{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "eac74414-000e-4193-af2f-1fdb328c8d96",
          "code": "21 CFR 331.11",
          "comments": "PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.11 Listing of specific active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.11",
          "code_system": "CFR",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6"
          ]
        },
        {
          "uuid": "aa629635-ea9a-42bd-83fc-d072ed7b49ee",
          "code": "21 CFR 331.15",
          "comments": "PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.15 Combination with nonantacid active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.15",
          "code_system": "CFR",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6"
          ]
        },
        {
          "uuid": "eab30da3-4932-4c8b-a985-59b633a37c1c",
          "code": "22004",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3981",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6"
          ]
        },
        {
          "uuid": "1eeb3190-2785-495f-8cdc-79292137c936",
          "code": "1371315",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1371315/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6"
          ]
        },
        {
          "uuid": "56a0d64a-a574-4c3a-92cf-9ee71c318479",
          "code": "m10473",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10473?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6"
          ]
        },
        {
          "uuid": "030f66ff-827f-489d-b74a-12bb40086cb8",
          "code": "205-695-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.178",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6"
          ]
        },
        {
          "uuid": "baef1b22-1fd8-4d88-9c03-f4f0aa8bdac1",
          "code": "439655",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439655",
          "code_system": "PUBCHEM",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6"
          ]
        },
        {
          "uuid": "55654e4e-13e3-463b-b032-294334882948",
          "code": "147-71-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=147-71-7",
          "code_system": "CAS",
          "references": [
            "72ed73e3-5c90-4e99-ab29-dccae7a61ff6",
            "332e97ac-75eb-422c-996c-616dd15622d0"
          ]
        },
        {
          "uuid": "631ad205-a068-c57f-31c5-9fc2b995b3f8",
          "code": "DTXSID4043775",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4043775",
          "code_system": "EPA CompTox",
          "references": [
            "d391cbd1-7b92-64cb-beb4-8765e4e354bb"
          ]
        },
        {
          "uuid": "b33fc686-5bf8-a446-b633-d23e80768e2f",
          "code": "DB01694",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01694",
          "code_system": "DRUG BANK",
          "references": [
            "a4ebb211-9f8e-dc0d-9de6-161d35916dae"
          ]
        },
        {
          "uuid": "0ea88274-7b09-4446-9507-094b6f271488",
          "code": "RRX6A4PL3C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d2041b9c-c9ea-ebd9-7324-fededf75ec41",
          "code": "15672",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15672",
          "code_system": "CHEBI",
          "references": [
            "a4ebb211-9f8e-dc0d-9de6-161d35916dae"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cbc250d0-2329-4893-8321-d6df56032c3a",
          "amount": {
            "uuid": "ece1a27c-2380-4828-96fb-1616c737cae5"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f0766917-40d0-4c39-838f-e030493e27f6",
            "refuuid": "6fc8f74b-9269-4382-a312-4a2884285bb1",
            "name": "MILACAINIDE TARTRATE",
            "unii": "320G17CN2U",
            "linking_id": "320G17CN2U",
            "ref_pname": "MILACAINIDE TARTRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1fe9d4c9-4fef-403c-b9fa-d4d937ae63cb",
          "name": "(-)-TARTARIC ACID",
          "stdName": "(-)-TARTARIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "070bbbf6-090c-4719-a804-ed4c0ee629cb"
          ],
          "display_name": false
        },
        {
          "uuid": "22c614e2-5a22-4fcf-ba8c-98876fb2c747",
          "name": "(2S,3S)-2,3-DIHYDROXYBUTANEDIOIC ACID",
          "stdName": "(2S,3S)-2,3-DIHYDROXYBUTANEDIOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "070bbbf6-090c-4719-a804-ed4c0ee629cb"
          ],
          "display_name": false
        },
        {
          "uuid": "f49854a5-258d-408a-b270-5be3b83ee0ec",
          "name": "BUTANEDIOIC ACID, 2,3-DIHYDROXY-, (2S,3S)-",
          "stdName": "BUTANEDIOIC ACID, 2,3-DIHYDROXY-, (2S,3S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "e1e5aea2-c8fb-4fef-97ef-6b630ba3dd67"
          ],
          "display_name": false
        },
        {
          "uuid": "9cfb013a-408e-4d6c-9cad-05adc1025561",
          "name": "D-TARTARIC ACID",
          "stdName": "D-TARTARIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "070bbbf6-090c-4719-a804-ed4c0ee629cb",
            "6066ea52-757b-48f7-a7c7-14ace3bd4a5a",
            "688845da-3037-4870-ae4f-ee536e793783"
          ],
          "display_name": false
        },
        {
          "uuid": "0eb45276-59da-43b5-90c7-20c2ae216ba9",
          "name": "D-TARTARIC ACID [MI]",
          "stdName": "D-TARTARIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "070bbbf6-090c-4719-a804-ed4c0ee629cb"
          ],
          "display_name": false
        },
        {
          "uuid": "18acc744-cf66-4974-88d3-96810f85c2e2",
          "name": "TARTARIC ACID, (-)-",
          "stdName": "TARTARIC ACID, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "697da193-0d35-4685-8e05-b365a6296601"
          ],
          "display_name": false
        },
        {
          "uuid": "6d260428-1747-47f1-92c9-be5d98ce3b2b",
          "name": "Tartaric acid, D-",
          "stdName": "TARTARIC ACID, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "697da193-0d35-4685-8e05-b365a6296601"
          ],
          "display_name": true
        },
        {
          "uuid": "acbd6ac5-90fd-41af-b75d-d270e483d8b5",
          "name": "UNNATURAL TARTARIC ACID",
          "stdName": "UNNATURAL TARTARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "070bbbf6-090c-4719-a804-ed4c0ee629cb"
          ],
          "display_name": false
        },
        {
          "uuid": "84e7cf4e-7964-4dfe-8949-54d154848b49",
          "name": "UNUSUAL TARTARIC ACID",
          "stdName": "UNUSUAL TARTARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a39898e-043b-4085-8f82-6691eafc340f",
            "070bbbf6-090c-4719-a804-ed4c0ee629cb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6066ea52-757b-48f7-a7c7-14ace3bd4a5a",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6a39898e-043b-4085-8f82-6691eafc340f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1e5aea2-c8fb-4fef-97ef-6b630ba3dd67",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "070bbbf6-090c-4719-a804-ed4c0ee629cb",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "697da193-0d35-4685-8e05-b365a6296601",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72ed73e3-5c90-4e99-ab29-dccae7a61ff6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391640000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b6b3cfa-dc6c-47b0-bc61-b288dadf9305",
          "citation": "SRS import [RRX6A4PL3C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RRX6A4PL3C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391640000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "688845da-3037-4870-ae4f-ee536e793783",
          "citation": "D-TARTARIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d391cbd1-7b92-64cb-beb4-8765e4e354bb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=147-71-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a4ebb211-9f8e-dc0d-9de6-161d35916dae",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "332e97ac-75eb-422c-996c-616dd15622d0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "62b240b2-0d45-33c9-f385-14805d4aa0e2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f8a576dd-eaa7-4926-b2ac-c80e4e6998f3",
          "id": "f8a576dd-eaa7-4926-b2ac-c80e4e6998f3",
          "molfile": "\n  Marvin  01132112532D          \n\n 10  9  0  0  1  0            999 V2000\n    4.3954   -3.1905    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.4269   -4.0149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6658   -2.8056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9675   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6343   -1.9811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0937   -2.7511    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.0622   -1.9267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8234   -3.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5216   -2.6966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8548   -3.9605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  END",
          "smiles": "[C@H]([C@@H](C(=O)O)O)(C(=O)O)O",
          "formula": "C4H6O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b5ea3654-8892-4bea-86e1-bcb2f515c0f8"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "150.087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "be8e0803-cd78-47d1-8da1-9fccea9b575c",
      "version": "10",
      "structure": {
        "id": "c27cc405-0160-41a9-8972-d4beb252c1d7",
        "molfile": "\n   JSDraw205072412032D\n\n 10  9  0  0  1  0              0 V2000\n   23.3736   -7.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7264   -8.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0756   -7.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4284   -8.0782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0720   -5.7414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7300   -9.6445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0244   -8.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0280   -9.6507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6716   -7.3138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3700   -5.7476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  2  6  1  1  0  0  0\n  1  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  1 10  1  1  0  0  0\nM  END",
        "smiles": "[C@H]([C@@H](C(=O)O)O)(C(=O)O)O",
        "formula": "C4H6O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "150.087",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0b6b3cfa-dc6c-47b0-bc61-b288dadf9305",
          "6066ea52-757b-48f7-a7c7-14ace3bd4a5a"
        ],
        "stereo_centers": 2
      },
      "unii": "RRX6A4PL3C"
    }
  ]
}