{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b63a8931-f7d7-420d-b37f-58071c36d23b",
          "code": "109646-19-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=109646-19-7",
          "code_system": "CAS",
          "references": [
            "7bdff885-7f66-4962-b8d7-5797f2ba51ab",
            "3974e5ea-4410-4ab5-9a71-c113f1f2385d"
          ]
        },
        {
          "uuid": "ece2bd9d-7850-4fa0-abcf-8ceab3f2829b",
          "code": "58750526",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/58750526",
          "code_system": "PUBCHEM",
          "references": [
            "7bdff885-7f66-4962-b8d7-5797f2ba51ab"
          ]
        },
        {
          "uuid": "88275e40-8c1f-42a6-87cd-09e36ecba813",
          "code": "RQY857DOCC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "184cc7cc-b452-a6e1-d7b6-c6514b4b45fd",
          "code": "2465834",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2465834/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "635976b3-f385-cafd-cca2-3ca5f1e54ff3"
          ]
        },
        {
          "uuid": "75726283-dcee-a228-75f1-59ddba1added",
          "code": "RQY857DOCC",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=RQY857DOCC",
          "code_system": "DAILYMED",
          "references": [
            "ed1c8f84-f693-526b-b014-b52ee5d32674"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ed4add3d-932b-4c96-ae4a-836b7375ddd6",
          "name": "1,2,4-TRIOXOLANE-3-OCTANOIC ACID, 5-OCTYL-",
          "stdName": "1,2,4-TRIOXOLANE-3-OCTANOIC ACID, 5-OCTYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9e4f824-c2a8-4ce8-98db-48e7f042a0c7",
            "3c81da6e-24d7-4894-8e65-87e9c93e7e4c"
          ],
          "display_name": false
        },
        {
          "uuid": "4f9ee91c-5063-4081-9bc3-50423b2b9c2a",
          "name": "OLEIC ACID OZONIDE",
          "stdName": "OLEIC ACID OZONIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c81da6e-24d7-4894-8e65-87e9c93e7e4c",
            "2f0f8184-1286-4a9e-a560-7878534042c3"
          ],
          "display_name": true
        },
        {
          "uuid": "d8c07817-68f4-4812-88db-5dab24f7beda",
          "name": "OLEIC ACID, OZONIDE",
          "stdName": "OLEIC ACID, OZONIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9e4f824-c2a8-4ce8-98db-48e7f042a0c7",
            "3c81da6e-24d7-4894-8e65-87e9c93e7e4c"
          ],
          "display_name": false
        },
        {
          "uuid": "98cc0ada-2daf-4050-a137-09bafe5a412d",
          "name": "OLEINA OZONIZZATA",
          "stdName": "OLEINA OZONIZZATA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c81da6e-24d7-4894-8e65-87e9c93e7e4c",
            "fc4176f4-b1a1-4b0d-9023-d86a820898df"
          ],
          "display_name": false
        },
        {
          "uuid": "aba641b2-f0ab-41fa-927a-49175bacc306",
          "name": "OZONIZED OLEIC ACID",
          "stdName": "OZONIZED OLEIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f274f2b0-55c5-458e-be32-d985671bb891",
            "3c81da6e-24d7-4894-8e65-87e9c93e7e4c",
            "fc4176f4-b1a1-4b0d-9023-d86a820898df"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9c3078a5-7ef9-4730-822b-4c4c0b63f354",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "2f0f8184-1286-4a9e-a560-7878534042c3",
          "citation": "Jpn. Kokai Tokkyo Koho",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3c81da6e-24d7-4894-8e65-87e9c93e7e4c",
          "citation": "PATENT",
          "doc_type": "PATENT",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9e4f824-c2a8-4ce8-98db-48e7f042a0c7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc4176f4-b1a1-4b0d-9023-d86a820898df",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bdff885-7f66-4962-b8d7-5797f2ba51ab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390521000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f8aee85-e078-4b7c-b4a5-985f1729f175",
          "citation": "SRS import [RQY857DOCC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RQY857DOCC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390521000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dba7558-695f-4da6-88c7-4ac6809fd2d9",
          "citation": "http://hal.inria.fr/docs/00/29/61/60/PDF/acp-7-1237-2007.pdf",
          "url": "http://hal.inria.fr/docs/00/29/61/60/PDF/acp-7-1237-2007.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f274f2b0-55c5-458e-be32-d985671bb891",
          "citation": "OZONIZED OLEIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "635976b3-f385-cafd-cca2-3ca5f1e54ff3",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "ed1c8f84-f693-526b-b014-b52ee5d32674",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3974e5ea-4410-4ab5-9a71-c113f1f2385d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c31612a7-3c4e-4646-ac35-443c1a33e821",
          "id": "c31612a7-3c4e-4646-ac35-443c1a33e821",
          "molfile": "\n  Marvin  01132110052D          \n\n 23 23  0  0  0  0            999 V2000\n    4.3021   -7.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7147   -6.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5397   -6.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9521   -5.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7772   -5.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1897   -4.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0147   -4.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4272   -4.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2522   -4.2495    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.7371   -3.5821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5217   -3.8370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5217   -4.6620    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   11.1892   -5.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1030   -5.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7704   -6.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6841   -7.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3516   -7.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2653   -8.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9328   -9.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8466   -9.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0929  -10.2192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5140  -10.3686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7371   -4.9170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 23  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 23 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCC1OC(CCCCCCCC(=O)O)OO1",
          "formula": "C18H34O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5bb8cbc3-fc3c-4616-b492-af8a42534b26"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "330.4603",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cc501542-750e-433d-bfe1-b516591767b9",
      "version": "5",
      "structure": {
        "id": "6192261f-4705-4ccb-a467-46fd6cf33042",
        "molfile": "\n  Marvin  01132105032D          \n\n 23 23  0  0  0  0            999 V2000\n   12.8466   -9.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0929  -10.2192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5140  -10.3686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9328   -9.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2653   -8.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3516   -7.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6841   -7.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7704   -6.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1030   -5.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1892   -5.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5217   -4.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5217   -3.8370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7371   -3.5821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2522   -4.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4272   -4.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0147   -4.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1897   -4.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7772   -5.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9521   -5.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5397   -6.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7147   -6.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3021   -7.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7371   -4.9170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 11  1  0  0  0  0\n 14 23  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCC1OC(CCCCCCCC(=O)O)OO1",
        "formula": "C18H34O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "330.4603",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4f8aee85-e078-4b7c-b4a5-985f1729f175",
          "6dba7558-695f-4da6-88c7-4ac6809fd2d9"
        ],
        "stereo_centers": 2
      },
      "unii": "RQY857DOCC"
    }
  ]
}