{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "56e57a67-9997-4952-9227-b421033e89d6",
          "code": "553-54-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=553-54-8",
          "code_system": "CAS",
          "references": [
            "f768715b-1aa3-4743-87f4-8f6887db2ddc",
            "4743e786-ee9c-4bd1-9954-714743b3c707"
          ]
        },
        {
          "uuid": "778f9ddc-d658-4940-90bd-d513d7dc4c57",
          "code": "C76050",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76050",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f768715b-1aa3-4743-87f4-8f6887db2ddc"
          ]
        },
        {
          "uuid": "6bd48114-7372-4171-8968-1457d2f47c0b",
          "code": "1363722",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363722/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f768715b-1aa3-4743-87f4-8f6887db2ddc"
          ]
        },
        {
          "uuid": "27ed6c72-331e-43a4-b749-04c156e51930",
          "code": "m6849",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6849?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f768715b-1aa3-4743-87f4-8f6887db2ddc"
          ]
        },
        {
          "uuid": "63fda9a4-769b-4cdd-b165-f2ec1b7a746d",
          "code": "SUB14373MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f768715b-1aa3-4743-87f4-8f6887db2ddc"
          ]
        },
        {
          "uuid": "2f1838ba-4681-44b3-b93b-f2b02998d7f8",
          "code": "209-042-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.221",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f768715b-1aa3-4743-87f4-8f6887db2ddc"
          ]
        },
        {
          "uuid": "b00336c0-cfbb-4867-b6d7-ee8decfa4dfc",
          "code": "2724073",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2724073",
          "code_system": "PUBCHEM",
          "references": [
            "f768715b-1aa3-4743-87f4-8f6887db2ddc"
          ]
        },
        {
          "uuid": "cb3be9ad-45c2-82b8-4a81-183b5bcc7665",
          "code": "DTXSID4044957",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4044957",
          "code_system": "EPA CompTox",
          "references": [
            "daa2f616-d559-032f-108c-b7c2b1c12fb6"
          ]
        },
        {
          "uuid": "e8879d75-e181-1c92-2246-2347010ffb08",
          "code": "C448",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C448",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f14f40bd-1fef-b546-7d9a-a2b109cc3bf1"
          ]
        },
        {
          "uuid": "e5213d8e-d1b4-435a-b57f-4a99fb538391",
          "code": "R9Z042Z19E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5030c417-1f1f-329d-fa3d-556538f04795",
          "code": "100000076781",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e3f80afa-3b89-dd78-6e28-60bfd2bb9944"
          ]
        },
        {
          "uuid": "69ef5bdc-9d88-ddc8-cfa3-29da6b42049d",
          "code": "R9Z042Z19E",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=R9Z042Z19E",
          "code_system": "DAILYMED",
          "references": [
            "690bc263-e02e-0194-ac16-2b8ac531ba2c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5aaa8a72-b186-46b8-8c84-a3cc0db4a6b8",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "81a31f22-0c95-462c-8f7c-bf069c47d8bf",
            "refuuid": "644bdd52-d45f-42c1-9c7b-35bce0733190",
            "name": "LITHIUM CATION",
            "unii": "8H8Z5UER66",
            "linking_id": "8H8Z5UER66",
            "ref_pname": "LITHIUM CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f76d8aa1-2906-40e4-b4fd-b59782ccc1c1",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "25fbbd83-67e7-4c8f-91b5-ec020234c548",
            "refuuid": "76d7e2f1-16f8-4289-8ee1-a8e17c4804bb",
            "name": "Benzoic Acid",
            "unii": "8SKN0B0MIM",
            "linking_id": "8SKN0B0MIM",
            "ref_pname": "Benzoic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "56325ad7-ad88-41b7-9b16-96f99f0b6257",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "364bb9f5-a795-4ba3-bb78-4e13083c08f0",
            "refuuid": "644bdd52-d45f-42c1-9c7b-35bce0733190",
            "name": "LITHIUM CATION",
            "unii": "8H8Z5UER66",
            "linking_id": "8H8Z5UER66",
            "ref_pname": "LITHIUM CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e66f712b-d808-4444-9359-c9c05518c704",
          "name": "BENZOIC ACID, LITHIUM SALT",
          "stdName": "BENZOIC ACID, LITHIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2871bede-b35b-4ce0-9340-d3d02aab61d6",
            "5b230995-904e-4fa1-9fea-5487e152f98f"
          ],
          "display_name": false
        },
        {
          "uuid": "0707337f-46df-4bf4-b504-7455f72d85c4",
          "name": "LITHIUM BENZOATE",
          "stdName": "LITHIUM BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43094621-0c6a-434c-8162-36f9a4136bf4",
            "7ece6396-96d2-4c27-8481-0a8dcd39f636",
            "9220b2a1-8e10-403a-9a5b-49815a115b96",
            "342f638c-46d6-401b-aa35-0afb75897cf4",
            "d8fcde21-a0c7-4345-a248-d00a19439cbd",
            "271281d7-97fb-47db-88dd-d79c5e64cd35",
            "9f3b275b-cb6d-484a-9797-6483032f5e2f",
            "d423b79a-ce93-4929-b945-33282c5c514d"
          ],
          "display_name": true
        },
        {
          "uuid": "b15745ee-b9ac-433a-a4d8-36b29bda0492",
          "name": "LITHIUM BENZOATE [MART.]",
          "stdName": "LITHIUM BENZOATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f3b275b-cb6d-484a-9797-6483032f5e2f"
          ],
          "display_name": false
        },
        {
          "uuid": "532692ab-0e2a-42ba-8a60-18d0ba6764d6",
          "name": "LITHIUM BENZOATE [MI]",
          "stdName": "LITHIUM BENZOATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43094621-0c6a-434c-8162-36f9a4136bf4",
            "d8fcde21-a0c7-4345-a248-d00a19439cbd"
          ],
          "display_name": false
        },
        {
          "uuid": "3ce7c35b-65d5-45fd-9226-6ccb7ec25ee8",
          "name": "LITHIUM BENZOICUM",
          "stdName": "LITHIUM BENZOICUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43094621-0c6a-434c-8162-36f9a4136bf4",
            "725b1175-c675-4124-bf85-c631f0cb12e2",
            "da8637c1-fb09-45f2-b2da-4ad1d9e33d49",
            "59627531-ee9e-46c2-9c75-c48f41b4e1ee",
            "82d38f28-2f63-472a-970a-29524d9a840c"
          ],
          "display_name": false
        },
        {
          "uuid": "88be512e-8026-45cd-9cce-d7d0d17720dd",
          "name": "LITHIUM BENZOICUM [HPUS]",
          "stdName": "LITHIUM BENZOICUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "725b1175-c675-4124-bf85-c631f0cb12e2",
            "59627531-ee9e-46c2-9c75-c48f41b4e1ee"
          ],
          "display_name": false
        },
        {
          "uuid": "b97bb6f9-bfeb-4e7b-a553-4d26bd05a784",
          "name": "Lithium benzoate [WHO-DD]",
          "stdName": "LITHIUM BENZOATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1a80626-e7a0-6029-4327-7179206a3570"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7ece6396-96d2-4c27-8481-0a8dcd39f636",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2871bede-b35b-4ce0-9340-d3d02aab61d6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b230995-904e-4fa1-9fea-5487e152f98f",
          "citation": "STN 2008",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82d38f28-2f63-472a-970a-29524d9a840c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43094621-0c6a-434c-8162-36f9a4136bf4",
          "citation": "HOMEOPATHIC PHARMACOPOEIA US",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59627531-ee9e-46c2-9c75-c48f41b4e1ee",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "725b1175-c675-4124-bf85-c631f0cb12e2",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f3b275b-cb6d-484a-9797-6483032f5e2f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8fcde21-a0c7-4345-a248-d00a19439cbd",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "271281d7-97fb-47db-88dd-d79c5e64cd35",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f768715b-1aa3-4743-87f4-8f6887db2ddc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390732000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38476d42-d3d2-474b-b57e-0ed335952747",
          "citation": "SRS import [R9Z042Z19E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R9Z042Z19E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390732000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da8637c1-fb09-45f2-b2da-4ad1d9e33d49",
          "citation": "LITHIUM BENZOICUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9220b2a1-8e10-403a-9a5b-49815a115b96",
          "citation": "LITHIUM BENZOATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "342f638c-46d6-401b-aa35-0afb75897cf4",
          "citation": "LITHIUM BENZOATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d423b79a-ce93-4929-b945-33282c5c514d",
          "citation": "LITHIUM BENZOATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "daa2f616-d559-032f-108c-b7c2b1c12fb6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=553-54-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f14f40bd-1fef-b546-7d9a-a2b109cc3bf1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4743e786-ee9c-4bd1-9954-714743b3c707",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d1a80626-e7a0-6029-4327-7179206a3570",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "690bc263-e02e-0194-ac16-2b8ac531ba2c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e3f80afa-3b89-dd78-6e28-60bfd2bb9944",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a38e1052-daa6-4d0c-8960-c448ed073130",
          "id": "a38e1052-daa6-4d0c-8960-c448ed073130",
          "molfile": "\n  Marvin  01132108302D          \n\n  1  0  0  0  0  0            999 V2000\n   -1.3821   -2.5075    0.0000 Li  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Li+]",
          "formula": "Li",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "290f878b-a3fa-40e9-8c00-2562229756f6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "6.94",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9e954165-e352-41ce-ac10-614b228ec63c",
          "id": "9e954165-e352-41ce-ac10-614b228ec63c",
          "molfile": "\n  Marvin  01132108142D          \n\n  9  9  0  0  0  0            999 V2000\n   -0.7935   -2.5075    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.3786   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7935   -1.0839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4512   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8661   -1.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6907   -1.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1186   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6907   -2.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8661   -2.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1ccc(cc1)C(=O)[O-]",
          "formula": "C7H5O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9ced42ea-4a4b-438d-a3a8-048249688408"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "121.1137",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2fc93f93-0621-47a6-8f1a-a281a7e795a2",
      "version": "9",
      "structure": {
        "id": "14d5b9db-661d-4bff-a4aa-1312efe6e38f",
        "molfile": "\n  Marvin  01132101172D          \n\n 10  9  0  0  0  0            999 V2000\n   -0.3786   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7935   -2.5075    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.7935   -1.0839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4512   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8661   -1.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8661   -2.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6907   -2.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6907   -1.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1186   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3821   -2.5075    0.0000 Li  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  5  2  0  0  0  0\n  9  8  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  CHG  2   2  -1  10   1\nM  END",
        "smiles": "c1ccc(cc1)C(=O)[O-].[Li+]",
        "formula": "C7H5O2.Li",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "128.0537",
        "optical_activity": "NONE",
        "references": [
          "7ece6396-96d2-4c27-8481-0a8dcd39f636",
          "38476d42-d3d2-474b-b57e-0ed335952747"
        ],
        "stereo_centers": 0
      },
      "unii": "R9Z042Z19E"
    }
  ]
}