{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f0562d15-143c-4860-bea2-afdb8213c6bb",
          "code": "N05AD02",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANTIPSYCHOTICS|Butyrophenone derivatives|trifluperidol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05AD02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "237ce9fa-7a4e-4998-a477-c712f520486f",
          "code": "QN05AD02",
          "comments": "VATC|PSYCHOLEPTICS|ANTIPSYCHOTICS|Butyrophenone derivatives|trifluperidol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05AD02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "f30d4d79-c34f-4621-b67e-bc82e6d8219c",
          "code": "749-13-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=749-13-3",
          "code_system": "CAS",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45",
            "ec918c9b-7316-45da-8d0b-413f6356956b"
          ]
        },
        {
          "uuid": "6a347a99-17c9-4464-a203-e03c531c3596",
          "code": "C76455",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76455",
          "code_system": "NCI_THESAURUS",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "9e6425b5-3cec-497d-9168-d851b354bf03",
          "code": "D014272",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014272",
          "code_system": "MESH",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "58929d82-4966-4ef6-98a6-c33f5cc15942",
          "code": "1604",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1604",
          "code_system": "INN",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "9751b87e-5289-4d37-97ae-d22c5a2682b8",
          "code": "10804",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10804/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "ca250aa3-3d97-4c7e-8cab-790f21d7476d",
          "code": "m11122",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11122?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "5357fa87-8460-4b46-85ac-25a1be1b7b23",
          "code": "SUB11289MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "483360ca-9a38-4582-b4fd-f96c6a52aa05",
          "code": "CHEMBL15023",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL15023",
          "code_system": "ChEMBL",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "bf1d05eb-a151-44a8-94dd-33e02c56b0e7",
          "code": "5567",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5567",
          "code_system": "PUBCHEM",
          "references": [
            "309c3ab9-faa4-406d-b42b-f0a372fd6d45"
          ]
        },
        {
          "uuid": "7e778176-9865-384b-9ac1-02d179357958",
          "code": "DTXSID4023703",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023703",
          "code_system": "EPA CompTox",
          "references": [
            "584dc8b6-a151-f587-fb44-f16011c580f5"
          ]
        },
        {
          "uuid": "c5671ae9-03db-5168-42d1-8d91b945194c",
          "code": "C29710",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antipsychotic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29710",
          "code_system": "NCI_THESAURUS",
          "references": [
            "82459406-e083-1bc7-0a5c-b9f73e502990"
          ]
        },
        {
          "uuid": "8707941c-858c-424e-98b6-a4ea660da1bf",
          "code": "R8869Q7R8I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2766b239-13f1-1766-f8b6-5b6fc95264a1",
          "code": "2741",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2741",
          "code_system": "DRUG CENTRAL",
          "references": [
            "82459406-e083-1bc7-0a5c-b9f73e502990"
          ]
        },
        {
          "uuid": "0463aa58-661f-6dd3-710e-154907738f91",
          "code": "DB13552",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13552",
          "code_system": "DRUG BANK",
          "references": [
            "82459406-e083-1bc7-0a5c-b9f73e502990"
          ]
        },
        {
          "uuid": "97f875bf-24ee-0265-cf72-6c110a47fbc9",
          "code": "Trifluperidol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Trifluperidol",
          "code_system": "WIKIPEDIA",
          "references": [
            "3b68159f-b142-02e1-9255-375b25d3114e"
          ]
        },
        {
          "uuid": "13a3f569-c377-875a-7f98-ce8634ac093c",
          "code": "100000077725",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d6f63843-135b-01e2-dad9-c6dfc6a2a1fb"
          ]
        },
        {
          "uuid": "7216e371-6def-dd81-b534-dd47ae484de4",
          "code": "170978",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=170978",
          "code_system": "NSC",
          "references": [
            "2fb66ef2-163b-db06-70a1-28613080e0cf"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "93dc4276-1735-42a8-a1e7-52d26afb823d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "108e4d13-3517-43cd-a541-cee4a30837ad",
            "refuuid": "36ec6c4e-2704-4c62-a25f-bf9420161b93",
            "name": "TRIFLUPERIDOL",
            "unii": "R8869Q7R8I",
            "linking_id": "R8869Q7R8I",
            "ref_pname": "TRIFLUPERIDOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "69a7fb53-c602-4b19-82e2-4df4eb8d372f",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b1216f6d-41ff-4685-bb5b-04997ca4404a",
            "refuuid": "84ce33c2-8cb9-4b06-b167-35ef15f2e59b",
            "name": "TRIFLUPERIDOL HYDROCHLORIDE",
            "unii": "UIC8RB6P81",
            "linking_id": "UIC8RB6P81",
            "ref_pname": "TRIFLUPERIDOL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "372587ca-6118-4872-af67-4e2396fe53f9",
          "name": "MCN-JR-2498",
          "stdName": "MCN-JR-2498",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed2ff1c1-d5a2-4ff4-9c5c-740677a1edfe",
            "65451b99-9207-4480-8747-0f168bf6818d"
          ],
          "display_name": false
        },
        {
          "uuid": "c0056e7a-208c-462f-a48b-ae5b20827243",
          "name": "NSC-170978",
          "stdName": "NSC-170978",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b28bed2-94c4-430c-90ca-608a75501fa6",
            "65451b99-9207-4480-8747-0f168bf6818d"
          ],
          "display_name": false
        },
        {
          "uuid": "07d11115-24ac-445b-8741-93b8a4ebe961",
          "name": "R-2498",
          "stdName": "R-2498",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed2ff1c1-d5a2-4ff4-9c5c-740677a1edfe",
            "65451b99-9207-4480-8747-0f168bf6818d"
          ],
          "display_name": false
        },
        {
          "uuid": "48293a7e-e04c-436d-9e13-b8509affbe22",
          "name": "TRIFLUPERIDOL",
          "stdName": "TRIFLUPERIDOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d0612c1-b882-4256-a1d4-654afc980eab",
            "78318cf0-f38b-40a4-bf01-3d04b22e3a44",
            "70232fb8-4878-44ea-a972-6f0121e89953",
            "65451b99-9207-4480-8747-0f168bf6818d",
            "ca20b9ce-1a62-4bc4-8373-0fb9b5f44c2d",
            "922284f0-f0d2-4d93-9b44-e29be1890648",
            "1d24335b-2341-435c-86ad-d19b0725494a",
            "6412fee7-8b9a-4763-8aab-a5a854325c5e",
            "98c76b64-828e-40aa-8c9c-fa159a7864a0",
            "99f2ed6b-a4e0-4a4c-b559-936d2011efec",
            "ed2ff1c1-d5a2-4ff4-9c5c-740677a1edfe",
            "01990b2f-a51b-4e3a-8965-e482df614053"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "18b00bf4-16f1-4467-b819-8f329fb8ea21",
              "name_org": "INN"
            },
            {
              "uuid": "f71cbc16-5264-4aa2-80a5-d2411698768e",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "cc879ce6-167a-4d9c-9b9e-d75528cbc164",
          "name": "TRIFLUPERIDOL [MART.]",
          "stdName": "TRIFLUPERIDOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca20b9ce-1a62-4bc4-8373-0fb9b5f44c2d"
          ],
          "display_name": false
        },
        {
          "uuid": "b6af6846-22d7-4617-81f1-63bbd71b5b73",
          "name": "TRIFLUPERIDOL [MI]",
          "stdName": "TRIFLUPERIDOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d0612c1-b882-4256-a1d4-654afc980eab",
            "65451b99-9207-4480-8747-0f168bf6818d"
          ],
          "display_name": false
        },
        {
          "uuid": "8d7b4ec6-b7fe-43ee-a3d2-46c534236dc0",
          "name": "TRIFLUPERIDOL [USAN]",
          "stdName": "TRIFLUPERIDOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6412fee7-8b9a-4763-8aab-a5a854325c5e"
          ],
          "display_name": false
        },
        {
          "uuid": "5fb93d8c-6775-068b-ac60-888d5bab05ec",
          "name": "Trifluperidol [WHO-DD]",
          "stdName": "TRIFLUPERIDOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "578e1537-8f1e-db15-4d1f-e7eb9979507b"
          ],
          "display_name": false
        },
        {
          "uuid": "a6c7666a-1ba5-45a2-8e45-6b6893870488",
          "name": "trifluperidol [INN]",
          "stdName": "TRIFLUPERIDOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99f2ed6b-a4e0-4a4c-b559-936d2011efec"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ed2ff1c1-d5a2-4ff4-9c5c-740677a1edfe",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "99f2ed6b-a4e0-4a4c-b559-936d2011efec",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6412fee7-8b9a-4763-8aab-a5a854325c5e",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca20b9ce-1a62-4bc4-8373-0fb9b5f44c2d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d0612c1-b882-4256-a1d4-654afc980eab",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65451b99-9207-4480-8747-0f168bf6818d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d24335b-2341-435c-86ad-d19b0725494a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b28bed2-94c4-430c-90ca-608a75501fa6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "309c3ab9-faa4-406d-b42b-f0a372fd6d45",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390471000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b6a00bd-8a5f-4806-a070-7dca9bcc749a",
          "citation": "SRS import [R8869Q7R8I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R8869Q7R8I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390471000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4228de5-cb9d-4531-8aec-ea34eb33f040",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78318cf0-f38b-40a4-bf01-3d04b22e3a44",
          "citation": "TRIFLUPERIDOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "922284f0-f0d2-4d93-9b44-e29be1890648",
          "citation": "TRIFLUPERIDOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98c76b64-828e-40aa-8c9c-fa159a7864a0",
          "citation": "TRIFLUPERIDOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70232fb8-4878-44ea-a972-6f0121e89953",
          "citation": "TRIFLUPERIDOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01990b2f-a51b-4e3a-8965-e482df614053",
          "citation": "TRIFLUPERIDOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "584dc8b6-a151-f587-fb44-f16011c580f5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=749-13-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "82459406-e083-1bc7-0a5c-b9f73e502990",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ec918c9b-7316-45da-8d0b-413f6356956b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3b68159f-b142-02e1-9255-375b25d3114e",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "2fb66ef2-163b-db06-70a1-28613080e0cf",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "578e1537-8f1e-db15-4d1f-e7eb9979507b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d6f63843-135b-01e2-dad9-c6dfc6a2a1fb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c96ff3d-2512-4644-a179-2cacfc8c4de9",
          "id": "0c96ff3d-2512-4644-a179-2cacfc8c4de9",
          "molfile": "\n  Marvin  01132100542D          \n\n 29 31  0  0  0  0            999 V2000\n    4.6045   -1.1794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8928   -0.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4832   -1.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6552   -1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2456   -0.7727    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4235   -0.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0109   -0.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1830   -0.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2266    0.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1889    1.3567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0516    0.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4612    1.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2891    1.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6987    0.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5209    0.6536    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2921   -0.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4671   -0.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6523   -0.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4773   -0.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6069   -0.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3199   -0.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0295   -0.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0265    0.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3236    0.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6061    0.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3401    1.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3566    2.5329    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1681    1.6885    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5121    1.7214    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 19  2  1  0  0  0  0\n  2 20  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 25  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\n 29 26  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)C(F)(F)F)C2(CCN(CCCC(=O)c3ccc(cc3)F)CC2)O",
          "formula": "C22H23F4NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b0d26b7a-a04e-4e12-a4a7-9116c0841783"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "409.418",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "36ec6c4e-2704-4c62-a25f-bf9420161b93",
      "version": "15",
      "structure": {
        "id": "568f63b2-5a97-4469-b703-51db4dec70d8",
        "molfile": "\n  Marvin  01132104302D          \n\n 29 31  0  0  0  0            999 V2000\n    5.3401    1.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3236    0.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6069   -0.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6061    0.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3566    2.5329    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1681    1.6885    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5121    1.7214    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0265    0.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3199   -0.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0295   -0.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8928   -0.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2456   -0.7727    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4773   -0.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4832   -1.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2266    0.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0516    0.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1889    1.3567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6552   -1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6523   -0.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4671   -0.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4612    1.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6987    0.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2891    1.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2921   -0.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5209    0.6536    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4235   -0.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0109   -0.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1830   -0.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6045   -1.1794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  8  2  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  8  2  0  0  0  0\n  9  3  2  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n 12 18  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 28  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 14  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24 20  2  0  0  0  0\n 25 22  1  0  0  0  0\n 26 12  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 19 12  1  0  0  0  0\n 24 22  1  0  0  0  0\n  6  1  1  0  0  0  0\n 11 29  1  0  0  0  0\n 11  3  1  0  0  0  0\n  7  1  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)C(F)(F)F)C2(CCN(CCCC(=O)c3ccc(cc3)F)CC2)O",
        "formula": "C22H23F4NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "409.418",
        "optical_activity": "NONE",
        "references": [
          "c4228de5-cb9d-4531-8aec-ea34eb33f040",
          "2b6a00bd-8a5f-4806-a070-7dca9bcc749a",
          "99f2ed6b-a4e0-4a4c-b559-936d2011efec"
        ],
        "stereo_centers": 0
      },
      "unii": "R8869Q7R8I"
    }
  ]
}