{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3afe015d-b705-4746-a344-88b73833bd15", "code": "15571-58-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=15571-58-1", "code_system": "CAS", "references": [ "e36fc4c4-bad1-41fc-b798-7bdd00461198", "86715bae-174a-435d-8046-a148857d69e6" ] }, { "uuid": "c5dcd156-385a-4211-b90e-cf75cff1b8a0", "code": "239-622-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.005", "code_system": "ECHA (EC/EINECS)", "references": [ "e36fc4c4-bad1-41fc-b798-7bdd00461198" ] }, { "uuid": "9ba9db57-ab92-e3ae-bfdb-a82171522f58", "code": "DTXSID8029735", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8029735", "code_system": "EPA CompTox", "references": [ "40e8cfac-4287-ea77-7b90-4174789b8f84" ] }, { "uuid": "e2c1fff0-5080-b37f-e63c-ae11a4bfec8c", "code": "9576033", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9576033", "code_system": "PUBCHEM", "references": [ "f4259e44-d332-092b-2efb-4329d91969f2" ] }, { "uuid": "585b9e7c-c931-4fa4-9d54-d99b679a6461", "code": "RA3NRC891C", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "6cd53eab-3dff-438f-97e3-8085671377a7", "code": "300000053229", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "9f8cd596-705b-def6-d174-f6ef060b2caf" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d9147a98-41df-4bbc-89b7-d7cc1791ec22", "name": "8-OXA-3,5-DITHIA-4-STANNATETRADECANOIC ACID, 10-ETHYL-4,4-DIOCTYL-7-OXO-, 2-ETHYLHEXYL ESTER", "stdName": "8-OXA-3,5-DITHIA-4-STANNATETRADECANOIC ACID, 10-ETHYL-4,4-DIOCTYL-7-OXO-, 2-ETHYLHEXYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df76b5ba-a52c-4a4d-8e4d-77d877ce6343" ], "display_name": false }, { "uuid": "7a50ecac-e617-4d20-b991-b303fcf7ddc8", "name": "ACETIC ACID, ((DIOCTYLSTANNYLENE)DITHIO)DI-, BIS(2-ETHYLHEXYL) ESTER", "stdName": "ACETIC ACID, ((DIOCTYLSTANNYLENE)DITHIO)DI-, BIS(2-ETHYLHEXYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df76b5ba-a52c-4a4d-8e4d-77d877ce6343" ], "display_name": false }, { "uuid": "720d7cef-66d8-4f7e-88b0-41f620cdce27", "name": "BIS(2-ETHYLHEXYL THIOGLYCOLATO)DIOCTYLTIN", "stdName": "BIS(2-ETHYLHEXYL THIOGLYCOLATO)DIOCTYLTIN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df76b5ba-a52c-4a4d-8e4d-77d877ce6343" ], "display_name": false }, { "uuid": "75475631-b462-4ff0-a883-2668c744d6c2", "name": "BIS(2-ETHYLHEXYL) ((DIOCTYLSTANNYLENE)DITHIO)DIACETATE", "stdName": "BIS(2-ETHYLHEXYL) ((DIOCTYLSTANNYLENE)DITHIO)DIACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df76b5ba-a52c-4a4d-8e4d-77d877ce6343" ], "display_name": false }, { "uuid": "79f50e6d-fc5e-4480-9b69-4710e0ede3a5", "name": "DIOCTYLLTIN BIS(2-ETHYLHEXYLMERCAPTOACETATE)", "stdName": "DIOCTYLLTIN BIS(2-ETHYLHEXYLMERCAPTOACETATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df76b5ba-a52c-4a4d-8e4d-77d877ce6343" ], "display_name": false }, { "uuid": "69df6e75-7f5f-4c8b-82ea-cdad2e432474", "name": "DIOCTYLTIN BIS(2-ETHYLHEXYL THIOGLYCOLATE)", "stdName": "DIOCTYLTIN BIS(2-ETHYLHEXYL THIOGLYCOLATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5dcb4a55-f2ba-4792-9abe-6a43028282a6" ], "display_name": true }, { "uuid": "694d15bf-4fbd-443c-8495-b6db0cb1c58c", "name": "TIN, BIS((CARBOXYMETHYL)THIO)DIOCTYL-, BIS(2-ETHYLHEXYL) ESTER", "stdName": "TIN, BIS((CARBOXYMETHYL)THIO)DIOCTYL-, BIS(2-ETHYLHEXYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df76b5ba-a52c-4a4d-8e4d-77d877ce6343" ], "display_name": false } ], "references": [ { "uuid": "5dcb4a55-f2ba-4792-9abe-6a43028282a6", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "df76b5ba-a52c-4a4d-8e4d-77d877ce6343", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e36fc4c4-bad1-41fc-b798-7bdd00461198", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391982000, "tags": [ "NOMEN" ] }, { "uuid": "786beeb4-d674-45a1-bd00-b54df04d6bf0", "citation": "SRS import [RA3NRC891C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=RA3NRC891C", "doc_type": "SRS", "public_domain": true, "document_date": 1493391982000, "tags": [ "NOMEN" ] }, { "uuid": "40e8cfac-4287-ea77-7b90-4174789b8f84", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15571-58-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f4259e44-d332-092b-2efb-4329d91969f2", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "86715bae-174a-435d-8046-a148857d69e6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9f8cd596-705b-def6-d174-f6ef060b2caf", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a484a0d3-154c-4ab3-949c-b07fd555967f", "id": "a484a0d3-154c-4ab3-949c-b07fd555967f", "molfile": "\n Marvin 01132108332D \n\n 43 42 0 0 0 0 999 V2000\n 7.8093 -9.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0967 -9.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0967 -8.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -8.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -7.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6615 -7.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6615 -6.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9489 -5.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9489 -4.9489 0.0000 Sn 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9489 -4.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2362 -3.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2362 -2.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5236 -2.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5236 -1.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8011 -1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8011 -0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0884 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7704 -4.9489 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1861 -4.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0076 -4.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4233 -4.9489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4233 -3.5236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2448 -3.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6605 -2.8011 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.4820 -2.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8978 -2.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2448 -2.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4233 -2.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0076 -1.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1861 -1.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1273 -4.9489 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7117 -5.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8902 -5.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4744 -4.9489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4744 -6.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6529 -6.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2372 -7.0967 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.4157 -7.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -7.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6529 -7.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4744 -7.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8902 -8.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7117 -8.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 18 1 0 0 0 0\n 9 31 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 27 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 40 1 0 0 0 0\n 38 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\nM END", "smiles": "CCCCCCCC[Sn](CCCCCCCC)(SCC(=O)OCC(CC)CCCC)SCC(=O)OCC(CC)CCCC", "formula": "C36H72O4S2Sn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7e55cde1-7b40-4d2c-9958-4db5b0528915" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "751.7981", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "5b722bac-a9c0-45f0-a8ed-10f193da7a0c", "version": "5", "structure": { "id": "4aaaf7b0-e6fd-4451-bc2d-1d855eb10665", "molfile": "\n Marvin 01132103542D \n\n 43 42 0 0 0 0 999 V2000\n 4.9489 -4.9489 0.0000 Sn 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7704 -4.9489 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1273 -4.9489 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9489 -5.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9489 -4.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1861 -4.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7117 -5.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6615 -6.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2362 -3.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0076 -4.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8902 -5.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6615 -7.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2362 -2.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4233 -3.5236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4233 -4.9489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4744 -6.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4744 -4.9489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -7.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5236 -2.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2448 -3.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6529 -6.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -8.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5236 -1.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6605 -2.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2372 -7.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0967 -8.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8011 -1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2448 -2.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4820 -2.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6529 -7.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4157 -7.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0967 -9.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8011 -0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4233 -2.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8978 -2.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4744 -7.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -7.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8093 -9.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0884 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0076 -1.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8902 -8.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1861 -1.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7117 -8.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 5 9 1 0 0 0 0\n 6 10 1 0 0 0 0\n 7 11 1 0 0 0 0\n 8 12 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 16 1 0 0 0 0\n 11 17 2 0 0 0 0\n 12 18 1 0 0 0 0\n 13 19 1 0 0 0 0\n 14 20 1 0 0 0 0\n 16 21 1 0 0 0 0\n 18 22 1 0 0 0 0\n 19 23 1 0 0 0 0\n 20 24 1 0 0 0 0\n 21 25 1 0 0 0 0\n 22 26 1 0 0 0 0\n 23 27 1 0 0 0 0\n 24 28 1 0 0 0 0\n 24 29 1 0 0 0 0\n 25 30 1 0 0 0 0\n 25 31 1 0 0 0 0\n 26 32 1 0 0 0 0\n 27 33 1 0 0 0 0\n 28 34 1 0 0 0 0\n 29 35 1 0 0 0 0\n 30 36 1 0 0 0 0\n 31 37 1 0 0 0 0\n 32 38 1 0 0 0 0\n 33 39 1 0 0 0 0\n 34 40 1 0 0 0 0\n 36 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 41 43 1 0 0 0 0\nM END", "smiles": "CCCCCCCC[Sn](CCCCCCCC)(SCC(=O)OCC(CC)CCCC)SCC(=O)OCC(CC)CCCC", "formula": "C36H72O4S2Sn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "751.7981", "optical_activity": "UNSPECIFIED", "references": [ "5dcb4a55-f2ba-4792-9abe-6a43028282a6", "786beeb4-d674-45a1-bd00-b54df04d6bf0" ], "stereo_centers": 2 }, "unii": "RA3NRC891C" } ] }