{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "913851b6-f0ba-2d7a-2fb9-81fc2e3b7824", "code": "74568", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74568", "code_system": "CHEBI", "references": [ "c89d91f5-89ab-931b-0a99-559e11fb35cf" ] }, { "uuid": "2a7c2219-0795-4cfa-242f-629f4dced4ab", "code": "DTXSID40216820", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40216820", "code_system": "EPA CompTox", "references": [ "c89d91f5-89ab-931b-0a99-559e11fb35cf" ] }, { "uuid": "14a2aa90-46b3-4511-9034-db60b22aca19", "code": "R8N73ETP3V", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ca5bc354-0519-4909-9fa5-3d1b9c959cce", "code": "151428", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/151428", "code_system": "PUBCHEM", "references": [ "bfeb3b71-17e2-4715-b9ef-c916be96d38a" ] }, { "uuid": "de770619-f541-41e1-8282-a1e2cec80154", "code": "6665-19-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6665-19-6", "code_system": "CAS", "references": [ "e563356e-f204-4678-b1ad-2c14802cb99a" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ed526715-4246-4657-bbcb-fa372cb497bb", "name": "L-LYSYL-L-SERINE", "stdName": "L-LYSYL-L-SERINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e563356e-f204-4678-b1ad-2c14802cb99a" ], "display_name": false }, { "uuid": "0b4c4b98-c58b-43ad-8066-913d78e62f93", "name": "LYSYLSERINE", "stdName": "LYSYLSERINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e563356e-f204-4678-b1ad-2c14802cb99a" ], "display_name": true }, { "uuid": "90223cac-5ac3-4dd1-b331-011e9d4b47e7", "name": "T CELL MODULATORY PEPTIDE", "stdName": "T CELL MODULATORY PEPTIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c81342c5-0618-4774-8690-b3c7d0a30c05" ], "display_name": false }, { "uuid": "27f36b6e-6742-4bcd-a49d-60e264ec8a0f", "name": "TCMP-80", "stdName": "TCMP-80", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "c81342c5-0618-4774-8690-b3c7d0a30c05" ], "display_name": false } ], "references": [ { "uuid": "b1857cb4-c7ca-415a-8a9a-da418dcacaa6", "citation": "SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c81342c5-0618-4774-8690-b3c7d0a30c05", "citation": "https://pubmed.ncbi.nlm.nih.gov/2140370/", "url": "https://pubmed.ncbi.nlm.nih.gov/2140370/", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e563356e-f204-4678-b1ad-2c14802cb99a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bfeb3b71-17e2-4715-b9ef-c916be96d38a", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c89d91f5-89ab-931b-0a99-559e11fb35cf", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5015347e-98f9-4b7a-83b1-263f7a5d6865", "id": "5015347e-98f9-4b7a-83b1-263f7a5d6865", "molfile": "\n Marvin 01132104102D \n\n 16 15 0 0 0 0 999 V2000\n -0.2414 -0.5706 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -0.8904 -1.0450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2411 0.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4718 0.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4721 1.4920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1850 1.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1854 2.7261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4421 -1.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4452 -1.8588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9761 -1.0305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6252 -1.5051 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 2.6255 -2.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3384 -2.7448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3086 -1.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3117 -0.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2095 -1.0374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 1 8 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 11 10 1 6 0 0 0\n 11 12 1 0 0 0 0\n 11 14 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\nM END", "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CO)C(=O)O)N", "formula": "C9H19N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5c1a42a6-ca0a-4ad3-bc51-3d60cebbdd91" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "233.2652", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "3e666ba6-dad7-4481-8981-ee5aa2b7f8b1", "version": "9", "structure": { "id": "44eeb30b-bf1d-4ea5-9cf0-b240e872926f", "molfile": "L-Lysyl-L-serine\n JSDraw209022111032D\n\n 16 15 0 0 1 0 0 V2000\n 29.2209 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8700 -6.9160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5719 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2209 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9229 -7.6960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5719 -5.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5719 -10.0360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -9.2560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8170 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -5.3560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4660 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1151 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7641 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4131 -7.6960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 6 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 7 2 0 0 0 0\n 4 8 1 0 0 0 0\n 5 9 1 0 0 0 0\n 5 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 9 12 1 6 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CO)C(=O)O)N", "formula": "C9H19N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "233.2652", "optical_activity": "UNSPECIFIED", "references": [ "e563356e-f204-4678-b1ad-2c14802cb99a" ], "stereo_centers": 2 }, "unii": "R8N73ETP3V" } ] }