{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6f0c4efa-e527-4b9a-a52b-640820f03783", "code": "74499-58-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=74499-58-4", "code_system": "CAS", "references": [ "3fea5167-9b81-412a-8ece-0925f2f4fd62", "acae2cdc-e7b6-49b3-86b1-8689b1463fb6" ] }, { "uuid": "18d39d98-1572-4720-a6cd-dd75a3a72ebf", "code": "277-895-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.792", "code_system": "ECHA (EC/EINECS)", "references": [ "3fea5167-9b81-412a-8ece-0925f2f4fd62" ] }, { "uuid": "3986b1ea-e667-4840-a6b7-b58aa90144fe", "code": "121494096", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/121494096", "code_system": "PUBCHEM", "references": [ "3fea5167-9b81-412a-8ece-0925f2f4fd62" ] }, { "uuid": "511ab162-a62f-4f4a-bc08-0c7f99c4cc98", "code": "RVU21J753H", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4145dfa4-bec1-4954-fb93-5370e402c965", "code": "DTXSID70868311", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70868311", "code_system": "EPA CompTox", "references": [ "91090303-650f-5b97-592d-436f52f3a12e" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ce0e3cef-34e0-40aa-b123-f89748bb7041", "name": "4,7,7-TRIMETHYL-2-(3-METHYL-2-BUTEN-1-YL)BICYCLO(4.1.0)HEPTAN-3-ONE", "stdName": "4,7,7-TRIMETHYL-2-(3-METHYL-2-BUTEN-1-YL)BICYCLO(4.1.0)HEPTAN-3-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "67a2f259-8ebd-421b-bb49-97800466c7e5" ], "display_name": true }, { "uuid": "e6a6bcca-a335-431a-9b18-2ae04a971d25", "name": "BICYCLO(4.1.0)HEPTAN-3-ONE, 4,7,7-TRIMETHYL-2-(3-METHYL-2-BUTEN-1-YL)-", "stdName": "BICYCLO(4.1.0)HEPTAN-3-ONE, 4,7,7-TRIMETHYL-2-(3-METHYL-2-BUTEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "92935bcc-392c-4f36-81d4-a7170d95d7ee" ], "display_name": false }, { "uuid": "b4a2c45a-5207-474d-8313-151c6de8fa08", "name": "PRECARONE", "stdName": "PRECARONE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5d026edc-8619-4be8-a67e-74f0f883b118" ], "display_name": false } ], "references": [ { "uuid": "92935bcc-392c-4f36-81d4-a7170d95d7ee", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5d026edc-8619-4be8-a67e-74f0f883b118", "citation": "http://www.google.com/patents/WO2006102777A1?cl=en", "url": "http://www.google.com/patents/WO2006102777A1?cl=en", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "67a2f259-8ebd-421b-bb49-97800466c7e5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3fea5167-9b81-412a-8ece-0925f2f4fd62", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392627000, "tags": [ "NOMEN" ] }, { "uuid": "72826956-c33b-4751-b503-fc3d892540f4", "citation": "SRS import [RVU21J753H]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RVU21J753H", "doc_type": "SRS", "public_domain": true, "document_date": 1493392627000, "tags": [ "NOMEN" ] }, { "uuid": "acae2cdc-e7b6-49b3-86b1-8689b1463fb6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "91090303-650f-5b97-592d-436f52f3a12e", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d32aaa6d-08fa-4deb-bf2a-8428cbf82174", "id": "d32aaa6d-08fa-4deb-bf2a-8428cbf82174", "molfile": "\n Marvin 01132110552D \n\n 16 17 0 0 0 0 999 V2000\n 5.4401 -9.2587 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.1532 -9.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8636 -9.2587 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.5740 -9.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8636 -8.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5740 -8.0120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1532 -8.0120 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.1532 -7.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8664 -6.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8664 -5.9555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5841 -5.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1532 -5.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4401 -8.4341 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 4.7223 -8.8413 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.0017 -8.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0017 -9.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 13 1 1 0 0 0 0\n 1 14 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 13 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 13 14 1 1 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\nM END", "smiles": "CC(=CCC1[C@H]2[C@@H](CC(C)C1=O)C2(C)C)C", "formula": "C15H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f1c4318f-e7bb-445c-b0ea-42599b8e32b5" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "220.351", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "250d3879-bef9-4487-a255-eec092de33d4", "version": "6", "structure": { "id": "017c3c02-ffaa-457d-9746-ef60f2f58f7d", "molfile": "\n Marvin 01132100242D \n\n 16 17 0 0 1 0 999 V2000\n 5.4401 -8.4341 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.4401 -9.2587 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.1532 -9.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8636 -9.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8636 -8.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1532 -8.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1532 -7.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8664 -6.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8664 -5.9555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5841 -5.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1532 -5.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5740 -8.0120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5740 -9.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7223 -8.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0017 -8.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0017 -9.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 5 12 2 0 0 0 0\n 4 13 1 0 0 0 0\n 2 14 1 1 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 1 14 1 1 0 0 0\nM END", "smiles": "CC(=CCC1[C@H]2[C@@H](CC(C)C1=O)C2(C)C)C", "formula": "C15H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "220.351", "optical_activity": "UNSPECIFIED", "references": [ "72826956-c33b-4751-b503-fc3d892540f4", "92935bcc-392c-4f36-81d4-a7170d95d7ee" ], "stereo_centers": 4 }, "unii": "RVU21J753H" } ] }