{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f6eda797-eafc-4eb3-8b22-93931ac98da7",
          "code": "87-90-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-90-1",
          "code_system": "CAS",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4",
            "f39fd7b9-fc4b-4d2d-acca-981a6bc0f801"
          ]
        },
        {
          "uuid": "7aafc6ab-bdf3-481c-bf7c-fff2ab7609cf",
          "code": "C72647",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72647",
          "code_system": "NCI_THESAURUS",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "ca865297-4542-4210-b884-305b8a881d2b",
          "code": "C051718",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67051718",
          "code_system": "MESH",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "992ca25d-a042-4732-aef1-f8f953af2902",
          "code": "TRICHLOROISOCYANURIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Trichloroisocyanuric_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "09a59d49-2833-4275-9fa2-ae66f914c2c5",
          "code": "81405",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4103",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "eb5da00f-ad1e-4ba5-a071-3699be85bad8",
          "code": "1807",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1807",
          "code_system": "INN",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "8d7d6bdb-b353-40b9-bf36-a78f40f1a0c7",
          "code": "201-782-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.621",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "f3d59da4-917a-41ce-9db4-0cc822192329",
          "code": "m11076",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11076?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "e29ddf60-cb48-40fe-b53c-cb821f7e0f91",
          "code": "CHEMBL1698868",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1698868",
          "code_system": "ChEMBL",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "a22c6523-48de-48e1-8515-93ebc4ffae4d",
          "code": "SUB10790MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "a55d918d-607f-4c0f-b07c-da50bab3ac95",
          "code": "6909",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6909",
          "code_system": "PUBCHEM",
          "references": [
            "65202f93-10c8-4065-a125-0d1e889909e4"
          ]
        },
        {
          "uuid": "ccdb220b-a622-f140-1e1a-3eaa304753c5",
          "code": "885",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/885",
          "code_system": "HSDB",
          "references": [
            "40c9d165-5b3e-fa29-ab10-76f10f56e238"
          ]
        },
        {
          "uuid": "05240b5b-a992-71f2-27ab-2eb4d1afce8f",
          "code": "DTXSID2026523",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2026523",
          "code_system": "EPA CompTox",
          "references": [
            "596fef7e-11f7-70f6-06b8-5c881d68344e"
          ]
        },
        {
          "uuid": "7ae10b08-e661-6663-4684-8b83b9186216",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2f624615-1afd-2963-c67f-4eecdabf5123"
          ]
        },
        {
          "uuid": "b4832c91-644c-4898-83b8-29aa010371ee",
          "code": "RL3HK1I66B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c4a9d7f0-4425-426b-71f9-95fa526ea4f1",
          "code": "3629",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3629",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2f624615-1afd-2963-c67f-4eecdabf5123"
          ]
        },
        {
          "uuid": "6bfb95b7-088b-88b1-9170-1c9dda059022",
          "code": "2375531",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2375531/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a975a73f-11e2-e9d6-5059-c895a1ccc4ee"
          ]
        },
        {
          "uuid": "ec87dde3-d849-aba4-e582-5b93a6bbd8d5",
          "code": "33015",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33015",
          "code_system": "CHEBI",
          "references": [
            "2f624615-1afd-2963-c67f-4eecdabf5123"
          ]
        },
        {
          "uuid": "c3e917b5-e2ee-a8f8-f5a4-2e29ece55a77",
          "code": "100000082971",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27c1d588-ae68-45fd-8b4e-9eb04905ca9b"
          ]
        },
        {
          "uuid": "ea1eeb1e-b214-2d70-aa92-405796e063ec",
          "code": "405124",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=405124",
          "code_system": "NSC",
          "references": [
            "e77814d3-1957-8e08-1f24-95a29604c920"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4a27584b-63f3-46c9-b236-8cb288f5c267",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a43466d9-db5f-4444-87d1-5fb8626f7ad9",
            "refuuid": "6adef71e-1a9e-4a0a-809a-a67a3176ff03",
            "name": "SYMCLOSENE",
            "unii": "RL3HK1I66B",
            "linking_id": "RL3HK1I66B",
            "ref_pname": "SYMCLOSENE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d0ee6af0-46c6-4976-a2eb-15aaf7626610",
          "name": "1,3,5-TRIAZINE, 2,4,6(1H,3H,5H)-TRIONE, 1,3,5-TRICHLORO-",
          "stdName": "1,3,5-TRIAZINE, 2,4,6(1H,3H,5H)-TRIONE, 1,3,5-TRICHLORO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a58cb52-6934-4abd-907c-72249e11ae82"
          ],
          "display_name": false
        },
        {
          "uuid": "cc326ccd-a93f-41bb-bd47-e05a69cfa230",
          "name": "1,3,5-TRICHLORO-S-TRIAZINE-2,4,6(1H,3H,5H)-TRIONE",
          "stdName": "1,3,5-TRICHLORO-S-TRIAZINE-2,4,6(1H,3H,5H)-TRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a58cb52-6934-4abd-907c-72249e11ae82"
          ],
          "display_name": false
        },
        {
          "uuid": "9d614b9d-672b-439a-8d55-066a5bbbb88a",
          "name": "NSC-405124",
          "stdName": "NSC-405124",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a58cb52-6934-4abd-907c-72249e11ae82"
          ],
          "display_name": false
        },
        {
          "uuid": "31a869a4-32e7-46de-8beb-52a890267ea5",
          "name": "SYMCLOSENE",
          "stdName": "SYMCLOSENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44c8519b-7db9-4f60-ab0a-ce9b950c8397",
            "96b66540-119e-4109-910f-aff148bb0e42",
            "9be53f10-60af-4952-82fe-36e73920ef4c",
            "784ad060-2990-4d21-a9d8-7d2e3b07c48c",
            "51838868-bd62-47d2-8296-d44d091931dd",
            "855dc2ce-bd1c-467c-ad0d-12af2287df74",
            "419161c6-2ff1-48eb-ab2f-36fbae183f97",
            "7dbed148-7db2-4e15-9160-bdadb2810622"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f003c0ba-de05-4bc0-beab-2c217fe1ade8",
              "name_org": "INN"
            },
            {
              "uuid": "4a861d6b-8a79-4573-9f92-2dd37197ef18",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "d889f15b-599d-4032-965c-ecb1e133ad13",
          "name": "SYMCLOSENE [HSDB]",
          "stdName": "SYMCLOSENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9be53f10-60af-4952-82fe-36e73920ef4c",
            "7dbed148-7db2-4e15-9160-bdadb2810622"
          ],
          "display_name": false
        },
        {
          "uuid": "0170945d-1eba-4ec4-a5cd-4e907f22a831",
          "name": "SYMCLOSENE [USAN]",
          "stdName": "SYMCLOSENE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96b66540-119e-4109-910f-aff148bb0e42"
          ],
          "display_name": false
        },
        {
          "uuid": "ab94e6cb-2d46-4e4d-857a-f3e72260a584",
          "name": "TRICHLOROISOCYANURIC ACID",
          "stdName": "TRICHLOROISOCYANURIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b38489f-718a-42b9-a674-d56236c1c8c4",
            "5a58cb52-6934-4abd-907c-72249e11ae82",
            "9be53f10-60af-4952-82fe-36e73920ef4c",
            "96707508-a365-43a6-b4a7-7fe2c692088b"
          ],
          "display_name": false
        },
        {
          "uuid": "4812449b-8210-47b4-96b1-05282cce3621",
          "name": "TRICHLOROISOCYANURIC ACID [MI]",
          "stdName": "TRICHLOROISOCYANURIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9be53f10-60af-4952-82fe-36e73920ef4c",
            "96707508-a365-43a6-b4a7-7fe2c692088b"
          ],
          "display_name": false
        },
        {
          "uuid": "a438513d-553a-466e-baa4-2a7ccffb3189",
          "name": "symclosene [INN]",
          "stdName": "SYMCLOSENE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "419161c6-2ff1-48eb-ab2f-36fbae183f97"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "51838868-bd62-47d2-8296-d44d091931dd",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5a58cb52-6934-4abd-907c-72249e11ae82",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "419161c6-2ff1-48eb-ab2f-36fbae183f97",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "96b66540-119e-4109-910f-aff148bb0e42",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96707508-a365-43a6-b4a7-7fe2c692088b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9be53f10-60af-4952-82fe-36e73920ef4c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dbed148-7db2-4e15-9160-bdadb2810622",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65202f93-10c8-4065-a125-0d1e889909e4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63e794d1-c32c-4762-8d07-a46a9773b3bc",
          "citation": "SRS import [RL3HK1I66B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RL3HK1I66B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b369934-7544-4a37-bf3b-7a4fd88db2b5",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "784ad060-2990-4d21-a9d8-7d2e3b07c48c",
          "citation": "SYMCLOSENE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "855dc2ce-bd1c-467c-ad0d-12af2287df74",
          "citation": "SYMCLOSENE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b38489f-718a-42b9-a674-d56236c1c8c4",
          "citation": "TRICHLOROISOCYANURIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44c8519b-7db9-4f60-ab0a-ce9b950c8397",
          "citation": "SYMCLOSENE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40c9d165-5b3e-fa29-ab10-76f10f56e238",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+87-90-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "596fef7e-11f7-70f6-06b8-5c881d68344e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-90-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2f624615-1afd-2963-c67f-4eecdabf5123",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f39fd7b9-fc4b-4d2d-acca-981a6bc0f801",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a975a73f-11e2-e9d6-5059-c895a1ccc4ee",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "e77814d3-1957-8e08-1f24-95a29604c920",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2567c018-e880-52ca-26c4-7790608fbd97",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "27c1d588-ae68-45fd-8b4e-9eb04905ca9b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d7d6aaf0-90eb-48e7-8708-ae4f52d21b2e",
          "id": "d7d6aaf0-90eb-48e7-8708-ae4f52d21b2e",
          "molfile": "\n  Marvin  01132111112D          \n\n 12 12  0  0  0  0            999 V2000\n   -0.6852    0.4961    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6796   -0.3314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3949   -0.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1159   -0.3576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3949   -1.5697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1159   -1.9731    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6703   -1.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6647   -2.8062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0451   -1.5604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7717   -1.9488    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0451   -0.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7717   -0.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 11  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  2  0  0  0  0\nM  END",
          "smiles": "c1(=O)n(c(=O)n(c(=O)n1Cl)Cl)Cl",
          "formula": "C3Cl3N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c0bc9f25-5ccf-47c4-a6ca-b71cf1a84c79"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "232.4093",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6adef71e-1a9e-4a0a-809a-a67a3176ff03",
      "version": "13",
      "structure": {
        "id": "b80f6411-0b48-4f9e-8050-931fcefd6d2a",
        "molfile": "\n  Marvin  01132109312D          \n\n 12 12  0  0  0  0            999 V2000\n   -1.3949   -0.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6796   -0.3314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3949   -1.5697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1159   -0.3576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0451   -0.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6852    0.4961    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6703   -1.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1159   -1.9731    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0451   -1.5604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7717   -0.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6647   -2.8062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7717   -1.9488    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n  7  9  1  0  0  0  0\nM  END",
        "smiles": "c1(=O)n(c(=O)n(c(=O)n1Cl)Cl)Cl",
        "formula": "C3Cl3N3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "232.4093",
        "optical_activity": "NONE",
        "references": [
          "3b369934-7544-4a37-bf3b-7a4fd88db2b5",
          "63e794d1-c32c-4762-8d07-a46a9773b3bc",
          "419161c6-2ff1-48eb-ab2f-36fbae183f97"
        ],
        "stereo_centers": 0
      },
      "unii": "RL3HK1I66B"
    }
  ]
}