{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0669aa17-2a20-4dd7-b6a3-7ad675011bb6", "code": "922165-31-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=922165-31-9", "code_system": "CAS", "references": [ "d7a0d769-6961-4d27-ae0e-f90288a9a22d", "f60e28c2-18d0-498b-a947-5e53c1e32493" ] }, { "uuid": "954dad8d-1159-4ef5-9143-70ed4b4ceecb", "code": "25116113", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25116113", "code_system": "PUBCHEM", "references": [ "d7a0d769-6961-4d27-ae0e-f90288a9a22d" ] }, { "uuid": "11a0f772-e549-79c8-c446-e812af72cf7f", "code": "DTXSID20238929", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20238929", "code_system": "EPA CompTox", "references": [ "cc546c06-9a8a-0c95-b7b3-52ca390194f6" ] }, { "uuid": "a40ccb81-e04d-2438-9c83-2791498ebd5e", "code": "2283759", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2283759/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "71b81302-4d3a-b6d3-3da7-e736ec7e8ee2" ] }, { "uuid": "a053e143-562a-443c-8710-771fd0f5df32", "code": "R6MU0U9L45", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "db4ee5b2-c138-4cd3-3b9f-a5e329dfb368", "code": "R6MU0U9L45", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=R6MU0U9L45", "code_system": "DAILYMED", "references": [ "9f47db45-d6fa-872d-b795-24e8ef131043" ] } ], "substance_class": "chemical", "names": [ { "uuid": "2bf2c094-bd0a-48f7-baec-f769790ab2ed", "name": "1,4-CYCLOHEXANEDICARBOXYLIC ACID, 1,4-BIS(2-(2-ETHOXYETHOXY)ETHYL) ESTER", "stdName": "1,4-CYCLOHEXANEDICARBOXYLIC ACID, 1,4-BIS(2-(2-ETHOXYETHOXY)ETHYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "08b7a13d-85b1-4d8b-ac04-9c3e4adc3df6", "46896e28-210c-4654-8ce5-2f32d3bff2b3" ], "display_name": false }, { "uuid": "1d321fbf-4250-4527-950c-8f1892b5c5c5", "name": "BIS-ETHOXYDIGLYCOL CYCLOHEXANE 1,4-DICARBOXYLATE", "stdName": "BIS-ETHOXYDIGLYCOL CYCLOHEXANE 1,4-DICARBOXYLATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "7daa9013-91a8-4e0d-9ab8-2a34e87f9893", "08b7a13d-85b1-4d8b-ac04-9c3e4adc3df6", "02f02e76-97ab-4cbb-9037-3450b4f56549" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "b82dab08-b4a5-41a8-94d7-89653e483de2", "name_org": "INCI" } ] }, { "uuid": "3b9e7629-877e-46f1-9343-01c84d874c97", "name": "NEOSOLUE-AQULIO", "stdName": "NEOSOLUE-AQULIO", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "7daa9013-91a8-4e0d-9ab8-2a34e87f9893", "08b7a13d-85b1-4d8b-ac04-9c3e4adc3df6" ], "display_name": false } ], "references": [ { "uuid": "7daa9013-91a8-4e0d-9ab8-2a34e87f9893", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "08b7a13d-85b1-4d8b-ac04-9c3e4adc3df6", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "46896e28-210c-4654-8ce5-2f32d3bff2b3", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d7a0d769-6961-4d27-ae0e-f90288a9a22d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391419000, "tags": [ "NOMEN" ] }, { "uuid": "ccb9ddf5-00df-4dec-b238-0dcc77078f1f", "citation": "SRS import [R6MU0U9L45]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R6MU0U9L45", "doc_type": "SRS", "public_domain": true, "document_date": 1493391419000, "tags": [ "NOMEN" ] }, { "uuid": "02f02e76-97ab-4cbb-9037-3450b4f56549", "citation": "BIS-ETHOXYDIGLYCOL CYCLOHEXANE 1,4-DICARBOXYLATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "cc546c06-9a8a-0c95-b7b3-52ca390194f6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=922165-31-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "71b81302-4d3a-b6d3-3da7-e736ec7e8ee2", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "f60e28c2-18d0-498b-a947-5e53c1e32493", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9f47db45-d6fa-872d-b795-24e8ef131043", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "405a16e2-998d-4b13-a50b-258968ba3691", "id": "405a16e2-998d-4b13-a50b-258968ba3691", "molfile": "\n Marvin 01132103242D \n\n 28 28 0 0 0 0 999 V2000\n 11.9528 -3.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2383 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5238 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8093 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0949 -3.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3804 -3.5669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6659 -3.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9515 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -3.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8081 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -4.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8081 -4.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8081 -5.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -6.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -5.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -4.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -6.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8081 -7.2794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -7.2794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9515 -6.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6659 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3804 -6.8669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0949 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8093 -6.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5238 -7.2794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2383 -6.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9528 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 17 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 18 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "CCOCCOCCOC(=O)C1CCC(CC1)C(=O)OCCOCCOCC", "formula": "C20H36O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ff3c116d-43cf-48c7-b171-001700d1c1b8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "404.4958", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "49a4f075-a4f7-4e62-bc88-55d89fb90f0f", "version": "6", "structure": { "id": "ee566db8-a7d2-4e28-b702-dafe84642127", "molfile": "\n Marvin 01132112202D \n\n 28 28 0 0 0 0 999 V2000\n 4.8081 -4.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -4.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -4.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -5.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -6.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8081 -5.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -3.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5226 -6.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9515 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6659 -3.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3804 -3.5669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0949 -3.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8093 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5238 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2383 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9528 -3.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 -7.2794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9515 -6.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6659 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3804 -6.8669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0949 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8093 -6.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5238 -7.2794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2383 -6.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9528 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8081 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8081 -7.2794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 1 6 1 0 0 0 0\n 2 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 8 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 7 27 2 0 0 0 0\n 8 28 2 0 0 0 0\nM END", "smiles": "CCOCCOCCOC(=O)C1CCC(CC1)C(=O)OCCOCCOCC", "formula": "C20H36O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "404.4958", "optical_activity": "NONE", "references": [ "ccb9ddf5-00df-4dec-b238-0dcc77078f1f", "46896e28-210c-4654-8ce5-2f32d3bff2b3" ], "stereo_centers": 0 }, "unii": "R6MU0U9L45" } ] }