{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9caec34f-164d-424f-b9a3-8fc82159ff61",
          "code": "17040-19-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17040-19-6",
          "code_system": "CAS",
          "references": [
            "47e0433c-c9cd-41a5-8a64-f285f6387b4a",
            "4704e46c-f0e2-42e5-9e29-10e08b03f5ca"
          ]
        },
        {
          "uuid": "491922ee-6442-48a0-8f5a-fc44ef6928c1",
          "code": "241-109-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.357",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "47e0433c-c9cd-41a5-8a64-f285f6387b4a"
          ]
        },
        {
          "uuid": "2567da9d-7fb2-4d8a-9f10-a79b36fca963",
          "code": "28213",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28213",
          "code_system": "PUBCHEM",
          "references": [
            "47e0433c-c9cd-41a5-8a64-f285f6387b4a"
          ]
        },
        {
          "uuid": "80ffef4b-a9be-876a-59db-03058eeddd1d",
          "code": "DTXSID4037582",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4037582",
          "code_system": "EPA CompTox",
          "references": [
            "39b3d423-b625-539f-aa07-3dbd0bdce671"
          ]
        },
        {
          "uuid": "be46c1a3-c1bf-4bdf-a644-5f913bfaba7c",
          "code": "RSO143122K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ffc3237e-9df4-087d-c35d-5b33f110ad8f",
          "code": "demeton-S-methylsulphon",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/demeton-S-methylsulphon.html",
          "code_system": "ALANWOOD",
          "references": [
            "f444da40-fa68-513f-f275-403493f9a7b1"
          ]
        },
        {
          "uuid": "4ac0795d-219a-e59d-296a-4a34454bb811",
          "code": "RSO143122K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(RSO143122K)",
          "code_system": "DAILYMED",
          "references": [
            "f67e87d5-9018-89dc-a875-6452d5583b2e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ba33a613-a1fc-495a-bba6-17bc0be3b258",
          "name": "DEMETON-S-METHYLSULFON",
          "stdName": "DEMETON-S-METHYLSULFON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4680c7d9-a1b9-4477-aea8-37cadd22563f"
          ],
          "display_name": false
        },
        {
          "uuid": "2c79bf35-26aa-46cd-898e-60823e28ea60",
          "name": "DEMETON-S-METHYLSULFONE",
          "stdName": "DEMETON-S-METHYLSULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d360c80-5fb1-483b-b842-008335c58390"
          ],
          "display_name": true
        },
        {
          "uuid": "09acff9b-9688-486a-9e6c-4b4ef338929f",
          "name": "DEMETON-S-METHYLSULPHON",
          "stdName": "DEMETON-S-METHYLSULPHON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "705d9059-db06-43f0-b7bf-c25a67f74dcb",
            "07dfaf59-3d0a-4b5c-bd77-611688132210"
          ],
          "display_name": false
        },
        {
          "uuid": "cd62e8c3-5712-4080-9abe-7a6a1a3e8e3e",
          "name": "DEMETON-S-METHYLSULPHON [ISO]",
          "stdName": "DEMETON-S-METHYLSULPHON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "705d9059-db06-43f0-b7bf-c25a67f74dcb"
          ],
          "display_name": false
        },
        {
          "uuid": "31c4e59b-af55-4609-8b56-cf8d7c0e56e7",
          "name": "OXYDEMETON-METHYL SULFONE",
          "stdName": "OXYDEMETON-METHYL SULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8318427-6eec-43b3-99b5-13f638591c13"
          ],
          "display_name": false
        },
        {
          "uuid": "1caa8f66-1d40-443f-a0c2-6e782354a373",
          "name": "OXYDEMETONMETHYL SULFONE",
          "stdName": "OXYDEMETONMETHYL SULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d360c80-5fb1-483b-b842-008335c58390"
          ],
          "display_name": false
        },
        {
          "uuid": "dc897c7f-3c0d-4969-92d2-2bba4983be10",
          "name": "PHOSPHOROTHIOIC ACID, S-(2-(ETHYLSULFONYL)ETHYL) O,O-DIMETHYL ESTER",
          "stdName": "PHOSPHOROTHIOIC ACID, S-(2-(ETHYLSULFONYL)ETHYL) O,O-DIMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d360c80-5fb1-483b-b842-008335c58390"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4680c7d9-a1b9-4477-aea8-37cadd22563f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e8318427-6eec-43b3-99b5-13f638591c13",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "705d9059-db06-43f0-b7bf-c25a67f74dcb",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d360c80-5fb1-483b-b842-008335c58390",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47e0433c-c9cd-41a5-8a64-f285f6387b4a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "266f1ca4-04b6-41a6-9131-3272e88aff67",
          "citation": "SRS import [RSO143122K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RSO143122K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5134487d-b022-45d4-b32f-e619942629e4",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07dfaf59-3d0a-4b5c-bd77-611688132210",
          "citation": "DEMETON-S-METHYLSULPHON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39b3d423-b625-539f-aa07-3dbd0bdce671",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17040-19-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f444da40-fa68-513f-f275-403493f9a7b1",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4704e46c-f0e2-42e5-9e29-10e08b03f5ca",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f67e87d5-9018-89dc-a875-6452d5583b2e",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "657f01fc-ba92-448c-9de3-01b0f5f956bb",
          "id": "657f01fc-ba92-448c-9de3-01b0f5f956bb",
          "molfile": "\n  Marvin  01132105172D          \n\n 14 13  0  0  0  0            999 V2000\n    4.1353   -4.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8591   -4.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5654   -4.9545    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9933   -4.2648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1461   -5.6760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2955   -5.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0086   -4.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7302   -5.3843    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4538   -4.9906    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0346   -4.2648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8603   -5.7099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6928   -5.7099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1839   -4.5904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9120   -4.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "CCS(=O)(=O)CCSP(=O)(OC)OC",
          "formula": "C6H15O5PS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "76a4a239-5631-4a8a-a183-5247403aeed1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "262.2865",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ec8c2d1a-16e5-47a2-820d-a18adbb85343",
      "version": "5",
      "structure": {
        "id": "09c7fa31-f731-422f-ab23-985b4bbdad53",
        "molfile": "\n  Marvin  01132100462D          \n\n 14 13  0  0  0  0            999 V2000\n    8.4538   -4.9906    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7302   -5.3843    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0086   -4.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2955   -5.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5654   -4.9545    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8591   -4.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1353   -4.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9933   -4.2648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1461   -5.6760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8603   -5.7099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6928   -5.7099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1839   -4.5904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9120   -4.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0346   -4.2648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  5  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1 14  2  0  0  0  0\nM  END",
        "smiles": "CCS(=O)(=O)CCSP(=O)(OC)OC",
        "formula": "C6H15O5PS2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "262.2865",
        "optical_activity": "NONE",
        "references": [
          "5134487d-b022-45d4-b32f-e619942629e4",
          "266f1ca4-04b6-41a6-9131-3272e88aff67"
        ],
        "stereo_centers": 0
      },
      "unii": "RSO143122K"
    }
  ]
}