{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "47b1332e-8e73-4444-abd5-c8102b12a3c2",
          "code": "57754-85-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57754-85-5",
          "code_system": "CAS",
          "references": [
            "43e10cf5-36cb-480f-8139-4973d11fa5d6",
            "0155a15a-6f02-4917-b2be-4b2e40572a78"
          ]
        },
        {
          "uuid": "517601a1-5203-4443-95e7-d96435ee09a6",
          "code": "117401",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:688",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "43e10cf5-36cb-480f-8139-4973d11fa5d6"
          ]
        },
        {
          "uuid": "0905fe08-da63-4cbf-83fe-17b9e7fd030c",
          "code": "260-929-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.373",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "43e10cf5-36cb-480f-8139-4973d11fa5d6"
          ]
        },
        {
          "uuid": "dcaf2c71-46ca-4581-8d83-d1e3acca53f4",
          "code": "m3659",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3659?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "43e10cf5-36cb-480f-8139-4973d11fa5d6"
          ]
        },
        {
          "uuid": "699cc1e7-c41d-4683-8cf1-6bf81fbd30f7",
          "code": "162839",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/162839",
          "code_system": "PUBCHEM",
          "references": [
            "43e10cf5-36cb-480f-8139-4973d11fa5d6"
          ]
        },
        {
          "uuid": "bca1b0df-2ae5-c8d7-05ef-bb118bf7c571",
          "code": "DTXSID6034265",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6034265",
          "code_system": "EPA CompTox",
          "references": [
            "d5114c55-f1e8-2481-ae11-f45cecd74033"
          ]
        },
        {
          "uuid": "7b227ad0-a37e-4399-bedf-9e7d4ee1a9cb",
          "code": "R7G6QF0YI5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8f395ea1-73c8-ff56-0202-a96d8ae4727b",
          "code": "clopyralid-olamine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/clopyralid-olamine.html",
          "code_system": "ALANWOOD",
          "references": [
            "a7f654e6-1e43-769c-39a8-e3e8a5242fe3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "35b1a979-15a6-4146-8b3c-b4ff908cee6d",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "2ef3ca8b-8bc9-4854-858d-649274b9c292",
            "refuuid": "2cc3a2b5-3ceb-4c88-8a52-8a8ecdf99b30",
            "name": "CLOPYRALID",
            "unii": "10G14M0WDH",
            "linking_id": "10G14M0WDH",
            "ref_pname": "CLOPYRALID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5c9a7234-26a6-42cf-8b2d-f85011afd824",
          "name": "2-PYRIDINECARBOXYLIC ACID, 3,6-DICHLORO-, COMPD. WITH 2-AMINOETHANOL (1:1)",
          "stdName": "2-PYRIDINECARBOXYLIC ACID, 3,6-DICHLORO-, COMPD. WITH 2-AMINOETHANOL (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29a3f6a1-199b-48e6-b1a9-0121432b3a75",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "330f8c06-62db-4cf3-b4df-b17fd533e785",
          "name": "CLOPYRALID MONOETHANOLAMINE",
          "stdName": "CLOPYRALID MONOETHANOLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37",
            "b8e38adf-57c9-465a-910d-d927dc5a6fd8"
          ],
          "display_name": false
        },
        {
          "uuid": "d9ea378c-d805-402d-807e-6291837b8e1c",
          "name": "CLOPYRALID MONOETHANOLAMINE SALT",
          "stdName": "CLOPYRALID MONOETHANOLAMINE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779e957e-68ce-4102-acc5-fb1ad227fccf",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37",
            "e4db17e3-e71f-46c4-bdbb-3ab705ff099f"
          ],
          "display_name": false
        },
        {
          "uuid": "a88f7890-9c7d-45a8-bd3b-936647febfa1",
          "name": "CLOPYRALID MONOETHANOLAMINE SALT [MI]",
          "stdName": "CLOPYRALID MONOETHANOLAMINE SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779e957e-68ce-4102-acc5-fb1ad227fccf",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "9d852fd3-0e48-40a6-91f3-85c13f64575d",
          "name": "CLOPYRALID OLAMINE",
          "stdName": "CLOPYRALID OLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29a3f6a1-199b-48e6-b1a9-0121432b3a75",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "8f4f913c-2ed5-4eda-918c-20ff5c7baccb",
          "name": "CLOPYRALID-OLAMINE",
          "stdName": "CLOPYRALID-OLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa3809ed-13c5-42a9-b2f4-06f4b8b5fabc",
            "90288632-d5b3-44cb-98b3-5d784a685a0e",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": true
        },
        {
          "uuid": "f6c6dd76-c984-416c-8eb3-a990034cae4d",
          "name": "CLOPYRALID-OLAMINE [ISO]",
          "stdName": "CLOPYRALID-OLAMINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90288632-d5b3-44cb-98b3-5d784a685a0e",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "4be12c23-542c-4eee-95ea-1b08b76448b0",
          "name": "DOW SHIELD",
          "stdName": "DOW SHIELD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779e957e-68ce-4102-acc5-fb1ad227fccf",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "0c83ebda-0a38-4383-9024-92c861ea572b",
          "name": "LONTREL",
          "stdName": "LONTREL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779e957e-68ce-4102-acc5-fb1ad227fccf",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "ff899bfc-db41-4058-95b3-c239d0b9401e",
          "name": "M-3972",
          "stdName": "M-3972",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29a3f6a1-199b-48e6-b1a9-0121432b3a75",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "f735e7b4-bf84-47ed-b323-bf50b055d9cb",
          "name": "RECLAIM",
          "stdName": "RECLAIM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779e957e-68ce-4102-acc5-fb1ad227fccf",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "374dcd35-0460-4ae5-99e5-5641d1664965",
          "name": "STINGER",
          "stdName": "STINGER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779e957e-68ce-4102-acc5-fb1ad227fccf",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        },
        {
          "uuid": "e7fa0603-e115-4ac2-9a88-064a39a773d5",
          "name": "TRANSLINE",
          "stdName": "TRANSLINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779e957e-68ce-4102-acc5-fb1ad227fccf",
            "fdfe2c48-ea8e-47f2-a343-2a82da238a37"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b8e38adf-57c9-465a-910d-d927dc5a6fd8",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fdfe2c48-ea8e-47f2-a343-2a82da238a37",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29a3f6a1-199b-48e6-b1a9-0121432b3a75",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "779e957e-68ce-4102-acc5-fb1ad227fccf",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90288632-d5b3-44cb-98b3-5d784a685a0e",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43e10cf5-36cb-480f-8139-4973d11fa5d6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392050000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7b00a46-de59-424e-a15d-846d73245b89",
          "citation": "SRS import [R7G6QF0YI5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R7G6QF0YI5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392050000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4db17e3-e71f-46c4-bdbb-3ab705ff099f",
          "citation": "CLOPYRALID MONOETHANOLAMINE SALT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa3809ed-13c5-42a9-b2f4-06f4b8b5fabc",
          "citation": "CLOPYRALID-OLAMINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d5114c55-f1e8-2481-ae11-f45cecd74033",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57754-85-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7f654e6-1e43-769c-39a8-e3e8a5242fe3",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "0155a15a-6f02-4917-b2be-4b2e40572a78",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f374ad25-38d8-45fb-8dfc-53c8f15f490d",
          "id": "f374ad25-38d8-45fb-8dfc-53c8f15f490d",
          "molfile": "\n  Marvin  01132112372D          \n\n  4  3  0  0  0  0            999 V2000\n    6.8065   -7.7191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6315   -7.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0440   -7.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8690   -7.0046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\nM  END",
          "smiles": "C(CO)N",
          "formula": "C2H7NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a4a4bbd6-b333-48e2-856d-ceed8c4e992b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "61.0832",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9795d939-3d96-473d-83ff-6fe2c10348b1",
          "id": "9795d939-3d96-473d-83ff-6fe2c10348b1",
          "molfile": "\n  Marvin  01132107522D          \n\n 11 11  0  0  0  0            999 V2000\n    7.9171   -5.8244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9171   -4.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6316   -4.5869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2026   -4.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4882   -4.9995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7737   -4.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0592   -4.9995    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7737   -3.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4882   -3.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2026   -3.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9171   -3.3494    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\nM  END",
          "smiles": "c1cc(Cl)nc(c1Cl)C(=O)O",
          "formula": "C6H3Cl2NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "76ddcd4d-374f-4019-861c-310ed1670c00"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "191.9996",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1e844e27-0e5c-4cb3-bdf0-5233f1a93a6c",
      "version": "4",
      "structure": {
        "id": "2b13c288-3686-44bd-9f33-6fba40ef8171",
        "molfile": "\n  Marvin  01132102202D          \n\n 15 14  0  0  0  0            999 V2000\n    5.7737   -4.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0592   -4.9995    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4882   -4.9995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2026   -4.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9171   -4.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9171   -5.8244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6316   -4.5869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2026   -3.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9171   -3.3494    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4882   -3.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7737   -3.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8065   -7.7191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6315   -7.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0440   -7.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8690   -7.0046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  8  4  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n  1 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
        "smiles": "c1cc(Cl)nc(c1Cl)C(=O)O.C(CO)N",
        "formula": "C6H3Cl2NO2.C2H7NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "253.0828",
        "optical_activity": "NONE",
        "references": [
          "29a3f6a1-199b-48e6-b1a9-0121432b3a75",
          "e7b00a46-de59-424e-a15d-846d73245b89"
        ],
        "stereo_centers": 0
      },
      "unii": "R7G6QF0YI5"
    }
  ]
}