{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b8a0e71b-fa57-4c19-89be-9276def62a0c",
          "code": "610-81-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=610-81-1",
          "code_system": "CAS",
          "references": [
            "1c559479-6730-446a-995c-917b70f660c1",
            "82f50f5f-e99d-4065-a079-105edb8866a8"
          ]
        },
        {
          "uuid": "1f43d491-5020-4e26-a156-6d9c195adb45",
          "code": "210-236-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.307",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1c559479-6730-446a-995c-917b70f660c1"
          ]
        },
        {
          "uuid": "951e8c20-61f9-4423-b9bf-c75e2094ac17",
          "code": "3758882",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3758882",
          "code_system": "PUBCHEM",
          "references": [
            "1c559479-6730-446a-995c-917b70f660c1"
          ]
        },
        {
          "uuid": "a2ad7a7c-2c9d-0859-53ea-3c04a8060554",
          "code": "DTXSID50209864",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50209864",
          "code_system": "EPA CompTox",
          "references": [
            "beb47326-95be-7067-af72-a702051cf8eb"
          ]
        },
        {
          "uuid": "29418583-7551-468d-ad43-42766cd04a42",
          "code": "R5WY41Q95Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ef489fad-200f-e124-004b-e1924613df5f",
          "code": "400380",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=400380",
          "code_system": "NSC",
          "references": [
            "4d528d09-d149-efd2-6802-220c191ed762"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c85e7f8e-fc9b-4692-9910-0d92c0d5d912",
          "name": "2-AMINO-5-HYDROXYNITROBENZENE",
          "stdName": "2-AMINO-5-HYDROXYNITROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a69933b-c838-4378-8728-79188cde9230",
            "e1f6c01f-0d56-4a52-a116-242bb495aed1"
          ],
          "display_name": false
        },
        {
          "uuid": "a5bae6e1-0de8-42ab-b12b-8a4b45318bca",
          "name": "2-NITRO-4-HYDROXYANILINE",
          "stdName": "2-NITRO-4-HYDROXYANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a69933b-c838-4378-8728-79188cde9230",
            "e1f6c01f-0d56-4a52-a116-242bb495aed1"
          ],
          "display_name": false
        },
        {
          "uuid": "0b2f02dc-06fa-4ec3-9940-176f3a55d4c0",
          "name": "4-AMINO-3-NITROPHENOL",
          "stdName": "4-AMINO-3-NITROPHENOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2739367c-d437-4f46-b37a-30da539d1802",
            "2a69933b-c838-4378-8728-79188cde9230",
            "e1f6c01f-0d56-4a52-a116-242bb495aed1",
            "064fcfd3-7c38-4eb7-907a-fd5acc4f59d9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bf6013a7-88c6-4760-a21b-c53317957e7f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1615f6ca-e389-40f3-a27f-abd54e5e12ed",
          "name": "NSC-400380",
          "stdName": "NSC-400380",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2da74d73-a3e9-4eed-b73a-17538247a04b",
            "e1f6c01f-0d56-4a52-a116-242bb495aed1"
          ],
          "display_name": false
        },
        {
          "uuid": "234477f2-5986-40e6-89a6-edbca8752919",
          "name": "PHENOL, 4-AMINO-3-NITRO-",
          "stdName": "PHENOL, 4-AMINO-3-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a69933b-c838-4378-8728-79188cde9230",
            "e1f6c01f-0d56-4a52-a116-242bb495aed1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2a69933b-c838-4378-8728-79188cde9230",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e1f6c01f-0d56-4a52-a116-242bb495aed1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "064fcfd3-7c38-4eb7-907a-fd5acc4f59d9",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2da74d73-a3e9-4eed-b73a-17538247a04b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c559479-6730-446a-995c-917b70f660c1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390901000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c286b816-aa9c-484c-9717-049bdaa42911",
          "citation": "SRS import [R5WY41Q95Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R5WY41Q95Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390901000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2739367c-d437-4f46-b37a-30da539d1802",
          "citation": "4-AMINO-3-NITROPHENOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "beb47326-95be-7067-af72-a702051cf8eb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=610-81-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d528d09-d149-efd2-6802-220c191ed762",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "82f50f5f-e99d-4065-a079-105edb8866a8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "694e8230-0994-4980-9250-8f7d6b45b5ae",
          "id": "694e8230-0994-4980-9250-8f7d6b45b5ae",
          "molfile": "\n  Marvin  01132105282D          \n\n 11 11  0  0  0  0            999 V2000\n    4.8596   -2.5068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5704   -2.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5704   -3.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -4.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9924   -3.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7033   -4.1798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9924   -2.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -2.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -1.6705    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.5704   -1.2521    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9924   -1.2521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\nM  CHG  2   9   1  10  -1\nM  END",
          "smiles": "c1cc(c(cc1O)[N+](=O)[O-])N",
          "formula": "C6H6N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9a1a15fa-ef86-4be8-8c82-791bc07a8f03"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "154.1237",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d9139efa-0035-487b-a68c-328406647a33",
      "version": "5",
      "structure": {
        "id": "69e08125-ad6d-4997-8333-9ae19db3f9f2",
        "molfile": "\n  Marvin  01132105302D          \n\n 11 11  0  0  0  0            999 V2000\n    7.7033   -4.1798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9924   -3.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -4.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5704   -3.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5704   -2.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8596   -2.5068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -2.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9924   -2.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -1.6705    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.5704   -1.2521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9924   -1.2521    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  2  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\nM  CHG  2   9   1  11  -1\nM  END",
        "smiles": "c1cc(c(cc1O)[N+](=O)[O-])N",
        "formula": "C6H6N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "154.1237",
        "optical_activity": "NONE",
        "references": [
          "c286b816-aa9c-484c-9717-049bdaa42911",
          "2a69933b-c838-4378-8728-79188cde9230"
        ],
        "stereo_centers": 0
      },
      "unii": "R5WY41Q95Z"
    }
  ]
}