{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4ab4b399-3b2b-e98b-ab03-031ddb327d0c",
          "code": "135399673",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135399673",
          "code_system": "PUBCHEM",
          "references": [
            "106089ef-2cfe-c3e2-e53c-4e3f4b652a6b"
          ]
        },
        {
          "uuid": "28166354-0275-49cd-984f-c85b04134604",
          "code": "R9YH59H93M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5e8ee75f-f408-4b6b-b581-da49da51d6b0",
          "code": "199327-61-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=199327-61-2",
          "code_system": "CAS",
          "references": [
            "c279be97-ce88-47aa-8629-06db90d876aa"
          ]
        },
        {
          "uuid": "df3c982f-31f1-1072-bbef-825f61e89326",
          "code": "DTXSID90439401",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90439401",
          "code_system": "EPA CompTox",
          "references": [
            "5ac11971-b8fb-b797-8d02-f7868d5126dc"
          ]
        },
        {
          "uuid": "fd3559ff-22c5-64c7-43ee-65eeb02211e0",
          "code": "300000053035",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "28411605-0076-ea23-df26-551c90c006af"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "e7d34487-973f-4808-bcab-6d5f4c59d3f1",
          "citation": "USP",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c279be97-ce88-47aa-8629-06db90d876aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "106089ef-2cfe-c3e2-e53c-4e3f4b652a6b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5ac11971-b8fb-b797-8d02-f7868d5126dc",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "28411605-0076-ea23-df26-551c90c006af",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c0018a89-e592-4a43-9cda-899a67f4391b",
          "id": "c0018a89-e592-4a43-9cda-899a67f4391b",
          "molfile": "\n  Marvin  07202215152D          \n\n 23 25  0  0  0  0            999 V2000\n   16.5253   -5.5138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2397   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2397   -4.2762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5253   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8107   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0963   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3818   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3818   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0963   -5.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8107   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5253   -3.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6673   -3.8638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9529   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2384   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5239   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3805   -3.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0950   -2.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8095   -3.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8095   -3.8638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0950   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3805   -3.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6673   -5.5138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9529   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 11  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 22  1  0  0  0  0\n  9 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "COc1cc2c(cc1OCCCN3CCOCC3)c(=O)nc[nH]2",
          "formula": "C16H21N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8074f4bb-e4af-4a6b-b2b3-563570440dfb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "319.3563",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f134fe2f-0671-4b7e-9564-495cf8d30f96",
      "version": "10",
      "structure": {
        "id": "79e2f8a3-3c2b-45df-bab6-bc57c6fa1813",
        "molfile": "usp2.mol\n   JSDraw207202215152D\n\n 23 25  0  0  0  0              0 V2000\n   31.2475  -10.4261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5985   -9.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5985   -8.0859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2475   -7.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8964   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5455   -7.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1945   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1945   -9.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5455  -10.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8964   -9.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2475   -5.7461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8434   -7.3061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4926   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415   -7.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7905   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7375   -5.7461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0885   -4.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4396   -5.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4396   -7.3061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0885   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7375   -7.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8434  -10.4261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4926   -9.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  1 10  1  0  0  0  0\n  5 10  2  0  0  0  0\n  4 11  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 12 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 16 21  1  0  0  0  0\n 15 19  1  0  0  0  0\n  7 12  1  0  0  0  0\n 22 23  1  0  0  0  0\n  8 22  1  0  0  0  0\nM  END",
        "smiles": "COc1cc2c(cc1OCCCN3CCOCC3)c(=O)nc[nH]2",
        "formula": "C16H21N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "319.3563",
        "optical_activity": "NONE",
        "references": [
          "c279be97-ce88-47aa-8629-06db90d876aa"
        ],
        "stereo_centers": 0
      },
      "unii": "R9YH59H93M",
      "relationships": [
        {
          "uuid": "f6c1b966-944b-4d64-87cf-06bfee652db2",
          "amount": {
            "uuid": "3669dceb-e74b-4021-9c24-20790e9c1d48"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "e7d34487-973f-4808-bcab-6d5f4c59d3f1"
          ],
          "related_substance": {
            "uuid": "fe561592-0c26-4890-8172-d4b45a3fe0ea",
            "refuuid": "0f331611-3703-477a-a771-8a7934049700",
            "name": "GEFITINIB",
            "unii": "S65743JHBS",
            "linking_id": "S65743JHBS",
            "ref_pname": "GEFITINIB",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "944f53cc-f9b1-4f3d-a504-b7556b2f91c8",
          "name": "4(3H)-Quinazolinone, 7-methoxy-6-[3-(4-morpholinyl)propoxy]-",
          "stdName": "4(3H)-QUINAZOLINONE, 7-METHOXY-6-(3-(4-MORPHOLINYL)PROPOXY)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c279be97-ce88-47aa-8629-06db90d876aa"
          ],
          "display_name": false
        },
        {
          "uuid": "9c77d716-762a-4f44-a559-eccafd36b07b",
          "name": "7-Methoxy-6-(3-morpholinopropoxy)quinazolin-4(3H)-one",
          "stdName": "7-METHOXY-6-(3-MORPHOLINOPROPOXY)QUINAZOLIN-4(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7d34487-973f-4808-bcab-6d5f4c59d3f1"
          ],
          "display_name": false
        },
        {
          "uuid": "755a8f13-3871-446b-888e-99e085a43bc4",
          "name": "7-Methoxy-6-[3-(4-morpholinyl)propoxy]-4(3H)-quinazolinone",
          "stdName": "7-METHOXY-6-(3-(4-MORPHOLINYL)PROPOXY)-4(3H)-QUINAZOLINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c279be97-ce88-47aa-8629-06db90d876aa"
          ],
          "display_name": true
        },
        {
          "uuid": "baf4cf6f-ac62-43eb-a62b-fdf2c92ea729",
          "name": "Gefitinib related compound A [USP]",
          "stdName": "GEFITINIB RELATED COMPOUND A [USP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7d34487-973f-4808-bcab-6d5f4c59d3f1"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "97a4da2e-2ff6-4f41-9b18-315a88a27ad1"
      }
    }
  ]
}