{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5f1250c7-6aa5-4feb-9829-e0fe51df6808",
          "code": "2482-00-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2482-00-0",
          "code_system": "CAS",
          "references": [
            "f52c16d8-a20b-4a81-8e69-7a18c9872f63",
            "fb51e0b2-9fa5-4c20-b4d7-c774f5af910f"
          ]
        },
        {
          "uuid": "e5377b50-543f-4213-8dab-63bfb68008d9",
          "code": "m1451",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1451?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f52c16d8-a20b-4a81-8e69-7a18c9872f63"
          ]
        },
        {
          "uuid": "6c1d34a2-491d-4308-89f0-12354531dafe",
          "code": "219-617-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.835",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f52c16d8-a20b-4a81-8e69-7a18c9872f63"
          ]
        },
        {
          "uuid": "dd705e08-64d1-4031-b127-9ba7d6311508",
          "code": "2794990",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2794990",
          "code_system": "PUBCHEM",
          "references": [
            "f52c16d8-a20b-4a81-8e69-7a18c9872f63"
          ]
        },
        {
          "uuid": "95f97be9-7205-9907-4727-010e33dfc426",
          "code": "DTXSID90179517",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90179517",
          "code_system": "EPA CompTox",
          "references": [
            "0b7c3515-eb4a-19c8-3e6c-aeb4c6c035c0"
          ]
        },
        {
          "uuid": "a26b0920-2eda-7da7-7f76-7b15b3acee6c",
          "code": "402 (Number of products:193)",
          "comments": "Dietary Supplement Label Database|Amino Acid|Agmatine sulfate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=402&item=Agmatine sulfate",
          "code_system": "DSLD",
          "references": [
            "c36e4edd-5be0-ee26-366e-3e259be79953"
          ]
        },
        {
          "uuid": "55ccf4da-223a-b454-448a-e23f02d2d48d",
          "code": "DBSALT000006",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT000006",
          "code_system": "DRUG BANK",
          "references": [
            "c36e4edd-5be0-ee26-366e-3e259be79953"
          ]
        },
        {
          "uuid": "b0de8881-2d4d-4465-b75c-f6b378224ae2",
          "code": "RU0176QL8I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b9b8e980-56a0-40db-b854-fe510cc046f7",
          "name": "AGMATINE SULFATE",
          "stdName": "AGMATINE SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "983f3938-1bb6-4e0a-9266-86e6ea0f3e8e",
            "b8cb1205-bb87-427b-92ad-cfe943d748a1",
            "f68d5afa-bb4b-44ab-af86-0ed6ca162c1e"
          ],
          "display_name": true
        },
        {
          "uuid": "ee966785-5892-4e52-bc8f-752897ab49d7",
          "name": "AGMATINE SULFATE [MI]",
          "stdName": "AGMATINE SULFATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cb1205-bb87-427b-92ad-cfe943d748a1",
            "f68d5afa-bb4b-44ab-af86-0ed6ca162c1e"
          ],
          "display_name": false
        },
        {
          "uuid": "0508800a-e08f-08ac-d0d8-74f178367341",
          "name": "Agmatine sulfate [WHO-DD]",
          "stdName": "AGMATINE SULFATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edf488d0-749e-d217-fa63-d542995222f5"
          ],
          "display_name": false
        },
        {
          "uuid": "20aee2c7-8812-4c53-9374-7703415c8574",
          "name": "GUANIDINE, N-(4-AMINOBUTYL)-, SULFATE (1:1)",
          "stdName": "GUANIDINE, N-(4-AMINOBUTYL)-, SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb0b0ac2-c25d-4a00-8edb-107a564f992d",
            "b8cb1205-bb87-427b-92ad-cfe943d748a1"
          ],
          "display_name": false
        },
        {
          "uuid": "14803bb1-335b-49d1-9ee0-e84809378200",
          "name": "NIH-11035",
          "stdName": "NIH-11035",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb0b0ac2-c25d-4a00-8edb-107a564f992d",
            "b8cb1205-bb87-427b-92ad-cfe943d748a1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f68d5afa-bb4b-44ab-af86-0ed6ca162c1e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b8cb1205-bb87-427b-92ad-cfe943d748a1",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb0b0ac2-c25d-4a00-8edb-107a564f992d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f52c16d8-a20b-4a81-8e69-7a18c9872f63",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392591000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d134564a-5d9d-4b78-abe1-adb5da56cbbd",
          "citation": "SRS import [RU0176QL8I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RU0176QL8I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392591000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "983f3938-1bb6-4e0a-9266-86e6ea0f3e8e",
          "citation": "AGMATINE SULFATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b78950c-7867-9bc3-708a-eef5ad3a431e",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0b7c3515-eb4a-19c8-3e6c-aeb4c6c035c0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2482-00-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c36e4edd-5be0-ee26-366e-3e259be79953",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fb51e0b2-9fa5-4c20-b4d7-c774f5af910f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "edf488d0-749e-d217-fa63-d542995222f5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a87cd633-97bb-4ea9-a1fc-34ae436855eb",
          "id": "a87cd633-97bb-4ea9-a1fc-34ae436855eb",
          "molfile": "\n  Marvin  01132108452D          \n\n  5  4  0  0  0  0            999 V2000\n   16.7340   -9.6439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7340  -10.4690    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7340  -11.2939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9090  -10.4690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5590  -10.4690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "496a0b84-a490-4744-932e-a44b0dff08fc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9837d2bc-df63-49e5-9c70-1db75eabc1b2",
          "id": "9837d2bc-df63-49e5-9c70-1db75eabc1b2",
          "molfile": "\n  Marvin  01132107542D          \n\n  9  8  0  0  0  0            999 V2000\n   10.6768   -7.9318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9592   -8.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2417   -7.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5290   -8.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8116   -7.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0986   -8.3577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3811   -7.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6637   -8.3623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3811   -7.1173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  END",
          "smiles": "C(CCNC(=N)N)CN",
          "formula": "C5H14N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1fee6098-8fc9-4a65-84c1-9e6705f54a8b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "130.1917",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b68a0f87-beaa-458f-bdb3-6f1485ba099f",
      "version": "9",
      "structure": {
        "id": "743e26e8-16d6-424d-a817-b9d68fe652e0",
        "molfile": "\n  Marvin  01132106022D          \n\n 14 12  0  0  0  0            999 V2000\n   12.8913   -8.0649    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8913   -7.4293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8913   -8.7004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2557   -8.0649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5268   -8.0649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8116   -7.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0986   -8.3577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3811   -7.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6637   -8.3623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3811   -7.1173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5290   -8.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2417   -7.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9592   -8.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6768   -7.9318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "C(CCNC(=N)N)CN.OS(=O)(=O)O",
        "formula": "C5H14N4.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.2712",
        "optical_activity": "NONE",
        "references": [
          "fb0b0ac2-c25d-4a00-8edb-107a564f992d",
          "d134564a-5d9d-4b78-abe1-adb5da56cbbd"
        ],
        "stereo_centers": 0
      },
      "unii": "RU0176QL8I"
    }
  ]
}