{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7d7289ef-8a16-4b65-bf02-8e63fde96981",
          "code": "447-05-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=447-05-2",
          "code_system": "CAS",
          "references": [
            "e7d2fc5a-a838-4b14-b5ec-3a72748ae08b",
            "6372631b-746f-4f1d-b6ac-0f0c83e66774"
          ]
        },
        {
          "uuid": "4a9da212-dbac-44d4-8642-d3b525ed0868",
          "code": "SUB23137",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e7d2fc5a-a838-4b14-b5ec-3a72748ae08b"
          ]
        },
        {
          "uuid": "6724d600-1fc7-4517-908c-31ee3ab63e88",
          "code": "207-179-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.528",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e7d2fc5a-a838-4b14-b5ec-3a72748ae08b"
          ]
        },
        {
          "uuid": "ab589eb8-a927-4c8e-a80f-5b3e7a0711fc",
          "code": "1055",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1055",
          "code_system": "PUBCHEM",
          "references": [
            "e7d2fc5a-a838-4b14-b5ec-3a72748ae08b"
          ]
        },
        {
          "uuid": "978168cd-bd71-7435-f7e0-ab5cfd19867c",
          "code": "DTXSID80196278",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80196278",
          "code_system": "EPA CompTox",
          "references": [
            "d53284c6-73d7-8a6d-d056-45df61f31f1f"
          ]
        },
        {
          "uuid": "758a3b0e-cc30-e3df-e9c1-fccc43f4a2fe",
          "code": "DB02209",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02209",
          "code_system": "DRUG BANK",
          "references": [
            "9349887a-c50f-9f88-b6ee-380fec0d317b"
          ]
        },
        {
          "uuid": "2c84b2ca-7d2a-48c6-a53d-7e15ba726810",
          "code": "RG20W8WYLS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "df219aa8-05ef-385f-7965-e0dbdfab418f",
          "code": "28803",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28803",
          "code_system": "CHEBI",
          "references": [
            "9349887a-c50f-9f88-b6ee-380fec0d317b"
          ]
        },
        {
          "uuid": "7d875716-4c67-f029-6c2a-a919019f8f90",
          "code": "83119",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=83119",
          "code_system": "NSC",
          "references": [
            "cc7dac87-1e06-6e52-5a79-b83c24a8a5af"
          ]
        },
        {
          "uuid": "936ae036-1a92-a26e-080b-f3adf5257a1a",
          "code": "100000088839",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "72f94a1e-599b-905c-71cd-cb993336def8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bcdbf8c8-dcd5-43b7-a4e6-baf17445743e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "04322f9d-2a46-4633-8336-28948a5c1f10",
            "refuuid": "d2be6f40-8380-4907-b5eb-b82f64103f16",
            "name": "PYRIDOXINE PHOSPHATE",
            "unii": "RG20W8WYLS",
            "linking_id": "RG20W8WYLS",
            "ref_pname": "PYRIDOXINE PHOSPHATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bd59957a-6e35-4717-8e54-8c751c19bf9f",
          "name": "3,4-PYRIDINEDIMETHANOL, 5-HYDROXY-6-METHYL-, .ALPHA.3-(DIHYDROGEN PHOSPHATE)",
          "stdName": "3,4-PYRIDINEDIMETHANOL, 5-HYDROXY-6-METHYL-, .ALPHA.3-(DIHYDROGEN PHOSPHATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "111d41f7-47d3-44d5-bfc4-22013e5689bd",
            "1ae6435e-0503-48b8-bf94-e023ca2a90ee"
          ],
          "display_name": false
        },
        {
          "uuid": "59bdadf6-b611-4046-978d-02d10ed48aca",
          "name": "NSC-83119",
          "stdName": "NSC-83119",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ae6435e-0503-48b8-bf94-e023ca2a90ee",
            "a33f3c54-87bd-4450-b6bd-b427fe1083ca"
          ],
          "display_name": false
        },
        {
          "uuid": "a168a928-bccd-4fa3-8bac-99f47c66a3f7",
          "name": "PYRIDOXINE 5-PHOSPHATE",
          "stdName": "PYRIDOXINE 5-PHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d122eefb-9769-43dd-830a-779e724557cc"
          ],
          "display_name": false
        },
        {
          "uuid": "3f20e40e-857d-4eb2-8ed0-8860fedd8ef7",
          "name": "PYRIDOXINE PHOSPHATE",
          "stdName": "PYRIDOXINE PHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df09d177-372a-4b0e-a732-c0cc386b5f39",
            "cbe3b8f4-753a-4516-9e0f-a8499b3de34c",
            "1ae6435e-0503-48b8-bf94-e023ca2a90ee",
            "2eb1569c-1935-440a-ac0f-b270eb4b09c6"
          ],
          "display_name": true
        },
        {
          "uuid": "8007e2c5-ba7e-7af1-9191-5c0c76c48cae",
          "name": "Pyridoxine phosphate [WHO-DD]",
          "stdName": "PYRIDOXINE PHOSPHATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc7cd528-95d7-6784-4a4b-df57e8527a5b"
          ],
          "display_name": false
        },
        {
          "uuid": "3430e923-433f-8381-9a34-94251b5a12f5",
          "name": "VITAMIN B6 (PYRIDOXINE PHOSPHATE)",
          "stdName": "VITAMIN B6 (PYRIDOXINE PHOSPHATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9be317f7-9b68-2104-dca8-2e51c496ecc0",
            "6372631b-746f-4f1d-b6ac-0f0c83e66774"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d122eefb-9769-43dd-830a-779e724557cc",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2eb1569c-1935-440a-ac0f-b270eb4b09c6",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ae6435e-0503-48b8-bf94-e023ca2a90ee",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "111d41f7-47d3-44d5-bfc4-22013e5689bd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbe3b8f4-753a-4516-9e0f-a8499b3de34c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a33f3c54-87bd-4450-b6bd-b427fe1083ca",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7d2fc5a-a838-4b14-b5ec-3a72748ae08b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8307131-4417-4ac6-afd2-434e0d309cc2",
          "citation": "http://www.karger.com/Article/Abstract/282203",
          "url": "http://www.karger.com/Article/Abstract/282203",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e775d747-0017-4243-b39b-a0cb22b74514",
          "citation": "SRS import [RG20W8WYLS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RG20W8WYLS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c545fb3-1018-4ed4-a998-664fb3efcb54",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df09d177-372a-4b0e-a732-c0cc386b5f39",
          "citation": "PYRIDOXINE PHOSPHATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d53284c6-73d7-8a6d-d056-45df61f31f1f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=447-05-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9349887a-c50f-9f88-b6ee-380fec0d317b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6372631b-746f-4f1d-b6ac-0f0c83e66774",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9be317f7-9b68-2104-dca8-2e51c496ecc0",
          "citation": "https://dsld.od.nih.gov/dsld/index.jsp",
          "url": "https://dsld.od.nih.gov/dsld/index.jsp",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "fc7cd528-95d7-6784-4a4b-df57e8527a5b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cc7dac87-1e06-6e52-5a79-b83c24a8a5af",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "72f94a1e-599b-905c-71cd-cb993336def8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b6781f3e-9f79-4c95-9fd7-19bb736eaf0f",
          "id": "b6781f3e-9f79-4c95-9fd7-19bb736eaf0f",
          "molfile": "\n  Marvin  01132109272D          \n\n 16 16  0  0  0  0            999 V2000\n    4.6987   -3.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3770   -3.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0932   -3.2270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8070   -3.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8070   -4.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4057   -4.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4057   -5.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0890   -6.0364    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7298   -6.6579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8775   -6.4933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4509   -5.4030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0932   -4.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0932   -5.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4293   -5.9392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3770   -4.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7135   -4.8217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 15  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 12  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 15  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(c(CO)c(cn1)COP(=O)(O)O)O",
          "formula": "C8H12NO6P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6adc9ef1-2192-4829-91e8-f53f29526173"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "249.1581",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d2be6f40-8380-4907-b5eb-b82f64103f16",
      "version": "13",
      "structure": {
        "id": "7df5be0c-ad9e-42de-baff-389129874f51",
        "molfile": "\n  Marvin  01132106322D          \n\n 16 16  0  0  0  0            999 V2000\n    6.8070   -4.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0932   -4.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3770   -4.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3770   -3.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6987   -3.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0932   -3.2270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8070   -3.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7135   -4.8217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0932   -5.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4293   -5.9392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4057   -4.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4057   -5.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0890   -6.0364    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7298   -6.6579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8775   -6.4933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4509   -5.4030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  2  0  0  0  0\nM  END",
        "smiles": "Cc1c(c(CO)c(cn1)COP(=O)(O)O)O",
        "formula": "C8H12NO6P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "249.1581",
        "optical_activity": "NONE",
        "references": [
          "8c545fb3-1018-4ed4-a998-664fb3efcb54",
          "e775d747-0017-4243-b39b-a0cb22b74514"
        ],
        "stereo_centers": 0
      },
      "unii": "RG20W8WYLS"
    }
  ]
}