{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0bc6c0a1-8d13-4458-a6cf-a1fd9ba1f280",
          "code": "36301-51-6",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=36301-51-6",
          "code_system": "CAS",
          "references": [
            "e5bfbb59-4baf-4f4c-80a6-bbdcf824c0ce",
            "33f89a2e-feb3-46f7-867c-97f4c3f8935c"
          ]
        },
        {
          "uuid": "fd269510-44dd-49b0-83c1-505f0e470f09",
          "code": "16742-82-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16742-82-8",
          "code_system": "CAS",
          "references": [
            "e5bfbb59-4baf-4f4c-80a6-bbdcf824c0ce",
            "ae320964-dc18-4643-9cd3-47f72f6fefe4"
          ]
        },
        {
          "uuid": "6bbaa33e-1def-d2b2-88d4-9c54b4cfdcf9",
          "code": "DTXSID90168284",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90168284",
          "code_system": "EPA CompTox",
          "references": [
            "c6f458b2-3ffb-b6a5-5dec-4bc08fbd6a7d"
          ]
        },
        {
          "uuid": "18f1f9ce-a3c1-876e-1818-18265715fb4f",
          "code": "135522907",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135522907",
          "code_system": "PUBCHEM",
          "references": [
            "fa42ec0d-3f54-9acb-8197-a23478b2cecb"
          ]
        },
        {
          "uuid": "1ef1a8b5-23ed-49b7-80f2-8f06951b6eab",
          "code": "R84H34PUR1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "01f815e8-c4fe-4472-be0d-658affd34658",
          "name": "BENZOIC ACID, 2-MERCAPTO-, ZINC COMPLEX",
          "stdName": "BENZOIC ACID, 2-MERCAPTO-, ZINC COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ad4d441-35f0-4c54-baf3-b4e63cee8eff",
            "66481e3d-d6cb-4038-891b-fac42b9d06dc"
          ],
          "display_name": false
        },
        {
          "uuid": "89fa6111-2e04-43e7-bfa0-5954c2082bdc",
          "name": "ZINC THIOSALICYLATE",
          "stdName": "ZINC THIOSALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ad4d441-35f0-4c54-baf3-b4e63cee8eff",
            "aeb035b7-5277-46ac-902b-9d4875dde19b",
            "66481e3d-d6cb-4038-891b-fac42b9d06dc",
            "b480899c-71bc-4e83-bca8-64bb4d1975db"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ea0498f9-1ff3-462a-a0ec-eaaed8d03448",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2ced5899-8275-4066-9240-5652057c041b",
          "name": "ZINC THIOSALICYLATE 20% SUSPENSION IN WATER",
          "stdName": "ZINC THIOSALICYLATE 20% SUSPENSION IN WATER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ad4d441-35f0-4c54-baf3-b4e63cee8eff",
            "66481e3d-d6cb-4038-891b-fac42b9d06dc"
          ],
          "display_name": false
        },
        {
          "uuid": "5a2194b1-12a9-4a78-9e8f-abc709c6135c",
          "name": "ZINC, BIS(2-(MERCAPTO-.KAPPA.S)BENZOATO-.KAPPA.O)-, (T-4)-",
          "stdName": "ZINC, BIS(2-(MERCAPTO-.KAPPA.S)BENZOATO-.KAPPA.O)-, (T-4)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ad4d441-35f0-4c54-baf3-b4e63cee8eff",
            "66481e3d-d6cb-4038-891b-fac42b9d06dc"
          ],
          "display_name": false
        },
        {
          "uuid": "3b0f9276-39e1-4354-98e1-24dc9698a4aa",
          "name": "ZINC, BIS(2-MERCAPTOBENZOATO-O,S)-, (T-4)-",
          "stdName": "ZINC, BIS(2-MERCAPTOBENZOATO-O,S)-, (T-4)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ad4d441-35f0-4c54-baf3-b4e63cee8eff",
            "66481e3d-d6cb-4038-891b-fac42b9d06dc"
          ],
          "display_name": false
        },
        {
          "uuid": "458c30c5-ede0-4788-a8be-f7386c029567",
          "name": "ZINC, BIS(O-MERCAPTOBENZOATO)-",
          "stdName": "ZINC, BIS(O-MERCAPTOBENZOATO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ad4d441-35f0-4c54-baf3-b4e63cee8eff",
            "66481e3d-d6cb-4038-891b-fac42b9d06dc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b480899c-71bc-4e83-bca8-64bb4d1975db",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1ad4d441-35f0-4c54-baf3-b4e63cee8eff",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66481e3d-d6cb-4038-891b-fac42b9d06dc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5bfbb59-4baf-4f4c-80a6-bbdcf824c0ce",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391629000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7768af7-4649-4339-b939-d4b0683c2f72",
          "citation": "SRS import [R84H34PUR1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R84H34PUR1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391629000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aeb035b7-5277-46ac-902b-9d4875dde19b",
          "citation": "ZINC THIOSALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c6f458b2-3ffb-b6a5-5dec-4bc08fbd6a7d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16742-82-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fa42ec0d-3f54-9acb-8197-a23478b2cecb",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "33f89a2e-feb3-46f7-867c-97f4c3f8935c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ae320964-dc18-4643-9cd3-47f72f6fefe4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "16f67ad7-af63-4d85-ba94-03b3a5eb8fc5",
          "id": "16f67ad7-af63-4d85-ba94-03b3a5eb8fc5",
          "molfile": "\n  Marvin  01132101232D          \n\n  1  0  0  0  0  0            999 V2000\n    9.6103   -5.0674    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "76cba567-dab7-47aa-a31d-f2eded6e50dd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c1889f3a-9c57-49b0-9120-49d225fa8011",
          "id": "c1889f3a-9c57-49b0-9120-49d225fa8011",
          "molfile": "\n  Marvin  01132110002D          \n\n 10 10  0  0  0  0            999 V2000\n    6.6683   -2.6546    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.9417   -3.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2473   -2.6546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -3.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -4.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -5.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -5.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2335   -5.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2335   -4.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5345   -3.8871    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1ccc(c(c1)C(=O)[O-])S",
          "formula": "C7H5O2S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "72fdf872-3ecd-49ca-b450-4efe4de9eadd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "153.1797",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3f06e63a-f4c2-46ca-8a22-fd3e73584dd8",
      "version": "8",
      "structure": {
        "id": "a2f6721b-ab34-46ba-9713-4417ec14b1df",
        "molfile": "\n  Marvin  01132108282D          \n\n 21 20  0  0  0  0            999 V2000\n    9.6103   -5.0674    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    5.9417   -5.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -5.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -4.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -3.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -3.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -2.6546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2473   -2.6546    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.2335   -4.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5345   -3.8871    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2335   -5.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -5.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -5.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -4.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -3.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -3.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6683   -2.6546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2473   -2.6546    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.2335   -4.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5345   -3.8871    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2335   -5.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n  2 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 21  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 19 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  CHG  3   1   2   8  -1  18  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  5  17  18  19  20  21\nM  SPA   1 10   2   3   4   5   6   7   8   9  10  11\nM  SDI   1  4    4.1145   -5.9398    4.1145   -2.2346\nM  SDI   1  4    7.0883   -2.2346    7.0883   -5.9398\nM  SMT   1 2\nM  END",
        "smiles": "c1ccc(c(c1)C(=O)[O-])S.c1ccc(c(c1)C(=O)[O-])S.[Zn+2]",
        "formula": "2C7H5O2S.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "371.7551",
        "optical_activity": "NONE",
        "references": [
          "f7768af7-4649-4339-b939-d4b0683c2f72",
          "66481e3d-d6cb-4038-891b-fac42b9d06dc"
        ],
        "stereo_centers": 0
      },
      "unii": "R84H34PUR1"
    }
  ]
}