{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a6d85a47-76b6-4db4-8202-0daa360d543b",
          "code": "150-39-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=150-39-0",
          "code_system": "CAS",
          "references": [
            "151d01e2-734c-4af8-8041-949af8f731f3",
            "5eb5dc08-2269-487f-8668-3bd27c6d039c"
          ]
        },
        {
          "uuid": "b8680c47-a7e1-4f9b-bf1e-3629b9edf9a0",
          "code": "C026060",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026060",
          "code_system": "MESH",
          "references": [
            "151d01e2-734c-4af8-8041-949af8f731f3"
          ]
        },
        {
          "uuid": "e389d163-4c44-426a-ac66-890ed8cd5567",
          "code": "39108",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:21",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "151d01e2-734c-4af8-8041-949af8f731f3"
          ]
        },
        {
          "uuid": "edb1a190-c40a-431a-bbcb-ba0580c14720",
          "code": "205-759-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.237",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "151d01e2-734c-4af8-8041-949af8f731f3"
          ]
        },
        {
          "uuid": "c0d76722-9b93-4096-964b-291592da9ad8",
          "code": "8773",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8773",
          "code_system": "PUBCHEM",
          "references": [
            "151d01e2-734c-4af8-8041-949af8f731f3"
          ]
        },
        {
          "uuid": "11ec95f4-4877-355d-7a8f-c0c8c303e4ee",
          "code": "5651",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5651",
          "code_system": "HSDB",
          "references": [
            "82eef1a0-e16a-3a9d-eca3-d119e148e45c"
          ]
        },
        {
          "uuid": "cfacafeb-a4ac-c909-c68a-a00f78e4925c",
          "code": "DTXSID1059737",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1059737",
          "code_system": "EPA CompTox",
          "references": [
            "4b0cab65-b923-6d9a-c2e1-41548fa5811d"
          ]
        },
        {
          "uuid": "436ca228-19c0-4cc7-8776-558c623b7f1d",
          "code": "1364568",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1364568/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "b6920af1-8489-4fe0-b3b7-946ae9ced1fa",
          "code": "R79J91U341",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f617efe6-fd5a-52f1-f452-f9b17b11b50a",
          "code": "Hydroxyethylethylenediaminetriacetic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hydroxyethylethylenediaminetriacetic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "1fd1cb20-aa20-6371-bbfe-20871de090ae"
          ]
        },
        {
          "uuid": "05f545d1-7053-410c-4067-f71183a3e8e4",
          "code": "7341",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7341",
          "code_system": "NSC",
          "references": [
            "6fdf98f0-fe29-c3e5-1abe-1041d8ece30f"
          ]
        },
        {
          "uuid": "670105b7-c8da-611b-1b02-283bb8c798c6",
          "code": "R79J91U341",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=R79J91U341",
          "code_system": "DAILYMED",
          "references": [
            "8469077f-0738-cd3f-46bc-79137b1a9177"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "94848e60-bac1-4ce0-bb5a-23d5d671c5b6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8f9ec2b3-5e30-4370-a5c4-586d29ca624c",
            "refuuid": "77ad759e-c234-47c2-982d-b21cab120e40",
            "name": "HYDROXYETHYLETHYLENEDIAMINETRIACETIC ACID",
            "unii": "R79J91U341",
            "linking_id": "R79J91U341",
            "ref_pname": "HYDROXYETHYLETHYLENEDIAMINETRIACETIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8987de23-83fe-4a66-b356-0a6e3e9b2073",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bc03e9eb-2518-4c48-83bd-59771fb40858",
            "refuuid": "2e7a7cb6-52fb-4bad-a1be-e613eefc2f48",
            "name": "TRISODIUM HEDTA",
            "unii": "K3E0U7O8KI",
            "linking_id": "K3E0U7O8KI",
            "ref_pname": "TRISODIUM HEDTA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "40a7c2c3-3acc-41a0-9bd2-7c9185169259",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "848f75b4-aded-44da-920c-297d2d41100d",
            "refuuid": "07540c6c-6a1b-4be8-954c-a663d8e52abb",
            "name": "DISODIUM HEDTA",
            "unii": "KME849MC7A",
            "linking_id": "KME849MC7A",
            "ref_pname": "DISODIUM HEDTA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "37bde2d2-81b4-4ac3-b129-f33cda21da10",
          "name": "HEDTA",
          "stdName": "HEDTA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "320ab87f-e6dd-4191-8956-c243af86f7b9",
            "dbe1a3a6-6a09-4695-8243-a41742f302dd",
            "db0ab1c1-e3e6-49c2-9397-318f13984beb",
            "eb7dc21e-db03-42a5-849e-f7b33d60bd07"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7cbdfd0a-6a95-4e2a-a6f2-1f9210ba5e81",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3996dbd0-b325-47da-8b34-6de076e75101",
          "name": "HYDROXYETHYLETHYLENEDIAMINETRIACETIC ACID",
          "stdName": "HYDROXYETHYLETHYLENEDIAMINETRIACETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3787a8fb-14b8-416e-b860-f5f8d19150ba",
            "02839e7e-625c-4d4b-bc02-e697dedab65b",
            "db0ab1c1-e3e6-49c2-9397-318f13984beb",
            "bbca3be8-7a2d-4025-94bc-a5e7825ace7f"
          ],
          "display_name": true
        },
        {
          "uuid": "8baa842f-4c1e-40d5-ab3d-3572dc1956e0",
          "name": "HYDROXYETHYLETHYLENEDIAMINETRIACETIC ACID [HSDB]",
          "stdName": "HYDROXYETHYLETHYLENEDIAMINETRIACETIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02839e7e-625c-4d4b-bc02-e697dedab65b",
            "db0ab1c1-e3e6-49c2-9397-318f13984beb"
          ],
          "display_name": false
        },
        {
          "uuid": "f3086933-8c0d-425c-ba90-fe3339a4ddef",
          "name": "N-(2-HYDROXYETHYL)ETHYLENEDIAMINE-N,N',N'-TRIACETIC ACID",
          "stdName": "N-(2-HYDROXYETHYL)ETHYLENEDIAMINE-N,N',N'-TRIACETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db0ab1c1-e3e6-49c2-9397-318f13984beb",
            "2b1a126d-8de5-405c-bd1b-805d7fa76c77"
          ],
          "display_name": false
        },
        {
          "uuid": "9e0e2a5f-469f-4267-af61-eb71f43a3cc1",
          "name": "N-(2-HYDROXYETHYL)ETHYLENEDIAMINETRIACETIC ACID",
          "stdName": "N-(2-HYDROXYETHYL)ETHYLENEDIAMINETRIACETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db0ab1c1-e3e6-49c2-9397-318f13984beb",
            "2b1a126d-8de5-405c-bd1b-805d7fa76c77"
          ],
          "display_name": false
        },
        {
          "uuid": "765f1d69-6d3a-443a-91bb-f374e1036f30",
          "name": "N-HYDROXYETHYL ETHYLENEDIAMINE TRIACETIC ACID",
          "stdName": "N-HYDROXYETHYL ETHYLENEDIAMINE TRIACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b1a126d-8de5-405c-bd1b-805d7fa76c77"
          ],
          "display_name": false
        },
        {
          "uuid": "a8382aef-8f7f-4e9a-8f85-8e1fefa51d96",
          "name": "NSC-7341",
          "stdName": "NSC-7341",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b0d4387-431a-4613-8d17-389e54900ff7",
            "db0ab1c1-e3e6-49c2-9397-318f13984beb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2b1a126d-8de5-405c-bd1b-805d7fa76c77",
          "citation": "http://www.chemblink.com/products/150-39-0.htm",
          "url": "http://www.chemblink.com/products/150-39-0.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eb7dc21e-db03-42a5-849e-f7b33d60bd07",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3787a8fb-14b8-416e-b860-f5f8d19150ba",
          "citation": "HAWLEYS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db0ab1c1-e3e6-49c2-9397-318f13984beb",
          "citation": "HAWLEY CONDENSED CHEMICAL DICTIONARY",
          "doc_type": "HAWLEY CONDENSED CHEMICAL DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02839e7e-625c-4d4b-bc02-e697dedab65b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbe1a3a6-6a09-4695-8243-a41742f302dd",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b0d4387-431a-4613-8d17-389e54900ff7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "151d01e2-734c-4af8-8041-949af8f731f3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389657000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3a59bf1-2c0f-4663-912f-bbbdcfb27980",
          "citation": "SRS import [R79J91U341]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R79J91U341",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389657000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbca3be8-7a2d-4025-94bc-a5e7825ace7f",
          "citation": "HYDROXYETHYLETHYLENEDIAMINETRIACETIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "320ab87f-e6dd-4191-8956-c243af86f7b9",
          "citation": "HEDTA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82eef1a0-e16a-3a9d-eca3-d119e148e45c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+150-39-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4b0cab65-b923-6d9a-c2e1-41548fa5811d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=150-39-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5eb5dc08-2269-487f-8668-3bd27c6d039c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1fd1cb20-aa20-6371-bbfe-20871de090ae",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "6fdf98f0-fe29-c3e5-1abe-1041d8ece30f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8469077f-0738-cd3f-46bc-79137b1a9177",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2a04b130-a5ac-41f8-b2b6-e0fcb8d26a35",
          "id": "2a04b130-a5ac-41f8-b2b6-e0fcb8d26a35",
          "molfile": "\n  Marvin  01132102172D          \n\n 19 18  0  0  0  0            999 V2000\n    6.7218   -7.4380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7218   -8.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4354   -8.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4172   -9.4955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7088   -9.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0056   -9.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2738   -9.9043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2816  -10.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5628  -11.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5628  -12.0060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8492  -10.7612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5576   -9.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5472   -8.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2712   -8.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8336   -8.2558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1516   -9.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8730   -9.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5840   -9.8913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8730   -8.6620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n 16  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\nM  END",
          "smiles": "C(CN(CC(=O)O)CC(=O)O)N(CCO)CC(=O)O",
          "formula": "C10H18N2O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fcd8c890-9046-4ceb-a60d-af86a7ca7e09"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "278.2595",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "77ad759e-c234-47c2-982d-b21cab120e40",
      "version": "9",
      "structure": {
        "id": "5a273be4-aa04-4bc3-a19b-648f47356e73",
        "molfile": "\n  Marvin  01132104402D          \n\n 19 18  0  0  0  0            999 V2000\n    4.5628  -11.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5472   -8.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8730   -9.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2738   -9.9043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5840   -9.8913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5628  -12.0060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2712   -8.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2816  -10.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5576   -9.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1516   -9.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4172   -9.4955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0056   -9.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8492  -10.7612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8730   -8.6620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8336   -8.2558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7088   -9.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7218   -7.4380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4354   -8.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7218   -8.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  2  2  0  0  0  0\n  8  1  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  2  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 11  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
        "smiles": "C(CN(CC(=O)O)CC(=O)O)N(CCO)CC(=O)O",
        "formula": "C10H18N2O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "278.2595",
        "optical_activity": "NONE",
        "references": [
          "2b1a126d-8de5-405c-bd1b-805d7fa76c77",
          "a3a59bf1-2c0f-4663-912f-bbbdcfb27980"
        ],
        "stereo_centers": 0
      },
      "unii": "R79J91U341"
    }
  ]
}