{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6521571-44c1-42fe-b9df-7b669bc2138c",
          "code": "14925",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14925",
          "code_system": "PUBCHEM",
          "references": [
            "d3124116-1bcd-4049-b671-7d1b3db06901"
          ]
        },
        {
          "uuid": "16bb655a-9b68-4ffa-a6bd-1be253a8d101",
          "code": "99-14-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99-14-9",
          "code_system": "CAS",
          "references": [
            "d3124116-1bcd-4049-b671-7d1b3db06901",
            "58b8ad54-db93-4a32-aad9-30b9fcc4e7a9"
          ]
        },
        {
          "uuid": "81188dfd-9899-49e5-92de-d0bacac8eb49",
          "code": "C028021",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67028021",
          "code_system": "MESH",
          "references": [
            "d3124116-1bcd-4049-b671-7d1b3db06901"
          ]
        },
        {
          "uuid": "373a8cf4-b70a-47ae-bc07-075e3ec6e1db",
          "code": "202-733-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.485",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d3124116-1bcd-4049-b671-7d1b3db06901"
          ]
        },
        {
          "uuid": "c9fa38ed-2584-483a-8580-f9b2045fe597",
          "code": "m11057",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11057?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d3124116-1bcd-4049-b671-7d1b3db06901"
          ]
        },
        {
          "uuid": "bb08e21b-7796-7cb8-4b69-aa818bdda4f3",
          "code": "DTXSID8059186",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8059186",
          "code_system": "EPA CompTox",
          "references": [
            "b46e13b5-60db-03b8-8cb4-fc1f9f7f488e"
          ]
        },
        {
          "uuid": "ece37d6c-cea3-d252-4cac-e4e8f7479ea0",
          "code": "DB04562",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04562",
          "code_system": "DRUG BANK",
          "references": [
            "b65035b9-1b2e-e56a-0921-8f7b5abeb210"
          ]
        },
        {
          "uuid": "f8383257-38b2-432d-abfa-fefc9baa4ee2",
          "code": "RA5QH2J020",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1dacd80c-89a4-b49f-a905-b6ed94510b58",
          "code": "45969",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:45969",
          "code_system": "CHEBI",
          "references": [
            "b65035b9-1b2e-e56a-0921-8f7b5abeb210"
          ]
        },
        {
          "uuid": "d856ad11-c197-a921-c41f-9fb694e819d5",
          "code": "Propane-1,2,3-tricarboxylic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Propane-1,2,3-tricarboxylic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "f8b27754-395e-e981-3a78-4f75f1ac3ceb"
          ]
        },
        {
          "uuid": "7396e27c-a033-7857-d2dc-50eefe528803",
          "code": "2347",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2347",
          "code_system": "NSC",
          "references": [
            "907d15f9-5990-a879-8efa-97fe8e6c42c3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "124e9774-0789-4093-8df5-b6de7fdc98b8",
          "name": ".BETA.-CARBOXYGLUTARIC ACID",
          "stdName": ".BETA.-CARBOXYGLUTARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "265e3160-ba2f-4617-a388-9c81c3b10dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "5ceed00a-0f57-4e2c-aa7d-2aa3a1f8c013",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "265e3160-ba2f-4617-a388-9c81c3b10dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "e0ece427-9efa-4cda-a4da-1f7582fe7722",
          "name": "1,2,3-TRICARBOXYPROPANE",
          "stdName": "1,2,3-TRICARBOXYPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "265e3160-ba2f-4617-a388-9c81c3b10dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "49e5eca6-c7b2-4e5b-8946-36d379f7e4ae",
          "name": "3-CARBOXYGLUTARIC ACID",
          "stdName": "3-CARBOXYGLUTARIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "265e3160-ba2f-4617-a388-9c81c3b10dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "04aeac21-db49-4182-b70a-0cb5884ab5c7",
          "name": "CARBALLYLIC ACID",
          "stdName": "CARBALLYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "265e3160-ba2f-4617-a388-9c81c3b10dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "a1fe64a8-8bb1-4374-b9e0-20844be938df",
          "name": "NSC-2347",
          "stdName": "NSC-2347",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "265e3160-ba2f-4617-a388-9c81c3b10dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "4e1190e4-de83-42d3-9cc0-34bae7b3a7bf",
          "name": "PROPANE TRICARBOXYLIC ACID",
          "stdName": "PROPANE TRICARBOXYLIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "b9bf8fc2-a885-4b40-abd1-6d80f8d4f140",
            "79eda6d2-ee42-4e2f-983c-62edf8fd6d1d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "75861c44-b884-4a5c-b987-e6b8b2cd6188",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6570cd93-d0e9-4da0-ad5a-98acc0dea101",
          "name": "TRICARBALLYLIC ACID",
          "stdName": "TRICARBALLYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "0a234d8d-a435-4fe6-8656-caea38f42862",
            "15d7f6b3-e5fe-47ff-bbcc-48ebc3f5f1dc",
            "265e3160-ba2f-4617-a388-9c81c3b10dd4"
          ],
          "display_name": false
        },
        {
          "uuid": "535467ad-5b97-40b9-8ab2-3decaa154e79",
          "name": "TRICARBALLYLIC ACID [MI]",
          "stdName": "TRICARBALLYLIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
            "15d7f6b3-e5fe-47ff-bbcc-48ebc3f5f1dc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b9bf8fc2-a885-4b40-abd1-6d80f8d4f140",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "22074f78-1b28-4e0b-b123-7ba4f81ff84c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "265e3160-ba2f-4617-a388-9c81c3b10dd4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15d7f6b3-e5fe-47ff-bbcc-48ebc3f5f1dc",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3124116-1bcd-4049-b671-7d1b3db06901",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ac56fc0-b82f-4e67-bbc7-6a5cc87a53ca",
          "citation": "SRS import [RA5QH2J020]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RA5QH2J020",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa21a287-7266-4a47-8a91-04fe9b6a7c70",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79eda6d2-ee42-4e2f-983c-62edf8fd6d1d",
          "citation": "PROPANE TRICARBOXYLIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0a234d8d-a435-4fe6-8656-caea38f42862",
          "citation": "TRICARBALLYLIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b46e13b5-60db-03b8-8cb4-fc1f9f7f488e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=99-14-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f8b27754-395e-e981-3a78-4f75f1ac3ceb",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "b65035b9-1b2e-e56a-0921-8f7b5abeb210",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "58b8ad54-db93-4a32-aad9-30b9fcc4e7a9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "907d15f9-5990-a879-8efa-97fe8e6c42c3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f05bacf5-de19-4b38-b3dd-d6b3c25bb040",
          "id": "f05bacf5-de19-4b38-b3dd-d6b3c25bb040",
          "molfile": "\n  Marvin  01132112282D          \n\n 12 11  0  0  0  0            999 V2000\n    5.9336   -2.7096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4559   -2.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0270   -1.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2828   -2.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7039   -2.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3251   -3.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4209   -3.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1116   -4.3886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8375   -3.2322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5270   -2.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9597   -3.5867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9173   -2.1656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "C(C(CC(=O)O)C(=O)O)C(=O)O",
          "formula": "C6H8O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b207071b-aec7-4ca8-8c66-fccd86e35c56"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "176.1244",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "80f500dd-9bf1-46e3-b634-118b6559325e",
      "version": "8",
      "structure": {
        "id": "c917c6cb-aa22-492e-b40c-89db395edf27",
        "molfile": "\n  Marvin  01132110232D          \n\n 12 11  0  0  0  0            999 V2000\n    7.7039   -2.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2828   -2.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4559   -2.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9336   -2.7096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0270   -1.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3251   -3.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4209   -3.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1116   -4.3886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8375   -3.2322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5270   -2.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9597   -3.5867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9173   -2.1656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
        "smiles": "C(C(CC(=O)O)C(=O)O)C(=O)O",
        "formula": "C6H8O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "176.1244",
        "optical_activity": "NONE",
        "references": [
          "6ac56fc0-b82f-4e67-bbc7-6a5cc87a53ca",
          "fa21a287-7266-4a47-8a91-04fe9b6a7c70"
        ],
        "stereo_centers": 0
      },
      "unii": "RA5QH2J020"
    }
  ]
}