{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f4badba9-133f-425c-b786-f0686e5eba15",
          "code": "81-77-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81-77-6",
          "code_system": "CAS",
          "references": [
            "a36832dc-bd4e-43c8-bd25-eab8f0f7e4cc",
            "c6624759-0813-49ef-a1d1-e70ec2cd435d"
          ]
        },
        {
          "uuid": "6c2a0275-39f5-42de-b28b-9ec2e3b6890e",
          "code": "201-375-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.251",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a36832dc-bd4e-43c8-bd25-eab8f0f7e4cc"
          ]
        },
        {
          "uuid": "20c0f2fb-fdf9-4472-b9ef-a97751cfa724",
          "code": "m6244",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6244?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a36832dc-bd4e-43c8-bd25-eab8f0f7e4cc"
          ]
        },
        {
          "uuid": "613d14c1-f727-4f03-b33b-2756eb695251",
          "code": "6690",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6690",
          "code_system": "PUBCHEM",
          "references": [
            "a36832dc-bd4e-43c8-bd25-eab8f0f7e4cc"
          ]
        },
        {
          "uuid": "369a8f7f-dcfe-b9b4-55c7-0391421b1a36",
          "code": "5243",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5243",
          "code_system": "HSDB",
          "references": [
            "a6c48b30-3e65-6d1c-873e-8f95cc7f107f"
          ]
        },
        {
          "uuid": "17036964-a46d-668a-babe-47b9fdc3a94b",
          "code": "DTXSID2026280",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2026280",
          "code_system": "EPA CompTox",
          "references": [
            "551e60a1-8ca7-7fde-c6d3-9e7e1cd28685"
          ]
        },
        {
          "uuid": "2dfe8bc6-a8d7-45cc-a18e-b139db5669e0",
          "code": "SUB195392",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4dcbbac3-c57c-6ead-f238-379e51038c84"
          ]
        },
        {
          "uuid": "8b1537f9-b9bf-4800-be39-33505cee8faa",
          "code": "R68OT0N83K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "82a37493-af6e-104a-2943-e77da5979b82",
          "code": "Indanthrone blue",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Indanthrone_blue",
          "code_system": "WIKIPEDIA",
          "references": [
            "5535de8c-341f-d5e1-cbbe-5897d0903708"
          ]
        },
        {
          "uuid": "012d620a-d0d4-4c60-744c-cccf6f608e4c",
          "code": "100000181601",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "94a817ba-8d2f-cdab-b6ff-c31b845522b8"
          ]
        },
        {
          "uuid": "8982f533-fe63-6d0e-b0a8-fd81ac115e21",
          "code": "47739",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=47739",
          "code_system": "NSC",
          "references": [
            "60e3b706-7c50-df09-9f27-a468158f791a"
          ]
        },
        {
          "uuid": "e88c4f60-f154-e85f-afb5-3324ab439f6a",
          "code": "652900",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=652900",
          "code_system": "NSC",
          "references": [
            "60e3b706-7c50-df09-9f27-a468158f791a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8220b84b-e7c6-4edc-b458-f91143a1d41c",
          "name": "5,9,14,18-ANTHRAZINETETRONE, 6,15-DIHYDRO-",
          "stdName": "5,9,14,18-ANTHRAZINETETRONE, 6,15-DIHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "b29736c0-7e70-45c7-911d-a38e7e670e62",
          "name": "6,15-DIHYDRO-5,9,14,18-ANTHRAZINETETRONE",
          "stdName": "6,15-DIHYDRO-5,9,14,18-ANTHRAZINETETRONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "9a2f8f2a-01bb-44ad-a415-895f606c26d4",
          "name": "C.I. 69800",
          "stdName": "C.I. 69800",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "c1f39ef3-1e01-446d-9503-6550e87e5dd3",
          "name": "C.I. PIGMENT BLUE 60 [HSDB]",
          "stdName": "C.I. PIGMENT BLUE 60 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "8965b4e8-2354-4ffb-8cec-0bcca3b60bc0"
          ],
          "display_name": false
        },
        {
          "uuid": "0d730f1b-00f4-4ba5-aa8e-4df1fd474e8b",
          "name": "CARBANTHRENE BLUE RS",
          "stdName": "CARBANTHRENE BLUE RS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "735f186b-520a-4a7b-a990-298267ee2b15",
          "name": "CI 69800",
          "stdName": "CI 69800",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "4cc55772-d447-4be1-a329-615e876489fc",
            "487cb657-37c6-4899-909b-c3d13c974d00",
            "7d993750-5734-47b6-a18f-bc78dec036d3"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4f80f591-f825-4356-ad10-9e2e5ae44639",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "18901757-e563-459a-97dc-c57a901920b2",
          "name": "CIBANONE BLUE",
          "stdName": "CIBANONE BLUE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "538a005f-da32-4e2b-91c5-0c857b44778f",
          "name": "FOOD BLUE 4",
          "stdName": "FOOD BLUE 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "4cc55772-d447-4be1-a329-615e876489fc"
          ],
          "display_name": false
        },
        {
          "uuid": "5d09f1e0-1dc6-4f56-b6a7-d6a0b873038f",
          "name": "INDANTHRENE",
          "stdName": "INDANTHRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9429858-01ab-4ac4-a564-b4d88d6b73e9",
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "0c51f8c4-e3b3-4012-b3c3-bcf838e9017e",
            "9a35833d-834b-4164-b0de-ae4221f91f2e"
          ],
          "display_name": true
        },
        {
          "uuid": "242e278f-bf3e-49ab-82de-d24b01a7952b",
          "name": "INDANTHRENE BLUE RS",
          "stdName": "INDANTHRENE BLUE RS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "4cc55772-d447-4be1-a329-615e876489fc"
          ],
          "display_name": false
        },
        {
          "uuid": "32e057ac-f50d-4165-a177-38c5052a71b1",
          "name": "INDANTHRENE [MI]",
          "stdName": "INDANTHRENE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "9a35833d-834b-4164-b0de-ae4221f91f2e"
          ],
          "display_name": false
        },
        {
          "uuid": "21f89c21-02b2-4f12-b362-6828712d6261",
          "name": "INDANTHRONE",
          "stdName": "INDANTHRONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "89329559-b2af-4f13-ada5-294c9c220015",
          "name": "INDANTHRONE BLUE",
          "stdName": "INDANTHRONE BLUE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "48a2b1d3-18b6-478c-9909-60cdd5674397",
          "name": "NSC-47739",
          "stdName": "NSC-47739",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "59d593d6-6f87-425b-95b0-3bc22e0b65fd",
          "name": "NSC-652900",
          "stdName": "NSC-652900",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "35f29e6e-3de6-4747-92e6-589c681bd0ee",
          "name": "PALANTHRENE BLUE GPT",
          "stdName": "PALANTHRENE BLUE GPT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "487cb657-37c6-4899-909b-c3d13c974d00"
          ],
          "display_name": false
        },
        {
          "uuid": "76377252-eb53-4f31-9b87-63575292bd44",
          "name": "PIGMENT BLUE 60",
          "stdName": "PIGMENT BLUE 60",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "4cc55772-d447-4be1-a329-615e876489fc"
          ],
          "display_name": false
        },
        {
          "uuid": "1365435b-599c-48d5-933e-8fe2b17db91e",
          "name": "VAT BLUE 4",
          "stdName": "VAT BLUE 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724fd3fb-de2f-4c61-acd2-503af89003b0",
            "4cc55772-d447-4be1-a329-615e876489fc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e9429858-01ab-4ac4-a564-b4d88d6b73e9",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "724fd3fb-de2f-4c61-acd2-503af89003b0",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a35833d-834b-4164-b0de-ae4221f91f2e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "487cb657-37c6-4899-909b-c3d13c974d00",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cc55772-d447-4be1-a329-615e876489fc",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8965b4e8-2354-4ffb-8cec-0bcca3b60bc0",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a36832dc-bd4e-43c8-bd25-eab8f0f7e4cc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389650000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bb481a9-793f-465a-ad40-a9f7b8575ed9",
          "citation": "SRS import [R68OT0N83K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R68OT0N83K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389650000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c51f8c4-e3b3-4012-b3c3-bcf838e9017e",
          "citation": "INDANTHRENE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d993750-5734-47b6-a18f-bc78dec036d3",
          "citation": "CI 69800 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6c48b30-3e65-6d1c-873e-8f95cc7f107f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+81-77-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "551e60a1-8ca7-7fde-c6d3-9e7e1cd28685",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=81-77-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5535de8c-341f-d5e1-cbbe-5897d0903708",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "4dcbbac3-c57c-6ead-f238-379e51038c84",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c6624759-0813-49ef-a1d1-e70ec2cd435d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "60e3b706-7c50-df09-9f27-a468158f791a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "94a817ba-8d2f-cdab-b6ff-c31b845522b8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b229dd42-1023-4dd8-b941-0652c8bfed49",
          "id": "b229dd42-1023-4dd8-b941-0652c8bfed49",
          "molfile": "\n  Marvin  01132109142D          \n\n 34 40  0  0  0  0            999 V2000\n    6.7688    0.4062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7688   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4795   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1995   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9195   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9195   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1995   -2.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4795   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7688   -2.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7688   -2.8616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0394   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3102   -2.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3102   -2.8801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4794   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4794   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7639   -4.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0440   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0440   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7963   -2.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7963   -2.0631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5949   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5949   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3102   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0394   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -2.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -1.9847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5993   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8793   -2.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1638   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1638   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8793   -4.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5993   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -4.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -5.2525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 24  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  8  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 24 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 21 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 19  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 33 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 25 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 25  1  0  0  0  0\n 28 27  1  0  0  0  0\n 32 27  2  0  0  0  0\n 29 28  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 34 33  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(=O)c3ccc4c(c3c2=O)[nH]c5ccc6c(c5[nH]4)c(=O)c7ccccc7c6=O",
          "formula": "C28H14N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0973b10b-4055-4b6a-9f7a-2b2c77b23161"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "442.4228",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e363bbd4-71b7-4d6e-8466-31d40b874676",
      "version": "10",
      "structure": {
        "id": "310c41f8-e0e8-4e53-967e-8dcd637011fb",
        "molfile": "\n  Marvin  01132102382D          \n\n 34 40  0  0  0  0            999 V2000\n    6.0394   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3102   -2.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3102   -2.8801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4794   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4794   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7639   -4.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0440   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0440   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7963   -2.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7963   -2.0631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5949   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5949   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3102   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0394   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7688   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4795   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1995   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9195   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9195   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1995   -2.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4795   -1.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7688   -2.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7688   -2.8616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7688    0.4062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -2.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5993   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8793   -2.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1638   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1638   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8793   -4.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5993   -4.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -4.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -5.2525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3147   -1.9847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  1  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22  1  1  0  0  0  0\n 23 22  2  0  0  0  0\n 16 21  2  0  0  0  0\n 24 15  2  0  0  0  0\n  4  9  2  0  0  0  0\n 25  8  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 28 27  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 32  7  1  0  0  0  0\n 33 32  2  0  0  0  0\n 31 26  1  0  0  0  0\n 34 25  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(=O)c3ccc4c(c3c2=O)[nH]c5ccc6c(c5[nH]4)c(=O)c7ccccc7c6=O",
        "formula": "C28H14N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "442.4228",
        "optical_activity": "NONE",
        "references": [
          "e9429858-01ab-4ac4-a564-b4d88d6b73e9",
          "3bb481a9-793f-465a-ad40-a9f7b8575ed9"
        ],
        "stereo_centers": 0
      },
      "unii": "R68OT0N83K"
    }
  ]
}