{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c2122f7f-21a1-43e4-9f3f-578f4e2d2410",
          "code": "10373-78-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10373-78-1",
          "code_system": "CAS",
          "references": [
            "7753b4a0-47d7-4e64-bcf3-fdd74adfb96a",
            "d0ce94c4-8336-4352-b7ff-630d72a55d24"
          ]
        },
        {
          "uuid": "b3fea7b1-d2b2-4bd2-8582-312190a3ce80",
          "code": "C553149",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67553149",
          "code_system": "MESH",
          "references": [
            "7753b4a0-47d7-4e64-bcf3-fdd74adfb96a"
          ]
        },
        {
          "uuid": "8c8ba01e-e57a-46e6-8d8a-d397f2a7c237",
          "code": "233-814-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.728",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7753b4a0-47d7-4e64-bcf3-fdd74adfb96a"
          ]
        },
        {
          "uuid": "dfdbea84-165b-4425-8318-b87621d796aa",
          "code": "641916",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/641916",
          "code_system": "PUBCHEM",
          "references": [
            "7753b4a0-47d7-4e64-bcf3-fdd74adfb96a"
          ]
        },
        {
          "uuid": "87cc036b-e63a-405a-e029-34ab9f2816db",
          "code": "DTXSID7049394",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7049394",
          "code_system": "EPA CompTox",
          "references": [
            "bd130b43-b997-a7d9-15c5-e5f85680fc05"
          ]
        },
        {
          "uuid": "9ba3ca57-9656-445f-b0eb-7ea933c45393",
          "code": "RAL3591W33",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6b32382a-98d8-6c57-49e1-eb49c3d29f38",
          "code": "34607",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34607",
          "code_system": "CHEBI",
          "references": [
            "a29529ba-3d0a-e1e4-4d27-bfa7a9146a6e"
          ]
        },
        {
          "uuid": "bf817e76-5d6c-97a4-7977-6e073758b378",
          "code": "Camphorquinone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Camphorquinone",
          "code_system": "WIKIPEDIA",
          "references": [
            "b2cf056c-6537-f6c2-9ae3-3fb462b46677"
          ]
        },
        {
          "uuid": "ed2bb08f-b82a-da4e-5a1d-1d48fae54b71",
          "code": "285",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=285",
          "code_system": "NSC",
          "references": [
            "dcb9499d-2979-ca3f-8fc0-687cdf12169c"
          ]
        },
        {
          "uuid": "c39fec20-be65-bbe5-41a8-4f90eb3647ee",
          "code": "402031",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=402031",
          "code_system": "NSC",
          "references": [
            "dcb9499d-2979-ca3f-8fc0-687cdf12169c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "38e96359-39d2-4878-b42a-e46812c3c995",
          "name": "(±)-CAMPHORQUINONE",
          "stdName": "(+/-)-CAMPHORQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "6ec2fc85-cf26-45ce-a110-1bd3c979f6da",
          "name": "1,7,7-TRIMETHYLBICYCLO(2.2.1)HEPTANE-2,3-DIONE",
          "stdName": "1,7,7-TRIMETHYLBICYCLO(2.2.1)HEPTANE-2,3-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "e6d5803c-dcf6-4546-883c-c0a333014052",
          "name": "2,3-BORNANEDIONE, (±)-",
          "stdName": "2,3-BORNANEDIONE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "1c89f160-73a1-4b60-a6cb-3bc2786f2e41",
          "name": "BICYCLO(2.2.1)HEPTANE-2,3-DIONE, 1,7,7-TRIMETHYL-",
          "stdName": "BICYCLO(2.2.1)HEPTANE-2,3-DIONE, 1,7,7-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "4a639234-a22e-41ef-81a1-1b68a4248315",
          "name": "BICYCLO(2.2.1)HEPTANE-2,3-DIONE, 1,7,7-TRIMETHYL-, (±)-",
          "stdName": "BICYCLO(2.2.1)HEPTANE-2,3-DIONE, 1,7,7-TRIMETHYL-, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "709597c0-3a8c-4a64-a7ca-030f4e8764f1",
          "name": "BORNANEDIONE",
          "stdName": "BORNANEDIONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2c78f5d-28bd-42b4-bc4f-b177fbdd9415",
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "c3ab3d71-7fff-40eb-9c89-6d98f0bb5934",
            "0e418b32-5405-47c2-8a10-0a15dbe1adea"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "150eee2a-4240-4532-9ce0-e1e0c85dab7d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7ba5a2e0-2287-4579-b4f5-4c9666dcfedc",
          "name": "CAMPHOQUINONE",
          "stdName": "CAMPHOQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "0af6443a-f728-44d3-a1f0-54d7c44e22fd",
          "name": "CAMPHORQUINONE",
          "stdName": "CAMPHORQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "07760cc3-33c6-44a3-b793-2453cf373ff2"
          ],
          "display_name": false
        },
        {
          "uuid": "3d045b5b-9f8f-4046-bbf8-d0f80b3e1254",
          "name": "D-CAMPHORCHINONE",
          "stdName": "D-CAMPHORCHINONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2c78f5d-28bd-42b4-bc4f-b177fbdd9415",
            "98c8e312-7df0-419f-9a44-5416e6154bc7"
          ],
          "display_name": false
        },
        {
          "uuid": "f1abbce3-9d82-4590-91ae-24e926374fa2",
          "name": "DL-BORNANE-2,3-DION",
          "stdName": "DL-BORNANE-2,3-DION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "11f1a68e-d6a0-49a1-adc9-5bae5d1624e8",
          "name": "DL-CAMPHORQUINONE",
          "stdName": "DL-CAMPHORQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "ec79e0ee-0147-4105-afc5-aef913577c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "6c62d3c4-f95f-4802-bec8-a7f6a925b6ff",
          "name": "NSC-285",
          "stdName": "NSC-285",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "af031df5-5b57-4427-b297-1ebc473a798b"
          ],
          "display_name": false
        },
        {
          "uuid": "3a6cc79e-3a70-47e1-8170-1698f49e2b88",
          "name": "NSC-402031",
          "stdName": "NSC-402031",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98c8e312-7df0-419f-9a44-5416e6154bc7",
            "af031df5-5b57-4427-b297-1ebc473a798b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "07760cc3-33c6-44a3-b793-2453cf373ff2",
          "citation": "SIGMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "98c8e312-7df0-419f-9a44-5416e6154bc7",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec79e0ee-0147-4105-afc5-aef913577c5a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af031df5-5b57-4427-b297-1ebc473a798b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2c78f5d-28bd-42b4-bc4f-b177fbdd9415",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e418b32-5405-47c2-8a10-0a15dbe1adea",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7753b4a0-47d7-4e64-bcf3-fdd74adfb96a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391413000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06bf0888-4a6b-4543-b229-488301a47d04",
          "citation": "SRS import [RAL3591W33]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RAL3591W33",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391413000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3ab3d71-7fff-40eb-9c89-6d98f0bb5934",
          "citation": "BORNANEDIONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bd130b43-b997-a7d9-15c5-e5f85680fc05",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10373-78-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2cf056c-6537-f6c2-9ae3-3fb462b46677",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "d0ce94c4-8336-4352-b7ff-630d72a55d24",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a29529ba-3d0a-e1e4-4d27-bfa7a9146a6e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dcb9499d-2979-ca3f-8fc0-687cdf12169c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f0f7c5cb-3bde-4034-b633-5712d18f88b2",
          "id": "f0f7c5cb-3bde-4034-b633-5712d18f88b2",
          "molfile": "\n  Marvin  01132112302D          \n\n 12 13  0  0  0  0            999 V2000\n    8.5681   -5.8752    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.2826   -5.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2826   -4.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5681   -4.2253    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.5681   -3.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8536   -4.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1391   -4.2253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8536   -5.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1391   -5.8752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0444   -5.0502    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7445   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6436   -4.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  8  1  0  0  0  0\n  1 10  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  4 10  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2=O",
          "formula": "C10H14O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "47fee039-5439-42a5-9a53-f658baf61dfb"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "166.2173",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "169eb6a9-3989-4678-b8ae-6ea65e5c1dc0",
      "version": "9",
      "structure": {
        "id": "abeada62-5b9f-41dc-8445-4c1b72a1d71e",
        "molfile": "\n  Marvin  01132108552D          \n\n 12 13  0  0  0  0            999 V2000\n    8.5681   -3.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5681   -4.2253    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2826   -4.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2826   -5.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5681   -5.8752    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8536   -5.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1391   -5.8752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8536   -4.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1391   -4.2253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0444   -5.0502    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7445   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6436   -4.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  2  8  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n  5 10  1  1  0  0  0\n  2 10  1  1  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2=O",
        "formula": "C10H14O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "166.2173",
        "optical_activity": "( + / - )",
        "references": [
          "06bf0888-4a6b-4543-b229-488301a47d04",
          "ec79e0ee-0147-4105-afc5-aef913577c5a"
        ],
        "stereo_centers": 2
      },
      "unii": "RAL3591W33"
    }
  ]
}