{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f3e2ce4c-3b38-4bde-86fd-dd02ad529339",
          "code": "217100",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:371",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "c6e92c08-bd9a-475c-8a3d-c9f828cd27f7",
          "code": "500",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=500",
          "code_system": "INN",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "e0a990b7-2343-4fdf-8321-d971c1b2aac8",
          "code": "2358",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2358/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "440482bf-539f-45c7-8c4e-2bc7f1e2e73b",
          "code": "m3362",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3362?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "0fa3c977-26ea-449f-9317-c46e2faf6b5f",
          "code": "DB00878",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00878",
          "code_system": "DRUG BANK",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "68c0368e-14cb-4fc2-a8f4-4334cfbf94c7",
          "code": "SUB06181MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "65e984a7-d813-4202-8677-856d6ab6d9af",
          "code": "21 CFR 524.402",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.402 Chlorhexidine.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.402",
          "code_system": "CFR",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "86a0e0c5-4d4a-4eeb-b618-fbb99a76eeb2",
          "code": "21 CFR 556.120",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 556 -- TOLERANCES FOR RESIDUES OF NEW ANIMAL DRUGS IN FOOD|Subpart B--Specific Tolerances for Residues of New Animal Drugs|Sec. 556.120 Chlorhexidine.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=556.120",
          "code_system": "CFR",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "d20559b8-9830-441d-8047-1bf31686a0e4",
          "code": "CHEMBL790",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL790",
          "code_system": "ChEMBL",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "3df3e472-4dea-442c-86bc-652791209246",
          "code": "200-238-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.217",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "4285ab4b-3dda-4eb0-b893-69369082bc5e",
          "code": "S03AA04",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICAL AND OTOLOGICAL PREPARATIONS|ANTIINFECTIVES|Antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S03AA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "c1a435a0-3c64-4534-a6ca-e7cb9b7d68b3",
          "code": "D09AA12",
          "comments": "ATC|DERMATOLOGICALS|MEDICATED DRESSINGS|MEDICATED DRESSINGS|Medicated dressings with antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D09AA12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "3784d140-5856-485a-9eac-b5f315b191ad",
          "code": "A01AB03",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|STOMATOLOGICAL PREPARATIONS|STOMATOLOGICAL PREPARATIONS|Antiinfectives and antiseptics for local oral treatment|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A01AB03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "f320ab6d-72de-436a-812c-25ce82691627",
          "code": "B05CA02",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|BLOOD SUBSTITUTES AND PERFUSION SOLUTIONS|IRRIGATING SOLUTIONS|Antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B05CA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "c120bc27-946c-4295-b057-8e1944a80d8f",
          "code": "S01AX09",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|ANTIINFECTIVES|Other antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01AX09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "0e9f095a-5215-407e-80d0-28ae49d1a265",
          "code": "D08AC02",
          "comments": "ATC|DERMATOLOGICALS|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Biguanides and amidines|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D08AC02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "7568c664-36f7-4310-8b16-8e650df2d531",
          "code": "R02AA05",
          "comments": "ATC|RESPIRATORY SYSTEM|THROAT PREPARATIONS|THROAT PREPARATIONS|Antiseptics|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R02AA05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "2edeaa69-0aba-41eb-98c0-e5795113605d",
          "code": "S02AA09",
          "comments": "ATC|SENSORY ORGANS|OTOLOGICALS|ANTIINFECTIVES|Antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S02AA09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "a6f471f5-79cc-4a99-a45e-d5f0aae2d567",
          "code": "N0000008478",
          "comments": "Physiological Effects [PE]|Generalized Systemic Effects [PE]|Cellular Activity Alteration [PE]|Cellular Structure Alteration [PE]|Cell Wall Alteration [PE]|Decreased Cell Wall Integrity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008478",
          "code_system": "NDF-RT",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "40c92ba4-f67d-4442-8d00-22f244a36604",
          "code": "QA01AB03",
          "comments": "VATC|STOMATOLOGICAL PREPARATIONS|STOMATOLOGICAL PREPARATIONS|Antiinfectives and antiseptics for local oral treatment|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA01AB03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "7ac21e47-0266-4c6f-9677-1e196c2c76b7",
          "code": "QR02AA05",
          "comments": "VATC|THROAT PREPARATIONS|THROAT PREPARATIONS|Antiseptics|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR02AA05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "8f6b51a9-b002-49bc-bf60-e6f45fba7cab",
          "code": "QS03AA04",
          "comments": "VATC|OPHTHALMOLOGICAL AND OTOLOGICAL PREPARATIONS|ANTIINFECTIVES|Antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS03AA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "94edea40-9a53-40d4-9ba9-4ce68df516f9",
          "code": "QD09AA12",
          "comments": "VATC|MEDICATED DRESSINGS|MEDICATED DRESSINGS|Medicated dressings with antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD09AA12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "5d041ef7-dc73-4749-ae97-8972de290d76",
          "code": "QD08AC52",
          "comments": "VATC|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Biguanides and amidines|chlorhexidine, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD08AC52&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "a0876ae8-6702-4a81-8193-c0d5ccd619ea",
          "code": "QS01AX09",
          "comments": "VATC|OPHTHALMOLOGICALS|ANTIINFECTIVES|Other antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01AX09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "de37bef9-f90e-4468-adf9-86c45b32b48f",
          "code": "QB05CA02",
          "comments": "VATC|BLOOD SUBSTITUTES AND PERFUSION SOLUTIONS|IRRIGATING SOLUTIONS|Antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB05CA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "d64cf47a-b01e-4b56-bc49-7da5eca6b8c9",
          "code": "QS02AA09",
          "comments": "VATC|OTOLOGICALS|ANTIINFECTIVES|Antiinfectives|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS02AA09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "5a9cb86f-2442-4cf3-8158-f90b93636fa0",
          "code": "QD08AC02",
          "comments": "VATC|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Biguanides and amidines|chlorhexidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD08AC02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "a02938a6-a6a4-4e86-ba9d-b794ccf1becd",
          "code": "55-56-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55-56-1",
          "code_system": "CAS",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069",
            "90d893e3-ee39-4a20-9c7a-2830f6ed751e"
          ]
        },
        {
          "uuid": "8430bc42-50a7-40ca-a7e4-f720c4b8fdc0",
          "code": "C364",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C364",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "7555bb8c-80c1-441b-b2fb-2b0d6186892b",
          "code": "D002710",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002710",
          "code_system": "MESH",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "c5ecc5c8-4e9b-4323-9779-00e12937b46b",
          "code": "15.1",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Disinfectants and antiseptics|Antiseptics",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/251/?section=107#type602",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "c0c21196-d9e9-4b0d-a5b2-bcfcddce0059",
          "code": "CHLORHEXIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chlorhexidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "c12cca4e-26c6-4db4-ac51-682387eafcf3",
          "code": "D08AC52",
          "comments": "ATC|DERMATOLOGICALS|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Biguanides and amidines|chlorhexidine, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D08AC52&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f13fe63f-7205-41c4-8ad3-f9d91c4d2069"
          ]
        },
        {
          "uuid": "9114b224-4f57-6888-2041-5d06d1c9258e",
          "code": "7196",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7196",
          "code_system": "HSDB",
          "references": [
            "6ea6af18-a512-6aee-bd91-4ce3ca5f513a"
          ]
        },
        {
          "uuid": "c4049f7e-4773-b77a-d4ff-c4b9bc6abd48",
          "code": "DTXSID2033314",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2033314",
          "code_system": "EPA CompTox",
          "references": [
            "86454a61-bbad-7c2c-fc22-33cf46eca3e2"
          ]
        },
        {
          "uuid": "f12d95ba-d503-8276-742a-b93a35bf61f3",
          "code": "Chlorhexidine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM494/",
          "code_system": "LACTMED",
          "references": [
            "57789f46-bdee-291f-655a-d7d604cbda02"
          ]
        },
        {
          "uuid": "61a037bd-1f58-7a9a-8f3d-40a78f383d3b",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "57789f46-bdee-291f-655a-d7d604cbda02"
          ]
        },
        {
          "uuid": "8a7023db-07b4-42c4-95fe-84018cc090d9",
          "code": "R4KO0DY52L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "88be9cac-147b-d9e8-e0a2-6ed2e8edbc53",
          "code": "2713",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2713",
          "code_system": "PUBCHEM",
          "references": [
            "7fd057ba-a8de-0bc3-c819-26d9b4de8434"
          ]
        },
        {
          "uuid": "5135cab5-1723-fb90-ba04-e611ef0428ac",
          "code": "597",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/597",
          "code_system": "DRUG CENTRAL",
          "references": [
            "57789f46-bdee-291f-655a-d7d604cbda02"
          ]
        },
        {
          "uuid": "9921c284-aeaf-18de-19af-c633527cec3a",
          "code": "3614",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3614",
          "code_system": "CHEBI",
          "references": [
            "57789f46-bdee-291f-655a-d7d604cbda02"
          ]
        },
        {
          "uuid": "dfc19fe8-efd8-d6cf-db42-5e75ebb7b08f",
          "code": "1111001",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1111001",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "57789f46-bdee-291f-655a-d7d604cbda02"
          ]
        },
        {
          "uuid": "ee2a4a30-1681-08f4-1b6f-f0e72ce9e4b6",
          "code": "100000081581",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5fb37fc8-535a-528f-933b-d1d0428bc4a8"
          ]
        },
        {
          "uuid": "e728de52-35d9-50c3-61be-d0bc7b0a4d7f",
          "code": "R4KO0DY52L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=R4KO0DY52L",
          "code_system": "DAILYMED",
          "references": [
            "bd1e3a2a-d1eb-60a9-fbaa-1ecf5a9665fa"
          ]
        },
        {
          "uuid": "87475f99-7352-5959-da12-391a28e72437",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "ef167d3f-af33-4799-556f-7a90c110419c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "855438aa-af5e-4875-bc1d-8b77476cba60",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "24bf1181-edf1-465a-a596-bb2bf019e9c0",
            "refuuid": "769a655b-33c6-4dba-a09b-d0a9d99a734a",
            "name": "CHLORHEXIDINE",
            "unii": "R4KO0DY52L",
            "linking_id": "R4KO0DY52L",
            "ref_pname": "CHLORHEXIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0aff7a19-3e0e-4d38-ab6b-39c395ab34e6",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "9c09b1b4-379e-434b-9023-994542c9d8e4",
            "refuuid": "03557225-eee3-4110-955d-b02f66b4b1b3",
            "name": "CHLORHEXIDINE ACETATE",
            "unii": "5908ZUF22Y",
            "linking_id": "5908ZUF22Y",
            "ref_pname": "CHLORHEXIDINE ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "719f8e38-9d4d-43fa-ab30-ad0850368aed",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ab59a3ef-4fa7-4de2-a2ce-a68e43eb893f",
            "refuuid": "78f59e2e-f31f-4a71-b789-bba657ff5d60",
            "name": "CHLORHEXIDINE GLUCONATE",
            "unii": "MOR84MUD8E",
            "linking_id": "MOR84MUD8E",
            "ref_pname": "CHLORHEXIDINE GLUCONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b62cdd3c-b1a8-4428-87fb-1c8385254ab3",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "4b349117-720b-4e49-8588-7780fe9d9b10",
            "refuuid": "d6e011df-f105-482e-aabd-70292a6a50b1",
            "name": "CHLORHEXIDINE HYDROCHLORIDE",
            "unii": "E64XL9U38K",
            "linking_id": "E64XL9U38K",
            "ref_pname": "CHLORHEXIDINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "01301246-36f0-4e3c-bc20-cb0836a64dfa",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "937f54e7-5c28-493c-a4b6-bd692491f482",
            "refuuid": "de6e9543-d020-48de-8279-888ab73c5994",
            "name": "CHLORHEXIDINE PHOSPHANILATE",
            "unii": "I20F29W4EO",
            "linking_id": "I20F29W4EO",
            "ref_pname": "CHLORHEXIDINE PHOSPHANILATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "baa86807-0bfa-413d-979b-6980dfd6ed24",
          "name": "CHLORHEXADINE",
          "stdName": "CHLORHEXADINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "127e85e8-0655-4547-ad69-768ea7c5574d",
            "7c617c22-eb47-42d0-bc17-60c1882545da"
          ],
          "display_name": false
        },
        {
          "uuid": "ff495dd7-9e73-4870-82a8-e388553f872a",
          "name": "CHLORHEXIDINE",
          "stdName": "CHLORHEXIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "127e85e8-0655-4547-ad69-768ea7c5574d",
            "3b9d60c9-663c-4794-852f-66d24c4c0c24",
            "ea716797-0c21-4290-8712-2b3eff98b433",
            "e5ad0b86-bbf4-45f4-aa77-7693755f8392",
            "01ad54b8-2623-4601-b8ad-04ec5f8d7bc4",
            "8bf28d90-5574-46a5-a23e-1de79b85036a",
            "01e49c93-5ce7-4f69-97a5-b65807f07e26",
            "5507f98b-931c-4253-98ba-fb06334316c4",
            "64d5b92f-04de-4c07-b313-6790df41dc55",
            "d230c4f7-cc80-47f5-9db3-0ce183f9d0da",
            "b884139b-05c1-45c8-9476-e3bf30424826",
            "735166ea-a2de-402a-8c62-099e869ea224",
            "d30a04ee-d1f4-4944-bed7-f6081358a352",
            "92f63535-f76a-4335-bdc9-34bbc15cbeb2",
            "cecb457c-1796-4a7f-a117-d716d8a385c8",
            "b5aecd17-02e7-44b6-a152-3089d5501f3d",
            "46dfdad0-00f8-4fc2-8d03-6914d56ac0da",
            "5c7d795b-1455-4f59-9af9-f3558e4f6e29"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6deb42b7-027a-4d53-b834-ef7ca65071a1",
              "name_org": "INN"
            },
            {
              "uuid": "9995e822-77e3-49cc-bb6f-f4815a9b5a56",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6f27499c-e510-4a29-ade9-9535985ca17f",
          "name": "CHLORHEXIDINE [HSDB]",
          "stdName": "CHLORHEXIDINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "127e85e8-0655-4547-ad69-768ea7c5574d",
            "e5ad0b86-bbf4-45f4-aa77-7693755f8392"
          ],
          "display_name": false
        },
        {
          "uuid": "cea28f95-1ad7-4ce2-a3ac-af40f27a275c",
          "name": "CHLORHEXIDINE [MART.]",
          "stdName": "CHLORHEXIDINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01e49c93-5ce7-4f69-97a5-b65807f07e26"
          ],
          "display_name": false
        },
        {
          "uuid": "bf63a52d-4433-4947-9c29-6a12106b1c34",
          "name": "CHLORHEXIDINE [MI]",
          "stdName": "CHLORHEXIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "127e85e8-0655-4547-ad69-768ea7c5574d",
            "b5aecd17-02e7-44b6-a152-3089d5501f3d"
          ],
          "display_name": false
        },
        {
          "uuid": "c3da4ccb-9c7a-4153-acc2-f3658e156f16",
          "name": "CHLORHEXIDINE [USP-RS]",
          "stdName": "CHLORHEXIDINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "127e85e8-0655-4547-ad69-768ea7c5574d",
            "d30a04ee-d1f4-4944-bed7-f6081358a352"
          ],
          "display_name": false
        },
        {
          "uuid": "a5f889fd-178c-4f34-b0f3-1de45eb02856",
          "name": "CHLORHEXIDINE [VANDF]",
          "stdName": "CHLORHEXIDINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "127e85e8-0655-4547-ad69-768ea7c5574d",
            "ea716797-0c21-4290-8712-2b3eff98b433"
          ],
          "display_name": false
        },
        {
          "uuid": "04064584-c5a3-7e25-6d04-af96a81c37f3",
          "name": "Chlorhexidine [WHO-DD]",
          "stdName": "CHLORHEXIDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0fd69c1-9ffc-04ab-6c55-085e81a225eb"
          ],
          "display_name": false
        },
        {
          "uuid": "c38bbc85-bc91-44ef-ac31-0cdbd3eeb1b7",
          "name": "DENTISEPT",
          "stdName": "DENTISEPT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f21693e2-191f-482a-a993-c7c5ac218a47",
            "40382f89-a9b2-4a6c-8243-d404e156995c"
          ],
          "display_name": false
        },
        {
          "uuid": "4a941e6d-9c10-47b3-84d5-25ec509cbba9",
          "name": "MERFEN-INCOLORE",
          "stdName": "MERFEN-INCOLORE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f21693e2-191f-482a-a993-c7c5ac218a47",
            "40382f89-a9b2-4a6c-8243-d404e156995c"
          ],
          "display_name": false
        },
        {
          "uuid": "f9f99777-4a1b-45a0-a31d-1d45adcd0073",
          "name": "chlorhexidine [INN]",
          "stdName": "CHLORHEXIDINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d230c4f7-cc80-47f5-9db3-0ce183f9d0da"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9e3461fa-f934-497b-8706-f37372297302",
          "citation": "SRS import [R4KO0DY52L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=R4KO0DY52L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf0c5aeb-0759-4ddc-9338-91655561884f",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cecb457c-1796-4a7f-a117-d716d8a385c8",
          "citation": "CHLORHEXIDINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b9d60c9-663c-4794-852f-66d24c4c0c24",
          "citation": "CHLORHEXIDINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46dfdad0-00f8-4fc2-8d03-6914d56ac0da",
          "citation": "CHLORHEXIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5507f98b-931c-4253-98ba-fb06334316c4",
          "citation": "CHLORHEXIDINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "735166ea-a2de-402a-8c62-099e869ea224",
          "citation": "CHLORHEXIDINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b884139b-05c1-45c8-9476-e3bf30424826",
          "citation": "CHLORHEXIDINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64d5b92f-04de-4c07-b313-6790df41dc55",
          "citation": "CHLORHEXIDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5c7d795b-1455-4f59-9af9-f3558e4f6e29",
          "citation": "CHLORHEXIDINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8bf28d90-5574-46a5-a23e-1de79b85036a",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d230c4f7-cc80-47f5-9db3-0ce183f9d0da",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "01e49c93-5ce7-4f69-97a5-b65807f07e26",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5aecd17-02e7-44b6-a152-3089d5501f3d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "127e85e8-0655-4547-ad69-768ea7c5574d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f21693e2-191f-482a-a993-c7c5ac218a47",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40382f89-a9b2-4a6c-8243-d404e156995c",
          "citation": "D07668",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01ad54b8-2623-4601-b8ad-04ec5f8d7bc4",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c617c22-eb47-42d0-bc17-60c1882545da",
          "citation": "http://www.duboisdistributors.com/catalog.asp?prodid=692619&showprevnext=1",
          "url": "http://www.duboisdistributors.com/catalog.asp?prodid=692619&showprevnext=1",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5ad0b86-bbf4-45f4-aa77-7693755f8392",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d30a04ee-d1f4-4944-bed7-f6081358a352",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92f63535-f76a-4335-bdc9-34bbc15cbeb2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea716797-0c21-4290-8712-2b3eff98b433",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f13fe63f-7205-41c4-8ad3-f9d91c4d2069",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ea6af18-a512-6aee-bd91-4ce3ca5f513a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+55-56-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "86454a61-bbad-7c2c-fc22-33cf46eca3e2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=55-56-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "68ca3332-abb4-0f50-2a3a-523af1d2626b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+55-56-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "57789f46-bdee-291f-655a-d7d604cbda02",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7fd057ba-a8de-0bc3-c819-26d9b4de8434",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "90d893e3-ee39-4a20-9c7a-2830f6ed751e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bd1e3a2a-d1eb-60a9-fbaa-1ecf5a9665fa",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f0fd69c1-9ffc-04ab-6c55-085e81a225eb",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5fb37fc8-535a-528f-933b-d1d0428bc4a8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ef167d3f-af33-4799-556f-7a90c110419c",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "07478bc9-d5d5-4716-97c0-032693440c62",
          "id": "07478bc9-d5d5-4716-97c0-032693440c62",
          "molfile": "\n  Marvin  01132100392D          \n\n 34 35  0  0  0  0            999 V2000\n   -0.6972   -4.2463    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0251   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7390   -4.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4572   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4572   -5.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1712   -5.8997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8852   -5.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8810   -4.6596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5991   -5.8914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3131   -5.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3089   -4.6513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0271   -5.8914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7411   -5.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4551   -5.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1690   -5.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8830   -5.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5970   -5.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3110   -5.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0249   -5.4655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7389   -5.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7264   -6.7014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4529   -5.4613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1669   -5.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1627   -6.6930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8808   -5.4530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5948   -5.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5948   -6.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3088   -7.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0311   -6.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7451   -7.1064    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   15.0311   -5.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3088   -5.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7390   -5.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0251   -5.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 34  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 33  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 23  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 32 26  2  0  0  0  0\n 28 27  2  0  0  0  0\n 28 29  1  0  0  0  0\n 30 29  1  0  0  0  0\n 29 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 34 33  1  0  0  0  0\nM  END",
          "smiles": "C(CCCNC(=N)NC(=N)Nc1ccc(cc1)Cl)CCNC(=N)NC(=N)Nc2ccc(cc2)Cl",
          "formula": "C22H30Cl2N10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d826ed11-765d-4e61-8479-2e21cc70f74b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "505.4473",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "769a655b-33c6-4dba-a09b-d0a9d99a734a",
      "version": "24",
      "structure": {
        "id": "89e22493-edbf-46fa-a09d-d853afb0bdba",
        "molfile": "\n  Marvin  01132107102D          \n\n 34 35  0  0  0  0            999 V2000\n    2.8852   -5.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1669   -5.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4529   -5.4613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5991   -5.8914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3131   -5.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7389   -5.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1712   -5.8997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8808   -5.4530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8810   -4.6596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1627   -6.6930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7264   -6.7014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3089   -4.6513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0271   -5.8914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0249   -5.4655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5948   -5.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4572   -5.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0311   -6.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0251   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6972   -4.2463    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   15.7451   -7.1064    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7390   -5.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4572   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5948   -6.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3088   -5.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3088   -7.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7390   -4.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0251   -5.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0311   -5.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7411   -5.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3110   -5.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5970   -5.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4551   -5.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1690   -5.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8830   -5.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  1  2  0  0  0  0\n 10  2  2  0  0  0  0\n 11  6  2  0  0  0  0\n 12  5  2  0  0  0  0\n 13  5  1  0  0  0  0\n 14 30  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17 28  1  0  0  0  0\n 18 26  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 22 16  1  0  0  0  0\n 23 15  2  0  0  0  0\n 24 15  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 22  2  0  0  0  0\n 27 21  1  0  0  0  0\n 28 24  2  0  0  0  0\n 29 13  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 34  1  0  0  0  0\n 32 29  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 18 27  2  0  0  0  0\n 25 17  2  0  0  0  0\nM  END",
        "smiles": "C(CCCNC(=N)NC(=N)Nc1ccc(cc1)Cl)CCNC(=N)NC(=N)Nc2ccc(cc2)Cl",
        "formula": "C22H30Cl2N10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "505.4473",
        "optical_activity": "NONE",
        "references": [
          "cf0c5aeb-0759-4ddc-9338-91655561884f",
          "9e3461fa-f934-497b-8706-f37372297302",
          "d230c4f7-cc80-47f5-9db3-0ce183f9d0da"
        ],
        "stereo_centers": 0
      },
      "unii": "R4KO0DY52L"
    }
  ]
}