ],
          "display_name": false
        },
        {
          "uuid": "6f3cf8fd-b991-4a7f-a078-2df32811844e",
          "name": "HEPES",
          "stdName": "HEPES",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff6b2b0c-a506-4771-96af-9c07288f0198",
            "c2b751d6-6c5d-404c-9ced-72ccb01297a0",
            "fb2c4833-5e69-4b82-9e4f-1a176a888e5e",
            "d73c18af-d6aa-402a-b7ad-6096f20f6efb"
          ],
          "display_name": false
        },
        {
          "uuid": "98b21fad-ced5-4db8-879b-f1c8b0dcc1eb",
          "name": "HEPES [MI]",
          "stdName": "HEPES [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff6b2b0c-a506-4771-96af-9c07288f0198",
            "c2b751d6-6c5d-404c-9ced-72ccb01297a0"
          ],
          "display_name": false
        },
        {
          "uuid": "94b83462-3257-46ab-bb43-4b80570086ed",
          "name": "HYDROXYETHYLPIPERAZINE ETHANE SULFONIC ACID",
          "stdName": "HYDROXYETHYLPIPERAZINE ETHANE SULFONIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b426e26e-c248-4571-aa00-68aec02bbdd6",
            "c2b751d6-6c5d-404c-9ced-72ccb01297a0",
            "e3ae242d-3106-4fec-a360-8c2c3e944420",
            "072f41da-3412-4075-9d2e-4a672df238b5",
            "d07e5be0-9ce2-49a8-ba4a-7e6506351d3e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5d6b4727-8f97-47c4-9cc1-4e47ae76cc10",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "92f787c7-8d8c-435c-919c-b6f2d62373ba",
          "name": "HYDROXYETHYLPIPERAZINE ETHANE SULFONIC ACID [II]",
          "stdName": "HYDROXYETHYLPIPERAZINE ETHANE SULFONIC ACID [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "072f41da-3412-4075-9d2e-4a672df238b5",
            "d07e5be0-9ce2-49a8-ba4a-7e6506351d3e"
          ],
          "display_name": false
        },
        {
          "uuid": "ee678b0c-ccee-43f5-896e-2f50b955a116",
          "name": "N-2-HYDROXYETHYLPIPERAZINE N'-2'-ETHANESULPHONIC ACID",
          "stdName": "N-2-HYDROXYETHYLPIPERAZINE N'-2'-ETHANESULPHONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6a25b23-9b11-4869-af18-7c6bd0de1b68"
          ],
          "display_name": false
        },
        {
          "uuid": "b9a83717-aa66-4186-a056-205be805af66",
          "name": "NSC-166663",
          "stdName": "NSC-166663",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "411ff07b-b08d-4026-ae63-3582c013c059",
            "1ca9171c-c65f-4dfd-a762-402f2cb5265d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b6a25b23-9b11-4869-af18-7c6bd0de1b68",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d73c18af-d6aa-402a-b7ad-6096f20f6efb",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB5408557.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB5408557.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "072f41da-3412-4075-9d2e-4a672df238b5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d07e5be0-9ce2-49a8-ba4a-7e6506351d3e",
          "citation": "CTFA 2006",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64d0d9a4-666f-4894-a5e6-42f444e4f37f",
          "citation": "ACD 9.0(CTFA 2006)",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfe4ac21-c944-4121-821e-41e292379ff1",
          "citation": "COINED(CTFA 2006)",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "411ff07b-b08d-4026-ae63-3582c013c059",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ca9171c-c65f-4dfd-a762-402f2cb5265d",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff6b2b0c-a506-4771-96af-9c07288f0198",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2b751d6-6c5d-404c-9ced-72ccb01297a0",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5372c17a-84b6-4ba1-b989-cb4e2364738f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390002000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dc91c92-b0cd-405c-9d60-1ea47446009a",
          "citation": "SRS import [RWW266YE9I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RWW266YE9I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390002000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb2c4833-5e69-4b82-9e4f-1a176a888e5e",
          "citation": "HEPES [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b426e26e-c248-4571-aa00-68aec02bbdd6",
          "citation": "HYDROXYETHYLPIPERAZINE ETHANE SULFONIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3ae242d-3106-4fec-a360-8c2c3e944420",
          "citation": "HYDROXYETHYLPIPERAZINE ETHANE SULFONIC ACID [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "81f2fde1-d065-5cdd-b6de-9e6900f75d30",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7365-45-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5b96f4fb-a081-2b19-9630-e26059e1618a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6dc2408c-7d17-1ff6-fded-1fee8fd424e4",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "0704500e-7196-46fa-89a8-847681b9b57f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8bed56b6-f7d4-300d-1eb8-da3960e20bd9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "baf63418-1a4f-a2b8-8d76-879c6d9f38dd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a320a766-881b-b888-8c01-4ba737bd4789",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "45aa2c84-041c-4332-b304-7c014d27b164",
          "id": "45aa2c84-041c-4332-b304-7c014d27b164",
          "molfile": "\n  Marvin  01132103402D          \n\n 15 15  0  0  0  0            999 V2000\n   -3.9949   -0.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2021   -0.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5049   -0.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7214   -0.6447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3018   -1.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4720   -1.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0617   -0.6355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6695   -0.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3358   -0.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0453   -0.6725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9554   -0.6725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0453   -1.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0453    0.0463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4874    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3049    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 15  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 10  2  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "C1CN(CCN1CCO)CCS(=O)(=O)O",
          "formula": "C8H18N2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1281c8c9-acd4-4178-b736-9462d5954362"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "238.3059",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6a351ea9-2452-42c7-a6d5-3a0417c667cb",
      "version": "10",
      "structure": {
        "id": "7dd51dad-5dbe-4fa7-9f9d-ddf84d0c451b",
        "molfile": "\n  Marvin  01132106322D          \n\n 15 15  0  0  0  0            999 V2000\n    2.0453   -0.6725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3358   -0.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0617   -0.6355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7214   -0.6447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0453   -1.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0453    0.0463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9554   -0.6725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6695   -0.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4720   -1.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4874    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3018   -1.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3049    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5049   -0.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9949   -0.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2021   -0.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4 11  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 13  1  0  0  0  0\n  4 12  1  0  0  0  0\nM  END",
        "smiles": "C1CN(CCN1CCO)CCS(=O)(=O)O",
        "formula": "C8H18N2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "238.3059",
        "optical_activity": "NONE",
        "references": [
          "4dc91c92-b0cd-405c-9d60-1ea47446009a",
          "b6a25b23-9b11-4869-af18-7c6bd0de1b68"
        ],
        "stereo_centers": 0
      },
      "unii": "RWW266YE9I"
    }
  ]
}