{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bbb54d3e-5aa0-4477-a141-da478d22eaba",
          "code": "72741-87-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72741-87-8",
          "code_system": "CAS",
          "references": [
            "4ee4e55c-abd5-4534-aafd-78f5a2cd3acd",
            "d0c57b0e-4002-4a4e-9500-de05f9c9089f"
          ]
        },
        {
          "uuid": "791075a9-e963-45b1-8cd8-393fdf44d1f4",
          "code": "D017026",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68017026",
          "code_system": "MESH",
          "references": [
            "4ee4e55c-abd5-4534-aafd-78f5a2cd3acd"
          ]
        },
        {
          "uuid": "5f5f6f2a-7194-427e-8a16-c075d9639687",
          "code": "SWAINSONINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Swainsonine",
          "code_system": "WIKIPEDIA",
          "references": [
            "4ee4e55c-abd5-4534-aafd-78f5a2cd3acd"
          ]
        },
        {
          "uuid": "eeb34507-ec38-481b-a417-d53ed04146f8",
          "code": "8084",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=8084",
          "code_system": "INN",
          "references": [
            "4ee4e55c-abd5-4534-aafd-78f5a2cd3acd"
          ]
        },
        {
          "uuid": "fc9bd77d-173f-4e4c-9a5f-93f2adb73ccc",
          "code": "CHEMBL371197",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL371197",
          "code_system": "ChEMBL",
          "references": [
            "4ee4e55c-abd5-4534-aafd-78f5a2cd3acd"
          ]
        },
        {
          "uuid": "9e157348-f274-4cbb-a71d-c1c332514a7a",
          "code": "51683",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/51683",
          "code_system": "PUBCHEM",
          "references": [
            "4ee4e55c-abd5-4534-aafd-78f5a2cd3acd"
          ]
        },
        {
          "uuid": "cf913bfb-a718-6fc7-8a07-f1809107c79b",
          "code": "DTXSID5046356",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5046356",
          "code_system": "EPA CompTox",
          "references": [
            "96d1bec3-3509-37b6-9368-525d3300aaa7"
          ]
        },
        {
          "uuid": "bde4cb51-0e7e-5ecf-81bd-e3bfc2b1c059",
          "code": "C152742",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152742",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6bb4073b-614c-0265-473f-ad2172a13e8b"
          ]
        },
        {
          "uuid": "a246e8e1-1dd3-3cbf-955c-ea7d5cf4ca2a",
          "code": "C2119",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Carbohydrate Processing Inhibitor[C2117]|Golgi Alpha-Mannosidase II Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2119",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3e6e3389-0b82-dcc9-e53e-d46542983cd5"
          ]
        },
        {
          "uuid": "d9fcf50e-4df0-122d-bd04-5846116dac97",
          "code": "C2080",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Chemoprotective Agent[C2459]|Cytoprotective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2080",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3e6e3389-0b82-dcc9-e53e-d46542983cd5"
          ]
        },
        {
          "uuid": "d158d336-626e-42d1-a76a-7889c21ead7b",
          "code": "RSY4RK37KQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3765a735-7fd7-7aa1-8c55-2a556f86f50a",
          "code": "DB02034",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02034",
          "code_system": "DRUG BANK",
          "references": [
            "3e6e3389-0b82-dcc9-e53e-d46542983cd5"
          ]
        },
        {
          "uuid": "7fc4a50b-0a12-dc47-cba5-cfa1cff1749f",
          "code": "9367",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9367",
          "code_system": "CHEBI",
          "references": [
            "3e6e3389-0b82-dcc9-e53e-d46542983cd5"
          ]
        },
        {
          "uuid": "79b1c855-cc20-9831-61b4-4b3ccbdaed5f",
          "code": "300000036976",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d42d4131-4e33-8f09-9ac3-06587eb2437f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "459521ff-8ede-4691-8ba2-2fdc7e988012",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3b56fc1d-cf14-4d26-a3a5-8389e94a74cf",
            "refuuid": "d43c189e-09d3-4715-b32c-ac29c203dc4b",
            "name": "TRIDOLGOSIR",
            "unii": "RSY4RK37KQ",
            "linking_id": "RSY4RK37KQ",
            "ref_pname": "TRIDOLGOSIR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a5688251-3640-423e-bb25-3ff51b2d8e9d",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "9d4ab9e4-e89a-4345-b329-f3843485416d",
            "refuuid": "29c9b2bb-1c60-4c7b-935f-36e02224c22b",
            "name": "TRIDOLGOSIR HYDROCHLORIDE",
            "unii": "78KR51ES9B",
            "linking_id": "78KR51ES9B",
            "ref_pname": "TRIDOLGOSIR HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e368bdd9-df46-4b1b-ad3f-6732e7bfe603",
          "name": "(1S,2R,8R,8AR)-OCTAHYDRO-1,2,8-INDOLIZINETRIOL",
          "stdName": "(1S,2R,8R,8AR)-OCTAHYDRO-1,2,8-INDOLIZINETRIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6d8ebbb-2ca6-41ba-84da-7ccfeae364df"
          ],
          "display_name": false
        },
        {
          "uuid": "6bc6cc52-f99f-4661-a218-9d620e662a60",
          "name": "1,2,8-INDOLIZINETRIOL, OCTAHYDRO-, (1S-(1.ALPHA.,2.ALPHA.,8.BETA.,8A.BETA.))-",
          "stdName": "1,2,8-INDOLIZINETRIOL, OCTAHYDRO-, (1S-(1.ALPHA.,2.ALPHA.,8.BETA.,8A.BETA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6d8ebbb-2ca6-41ba-84da-7ccfeae364df"
          ],
          "display_name": false
        },
        {
          "uuid": "2b5e1cd8-7645-42be-9722-ae00292e1fbc",
          "name": "SWAINSONINE",
          "stdName": "SWAINSONINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83bbc8f0-26f7-4f55-b821-c3b88947b290"
          ],
          "display_name": false
        },
        {
          "uuid": "c3396193-c635-4111-8eaa-4264629ee7d5",
          "name": "TRIDOLGOSIR",
          "stdName": "TRIDOLGOSIR",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9bd9b12-2924-428d-945e-65440b6c1801",
            "07665676-366f-45d4-a20a-0752b1fb6a90",
            "a5d64623-6642-4ebb-b4f2-3e09ec313577",
            "8d674b51-e781-45d0-8ce8-a9bc96f279e8"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f2d74e52-3ea1-42fb-afba-c9e1831caf77",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "6851e134-ffd1-2322-cbdb-56d95bc3cdcd",
          "name": "Tridolgosir [WHO-DD]",
          "stdName": "TRIDOLGOSIR [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69e2a9b0-16cc-2cce-8243-9825ed228a24"
          ],
          "display_name": false
        },
        {
          "uuid": "8de803fc-0fae-4b6c-8c5e-d2061a17805a",
          "name": "tridolgosir [INN]",
          "stdName": "TRIDOLGOSIR [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07665676-366f-45d4-a20a-0752b1fb6a90"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "07665676-366f-45d4-a20a-0752b1fb6a90",
          "citation": "INN Proposed List 84",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL84.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a6d8ebbb-2ca6-41ba-84da-7ccfeae364df",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83bbc8f0-26f7-4f55-b821-c3b88947b290",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d674b51-e781-45d0-8ce8-a9bc96f279e8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ee4e55c-abd5-4534-aafd-78f5a2cd3acd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390990000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4d2ff30-7eca-4de4-87f5-9a74e99a2fe0",
          "citation": "SRS import [RSY4RK37KQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RSY4RK37KQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390990000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56d0167d-6da9-4362-9b02-fb63ad58423b",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5d64623-6642-4ebb-b4f2-3e09ec313577",
          "citation": "TRIDOLGOSIR [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9bd9b12-2924-428d-945e-65440b6c1801",
          "citation": "TRIDOLGOSIR [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "96d1bec3-3509-37b6-9368-525d3300aaa7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72741-87-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6bb4073b-614c-0265-473f-ad2172a13e8b",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3e6e3389-0b82-dcc9-e53e-d46542983cd5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d0c57b0e-4002-4a4e-9500-de05f9c9089f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "69e2a9b0-16cc-2cce-8243-9825ed228a24",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d42d4131-4e33-8f09-9ac3-06587eb2437f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9c6f1de3-0a60-444b-9d40-e8530d87b465",
          "id": "9c6f1de3-0a60-444b-9d40-e8530d87b465",
          "molfile": "\n  Marvin  01132108082D          \n\n 12 13  0  0  1  0            999 V2000\n    5.9884   -2.8442    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.1634   -2.8442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4723   -3.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2511   -3.2543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9699   -3.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6843   -3.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6843   -2.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9699   -2.0192    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.9699   -1.1943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2511   -2.4293    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4723   -2.1759    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.0575   -1.4615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n 10  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  1  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\nM  END",
          "smiles": "C1CC([C@@H]2[C@@H]([C@@H](CN2C1)O)O)O",
          "formula": "C8H15NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "074a3e38-911e-4309-85d9-2beb1fb1e230"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "173.2099",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d43c189e-09d3-4715-b32c-ac29c203dc4b",
      "version": "16",
      "structure": {
        "id": "82cbe97e-df0f-47a5-aee2-3b25c2dce5fa",
        "molfile": "\n  Marvin  01132106472D          \n\n 13 14  0  0  1  0            999 V2000\n    7.2511   -3.2543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2511   -2.4293    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4723   -2.1759    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.0575   -1.4615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9884   -2.8442    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4723   -3.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1634   -2.8442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9699   -2.0192    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9699   -1.1943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6843   -2.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6843   -3.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9699   -3.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2511   -1.6045    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  1  0  0  0\n  8  2  1  0  0  0  0\n  8  9  1  6  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  1  0  0  0  0\n  2 13  1  6  0  0  0\nM  END",
        "smiles": "C1C[C@H]([C@]2([H])[C@@H]([C@@H](CN2C1)O)O)O",
        "formula": "C8H15NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "173.2099",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "56d0167d-6da9-4362-9b02-fb63ad58423b",
          "d4d2ff30-7eca-4de4-87f5-9a74e99a2fe0",
          "07665676-366f-45d4-a20a-0752b1fb6a90"
        ],
        "stereo_centers": 4
      },
      "unii": "RSY4RK37KQ"
    }
  ]
}