{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "57b71191-d23e-4200-ac36-59d15672269e",
          "code": "72102-84-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72102-84-2",
          "code_system": "CAS",
          "references": [
            "25e20439-a2d0-42a0-b16a-f2f398bc134d",
            "835811ff-3def-4d63-8db2-f39efbcd7d9a"
          ]
        },
        {
          "uuid": "cb4afcf5-6ba6-492b-8920-27485d86925c",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "25e20439-a2d0-42a0-b16a-f2f398bc134d"
          ]
        },
        {
          "uuid": "ebe678db-94f8-452c-b694-0d666367e56e",
          "code": "21 CFR 178.3297",
          "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297",
          "code_system": "CFR",
          "references": [
            "25e20439-a2d0-42a0-b16a-f2f398bc134d"
          ]
        },
        {
          "uuid": "dddf9271-a8c4-41e8-898d-bb533c448be4",
          "code": "276-344-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.069.383",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "25e20439-a2d0-42a0-b16a-f2f398bc134d"
          ]
        },
        {
          "uuid": "e4c2df2b-99e3-0589-4194-921a576bbdc7",
          "code": "DTXSID6072502",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6072502",
          "code_system": "EPA CompTox",
          "references": [
            "0d03deaf-83b6-3ff9-9ab2-9c1bb94a633a"
          ]
        },
        {
          "uuid": "1452c237-f207-42fe-a9a5-bff68440b859",
          "code": "RSE7HB753B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "76650672-5631-41d1-b2ea-4171ddbf142f",
          "name": "2,4,6(1H,3H,5H)-PYRIMIDINETRIONE, 5-(2-(2,3-DIHYDRO-6-METHYL-2-OXO-1H-BENZIMIDAZOL-5-YL)DIAZENYL)-",
          "stdName": "2,4,6(1H,3H,5H)-PYRIMIDINETRIONE, 5-(2-(2,3-DIHYDRO-6-METHYL-2-OXO-1H-BENZIMIDAZOL-5-YL)DIAZENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": false
        },
        {
          "uuid": "9407e3ee-a83b-4174-83fb-1279e568a683",
          "name": "5-((2,3-DIHYDRO-6-METHYL-2-OXO-1H- BENZIMIDAZOL-5-YL)AZO)-2,4,6(1H,3H,5H)- PYRIMIDINETRIONE",
          "stdName": "5-((2,3-DIHYDRO-6-METHYL-2-OXO-1H- BENZIMIDAZOL-5-YL)AZO)-2,4,6(1H,3H,5H)- PYRIMIDINETRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bf13158-3096-45dc-9448-f1c005819f1b"
          ],
          "display_name": false
        },
        {
          "uuid": "300bd0a9-00e0-4f81-b137-e18f18d69091",
          "name": "C.I. 12760",
          "stdName": "C.I. 12760",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": false
        },
        {
          "uuid": "057bebb0-41ac-4aca-8aab-45e30b1bd14f",
          "name": "C.I. PIGMENT ORANGE 64",
          "stdName": "C.I. PIGMENT ORANGE 64",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": false
        },
        {
          "uuid": "a476dbac-88dc-4baf-a686-2485970a030d",
          "name": "CI 12760",
          "stdName": "CI 12760",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": false
        },
        {
          "uuid": "a95fc75b-3a26-44ec-af5e-646a2045afdc",
          "name": "CROMOPHTAL ORANGE GL",
          "stdName": "CROMOPHTAL ORANGE GL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": false
        },
        {
          "uuid": "0f10a7d7-6124-480c-afc2-ed37b85f1d40",
          "name": "CROMOPHTAL ORANGE GP",
          "stdName": "CROMOPHTAL ORANGE GP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": false
        },
        {
          "uuid": "1604f6be-d89a-4958-aeb4-b283adbad68f",
          "name": "MICROLEN ORANGE GP-MP",
          "stdName": "MICROLEN ORANGE GP-MP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": false
        },
        {
          "uuid": "ce6b4dce-de28-43db-81ea-8159dafe2c5d",
          "name": "PIGMENT ORANGE 64",
          "stdName": "PIGMENT ORANGE 64",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f372b-0607-4c3e-9e3a-6d6cc01d250d"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "9bf13158-3096-45dc-9448-f1c005819f1b",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "058f372b-0607-4c3e-9e3a-6d6cc01d250d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25e20439-a2d0-42a0-b16a-f2f398bc134d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1fdb1d2-c0f4-403c-83aa-373a2a5f4ba6",
          "citation": "SRS import [RSE7HB753B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RSE7HB753B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d03deaf-83b6-3ff9-9ab2-9c1bb94a633a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72102-84-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "835811ff-3def-4d63-8db2-f39efbcd7d9a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "57f6f788-3fa3-4da5-9705-88debfba5f07",
          "id": "57f6f788-3fa3-4da5-9705-88debfba5f07",
          "molfile": "\n  Marvin  01132104342D          \n\n 22 24  0  0  0  0            999 V2000\n    1.3586   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0731   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7876   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5020   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2866   -2.8396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7716   -2.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5966   -2.1722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2866   -1.5048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5020   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7876   -1.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0731   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3586   -1.3472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6442   -1.7597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0703   -1.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0703   -0.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6442   -0.1097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7848   -0.1097    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4993   -0.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2137   -0.1097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4993   -1.3472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7848   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7848   -2.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 11  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 21  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  2  0  0  0  0\nM  END",
          "smiles": "Cc1cc2c(cc1/N=N/C3C(=O)NC(=O)NC3=O)[nH]c(=O)[nH]2",
          "formula": "C12H10N6O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2df288b4-1441-4844-971b-2661848fb279"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "302.2461",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e0e679d0-d927-4ec8-aa03-78c0ccf20d53",
      "version": "3",
      "structure": {
        "id": "4788882c-b75a-4642-9274-23afdf222b82",
        "molfile": "\n  Marvin  01132103452D          \n\n 22 24  0  0  0  0            999 V2000\n   -1.4993   -0.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7848   -0.1097    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0703   -0.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0703   -1.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7848   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4993   -1.3472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2137   -0.1097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6442   -0.1097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7848   -2.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6442   -1.7597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3586   -1.3472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7716   -2.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2866   -1.5048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5020   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5020   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2866   -2.8396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7876   -1.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0731   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0731   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7876   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5966   -2.1722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3586   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  3  8  2  0  0  0  0\n  5  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 12 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 15 20  2  0  0  0  0\n 14 17  2  0  0  0  0\n 12 21  2  0  0  0  0\n 19 22  1  0  0  0  0\n 11 18  1  0  0  0  0\n  4 10  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc2c(cc1/N=N/C3C(=O)NC(=O)NC3=O)[nH]c(=O)[nH]2",
        "formula": "C12H10N6O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "302.2461",
        "optical_activity": "NONE",
        "references": [
          "058f372b-0607-4c3e-9e3a-6d6cc01d250d",
          "e1fdb1d2-c0f4-403c-83aa-373a2a5f4ba6"
        ],
        "stereo_centers": 0
      },
      "unii": "RSE7HB753B"
    }
  ]
}