{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aaa484b4-0cf3-4b8a-8d2f-fb3e69cd0423",
          "code": "143-50-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=143-50-0",
          "code_system": "CAS",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2",
            "f0bd36d0-c258-4c6c-8a30-28c12bc6e3bd"
          ]
        },
        {
          "uuid": "16db0cea-a9b6-4b1d-9af4-590cf2678ce5",
          "code": "C44352",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44352",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2"
          ]
        },
        {
          "uuid": "84c02385-a191-4881-8a2f-028c80e3e3d5",
          "code": "D007631",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68007631",
          "code_system": "MESH",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2"
          ]
        },
        {
          "uuid": "23e4fe1a-c323-4d74-81a9-11cf40be831e",
          "code": "KEPONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Kepone",
          "code_system": "WIKIPEDIA",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2"
          ]
        },
        {
          "uuid": "8a8e39ba-d09e-402e-bcc2-271cd8a6e005",
          "code": "27701",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2037",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2"
          ]
        },
        {
          "uuid": "fd6920f5-b507-42f5-b919-5d5eace8ff9b",
          "code": "205-601-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.093",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2"
          ]
        },
        {
          "uuid": "b6279348-20be-4f1b-b049-ad41be6a8f5b",
          "code": "m3354",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3354?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2"
          ]
        },
        {
          "uuid": "0cdfd30d-3a63-42e2-baa7-ec8c3605053d",
          "code": "299",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/299",
          "code_system": "PUBCHEM",
          "references": [
            "1d5543f3-bae4-4115-b660-6d2eacd44ab2"
          ]
        },
        {
          "uuid": "16bf0f9e-52a8-6c45-880b-1723a039e1b6",
          "code": "1558",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1558",
          "code_system": "HSDB",
          "references": [
            "badd851c-1bf4-ee8a-9da4-aa3871ad445d"
          ]
        },
        {
          "uuid": "b80388b0-9c0f-bf0d-d460-884c46016664",
          "code": "DTXSID1020770",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1020770",
          "code_system": "EPA CompTox",
          "references": [
            "8dd32950-602e-a34b-851b-e067b343c4eb"
          ]
        },
        {
          "uuid": "15ff8f4d-0123-5db5-0cde-fb478708891b",
          "code": "C45410",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Organo-halide Carcinogen[C45183]|Halogenated Ring Carcinogen[C45186]|Chlorinated Ring Carcinogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45410",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4a249ce0-e014-cfb0-77dd-1733305d0312"
          ]
        },
        {
          "uuid": "25ea76d3-480a-406c-8152-7e62609ec82c",
          "code": "RG5XJ88UDF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "38faa120-5e52-9a6a-0630-9ddd4846c396",
          "code": "16548",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16548",
          "code_system": "CHEBI",
          "references": [
            "4a249ce0-e014-cfb0-77dd-1733305d0312"
          ]
        },
        {
          "uuid": "dfd07ae8-53ba-d47a-deaf-4ef8e807256c",
          "code": "124074",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=124074",
          "code_system": "NSC",
          "references": [
            "8bf1fcab-ae76-8c10-1158-d22b228ff48f"
          ]
        },
        {
          "uuid": "b0e56b6f-fc2e-dbe2-f804-8200f8c78f0c",
          "code": "56532",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=56532",
          "code_system": "NSC",
          "references": [
            "8bf1fcab-ae76-8c10-1158-d22b228ff48f"
          ]
        },
        {
          "uuid": "b70503c9-4ad1-d150-a067-5dbc644ef1d9",
          "code": "chlordecone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/chlordecone.html",
          "code_system": "ALANWOOD",
          "references": [
            "36ad5f28-51a1-2926-77f0-5b7640f34202"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3179744d-c959-4158-b98d-9e9cfba3ce57",
          "type": "METABOLITE->PARENT",
          "references": [
            "23a7c962-f61f-42a1-a173-5bbd9e76bd84"
          ],
          "related_substance": {
            "uuid": "e81029b4-3e06-4746-b282-8116d0ca1e9d",
            "refuuid": "da0e6e71-caa3-436e-950c-bd5d2c32488c",
            "name": "CHLORDECONE ALCOHOL",
            "unii": "6WGX423WZJ",
            "linking_id": "6WGX423WZJ",
            "ref_pname": "CHLORDECONE ALCOHOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6937e24d-62b6-426a-8715-416b3832d0bc",
          "name": "CHLORDECONE",
          "stdName": "CHLORDECONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e33f692f-7b63-4764-a12f-d28efe97ab62",
            "4ea559eb-85a6-43c2-9a5e-bb400f350408",
            "20d12fdd-3fd8-4b72-ab4f-a8f39aae8917",
            "0cdad84c-f98e-44b0-af45-b8c05141c69b",
            "35126eb4-a99c-4d4a-9d41-0f9ca41a6189",
            "dac4954f-48dc-48cd-935f-2d48710824c2",
            "97e730e6-ca19-40d0-abea-8a725d7a03bd"
          ],
          "display_name": true
        },
        {
          "uuid": "f0767413-12dd-4d24-af36-7d2d04184f27",
          "name": "CHLORDECONE [HSDB]",
          "stdName": "CHLORDECONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cdad84c-f98e-44b0-af45-b8c05141c69b"
          ],
          "display_name": false
        },
        {
          "uuid": "c8c969bf-59cd-b594-bdf8-9116eddb462a",
          "name": "CHLORDECONE [IARC]",
          "stdName": "CHLORDECONE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9c4852-8b98-695c-d8f2-a24112522ca0"
          ],
          "display_name": false
        },
        {
          "uuid": "02b4f8f6-2a31-4fb0-ad92-76700715418b",
          "name": "CHLORDECONE [ISO]",
          "stdName": "CHLORDECONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e33f692f-7b63-4764-a12f-d28efe97ab62"
          ],
          "display_name": false
        },
        {
          "uuid": "b79ee19c-e73a-4938-a051-ab548c2f45d2",
          "name": "CHLORDECONE [MI]",
          "stdName": "CHLORDECONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ea559eb-85a6-43c2-9a5e-bb400f350408"
          ],
          "display_name": false
        },
        {
          "uuid": "b5f0e234-95a0-42b4-ab50-e1f9821348a2",
          "name": "CLORDECONE",
          "stdName": "CLORDECONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f91e6b4e-ce63-4c6a-b25f-19ee3ba5431f"
          ],
          "display_name": false
        },
        {
          "uuid": "3b608a38-bf69-482f-acd7-c54112348949",
          "name": "DECACHLOROKETONE",
          "stdName": "DECACHLOROKETONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f91e6b4e-ce63-4c6a-b25f-19ee3ba5431f"
          ],
          "display_name": false
        },
        {
          "uuid": "0f7100b5-f050-4ef1-89a2-1c9ac86a9b54",
          "name": "GC-1189",
          "stdName": "GC-1189",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f91e6b4e-ce63-4c6a-b25f-19ee3ba5431f"
          ],
          "display_name": false
        },
        {
          "uuid": "f3c9b649-9a3a-40ad-b136-21dc020cc5ac",
          "name": "KEPONE",
          "stdName": "KEPONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf655cf6-cbd2-4ff7-9ea6-796ae2ed3474"
          ],
          "display_name": false
        },
        {
          "uuid": "9b27f1f8-34c7-40f4-9431-67678998270f",
          "name": "NSC-124074",
          "stdName": "NSC-124074",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32c032b6-d60a-4a1a-b0e4-9ce625a9b288"
          ],
          "display_name": false
        },
        {
          "uuid": "4d39e604-2384-4257-ad20-7e1d2c9e43c5",
          "name": "NSC-56532",
          "stdName": "NSC-56532",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32c032b6-d60a-4a1a-b0e4-9ce625a9b288"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cf655cf6-cbd2-4ff7-9ea6-796ae2ed3474",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "97e730e6-ca19-40d0-abea-8a725d7a03bd",
          "citation": "http://en.wikipedia.org/wiki/Kepone",
          "url": "http://en.wikipedia.org/wiki/Kepone",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f91e6b4e-ce63-4c6a-b25f-19ee3ba5431f",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J10.213J",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J10.213J",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ea559eb-85a6-43c2-9a5e-bb400f350408",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cdad84c-f98e-44b0-af45-b8c05141c69b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e33f692f-7b63-4764-a12f-d28efe97ab62",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32c032b6-d60a-4a1a-b0e4-9ce625a9b288",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d5543f3-bae4-4115-b660-6d2eacd44ab2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389645000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fb6f7aa-2e70-4c14-a5fb-31a054fe970a",
          "citation": "SRS import [RG5XJ88UDF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RG5XJ88UDF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389645000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7af5ba98-447c-4e05-8ba1-930d2ed1fd87",
          "citation": "wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dac4954f-48dc-48cd-935f-2d48710824c2",
          "citation": "CHLORDECONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35126eb4-a99c-4d4a-9d41-0f9ca41a6189",
          "citation": "CHLORDECONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "20d12fdd-3fd8-4b72-ab4f-a8f39aae8917",
          "citation": "CHLORDECONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "badd851c-1bf4-ee8a-9da4-aa3871ad445d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+143-50-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8dd32950-602e-a34b-851b-e067b343c4eb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=143-50-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7a9c4852-8b98-695c-d8f2-a24112522ca0",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "4a249ce0-e014-cfb0-77dd-1733305d0312",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "36ad5f28-51a1-2926-77f0-5b7640f34202",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "23a7c962-f61f-42a1-a173-5bbd9e76bd84",
          "citation": "Drug Metab Dispos 1980;8(6):434",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8bf1fcab-ae76-8c10-1158-d22b228ff48f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f0bd36d0-c258-4c6c-8a30-28c12bc6e3bd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8739c510-9d7e-450f-9e90-d4563c15e9d8",
          "id": "8739c510-9d7e-450f-9e90-d4563c15e9d8",
          "molfile": "\n  Marvin  01132107012D          \n\n 21 25  0  0  0  0            999 V2000\n   -1.7474   -3.0586    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9065   -2.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6738   -2.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9704   -3.1273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4008   -2.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8092   -1.9817    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4938   -2.2912    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.2832   -2.0634    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0037   -2.6201    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.8425   -2.9747    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0037   -1.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4170   -1.5819    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9065   -1.6958    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.8871   -0.9758    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4008   -1.3563    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -2.6093   -0.9156    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4938   -1.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5131   -0.7372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7802   -1.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6319   -0.6921    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3289   -1.2144    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  9  2  1  0  0  0  0\n  2 13  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  5 15  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n  7 17  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 19  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "C1(=O)C2(C3(C4(C1(C5(C2(C3(C(C45Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl",
          "formula": "C10Cl10O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "94b5c1e5-45af-428f-ab4b-e91e84050ab5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "490.6361",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "63aebb27-0706-4a05-b48f-5deb52daa0ba",
      "version": "12",
      "structure": {
        "id": "740efd93-96b0-4e81-a87a-96a73342fc92",
        "molfile": "\n  Marvin  01132106012D          \n\n 21 25  0  0  0  0            999 V2000\n   -2.4008   -1.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4938   -2.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9065   -1.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0037   -2.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4938   -1.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0037   -1.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4008   -2.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9065   -2.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7802   -1.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6738   -2.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9704   -3.1273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2832   -2.0634    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6093   -0.9156    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8425   -2.9747    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8871   -0.9758    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5131   -0.7372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4170   -1.5819    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7474   -3.0586    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8092   -1.9817    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6319   -0.6921    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3289   -1.2144    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12  2  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15  3  1  0  0  0  0\n 16  5  1  0  0  0  0\n 17  6  1  0  0  0  0\n 18  8  1  0  0  0  0\n 19  7  1  0  0  0  0\n 20  9  1  0  0  0  0\n 21  9  1  0  0  0  0\n  2  5  1  0  0  0  0\n  8 10  1  0  0  0  0\n  6  9  1  0  0  0  0\n  4  8  1  0  0  0  0\n  4  6  1  0  0  0  0\nM  END",
        "smiles": "C1(=O)C2(C3(C4(C1(C5(C2(C3(C(C45Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl",
        "formula": "C10Cl10O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "490.6361",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0fb6f7aa-2e70-4c14-a5fb-31a054fe970a",
          "7af5ba98-447c-4e05-8ba1-930d2ed1fd87"
        ],
        "stereo_centers": 4
      },
      "unii": "RG5XJ88UDF"
    }
  ]
}