{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b80817af-4c5d-40f6-9ae8-ba1a8ce28075",
          "code": "1225570-30-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1225570-30-8",
          "code_system": "CAS",
          "references": [
            "45ed0ae0-adcd-4413-a0e2-6712429193df",
            "7511af46-c9ab-47b2-9bd4-04287da7f326"
          ]
        },
        {
          "uuid": "1fbaf576-bd32-4dbf-9f8f-63777adb77fd",
          "code": "46235960",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/46235960",
          "code_system": "PUBCHEM",
          "references": [
            "45ed0ae0-adcd-4413-a0e2-6712429193df"
          ]
        },
        {
          "uuid": "0e2326e7-f21a-392f-4587-f3d4dccc6bb7",
          "code": "DTXSID60153642",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60153642",
          "code_system": "EPA CompTox",
          "references": [
            "75219618-d067-2576-6cdc-0292db1c76e6"
          ]
        },
        {
          "uuid": "7d3d48ce-7906-4375-8aaa-4904916f88e0",
          "code": "R80G40F5NQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "50c61bbb-f5ba-4bc8-9633-5b52fb3e364f",
          "name": "2H-1-BENZOPYRAN-3-CARBOXAMIDE, 7-(1,1-DIMETHYLETHYL)-N-((3-FLUORO-4-((METHYLSULFONYL)AMINO)PHENYL)METHYL)-",
          "stdName": "2H-1-BENZOPYRAN-3-CARBOXAMIDE, 7-(1,1-DIMETHYLETHYL)-N-((3-FLUORO-4-((METHYLSULFONYL)AMINO)PHENYL)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71d6ca7d-f91b-4c54-a87b-eb83bcd34672",
            "5a13ce7b-4afd-43b3-b54c-363428d46546"
          ],
          "display_name": false
        },
        {
          "uuid": "dd367f37-4b61-4a3b-8b5a-d5139dc6cdc3",
          "name": "EPIGLOSSIER AP-1",
          "stdName": "EPIGLOSSIER AP-1",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "628cd50b-ff8f-4e7a-a321-ab57f3aa6351",
            "5a13ce7b-4afd-43b3-b54c-363428d46546"
          ],
          "display_name": false
        },
        {
          "uuid": "8e38aed0-44f9-41e4-9a5d-2c84e61900d3",
          "name": "T-BUTYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE",
          "stdName": "T-BUTYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "628cd50b-ff8f-4e7a-a321-ab57f3aa6351",
            "61a2fe98-5711-4a79-8a95-a7641ce23bbf",
            "5a13ce7b-4afd-43b3-b54c-363428d46546"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3942c93b-b166-4649-abaa-d6ae0b80f583",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "800b0427-1803-43f6-bf10-f2e3b28269fe",
          "name": "TERT-BUTYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE",
          "stdName": "TERT-BUTYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b10ba70-19ee-4c8a-aab7-84a17b29d6a0",
            "5a13ce7b-4afd-43b3-b54c-363428d46546"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "628cd50b-ff8f-4e7a-a321-ab57f3aa6351",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5a13ce7b-4afd-43b3-b54c-363428d46546",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71d6ca7d-f91b-4c54-a87b-eb83bcd34672",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b10ba70-19ee-4c8a-aab7-84a17b29d6a0",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45ed0ae0-adcd-4413-a0e2-6712429193df",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19749742-2007-48e5-a944-0f755bb29433",
          "citation": "SRS import [R80G40F5NQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R80G40F5NQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61a2fe98-5711-4a79-8a95-a7641ce23bbf",
          "citation": "T-BUTYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "75219618-d067-2576-6cdc-0292db1c76e6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1225570-30-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7511af46-c9ab-47b2-9bd4-04287da7f326",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7a62c7f5-6381-44bb-9965-118c18a917f2",
          "id": "7a62c7f5-6381-44bb-9965-118c18a917f2",
          "molfile": "\n  Marvin  01132106222D          \n\n 30 32  0  0  0  0            999 V2000\n    6.3155   -0.5745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3155   -1.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6010   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6010   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0299   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0299   -2.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7444   -3.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4589   -2.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1733   -3.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8878   -2.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8878   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1733   -1.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4589   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7444   -1.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -3.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -2.6370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -3.8745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -4.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -5.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -5.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -6.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -6.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -7.5871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -7.9995    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8878   -8.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0148   -8.7140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1898   -7.2850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0313   -6.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7458   -6.7620    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0313   -5.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 14  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 30  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 28 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  2  0  0  0  0\n 24 27  2  0  0  0  0\n 28 29  1  0  0  0  0\n 30 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc2C=C(COc2c1)C(=O)NCc3ccc(c(c3)F)NS(=O)(=O)C",
          "formula": "C22H25FN2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4b0e5352-1786-4145-a58f-1289af63f586"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "432.5102",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c31208d4-f8ad-4708-b968-42d0fb3c4959",
      "version": "4",
      "structure": {
        "id": "79980302-c91a-4d47-9245-7d387057300e",
        "molfile": "\n  Marvin  01132106192D          \n\n 30 32  0  0  0  0            999 V2000\n   11.3168   -4.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -5.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0313   -5.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0313   -6.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -6.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -6.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -5.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8878   -2.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1733   -3.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7444   -3.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0299   -2.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7444   -1.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4589   -2.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4589   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1733   -1.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8878   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3155   -0.5745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6010   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6010   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0299   -1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3155   -1.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -2.6370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -3.8745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -3.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7458   -6.7620    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3168   -7.5871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0148   -8.7140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1898   -7.2850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6023   -7.9995    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8878   -8.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  8 24  1  0  0  0  0\n 16  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 13  1  0  0  0  0\n 13 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 20  1  0  0  0  0\n 20 12  2  0  0  0  0\n 12 14  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 21 17  1  0  0  0  0\n 21 18  1  0  0  0  0\n 21 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 24 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 23  1  1  0  0  0  0\n  4 25  1  0  0  0  0\n 29 26  1  0  0  0  0\n 29 27  2  0  0  0  0\n 29 28  2  0  0  0  0\n 30 29  1  0  0  0  0\n  5 26  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc2C=C(COc2c1)C(=O)NCc3ccc(c(c3)F)NS(=O)(=O)C",
        "formula": "C22H25FN2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "432.5102",
        "optical_activity": "NONE",
        "references": [
          "71d6ca7d-f91b-4c54-a87b-eb83bcd34672",
          "19749742-2007-48e5-a944-0f755bb29433"
        ],
        "stereo_centers": 0
      },
      "unii": "R80G40F5NQ"
    }
  ]
}