{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "06ab04c6-cf59-4c7a-9d4c-fd383793b9a2",
          "code": "100368-98-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=100368-98-7",
          "code_system": "CAS",
          "references": [
            "418b2376-f0ed-40af-a1b8-35a85bf3534a",
            "6cb1dcea-7461-4190-a5e0-13403bda09e7"
          ]
        },
        {
          "uuid": "90a28db8-a95f-411f-8d45-3bcc14fe751d",
          "code": "PHENETRAZINE",
          "comments": "New stimulant, Phenetrazine (3-ethyl-2-phenylmorpholine): Not to be confused with Phenmetrazine (3-methyl-2-phenylmorpholine)",
          "type": "PRIMARY",
          "url": "http://www.bluelight.org/vb/threads/745707-New-stimulant-Phenetrazine-(3-ethyl-2-phenylmorpholine)",
          "code_system": "WEB RESOURCE",
          "references": [
            "418b2376-f0ed-40af-a1b8-35a85bf3534a"
          ]
        },
        {
          "uuid": "85c93d5c-a7a9-4583-a939-1566560824db",
          "code": "3-ETHYL-2-PHENYLMORPHOLINE",
          "comments": "InChI:InChI=1S/C12H17NO/c1-2-11-12(14-9-8-13-11)10-6-4-3-5-7-10/h3-7,11-13H,2,8-9H2,1H3; InChI key:DOMAVIHZFHQQHF-UHFFFAOYSA-N; SMILES:CCC1NCCOC1c1ccccc1",
          "type": "PRIMARY",
          "url": "http://nsddb.eu/substance/568/",
          "code_system": "MANUFACTURER PRODUCT INFORMATION",
          "references": [
            "418b2376-f0ed-40af-a1b8-35a85bf3534a"
          ]
        },
        {
          "uuid": "e8bf4ad9-0d5b-44f7-ba8b-bce5be2d7a98",
          "code": "43350824",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/43350824",
          "code_system": "PUBCHEM",
          "references": [
            "418b2376-f0ed-40af-a1b8-35a85bf3534a"
          ]
        },
        {
          "uuid": "1ab4b3c2-99cc-46ed-b8fe-19da7653f8c8",
          "code": "RT2R95YBRR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "08b08a5b-98ec-bd5a-fee3-cf0897c2200d",
          "code": "Designer-drugs-Phenetrazine",
          "comments": "Wikipedia|List of designer drugs|Stimulants|Phenylmorpholines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "9b1a4964-8639-3d7d-6517-d21d5b1a6339"
          ]
        },
        {
          "uuid": "57a53fd9-15cf-1990-e172-454634d53a8d",
          "code": "DTXSID801342627",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801342627",
          "code_system": "EPA CompTox",
          "references": [
            "73d2325b-ed34-ebab-58fb-d56b2ecac33d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1769f3d3-969c-4213-8e83-595ce9d63692",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a45164ff-6c19-47d6-82e2-39391602a019",
            "refuuid": "c073cac2-1d4c-4fd0-ae51-80a3ec46a678",
            "name": "PHENETRAZINE",
            "unii": "RT2R95YBRR",
            "linking_id": "RT2R95YBRR",
            "ref_pname": "PHENETRAZINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "58ea2732-b4aa-4d85-b596-c19c0e758a68",
          "name": "2-PHENYL-3-ETHYLMORPHOLINE",
          "stdName": "2-PHENYL-3-ETHYLMORPHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e29a102e-7e69-40d9-82b0-45739d4df8a6"
          ],
          "display_name": false
        },
        {
          "uuid": "a9427b94-6c8d-43cd-aecb-1f4030aa871e",
          "name": "3-ETHYL-2-PHENYLMORPHOLINE",
          "stdName": "3-ETHYL-2-PHENYLMORPHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e29a102e-7e69-40d9-82b0-45739d4df8a6"
          ],
          "display_name": false
        },
        {
          "uuid": "df413390-38a8-4548-93bf-1f358a161eff",
          "name": "MORPHOLINE, 3-ETHYL-2-PHENYL-",
          "stdName": "MORPHOLINE, 3-ETHYL-2-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36297b21-898d-45bb-82f1-99d0c61d3dfa"
          ],
          "display_name": false
        },
        {
          "uuid": "fc621434-af9e-4d4a-8c66-9cb2f659790e",
          "name": "PE",
          "stdName": "PE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adffcaae-5a59-4391-9628-765d2c879610"
          ],
          "display_name": false
        },
        {
          "uuid": "9f07abe6-d78f-412d-8df5-7a29a44f44fe",
          "name": "PHENETRAZINE",
          "stdName": "PHENETRAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d77709ea-b912-4345-bc71-a1b2b6218f5d"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "d77709ea-b912-4345-bc71-a1b2b6218f5d",
          "citation": "Said IOUGHLISSEN-French ANSM; 2/17/2016 E-Mail List",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "adffcaae-5a59-4391-9628-765d2c879610",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36297b21-898d-45bb-82f1-99d0c61d3dfa",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e29a102e-7e69-40d9-82b0-45739d4df8a6",
          "citation": "WEB PAGE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "418b2376-f0ed-40af-a1b8-35a85bf3534a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393304000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "397f51bd-a3c1-4221-99cf-733f7789ce39",
          "citation": "SRS import [RT2R95YBRR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RT2R95YBRR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393304000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cb1dcea-7461-4190-a5e0-13403bda09e7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9b1a4964-8639-3d7d-6517-d21d5b1a6339",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "73d2325b-ed34-ebab-58fb-d56b2ecac33d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "77a5e9e5-effd-4a1c-adc9-6c0fc795d5e7",
          "id": "77a5e9e5-effd-4a1c-adc9-6c0fc795d5e7",
          "molfile": "\n  Marvin  01132106132D          \n\n 14 15  0  0  0  0            999 V2000\n    5.6558   -6.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0683   -5.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6604   -4.7451    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.8355   -4.7395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4279   -4.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8451   -3.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6700   -3.3162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0777   -4.0334    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.9026   -4.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3210   -3.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1460   -3.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5569   -4.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1385   -4.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3092   -4.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "CCC1C(c2ccccc2)OCCN1",
          "formula": "C12H17NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e00367d0-ccee-4351-976f-24ad67168ed9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "191.2699",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c073cac2-1d4c-4fd0-ae51-80a3ec46a678",
      "version": "6",
      "structure": {
        "id": "c28b42a9-9ff1-450b-8808-c86b7513c09a",
        "molfile": "\n  Marvin  01132110032D          \n\n 14 15  0  0  0  0            999 V2000\n    6.0777   -4.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9026   -4.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3210   -3.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1460   -3.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5569   -4.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1385   -4.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3092   -4.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6700   -3.3162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8451   -3.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4279   -4.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8355   -4.7395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6604   -4.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0683   -5.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6558   -6.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  2  7  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "CCC1C(c2ccccc2)OCCN1",
        "formula": "C12H17NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "191.2699",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d77709ea-b912-4345-bc71-a1b2b6218f5d",
          "397f51bd-a3c1-4221-99cf-733f7789ce39"
        ],
        "stereo_centers": 2
      },
      "unii": "RT2R95YBRR"
    }
  ]
}