{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9977049e-1227-4f76-879b-03a94fcc83bb",
          "code": "219-730-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.937",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1de968a7-e5fb-4ce9-891e-ae0f6789c9a2"
          ]
        },
        {
          "uuid": "c96d7878-3f87-4fc5-8756-f37e4dc5a959",
          "code": "2512-29-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2512-29-0",
          "code_system": "CAS",
          "references": [
            "1de968a7-e5fb-4ce9-891e-ae0f6789c9a2",
            "16602078-bc8a-47e1-ac04-8b66b3bd8be7"
          ]
        },
        {
          "uuid": "faa4c8e9-3e98-4f29-a7e9-5f1cf39a4f26",
          "code": "1089943-13-4",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1089943-13-4",
          "code_system": "CAS",
          "references": [
            "1de968a7-e5fb-4ce9-891e-ae0f6789c9a2",
            "bc52a91c-4955-4eff-8206-35f7219ad46b"
          ]
        },
        {
          "uuid": "c8786ed3-ac75-3942-fdf5-7970b210f0f0",
          "code": "6142",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6142",
          "code_system": "HSDB",
          "references": [
            "37e48bd5-1d1e-8e5b-3746-2fd0e7a86d2e"
          ]
        },
        {
          "uuid": "00c95863-ac3b-a862-7cb4-3ffc2f30fda4",
          "code": "DTXSID4041735",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4041735",
          "code_system": "EPA CompTox",
          "references": [
            "7292b844-0618-1fae-32cf-5b467686454e"
          ]
        },
        {
          "uuid": "6319b53d-28d1-77cd-d99b-629ac312b199",
          "code": "1872250",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1872250/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "cfe139dc-e089-4833-8a98-bfbbbe69a751",
          "code": "RMB4YA40UY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "65f3bd3b-8b6d-6ad7-d080-712f9b0ba36b",
          "code": "RMB4YA40UY",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=RMB4YA40UY",
          "code_system": "DAILYMED",
          "references": [
            "f9ad2249-2448-e42e-eccc-485fb1c90707"
          ]
        },
        {
          "uuid": "0ef88c1f-ecdf-d963-1f62-c588b72bcc2c",
          "code": "6131",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6131",
          "code_system": "NSC",
          "references": [
            "af97c062-d9ad-b693-cfad-489b952c98fd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "061d129a-f233-4a72-90b7-084b98c7e674",
          "name": ".ALPHA.-(O-NITRO-P-TOLYLAZO)ACETOACETANILIDE",
          "stdName": ".ALPHA.-(O-NITRO-P-TOLYLAZO)ACETOACETANILIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "d8dd1688-a071-407c-855f-3fadab9e1607",
          "name": "BUTANAMIDE, 2-((4-METHYL-2-NITROPHENYL)AZO)-3-OXO-N-PHENYL-",
          "stdName": "BUTANAMIDE, 2-((4-METHYL-2-NITROPHENYL)AZO)-3-OXO-N-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "89a2458a-4ac0-460d-85d5-4bb7864e36d4",
          "name": "BUTANAMIDE, 2-(2-(4-METHYL-2-NITROPHENYL)DIAZENYL)-3-OXO-N-PHENYL-",
          "stdName": "BUTANAMIDE, 2-(2-(4-METHYL-2-NITROPHENYL)DIAZENYL)-3-OXO-N-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "9942734f-069b-4316-9343-2e284a929802",
          "name": "C.I. 11680",
          "stdName": "C.I. 11680",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "1551822f-63b2-4dd0-98a2-aad4b924a479",
          "name": "C.I. PIGMENT YELLOW 1",
          "stdName": "C.I. PIGMENT YELLOW 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "908449ee-8553-408f-ad7f-96c6345286c2"
          ],
          "display_name": false
        },
        {
          "uuid": "6211c30b-5834-4c66-8d5f-f8eb255c8b06",
          "name": "CI 11680",
          "stdName": "CI 11680",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "62c14689-2025-4c9f-92dc-a936cfb329a2",
            "9509862d-5169-4ba4-9f00-62fffe835cd3",
            "a5c590db-73c0-466e-90bd-a0b254a0a43a"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3fef18d2-c886-4ce7-a7e4-f5b110c48697",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "03a15c4a-fa83-4a6a-802e-95f016ef642a",
          "name": "HANCOCK YELLOW G",
          "stdName": "HANCOCK YELLOW G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "62c14689-2025-4c9f-92dc-a936cfb329a2"
          ],
          "display_name": false
        },
        {
          "uuid": "acb87b6d-bca4-42ba-a152-dd7332f790d0",
          "name": "HANSA YELLOW G",
          "stdName": "HANSA YELLOW G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "e2363b92-fccc-4ede-9f7e-b133fb21b216",
          "name": "JAPAN YELLOW NO. 401",
          "stdName": "JAPAN YELLOW NO. 401",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "6f33c069-ea1b-491b-a44a-b009659514c1",
          "name": "JAUNE COVANOR W 1605",
          "stdName": "JAUNE COVANOR W 1605",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "62c14689-2025-4c9f-92dc-a936cfb329a2"
          ],
          "display_name": false
        },
        {
          "uuid": "d7376828-0c54-412f-9182-d835994dd3e8",
          "name": "NSC-6131",
          "stdName": "NSC-6131",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "928b4d57-391b-456a-8c6e-627972bb40cf"
          ],
          "display_name": false
        },
        {
          "uuid": "c6741218-8c46-41d7-ba63-671644021d59",
          "name": "PIGMENT FAST YELLOW",
          "stdName": "PIGMENT FAST YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "3a5572d5-05a7-4c95-8e0a-8ed05eedf21c",
          "name": "PIGMENT LIGHTFAST YELLOW",
          "stdName": "PIGMENT LIGHTFAST YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "b3807f10-ef9c-4762-8093-f398f90d3e96",
          "name": "PIGMENT YELLOW 1",
          "stdName": "PIGMENT YELLOW 1",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "62c14689-2025-4c9f-92dc-a936cfb329a2",
            "f1d26230-1f71-4b98-89f9-88e242ce910e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9f917782-897c-4eca-9ee6-c39fa23de20b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "610a75bd-6df2-47f0-8e20-b632eaafa3c1",
          "name": "PIGMENT YELLOW 1, (±)-",
          "stdName": "PIGMENT YELLOW 1, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "eb065373-0a19-49ce-a451-edc6bf410f63"
          ],
          "display_name": false
        },
        {
          "uuid": "14e61980-0905-4d2c-91b9-bb9b7462c0ca",
          "name": "SANYO FAST YELLOW G",
          "stdName": "SANYO FAST YELLOW G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        },
        {
          "uuid": "1204aed5-50b4-48bf-805f-52d303b46903",
          "name": "TOLUIDINE YELLOW",
          "stdName": "TOLUIDINE YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
            "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "62c14689-2025-4c9f-92dc-a936cfb329a2",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c24a2031-e1d2-4a0b-bd8a-4c16e9507825",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fd3b890-2c0b-4687-9e4e-20c1121509a8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9509862d-5169-4ba4-9f00-62fffe835cd3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb065373-0a19-49ce-a451-edc6bf410f63",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "908449ee-8553-408f-ad7f-96c6345286c2",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "928b4d57-391b-456a-8c6e-627972bb40cf",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1de968a7-e5fb-4ce9-891e-ae0f6789c9a2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd8dc0e2-069d-4303-9690-66d271e91a09",
          "citation": "SRS import [RMB4YA40UY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RMB4YA40UY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1d26230-1f71-4b98-89f9-88e242ce910e",
          "citation": "PIGMENT YELLOW 1 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a5c590db-73c0-466e-90bd-a0b254a0a43a",
          "citation": "CI 11680 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37e48bd5-1d1e-8e5b-3746-2fd0e7a86d2e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2512-29-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7292b844-0618-1fae-32cf-5b467686454e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2512-29-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bc52a91c-4955-4eff-8206-35f7219ad46b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "16602078-bc8a-47e1-ac04-8b66b3bd8be7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "af97c062-d9ad-b693-cfad-489b952c98fd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f9ad2249-2448-e42e-eccc-485fb1c90707",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8f121767-1694-44fc-890f-701520d1e50e",
          "id": "8f121767-1694-44fc-890f-701520d1e50e",
          "molfile": "\n  Marvin  01132107252D          \n\n 25 26  0  0  0  0            999 V2000\n    7.4243   -2.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -2.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8532   -2.5214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -3.7589    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.4243   -4.1714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4243   -4.9964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7098   -5.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7098   -6.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9953   -6.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2809   -6.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5664   -6.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2809   -5.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9953   -4.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9953   -4.1714    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.7098   -3.7589    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.2809   -3.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8532   -4.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8532   -4.9964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5677   -3.7589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2821   -4.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2821   -4.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9966   -5.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7111   -4.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7111   -4.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9966   -3.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 17  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\nM  CHG  2  14   1  15  -1\nM  END",
          "smiles": "Cc1ccc(c(c1)[N+](=O)[O-])/N=N/C(C(=O)C)C(=O)Nc2ccccc2",
          "formula": "C17H16N4O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a29f703-d92b-4c86-8b0f-3d8a49bd6979"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "340.334",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81952e04-db3b-4f67-a622-fb3ade0f2891",
      "version": "9",
      "structure": {
        "id": "46c17c67-e42c-4382-80bb-606eacc1eb89",
        "molfile": "\n  Marvin  01132103432D          \n\n 25 26  0  0  0  0            999 V2000\n    6.7098   -5.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4243   -4.9964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4243   -4.1714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -3.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -2.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8532   -2.5214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4243   -2.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8532   -4.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8532   -4.9964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5677   -3.7589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2821   -4.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2821   -4.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9966   -5.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7111   -4.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7111   -4.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9966   -3.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7098   -6.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9953   -6.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2809   -6.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5664   -6.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2809   -5.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9953   -4.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9953   -4.1714    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.7098   -3.7589    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.2809   -3.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 11 16  2  0  0  0  0\n  1 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 21  2  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\nM  CHG  2  23   1  24  -1\nM  END",
        "smiles": "Cc1ccc(c(c1)[N+](=O)[O-])/N=N/C(C(=O)C)C(=O)Nc2ccccc2",
        "formula": "C17H16N4O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "340.334",
        "optical_activity": "( + / - )",
        "references": [
          "bd8dc0e2-069d-4303-9690-66d271e91a09",
          "4fd3b890-2c0b-4687-9e4e-20c1121509a8"
        ],
        "stereo_centers": 1
      },
      "unii": "RMB4YA40UY"
    }
  ]
}