{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1e070db1-5bdd-4812-aed2-1be62f5cc518", "code": "14450-05-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=14450-05-6", "code_system": "CAS", "references": [ "a5e554ef-5b0a-42bd-a6eb-a59c9780fd95", "d2915a61-00bf-402f-b869-c456e22d0414" ] }, { "uuid": "da055c10-8e2b-46fa-b9d0-7ce7a28221e1", "code": "238-430-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.921", "code_system": "ECHA (EC/EINECS)", "references": [ "a5e554ef-5b0a-42bd-a6eb-a59c9780fd95" ] }, { "uuid": "825ff162-124c-4f32-87d4-c3a676446b5d", "code": "84447", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84447", "code_system": "PUBCHEM", "references": [ "a5e554ef-5b0a-42bd-a6eb-a59c9780fd95" ] }, { "uuid": "35f71634-62c0-a702-6856-c6906753da38", "code": "DTXSID6027765", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6027765", "code_system": "EPA CompTox", "references": [ "f2653392-7200-3fe1-10c3-4a32729b9055" ] }, { "uuid": "354bafdb-d766-4fd6-b092-cde7c70d86c0", "code": "RNT5EQ94KD", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "e16118f4-a241-470d-9d06-1fbe01e26607", "name": "NONANOIC ACID, 1,1'-(2,2-BIS(((1-OXONONYL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER", "stdName": "NONANOIC ACID, 1,1'-(2,2-BIS(((1-OXONONYL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false }, { "uuid": "a4303612-1396-4430-8ef3-d6670157eb16", "name": "NONANOIC ACID, 2,2-BIS(((1-OXONONYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER", "stdName": "NONANOIC ACID, 2,2-BIS(((1-OXONONYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false }, { "uuid": "192fd8d3-8bea-47ad-ba4e-bbec1f6eed60", "name": "NONANOIC ACID, NEOPENTANETETRAYL ESTER", "stdName": "NONANOIC ACID, NEOPENTANETETRAYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false }, { "uuid": "f03c9340-8981-4faa-92a3-1466194c208f", "name": "PELEMOL PTP", "stdName": "PELEMOL PTP", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "35f666f3-9882-4a6f-9631-a8fc4618590a" ], "display_name": false }, { "uuid": "10ad9f06-8cee-49bd-94f8-4e5230fdee1e", "name": "PENTAERYTHRITOL NONANOATE", "stdName": "PENTAERYTHRITOL NONANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false }, { "uuid": "ba6de718-2f59-469a-8011-c6a7da03dfbb", "name": "PENTAERYTHRITOL TETRAKISPELARGONATE", "stdName": "PENTAERYTHRITOL TETRAKISPELARGONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false }, { "uuid": "82e4e5a5-f1fe-4ddc-93bc-15c0231b61e0", "name": "PENTAERYTHRITOL TETRAPELARGONATE", "stdName": "PENTAERYTHRITOL TETRAPELARGONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false }, { "uuid": "e066e264-c332-4fb4-afb1-7f6fb2a35fd9", "name": "PENTAERYTHRITOL, TETRANONANOATE", "stdName": "PENTAERYTHRITOL, TETRANONANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false }, { "uuid": "a078444d-e5ee-4020-9842-62a3e6dd2bb0", "name": "PENTAERYTHRITYL TETRAPELARGONATE", "stdName": "PENTAERYTHRITYL TETRAPELARGONATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "938cbc71-6cf8-4a38-8f8c-460ca4a5161d", "35f666f3-9882-4a6f-9631-a8fc4618590a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "90114d47-3846-4b3c-b524-7132feae460e", "name_org": "INCI" } ] }, { "uuid": "fa8c02e4-dfa4-4cac-84e1-427ee0c5d8ab", "name": "REOLUBE LP 3600", "stdName": "REOLUBE LP 3600", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a73df876-cea5-4895-955f-79e4357d52dd", "da8ec220-7349-4208-a488-4b56a4d7210d" ], "display_name": false } ], "references": [ { "uuid": "da8ec220-7349-4208-a488-4b56a4d7210d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "35f666f3-9882-4a6f-9631-a8fc4618590a", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a73df876-cea5-4895-955f-79e4357d52dd", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a5e554ef-5b0a-42bd-a6eb-a59c9780fd95", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391046000, "tags": [ "NOMEN" ] }, { "uuid": "7aceb365-d7e7-4ad1-9b5e-c121f59dbf9b", "citation": "SRS import [RNT5EQ94KD]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RNT5EQ94KD", "doc_type": "SRS", "public_domain": true, "document_date": 1493391046000, "tags": [ "NOMEN" ] }, { "uuid": "1b6dd900-a2f7-474f-9db6-008e51282393", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "938cbc71-6cf8-4a38-8f8c-460ca4a5161d", "citation": "PENTAERYTHRITYL TETRAPELARGONATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f2653392-7200-3fe1-10c3-4a32729b9055", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14450-05-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d2915a61-00bf-402f-b869-c456e22d0414", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "84793681-2c67-4310-bc20-d8f7831c316b", "id": "84793681-2c67-4310-bc20-d8f7831c316b", "molfile": "\n Marvin 01132106522D \n\n 49 48 0 0 0 0 999 V2000\n 0.9473 -0.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4561 -1.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2716 -1.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7800 -2.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5956 -2.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1043 -2.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9153 -2.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4240 -3.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2438 -3.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5459 -2.2726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9626 -3.4633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7852 -4.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3984 -4.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0131 -5.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8122 -5.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6242 -5.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1701 -4.6235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8856 -6.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6976 -6.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9637 -6.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7745 -7.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0407 -7.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8480 -8.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1140 -8.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9261 -8.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8497 -5.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0452 -5.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1578 -5.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9380 -4.2323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4398 -5.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3013 -6.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5226 -6.6909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3842 -7.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6054 -7.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4627 -8.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6840 -8.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5473 -9.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9516 -4.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6958 -3.4067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2446 -2.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9887 -1.9936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0491 -2.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5932 -2.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3978 -2.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9509 -1.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7555 -2.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3043 -1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1043 -1.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6574 -1.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 26 13 1 0 0 0 0\n 38 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 2 0 0 0 0\n 42 40 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 47 46 1 0 0 0 0\n 48 47 1 0 0 0 0\n 49 48 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC", "formula": "C41H76O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "428c983d-5f60-42d2-b20c-2e3dcda9c80a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "697.0389", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "4bb6036e-2a48-471a-8010-db46bf779550", "version": "5", "structure": { "id": "ea813cea-3048-4917-8efb-71ddb76a0ad0", "molfile": "\n Marvin 01132112082D \n\n 49 48 0 0 0 0 999 V2000\n 6.2438 -3.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5459 -2.2726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4240 -3.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9153 -2.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1043 -2.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5956 -2.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7800 -2.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2716 -1.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4561 -1.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9473 -0.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9626 -3.4633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7852 -4.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3984 -4.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0131 -5.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8122 -5.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6242 -5.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1701 -4.6235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8856 -6.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6976 -6.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9637 -6.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7745 -7.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0407 -7.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8480 -8.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1140 -8.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9261 -8.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8497 -5.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0452 -5.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1578 -5.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9380 -4.2323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4398 -5.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3013 -6.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5226 -6.6909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3842 -7.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6054 -7.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4627 -8.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6840 -8.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5473 -9.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9516 -4.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6958 -3.4067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2446 -2.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9887 -1.9936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0491 -2.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5932 -2.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3978 -2.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9509 -1.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7555 -2.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3043 -1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1043 -1.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6574 -1.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 1 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 13 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 13 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 2 0 0 0 0\n 42 40 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 47 46 1 0 0 0 0\n 48 47 1 0 0 0 0\n 49 48 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC", "formula": "C41H76O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "697.0389", "optical_activity": "NONE", "references": [ "1b6dd900-a2f7-474f-9db6-008e51282393", "7aceb365-d7e7-4ad1-9b5e-c121f59dbf9b" ], "stereo_centers": 0 }, "unii": "RNT5EQ94KD" } ] }